instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_2933>?
The molecular formula for <BB_2933> (CC(C)(C)OC(=O)Nc1cccnc1C(F)(F)F) is C11H13F3N2O2.
Describe the ring structures in building block <BB_2933>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2933>.
The molecule contains the following groups: Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2933>.
**Token:** <BB_2933> **SMILES:** CC(C)(C)OC(=O)Nc1cccnc1C(F)(F)F **Molecular Formula:** C11H13F3N2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2934>.
Cn1cnc(C(=O)O)c1
What is the building block token for the following molecule?
Cn1cnc(C(=O)O)c1
<BB_2934>
What is the molecular formula for <BB_2934>?
The molecular formula for <BB_2934> (Cn1cnc(C(=O)O)c1) is C5H6N2O2.
Describe the ring structures in building block <BB_2934>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2934>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_2934>.
**Token:** <BB_2934> **SMILES:** Cn1cnc(C(=O)O)c1 **Molecular Formula:** C5H6N2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_2935>.
C1CC(NC2COC2)CO1
What is the building block token for the following molecule?
C1CC(NC2COC2)CO1
<BB_2935>
What is the molecular formula for <BB_2935>?
The molecular formula for <BB_2935> (C1CC(NC2COC2)CO1) is C7H13NO2.
Describe the ring structures in building block <BB_2935>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 4.
List the primary functional groups present in <BB_2935>.
The molecule contains the following groups: Secondary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_2935>.
**Token:** <BB_2935> **SMILES:** C1CC(NC2COC2)CO1 **Molecular Formula:** C7H13NO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 4. **Functional Groups:** Secondary Amine, Ether
Provide the SMILES representation for the building block token <BB_2936>.
CC1(C)COC(Nc2ccc(N)cc2)=N1
What is the building block token for the following molecule?
CC1(C)COC(Nc2ccc(N)cc2)=N1
<BB_2936>
What is the molecular formula for <BB_2936>?
The molecular formula for <BB_2936> (CC1(C)COC(Nc2ccc(N)cc2)=N1) is C11H15N3O.
Describe the ring structures in building block <BB_2936>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2936>.
The molecule contains the following groups: Amine, Secondary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_2936>.
**Token:** <BB_2936> **SMILES:** CC1(C)COC(Nc2ccc(N)cc2)=N1 **Molecular Formula:** C11H15N3O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Secondary Amine, Ether
Provide the SMILES representation for the building block token <BB_2937>.
CN(C)S(=O)(=O)c1cccc2c1CCNC2.Cl
What is the building block token for the following molecule?
CN(C)S(=O)(=O)c1cccc2c1CCNC2.Cl
<BB_2937>
What is the molecular formula for <BB_2937>?
The molecular formula for <BB_2937> (CN(C)S(=O)(=O)c1cccc2c1CCNC2.Cl) is C11H17ClN2O2S.
Describe the ring structures in building block <BB_2937>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2937>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I), Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_2937>.
**Token:** <BB_2937> **SMILES:** CN(C)S(=O)(=O)c1cccc2c1CCNC2.Cl **Molecular Formula:** C11H17ClN2O2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I), Sulfonamide
Provide the SMILES representation for the building block token <BB_2938>.
NS(=O)(=O)NCCCO
What is the building block token for the following molecule?
NS(=O)(=O)NCCCO
<BB_2938>
What is the molecular formula for <BB_2938>?
The molecular formula for <BB_2938> (NS(=O)(=O)NCCCO) is C3H10N2O3S.
Describe the ring structures in building block <BB_2938>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2938>.
The molecule contains the following groups: Amine, Secondary Amine, Alcohol, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_2938>.
**Token:** <BB_2938> **SMILES:** NS(=O)(=O)NCCCO **Molecular Formula:** C3H10N2O3S **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Secondary Amine, Alcohol, Sulfonamide
Provide the SMILES representation for the building block token <BB_2939>.
BrCC1COCOC1
What is the building block token for the following molecule?
BrCC1COCOC1
<BB_2939>
What is the molecular formula for <BB_2939>?
The molecular formula for <BB_2939> (BrCC1COCOC1) is C5H9BrO2.
Describe the ring structures in building block <BB_2939>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_2939>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2939>.
**Token:** <BB_2939> **SMILES:** BrCC1COCOC1 **Molecular Formula:** C5H9BrO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2940>.
Cc1cc(Cl)n2ncc(C#N)c2n1
What is the building block token for the following molecule?
Cc1cc(Cl)n2ncc(C#N)c2n1
<BB_2940>
What is the molecular formula for <BB_2940>?
The molecular formula for <BB_2940> (Cc1cc(Cl)n2ncc(C#N)c2n1) is C8H5ClN4.
Describe the ring structures in building block <BB_2940>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_2940>.
The molecule contains the following groups: Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_2940>.
**Token:** <BB_2940> **SMILES:** Cc1cc(Cl)n2ncc(C#N)c2n1 **Molecular Formula:** C8H5ClN4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_2941>.
CC1(C)OB(c2ccc3nsnc3c2)OC1(C)C
What is the building block token for the following molecule?
CC1(C)OB(c2ccc3nsnc3c2)OC1(C)C
<BB_2941>
What is the molecular formula for <BB_2941>?
The molecular formula for <BB_2941> (CC1(C)OB(c2ccc3nsnc3c2)OC1(C)C) is C12H15BN2O2S.
Describe the ring structures in building block <BB_2941>.
The molecule contains 3 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_2941>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_2941>.
**Token:** <BB_2941> **SMILES:** CC1(C)OB(c2ccc3nsnc3c2)OC1(C)C **Molecular Formula:** C12H15BN2O2S **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_2942>.
CC(C)CC(=O)NCCC(=O)O
What is the building block token for the following molecule?
CC(C)CC(=O)NCCC(=O)O
<BB_2942>
What is the molecular formula for <BB_2942>?
The molecular formula for <BB_2942> (CC(C)CC(=O)NCCC(=O)O) is C8H15NO3.
Describe the ring structures in building block <BB_2942>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2942>.
The molecule contains the following groups: Carboxylic Acid, Amide.
Provide a comprehensive chemical profile for the building block <BB_2942>.
**Token:** <BB_2942> **SMILES:** CC(C)CC(=O)NCCC(=O)O **Molecular Formula:** C8H15NO3 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid, Amide
Provide the SMILES representation for the building block token <BB_2943>.
CC(C)(C)OCCON.Cl
What is the building block token for the following molecule?
CC(C)(C)OCCON.Cl
<BB_2943>
What is the molecular formula for <BB_2943>?
The molecular formula for <BB_2943> (CC(C)(C)OCCON.Cl) is C6H16ClNO2.
Describe the ring structures in building block <BB_2943>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2943>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2943>.
**Token:** <BB_2943> **SMILES:** CC(C)(C)OCCON.Cl **Molecular Formula:** C6H16ClNO2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2944>.
CC(C)(C)OC(=O)NC(CCSC(F)(F)F)C(=O)O
What is the building block token for the following molecule?
CC(C)(C)OC(=O)NC(CCSC(F)(F)F)C(=O)O
<BB_2944>
What is the molecular formula for <BB_2944>?
The molecular formula for <BB_2944> (CC(C)(C)OC(=O)NC(CCSC(F)(F)F)C(=O)O) is C10H16F3NO4S.
Describe the ring structures in building block <BB_2944>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2944>.
The molecule contains the following groups: Carboxylic Acid, Amide, Ether, Sulfide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2944>.
**Token:** <BB_2944> **SMILES:** CC(C)(C)OC(=O)NC(CCSC(F)(F)F)C(=O)O **Molecular Formula:** C10H16F3NO4S **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid, Amide, Ether, Sulfide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2945>.
Cc1coc2c(CC#N)cccc12
What is the building block token for the following molecule?
Cc1coc2c(CC#N)cccc12
<BB_2945>
What is the molecular formula for <BB_2945>?
The molecular formula for <BB_2945> (Cc1coc2c(CC#N)cccc12) is C11H9NO.
Describe the ring structures in building block <BB_2945>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2945>.
The molecule contains the following groups: Nitrile.
Provide a comprehensive chemical profile for the building block <BB_2945>.
**Token:** <BB_2945> **SMILES:** Cc1coc2c(CC#N)cccc12 **Molecular Formula:** C11H9NO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Nitrile
Provide the SMILES representation for the building block token <BB_2946>.
COC(=O)c1cc(S(=O)(=O)Cl)cc(F)c1F
What is the building block token for the following molecule?
COC(=O)c1cc(S(=O)(=O)Cl)cc(F)c1F
<BB_2946>
What is the molecular formula for <BB_2946>?
The molecular formula for <BB_2946> (COC(=O)c1cc(S(=O)(=O)Cl)cc(F)c1F) is C8H5ClF2O4S.
Describe the ring structures in building block <BB_2946>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2946>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2946>.
**Token:** <BB_2946> **SMILES:** COC(=O)c1cc(S(=O)(=O)Cl)cc(F)c1F **Molecular Formula:** C8H5ClF2O4S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2947>.
CC1(C)OCC(CCC(=O)O)O1
What is the building block token for the following molecule?
CC1(C)OCC(CCC(=O)O)O1
<BB_2947>
What is the molecular formula for <BB_2947>?
The molecular formula for <BB_2947> (CC1(C)OCC(CCC(=O)O)O1) is C8H14O4.
Describe the ring structures in building block <BB_2947>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_2947>.
The molecule contains the following groups: Carboxylic Acid, Ether.
Provide a comprehensive chemical profile for the building block <BB_2947>.
**Token:** <BB_2947> **SMILES:** CC1(C)OCC(CCC(=O)O)O1 **Molecular Formula:** C8H14O4 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid, Ether
Provide the SMILES representation for the building block token <BB_2948>.
CNC(c1ccc(Cl)cc1)c1nccn1C
What is the building block token for the following molecule?
CNC(c1ccc(Cl)cc1)c1nccn1C
<BB_2948>
What is the molecular formula for <BB_2948>?
The molecular formula for <BB_2948> (CNC(c1ccc(Cl)cc1)c1nccn1C) is C12H14ClN3.
Describe the ring structures in building block <BB_2948>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_2948>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2948>.
**Token:** <BB_2948> **SMILES:** CNC(c1ccc(Cl)cc1)c1nccn1C **Molecular Formula:** C12H14ClN3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2949>.
Cc1ccc([N+](=O)[O-])c(OC(F)F)c1
What is the building block token for the following molecule?
Cc1ccc([N+](=O)[O-])c(OC(F)F)c1
<BB_2949>
What is the molecular formula for <BB_2949>?
The molecular formula for <BB_2949> (Cc1ccc([N+](=O)[O-])c(OC(F)F)c1) is C8H7F2NO3.
Describe the ring structures in building block <BB_2949>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2949>.
The molecule contains the following groups: Tertiary Amine, Ether, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_2949>.
**Token:** <BB_2949> **SMILES:** Cc1ccc([N+](=O)[O-])c(OC(F)F)c1 **Molecular Formula:** C8H7F2NO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Ether, Halogen (F,Cl,Br,I), Nitro