instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_2983>?
The molecular formula for <BB_2983> (O=C(O)C(F)(F)F.O=S(=O)(F)CCC1CNC1) is C7H11F4NO4S.
Describe the ring structures in building block <BB_2983>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_2983>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2983>.
**Token:** <BB_2983> **SMILES:** O=C(O)C(F)(F)F.O=S(=O)(F)CCC1CNC1 **Molecular Formula:** C7H11F4NO4S **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2984>.
Cc1cc(N=[N+]=[N-])ccc1C#N
What is the building block token for the following molecule?
Cc1cc(N=[N+]=[N-])ccc1C#N
<BB_2984>
What is the molecular formula for <BB_2984>?
The molecular formula for <BB_2984> (Cc1cc(N=[N+]=[N-])ccc1C#N) is C8H6N4.
Describe the ring structures in building block <BB_2984>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2984>.
The molecule contains the following groups: Nitrile.
Provide a comprehensive chemical profile for the building block <BB_2984>.
**Token:** <BB_2984> **SMILES:** Cc1cc(N=[N+]=[N-])ccc1C#N **Molecular Formula:** C8H6N4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Nitrile
Provide the SMILES representation for the building block token <BB_2985>.
O=C(O)CC1(CC(=O)O)CCCCCC1
What is the building block token for the following molecule?
O=C(O)CC1(CC(=O)O)CCCCCC1
<BB_2985>
What is the molecular formula for <BB_2985>?
The molecular formula for <BB_2985> (O=C(O)CC1(CC(=O)O)CCCCCC1) is C11H18O4.
Describe the ring structures in building block <BB_2985>.
The molecule contains 1 ring(s): an aliphatic ring of size 7.
List the primary functional groups present in <BB_2985>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_2985>.
**Token:** <BB_2985> **SMILES:** O=C(O)CC1(CC(=O)O)CCCCCC1 **Molecular Formula:** C11H18O4 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 7. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_2986>.
NNc1ccc(S(=O)(=O)C(F)F)cc1
What is the building block token for the following molecule?
NNc1ccc(S(=O)(=O)C(F)F)cc1
<BB_2986>
What is the molecular formula for <BB_2986>?
The molecular formula for <BB_2986> (NNc1ccc(S(=O)(=O)C(F)F)cc1) is C7H8F2N2O2S.
Describe the ring structures in building block <BB_2986>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2986>.
The molecule contains the following groups: Amine, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2986>.
**Token:** <BB_2986> **SMILES:** NNc1ccc(S(=O)(=O)C(F)F)cc1 **Molecular Formula:** C7H8F2N2O2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2987>.
C=C(C(=O)OC)c1ccc(Cl)c(F)c1
What is the building block token for the following molecule?
C=C(C(=O)OC)c1ccc(Cl)c(F)c1
<BB_2987>
What is the molecular formula for <BB_2987>?
The molecular formula for <BB_2987> (C=C(C(=O)OC)c1ccc(Cl)c(F)c1) is C10H8ClFO2.
Describe the ring structures in building block <BB_2987>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2987>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2987>.
**Token:** <BB_2987> **SMILES:** C=C(C(=O)OC)c1ccc(Cl)c(F)c1 **Molecular Formula:** C10H8ClFO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2988>.
CC(=O)N(c1nc(C=O)cs1)c1ccc(F)cc1F
What is the building block token for the following molecule?
CC(=O)N(c1nc(C=O)cs1)c1ccc(F)cc1F
<BB_2988>
What is the molecular formula for <BB_2988>?
The molecular formula for <BB_2988> (CC(=O)N(c1nc(C=O)cs1)c1ccc(F)cc1F) is C12H8F2N2O2S.
Describe the ring structures in building block <BB_2988>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2988>.
The molecule contains the following groups: Amide, Aldehyde, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2988>.
**Token:** <BB_2988> **SMILES:** CC(=O)N(c1nc(C=O)cs1)c1ccc(F)cc1F **Molecular Formula:** C12H8F2N2O2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amide, Aldehyde, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2989>.
COC(=O)CS(N)(=O)=O
What is the building block token for the following molecule?
COC(=O)CS(N)(=O)=O
<BB_2989>
What is the molecular formula for <BB_2989>?
The molecular formula for <BB_2989> (COC(=O)CS(N)(=O)=O) is C3H7NO4S.
Describe the ring structures in building block <BB_2989>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2989>.
The molecule contains the following groups: Amine, Ester, Ether, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_2989>.
**Token:** <BB_2989> **SMILES:** COC(=O)CS(N)(=O)=O **Molecular Formula:** C3H7NO4S **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Ester, Ether, Sulfonamide
Provide the SMILES representation for the building block token <BB_2990>.
BrCc1ccc(C2CCOCC2)cc1
What is the building block token for the following molecule?
BrCc1ccc(C2CCOCC2)cc1
<BB_2990>
What is the molecular formula for <BB_2990>?
The molecular formula for <BB_2990> (BrCc1ccc(C2CCOCC2)cc1) is C12H15BrO.
Describe the ring structures in building block <BB_2990>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2990>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2990>.
**Token:** <BB_2990> **SMILES:** BrCc1ccc(C2CCOCC2)cc1 **Molecular Formula:** C12H15BrO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2991>.
CC1(C)CC2(CNC2)C1.Cl
What is the building block token for the following molecule?
CC1(C)CC2(CNC2)C1.Cl
<BB_2991>
What is the molecular formula for <BB_2991>?
The molecular formula for <BB_2991> (CC1(C)CC2(CNC2)C1.Cl) is C8H16ClN.
Describe the ring structures in building block <BB_2991>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4.
List the primary functional groups present in <BB_2991>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2991>.
**Token:** <BB_2991> **SMILES:** CC1(C)CC2(CNC2)C1.Cl **Molecular Formula:** C8H16ClN **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2992>.
CC(=O)NCCNc1nc(CC(=O)[O-])cs1.[Li+]
What is the building block token for the following molecule?
CC(=O)NCCNc1nc(CC(=O)[O-])cs1.[Li+]
<BB_2992>
What is the molecular formula for <BB_2992>?
The molecular formula for <BB_2992> (CC(=O)NCCNc1nc(CC(=O)[O-])cs1.[Li+]) is C9H12LiN3O3S.
Describe the ring structures in building block <BB_2992>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2992>.
The molecule contains the following groups: Secondary Amine, Amide.
Provide a comprehensive chemical profile for the building block <BB_2992>.
**Token:** <BB_2992> **SMILES:** CC(=O)NCCNc1nc(CC(=O)[O-])cs1.[Li+] **Molecular Formula:** C9H12LiN3O3S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Secondary Amine, Amide
Provide the SMILES representation for the building block token <BB_2993>.
Br.FC(F)c1cccnc1CBr
What is the building block token for the following molecule?
Br.FC(F)c1cccnc1CBr
<BB_2993>
What is the molecular formula for <BB_2993>?
The molecular formula for <BB_2993> (Br.FC(F)c1cccnc1CBr) is C7H7Br2F2N.
Describe the ring structures in building block <BB_2993>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2993>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2993>.
**Token:** <BB_2993> **SMILES:** Br.FC(F)c1cccnc1CBr **Molecular Formula:** C7H7Br2F2N **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2994>.
COC(=O)C(S)C1CC1
What is the building block token for the following molecule?
COC(=O)C(S)C1CC1
<BB_2994>
What is the molecular formula for <BB_2994>?
The molecular formula for <BB_2994> (COC(=O)C(S)C1CC1) is C6H10O2S.
Describe the ring structures in building block <BB_2994>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_2994>.
The molecule contains the following groups: Ester, Ether, Thiol.
Provide a comprehensive chemical profile for the building block <BB_2994>.
**Token:** <BB_2994> **SMILES:** COC(=O)C(S)C1CC1 **Molecular Formula:** C6H10O2S **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Ester, Ether, Thiol
Provide the SMILES representation for the building block token <BB_2995>.
O=C(CCl)c1csc(N2CCCCC2)n1
What is the building block token for the following molecule?
O=C(CCl)c1csc(N2CCCCC2)n1
<BB_2995>
What is the molecular formula for <BB_2995>?
The molecular formula for <BB_2995> (O=C(CCl)c1csc(N2CCCCC2)n1) is C10H13ClN2OS.
Describe the ring structures in building block <BB_2995>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2995>.
The molecule contains the following groups: Tertiary Amine, Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2995>.
**Token:** <BB_2995> **SMILES:** O=C(CCl)c1csc(N2CCCCC2)n1 **Molecular Formula:** C10H13ClN2OS **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Tertiary Amine, Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2996>.
Cc1c(CCl)noc1-c1ccc(Cl)cc1
What is the building block token for the following molecule?
Cc1c(CCl)noc1-c1ccc(Cl)cc1
<BB_2996>
What is the molecular formula for <BB_2996>?
The molecular formula for <BB_2996> (Cc1c(CCl)noc1-c1ccc(Cl)cc1) is C11H9Cl2NO.
Describe the ring structures in building block <BB_2996>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2996>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2996>.
**Token:** <BB_2996> **SMILES:** Cc1c(CCl)noc1-c1ccc(Cl)cc1 **Molecular Formula:** C11H9Cl2NO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2997>.
O=C(O)C1CC(O)CN1C(=O)OCc1ccccc1
What is the building block token for the following molecule?
O=C(O)C1CC(O)CN1C(=O)OCc1ccccc1
<BB_2997>
What is the molecular formula for <BB_2997>?
The molecular formula for <BB_2997> (O=C(O)C1CC(O)CN1C(=O)OCc1ccccc1) is C13H15NO5.
Describe the ring structures in building block <BB_2997>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2997>.
The molecule contains the following groups: Carboxylic Acid, Amide, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_2997>.
**Token:** <BB_2997> **SMILES:** O=C(O)C1CC(O)CN1C(=O)OCc1ccccc1 **Molecular Formula:** C13H15NO5 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amide, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_2998>.
COC(=O)c1ccc(CN)nc1C.Cl
What is the building block token for the following molecule?
COC(=O)c1ccc(CN)nc1C.Cl
<BB_2998>
What is the molecular formula for <BB_2998>?
The molecular formula for <BB_2998> (COC(=O)c1ccc(CN)nc1C.Cl) is C9H13ClN2O2.
Describe the ring structures in building block <BB_2998>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2998>.
The molecule contains the following groups: Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2998>.
**Token:** <BB_2998> **SMILES:** COC(=O)c1ccc(CN)nc1C.Cl **Molecular Formula:** C9H13ClN2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2999>.
O=C(O)[C@@H]1CC2(CN1)OCCO2
What is the building block token for the following molecule?
O=C(O)[C@@H]1CC2(CN1)OCCO2
<BB_2999>
What is the molecular formula for <BB_2999>?
The molecular formula for <BB_2999> (O=C(O)[C@@H]1CC2(CN1)OCCO2) is C7H11NO4.
Describe the ring structures in building block <BB_2999>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2999>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_2999>.
**Token:** <BB_2999> **SMILES:** O=C(O)[C@@H]1CC2(CN1)OCCO2 **Molecular Formula:** C7H11NO4 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid, Secondary Amine, Ether