instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_3000>.
Cc1csc(-c2cc(C(=O)O)no2)c1
What is the building block token for the following molecule?
Cc1csc(-c2cc(C(=O)O)no2)c1
<BB_3000>
What is the molecular formula for <BB_3000>?
The molecular formula for <BB_3000> (Cc1csc(-c2cc(C(=O)O)no2)c1) is C9H7NO3S.
Describe the ring structures in building block <BB_3000>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5.
List the primary functional groups present in <BB_3000>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_3000>.
**Token:** <BB_3000> **SMILES:** Cc1csc(-c2cc(C(=O)O)no2)c1 **Molecular Formula:** C9H7NO3S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_3001>.
CC(C)CC[C@@H](N)C(=O)O.Cl
What is the building block token for the following molecule?
CC(C)CC[C@@H](N)C(=O)O.Cl
<BB_3001>
What is the molecular formula for <BB_3001>?
The molecular formula for <BB_3001> (CC(C)CC[C@@H](N)C(=O)O.Cl) is C7H16ClNO2.
Describe the ring structures in building block <BB_3001>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_3001>.
The molecule contains the following groups: Carboxylic Acid, Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3001>.
**Token:** <BB_3001> **SMILES:** CC(C)CC[C@@H](N)C(=O)O.Cl **Molecular Formula:** C7H16ClNO2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid, Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3002>.
CS(=N)(=O)c1ccncc1
What is the building block token for the following molecule?
CS(=N)(=O)c1ccncc1
<BB_3002>
What is the molecular formula for <BB_3002>?
The molecular formula for <BB_3002> (CS(=N)(=O)c1ccncc1) is C6H8N2OS.
Describe the ring structures in building block <BB_3002>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3002>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_3002>.
**Token:** <BB_3002> **SMILES:** CS(=N)(=O)c1ccncc1 **Molecular Formula:** C6H8N2OS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_3003>.
O=c1[nH][nH]c(=O)n1CCO
What is the building block token for the following molecule?
O=c1[nH][nH]c(=O)n1CCO
<BB_3003>
What is the molecular formula for <BB_3003>?
The molecular formula for <BB_3003> (O=c1[nH][nH]c(=O)n1CCO) is C4H7N3O3.
Describe the ring structures in building block <BB_3003>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_3003>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_3003>.
**Token:** <BB_3003> **SMILES:** O=c1[nH][nH]c(=O)n1CCO **Molecular Formula:** C4H7N3O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_3004>.
Cc1nc(N=C=S)ccc1Br
What is the building block token for the following molecule?
Cc1nc(N=C=S)ccc1Br
<BB_3004>
What is the molecular formula for <BB_3004>?
The molecular formula for <BB_3004> (Cc1nc(N=C=S)ccc1Br) is C7H5BrN2S.
Describe the ring structures in building block <BB_3004>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3004>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3004>.
**Token:** <BB_3004> **SMILES:** Cc1nc(N=C=S)ccc1Br **Molecular Formula:** C7H5BrN2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3005>.
CC(C)(CN)c1cccc(Br)c1
What is the building block token for the following molecule?
CC(C)(CN)c1cccc(Br)c1
<BB_3005>
What is the molecular formula for <BB_3005>?
The molecular formula for <BB_3005> (CC(C)(CN)c1cccc(Br)c1) is C10H14BrN.
Describe the ring structures in building block <BB_3005>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3005>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3005>.
**Token:** <BB_3005> **SMILES:** CC(C)(CN)c1cccc(Br)c1 **Molecular Formula:** C10H14BrN **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3006>.
Cc1cncc(-c2cc(N)no2)c1
What is the building block token for the following molecule?
Cc1cncc(-c2cc(N)no2)c1
<BB_3006>
What is the molecular formula for <BB_3006>?
The molecular formula for <BB_3006> (Cc1cncc(-c2cc(N)no2)c1) is C9H9N3O.
Describe the ring structures in building block <BB_3006>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_3006>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_3006>.
**Token:** <BB_3006> **SMILES:** Cc1cncc(-c2cc(N)no2)c1 **Molecular Formula:** C9H9N3O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_3007>.
CC1(C)CNC(=O)C1N
What is the building block token for the following molecule?
CC1(C)CNC(=O)C1N
<BB_3007>
What is the molecular formula for <BB_3007>?
The molecular formula for <BB_3007> (CC1(C)CNC(=O)C1N) is C6H12N2O.
Describe the ring structures in building block <BB_3007>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_3007>.
The molecule contains the following groups: Amine, Amide.
Provide a comprehensive chemical profile for the building block <BB_3007>.
**Token:** <BB_3007> **SMILES:** CC1(C)CNC(=O)C1N **Molecular Formula:** C6H12N2O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amine, Amide
Provide the SMILES representation for the building block token <BB_3008>.
CCNc1ccnc(Cl)n1
What is the building block token for the following molecule?
CCNc1ccnc(Cl)n1
<BB_3008>
What is the molecular formula for <BB_3008>?
The molecular formula for <BB_3008> (CCNc1ccnc(Cl)n1) is C6H8ClN3.
Describe the ring structures in building block <BB_3008>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3008>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3008>.
**Token:** <BB_3008> **SMILES:** CCNc1ccnc(Cl)n1 **Molecular Formula:** C6H8ClN3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3009>.
Cl.N#CC1(CO)CCNCC1
What is the building block token for the following molecule?
Cl.N#CC1(CO)CCNCC1
<BB_3009>
What is the molecular formula for <BB_3009>?
The molecular formula for <BB_3009> (Cl.N#CC1(CO)CCNCC1) is C7H13ClN2O.
Describe the ring structures in building block <BB_3009>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_3009>.
The molecule contains the following groups: Secondary Amine, Alcohol, Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_3009>.
**Token:** <BB_3009> **SMILES:** Cl.N#CC1(CO)CCNCC1 **Molecular Formula:** C7H13ClN2O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Alcohol, Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_3010>.
CC1SCc2c(Cl)nc(Cl)nc21
What is the building block token for the following molecule?
CC1SCc2c(Cl)nc(Cl)nc21
<BB_3010>
What is the molecular formula for <BB_3010>?
The molecular formula for <BB_3010> (CC1SCc2c(Cl)nc(Cl)nc21) is C7H6Cl2N2S.
Describe the ring structures in building block <BB_3010>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_3010>.
The molecule contains the following groups: Sulfide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3010>.
**Token:** <BB_3010> **SMILES:** CC1SCc2c(Cl)nc(Cl)nc21 **Molecular Formula:** C7H6Cl2N2S **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Sulfide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3011>.
Cl.OC1(Cc2ccc(Cl)cc2)CCNC1
What is the building block token for the following molecule?
Cl.OC1(Cc2ccc(Cl)cc2)CCNC1
<BB_3011>
What is the molecular formula for <BB_3011>?
The molecular formula for <BB_3011> (Cl.OC1(Cc2ccc(Cl)cc2)CCNC1) is C11H15Cl2NO.
Describe the ring structures in building block <BB_3011>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_3011>.
The molecule contains the following groups: Secondary Amine, Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3011>.
**Token:** <BB_3011> **SMILES:** Cl.OC1(Cc2ccc(Cl)cc2)CCNC1 **Molecular Formula:** C11H15Cl2NO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3012>.
COC(=O)c1c(O)ccn1Cc1ccccc1
What is the building block token for the following molecule?
COC(=O)c1c(O)ccn1Cc1ccccc1
<BB_3012>
What is the molecular formula for <BB_3012>?
The molecular formula for <BB_3012> (COC(=O)c1c(O)ccn1Cc1ccccc1) is C13H13NO3.
Describe the ring structures in building block <BB_3012>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_3012>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_3012>.
**Token:** <BB_3012> **SMILES:** COC(=O)c1c(O)ccn1Cc1ccccc1 **Molecular Formula:** C13H13NO3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_3013>.
C=C[C@@H]1CCNC1.Cl
What is the building block token for the following molecule?
C=C[C@@H]1CCNC1.Cl
<BB_3013>
What is the molecular formula for <BB_3013>?
The molecular formula for <BB_3013> (C=C[C@@H]1CCNC1.Cl) is C6H12ClN.
Describe the ring structures in building block <BB_3013>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_3013>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3013>.
**Token:** <BB_3013> **SMILES:** C=C[C@@H]1CCNC1.Cl **Molecular Formula:** C6H12ClN **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3014>.
Cn1cc(-c2csc(C=O)n2)cn1
What is the building block token for the following molecule?
Cn1cc(-c2csc(C=O)n2)cn1
<BB_3014>
What is the molecular formula for <BB_3014>?
The molecular formula for <BB_3014> (Cn1cc(-c2csc(C=O)n2)cn1) is C8H7N3OS.
Describe the ring structures in building block <BB_3014>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5.
List the primary functional groups present in <BB_3014>.
The molecule contains the following groups: Aldehyde.
Provide a comprehensive chemical profile for the building block <BB_3014>.
**Token:** <BB_3014> **SMILES:** Cn1cc(-c2csc(C=O)n2)cn1 **Molecular Formula:** C8H7N3OS **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5. **Functional Groups:** Aldehyde
Provide the SMILES representation for the building block token <BB_3015>.
Nc1nc(Cl)cc(C2CC2)n1
What is the building block token for the following molecule?
Nc1nc(Cl)cc(C2CC2)n1
<BB_3015>
What is the molecular formula for <BB_3015>?
The molecular formula for <BB_3015> (Nc1nc(Cl)cc(C2CC2)n1) is C7H8ClN3.
Describe the ring structures in building block <BB_3015>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_3015>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3015>.
**Token:** <BB_3015> **SMILES:** Nc1nc(Cl)cc(C2CC2)n1 **Molecular Formula:** C7H8ClN3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3016>.
Cc1nc2c(=O)[nH]nc(-c3ccccc3)c2s1
What is the building block token for the following molecule?
Cc1nc2c(=O)[nH]nc(-c3ccccc3)c2s1
<BB_3016>
What is the molecular formula for <BB_3016>?
The molecular formula for <BB_3016> (Cc1nc2c(=O)[nH]nc(-c3ccccc3)c2s1) is C12H9N3OS.
Describe the ring structures in building block <BB_3016>.
The molecule contains 3 ring(s): an aromatic ring of size 5, an aromatic ring of size 6, an aromatic ring of size 6.