instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_2966>.
The molecule contains the following groups: Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_2966>.
**Token:** <BB_2966> **SMILES:** CC(C)(C)OC(=O)N1CCC(n2ccc(N)n2)C1 **Molecular Formula:** C12H20N4O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 5. **Functional Groups:** Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_2967>.
CC(C)(C)OC(=O)N1C[C@H](N)C[C@H]1c1ccccc1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1C[C@H](N)C[C@H]1c1ccccc1
<BB_2967>
What is the molecular formula for <BB_2967>?
The molecular formula for <BB_2967> (CC(C)(C)OC(=O)N1C[C@H](N)C[C@H]1c1ccccc1) is C15H22N2O2.
Describe the ring structures in building block <BB_2967>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2967>.
The molecule contains the following groups: Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_2967>.
**Token:** <BB_2967> **SMILES:** CC(C)(C)OC(=O)N1C[C@H](N)C[C@H]1c1ccccc1 **Molecular Formula:** C15H22N2O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_2968>.
Cl.c1ccc2c(c1)CC(C1CCNC1)C2
What is the building block token for the following molecule?
Cl.c1ccc2c(c1)CC(C1CCNC1)C2
<BB_2968>
What is the molecular formula for <BB_2968>?
The molecular formula for <BB_2968> (Cl.c1ccc2c(c1)CC(C1CCNC1)C2) is C13H18ClN.
Describe the ring structures in building block <BB_2968>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2968>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2968>.
**Token:** <BB_2968> **SMILES:** Cl.c1ccc2c(c1)CC(C1CCNC1)C2 **Molecular Formula:** C13H18ClN **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2969>.
OC(c1ncc[nH]1)C1CCCCC1
What is the building block token for the following molecule?
OC(c1ncc[nH]1)C1CCCCC1
<BB_2969>
What is the molecular formula for <BB_2969>?
The molecular formula for <BB_2969> (OC(c1ncc[nH]1)C1CCCCC1) is C10H16N2O.
Describe the ring structures in building block <BB_2969>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2969>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_2969>.
**Token:** <BB_2969> **SMILES:** OC(c1ncc[nH]1)C1CCCCC1 **Molecular Formula:** C10H16N2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_2970>.
Nc1nc(Cl)cc(Cl)c1[N+](=O)[O-]
What is the building block token for the following molecule?
Nc1nc(Cl)cc(Cl)c1[N+](=O)[O-]
<BB_2970>
What is the molecular formula for <BB_2970>?
The molecular formula for <BB_2970> (Nc1nc(Cl)cc(Cl)c1[N+](=O)[O-]) is C5H3Cl2N3O2.
Describe the ring structures in building block <BB_2970>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2970>.
The molecule contains the following groups: Amine, Tertiary Amine, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_2970>.
**Token:** <BB_2970> **SMILES:** Nc1nc(Cl)cc(Cl)c1[N+](=O)[O-] **Molecular Formula:** C5H3Cl2N3O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_2971>.
COc1ccc(CSc2nnc(S)s2)cc1
What is the building block token for the following molecule?
COc1ccc(CSc2nnc(S)s2)cc1
<BB_2971>
What is the molecular formula for <BB_2971>?
The molecular formula for <BB_2971> (COc1ccc(CSc2nnc(S)s2)cc1) is C10H10N2OS3.
Describe the ring structures in building block <BB_2971>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_2971>.
The molecule contains the following groups: Ether, Thiol, Sulfide.
Provide a comprehensive chemical profile for the building block <BB_2971>.
**Token:** <BB_2971> **SMILES:** COc1ccc(CSc2nnc(S)s2)cc1 **Molecular Formula:** C10H10N2OS3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Ether, Thiol, Sulfide
Provide the SMILES representation for the building block token <BB_2972>.
CCC(Br)C(=O)OC(C)(C)C
What is the building block token for the following molecule?
CCC(Br)C(=O)OC(C)(C)C
<BB_2972>
What is the molecular formula for <BB_2972>?
The molecular formula for <BB_2972> (CCC(Br)C(=O)OC(C)(C)C) is C8H15BrO2.
Describe the ring structures in building block <BB_2972>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2972>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2972>.
**Token:** <BB_2972> **SMILES:** CCC(Br)C(=O)OC(C)(C)C **Molecular Formula:** C8H15BrO2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2973>.
O=C(O)c1cc(-n2cnnc2)ccn1
What is the building block token for the following molecule?
O=C(O)c1cc(-n2cnnc2)ccn1
<BB_2973>
What is the molecular formula for <BB_2973>?
The molecular formula for <BB_2973> (O=C(O)c1cc(-n2cnnc2)ccn1) is C8H6N4O2.
Describe the ring structures in building block <BB_2973>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_2973>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_2973>.
**Token:** <BB_2973> **SMILES:** O=C(O)c1cc(-n2cnnc2)ccn1 **Molecular Formula:** C8H6N4O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_2974>.
CC1(C)OB(C2CNCC23CCC3)OC1(C)C.Cl
What is the building block token for the following molecule?
CC1(C)OB(C2CNCC23CCC3)OC1(C)C.Cl
<BB_2974>
What is the molecular formula for <BB_2974>?
The molecular formula for <BB_2974> (CC1(C)OB(C2CNCC23CCC3)OC1(C)C.Cl) is C13H25BClNO2.
Describe the ring structures in building block <BB_2974>.
The molecule contains 3 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5, an aliphatic ring of size 4.
List the primary functional groups present in <BB_2974>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2974>.
**Token:** <BB_2974> **SMILES:** CC1(C)OB(C2CNCC23CCC3)OC1(C)C.Cl **Molecular Formula:** C13H25BClNO2 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5, an aliphatic ring of size 4. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2975>.
CC1Cc2ccc(F)cc2C1N.Cl
What is the building block token for the following molecule?
CC1Cc2ccc(F)cc2C1N.Cl
<BB_2975>
What is the molecular formula for <BB_2975>?
The molecular formula for <BB_2975> (CC1Cc2ccc(F)cc2C1N.Cl) is C10H13ClFN.
Describe the ring structures in building block <BB_2975>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2975>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2975>.
**Token:** <BB_2975> **SMILES:** CC1Cc2ccc(F)cc2C1N.Cl **Molecular Formula:** C10H13ClFN **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2976>.
Cl.O=C(O)C(F)(F)CNCc1cc(Cl)sc1Cl
What is the building block token for the following molecule?
Cl.O=C(O)C(F)(F)CNCc1cc(Cl)sc1Cl
<BB_2976>
What is the molecular formula for <BB_2976>?
The molecular formula for <BB_2976> (Cl.O=C(O)C(F)(F)CNCc1cc(Cl)sc1Cl) is C8H8Cl3F2NO2S.
Describe the ring structures in building block <BB_2976>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2976>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2976>.
**Token:** <BB_2976> **SMILES:** Cl.O=C(O)C(F)(F)CNCc1cc(Cl)sc1Cl **Molecular Formula:** C8H8Cl3F2NO2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2977>.
COc1ccn2nc(N)nc2c1
What is the building block token for the following molecule?
COc1ccn2nc(N)nc2c1
<BB_2977>
What is the molecular formula for <BB_2977>?
The molecular formula for <BB_2977> (COc1ccn2nc(N)nc2c1) is C7H8N4O.
Describe the ring structures in building block <BB_2977>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_2977>.
The molecule contains the following groups: Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_2977>.
**Token:** <BB_2977> **SMILES:** COc1ccn2nc(N)nc2c1 **Molecular Formula:** C7H8N4O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amine, Ether
Provide the SMILES representation for the building block token <BB_2978>.
Cl.Nc1ncc(Cc2ccc(F)cc2F)s1
What is the building block token for the following molecule?
Cl.Nc1ncc(Cc2ccc(F)cc2F)s1
<BB_2978>
What is the molecular formula for <BB_2978>?
The molecular formula for <BB_2978> (Cl.Nc1ncc(Cc2ccc(F)cc2F)s1) is C10H9ClF2N2S.
Describe the ring structures in building block <BB_2978>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2978>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2978>.
**Token:** <BB_2978> **SMILES:** Cl.Nc1ncc(Cc2ccc(F)cc2F)s1 **Molecular Formula:** C10H9ClF2N2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2979>.
CC(C)(C)OC(=O)CC(O)C(=O)O
What is the building block token for the following molecule?
CC(C)(C)OC(=O)CC(O)C(=O)O
<BB_2979>
What is the molecular formula for <BB_2979>?
The molecular formula for <BB_2979> (CC(C)(C)OC(=O)CC(O)C(=O)O) is C8H14O5.
Describe the ring structures in building block <BB_2979>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2979>.
The molecule contains the following groups: Carboxylic Acid, Ester, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_2979>.
**Token:** <BB_2979> **SMILES:** CC(C)(C)OC(=O)CC(O)C(=O)O **Molecular Formula:** C8H14O5 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid, Ester, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_2980>.
CN(C)C(OC(C)(C)C)N(C)C
What is the building block token for the following molecule?
CN(C)C(OC(C)(C)C)N(C)C
<BB_2980>
What is the molecular formula for <BB_2980>?
The molecular formula for <BB_2980> (CN(C)C(OC(C)(C)C)N(C)C) is C9H22N2O.
Describe the ring structures in building block <BB_2980>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2980>.
The molecule contains the following groups: Tertiary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_2980>.
**Token:** <BB_2980> **SMILES:** CN(C)C(OC(C)(C)C)N(C)C **Molecular Formula:** C9H22N2O **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Tertiary Amine, Ether
Provide the SMILES representation for the building block token <BB_2981>.
Cc1c(N)cccc1C(=O)Nc1ccccc1
What is the building block token for the following molecule?
Cc1c(N)cccc1C(=O)Nc1ccccc1
<BB_2981>
What is the molecular formula for <BB_2981>?
The molecular formula for <BB_2981> (Cc1c(N)cccc1C(=O)Nc1ccccc1) is C14H14N2O.
Describe the ring structures in building block <BB_2981>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2981>.
The molecule contains the following groups: Amine, Amide.
Provide a comprehensive chemical profile for the building block <BB_2981>.
**Token:** <BB_2981> **SMILES:** Cc1c(N)cccc1C(=O)Nc1ccccc1 **Molecular Formula:** C14H14N2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Amide
Provide the SMILES representation for the building block token <BB_2982>.
Cl.Nc1cc(OC2CC2)ccc1F
What is the building block token for the following molecule?
Cl.Nc1cc(OC2CC2)ccc1F
<BB_2982>
What is the molecular formula for <BB_2982>?
The molecular formula for <BB_2982> (Cl.Nc1cc(OC2CC2)ccc1F) is C9H11ClFNO.
Describe the ring structures in building block <BB_2982>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_2982>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2982>.
**Token:** <BB_2982> **SMILES:** Cl.Nc1cc(OC2CC2)ccc1F **Molecular Formula:** C9H11ClFNO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2983>.
O=C(O)C(F)(F)F.O=S(=O)(F)CCC1CNC1
What is the building block token for the following molecule?
O=C(O)C(F)(F)F.O=S(=O)(F)CCC1CNC1
<BB_2983>