instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_2950>.
Nc1c(Br)cc(F)cc1OC(F)F
What is the building block token for the following molecule?
Nc1c(Br)cc(F)cc1OC(F)F
<BB_2950>
What is the molecular formula for <BB_2950>?
The molecular formula for <BB_2950> (Nc1c(Br)cc(F)cc1OC(F)F) is C7H5BrF3NO.
Describe the ring structures in building block <BB_2950>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2950>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2950>.
**Token:** <BB_2950> **SMILES:** Nc1c(Br)cc(F)cc1OC(F)F **Molecular Formula:** C7H5BrF3NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2951>.
Cc1cccc(C(C(=O)O)N2CCNCC2)c1.Cl.Cl
What is the building block token for the following molecule?
Cc1cccc(C(C(=O)O)N2CCNCC2)c1.Cl.Cl
<BB_2951>
What is the molecular formula for <BB_2951>?
The molecular formula for <BB_2951> (Cc1cccc(C(C(=O)O)N2CCNCC2)c1.Cl.Cl) is C13H20Cl2N2O2.
Describe the ring structures in building block <BB_2951>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2951>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2951>.
**Token:** <BB_2951> **SMILES:** Cc1cccc(C(C(=O)O)N2CCNCC2)c1.Cl.Cl **Molecular Formula:** C13H20Cl2N2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2952>.
C#Cc1cccnc1OC
What is the building block token for the following molecule?
C#Cc1cccnc1OC
<BB_2952>
What is the molecular formula for <BB_2952>?
The molecular formula for <BB_2952> (C#Cc1cccnc1OC) is C8H7NO.
Describe the ring structures in building block <BB_2952>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2952>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_2952>.
**Token:** <BB_2952> **SMILES:** C#Cc1cccnc1OC **Molecular Formula:** C8H7NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_2953>.
C=C(CO)c1ccc(OC)nc1
What is the building block token for the following molecule?
C=C(CO)c1ccc(OC)nc1
<BB_2953>
What is the molecular formula for <BB_2953>?
The molecular formula for <BB_2953> (C=C(CO)c1ccc(OC)nc1) is C9H11NO2.
Describe the ring structures in building block <BB_2953>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2953>.
The molecule contains the following groups: Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_2953>.
**Token:** <BB_2953> **SMILES:** C=C(CO)c1ccc(OC)nc1 **Molecular Formula:** C9H11NO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Alcohol, Ether
Provide the SMILES representation for the building block token <BB_2954>.
Nc1ccn(-c2ccc(Cl)cc2Cl)n1
What is the building block token for the following molecule?
Nc1ccn(-c2ccc(Cl)cc2Cl)n1
<BB_2954>
What is the molecular formula for <BB_2954>?
The molecular formula for <BB_2954> (Nc1ccn(-c2ccc(Cl)cc2Cl)n1) is C9H7Cl2N3.
Describe the ring structures in building block <BB_2954>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2954>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2954>.
**Token:** <BB_2954> **SMILES:** Nc1ccn(-c2ccc(Cl)cc2Cl)n1 **Molecular Formula:** C9H7Cl2N3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2955>.
Cl.NC(c1ccccc1)C(F)F
What is the building block token for the following molecule?
Cl.NC(c1ccccc1)C(F)F
<BB_2955>
What is the molecular formula for <BB_2955>?
The molecular formula for <BB_2955> (Cl.NC(c1ccccc1)C(F)F) is C8H10ClF2N.
Describe the ring structures in building block <BB_2955>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2955>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2955>.
**Token:** <BB_2955> **SMILES:** Cl.NC(c1ccccc1)C(F)F **Molecular Formula:** C8H10ClF2N **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2956>.
Cl.Cl.c1cc2cc(N3CCNCC3)ccc2o1
What is the building block token for the following molecule?
Cl.Cl.c1cc2cc(N3CCNCC3)ccc2o1
<BB_2956>
What is the molecular formula for <BB_2956>?
The molecular formula for <BB_2956> (Cl.Cl.c1cc2cc(N3CCNCC3)ccc2o1) is C12H16Cl2N2O.
Describe the ring structures in building block <BB_2956>.
The molecule contains 3 ring(s): an aromatic ring of size 5, an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2956>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2956>.
**Token:** <BB_2956> **SMILES:** Cl.Cl.c1cc2cc(N3CCNCC3)ccc2o1 **Molecular Formula:** C12H16Cl2N2O **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 5, an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2957>.
Cl.NC(CC(=O)O)C1CCCCCC1
What is the building block token for the following molecule?
Cl.NC(CC(=O)O)C1CCCCCC1
<BB_2957>
What is the molecular formula for <BB_2957>?
The molecular formula for <BB_2957> (Cl.NC(CC(=O)O)C1CCCCCC1) is C10H20ClNO2.
Describe the ring structures in building block <BB_2957>.
The molecule contains 1 ring(s): an aliphatic ring of size 7.
List the primary functional groups present in <BB_2957>.
The molecule contains the following groups: Carboxylic Acid, Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2957>.
**Token:** <BB_2957> **SMILES:** Cl.NC(CC(=O)O)C1CCCCCC1 **Molecular Formula:** C10H20ClNO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 7. **Functional Groups:** Carboxylic Acid, Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2958>.
Cl.FC1(F)CCNCC1CS
What is the building block token for the following molecule?
Cl.FC1(F)CCNCC1CS
<BB_2958>
What is the molecular formula for <BB_2958>?
The molecular formula for <BB_2958> (Cl.FC1(F)CCNCC1CS) is C6H12ClF2NS.
Describe the ring structures in building block <BB_2958>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_2958>.
The molecule contains the following groups: Secondary Amine, Thiol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2958>.
**Token:** <BB_2958> **SMILES:** Cl.FC1(F)CCNCC1CS **Molecular Formula:** C6H12ClF2NS **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Thiol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2959>.
CC(C)(C)c1cc(N)n(-c2ccc(C#N)cc2)n1.Cl
What is the building block token for the following molecule?
CC(C)(C)c1cc(N)n(-c2ccc(C#N)cc2)n1.Cl
<BB_2959>
What is the molecular formula for <BB_2959>?
The molecular formula for <BB_2959> (CC(C)(C)c1cc(N)n(-c2ccc(C#N)cc2)n1.Cl) is C14H17ClN4.
Describe the ring structures in building block <BB_2959>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2959>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_2959>.
**Token:** <BB_2959> **SMILES:** CC(C)(C)c1cc(N)n(-c2ccc(C#N)cc2)n1.Cl **Molecular Formula:** C14H17ClN4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_2960>.
C1=C(c2ccncc2)CCCC1.Cl
What is the building block token for the following molecule?
C1=C(c2ccncc2)CCCC1.Cl
<BB_2960>
What is the molecular formula for <BB_2960>?
The molecular formula for <BB_2960> (C1=C(c2ccncc2)CCCC1.Cl) is C11H14ClN.
Describe the ring structures in building block <BB_2960>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2960>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2960>.
**Token:** <BB_2960> **SMILES:** C1=C(c2ccncc2)CCCC1.Cl **Molecular Formula:** C11H14ClN **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2961>.
Cc1n[nH]c2cc(CN)ccc12.Cl.Cl
What is the building block token for the following molecule?
Cc1n[nH]c2cc(CN)ccc12.Cl.Cl
<BB_2961>
What is the molecular formula for <BB_2961>?
The molecular formula for <BB_2961> (Cc1n[nH]c2cc(CN)ccc12.Cl.Cl) is C9H13Cl2N3.
Describe the ring structures in building block <BB_2961>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2961>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2961>.
**Token:** <BB_2961> **SMILES:** Cc1n[nH]c2cc(CN)ccc12.Cl.Cl **Molecular Formula:** C9H13Cl2N3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2962>.
CNCCc1cccc(N)c1.Cl
What is the building block token for the following molecule?
CNCCc1cccc(N)c1.Cl
<BB_2962>
What is the molecular formula for <BB_2962>?
The molecular formula for <BB_2962> (CNCCc1cccc(N)c1.Cl) is C9H15ClN2.
Describe the ring structures in building block <BB_2962>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2962>.
The molecule contains the following groups: Amine, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2962>.
**Token:** <BB_2962> **SMILES:** CNCCc1cccc(N)c1.Cl **Molecular Formula:** C9H15ClN2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2963>.
O=Cc1ccccc1OCc1ccccc1F
What is the building block token for the following molecule?
O=Cc1ccccc1OCc1ccccc1F
<BB_2963>
What is the molecular formula for <BB_2963>?
The molecular formula for <BB_2963> (O=Cc1ccccc1OCc1ccccc1F) is C14H11FO2.
Describe the ring structures in building block <BB_2963>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2963>.
The molecule contains the following groups: Aldehyde, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2963>.
**Token:** <BB_2963> **SMILES:** O=Cc1ccccc1OCc1ccccc1F **Molecular Formula:** C14H11FO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Aldehyde, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2964>.
COC(=O)c1ccc2c(c1)C(C)CN2.Cl
What is the building block token for the following molecule?
COC(=O)c1ccc2c(c1)C(C)CN2.Cl
<BB_2964>
What is the molecular formula for <BB_2964>?
The molecular formula for <BB_2964> (COC(=O)c1ccc2c(c1)C(C)CN2.Cl) is C11H14ClNO2.
Describe the ring structures in building block <BB_2964>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2964>.
The molecule contains the following groups: Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2964>.
**Token:** <BB_2964> **SMILES:** COC(=O)c1ccc2c(c1)C(C)CN2.Cl **Molecular Formula:** C11H14ClNO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2965>.
NC(=NO)c1nnc(Br)s1
What is the building block token for the following molecule?
NC(=NO)c1nnc(Br)s1
<BB_2965>
What is the molecular formula for <BB_2965>?
The molecular formula for <BB_2965> (NC(=NO)c1nnc(Br)s1) is C3H3BrN4OS.
Describe the ring structures in building block <BB_2965>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2965>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2965>.
**Token:** <BB_2965> **SMILES:** NC(=NO)c1nnc(Br)s1 **Molecular Formula:** C3H3BrN4OS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2966>.
CC(C)(C)OC(=O)N1CCC(n2ccc(N)n2)C1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CCC(n2ccc(N)n2)C1
<BB_2966>
What is the molecular formula for <BB_2966>?
The molecular formula for <BB_2966> (CC(C)(C)OC(=O)N1CCC(n2ccc(N)n2)C1) is C12H20N4O2.
Describe the ring structures in building block <BB_2966>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 5.