instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_3016>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_3016>.
**Token:** <BB_3016> **SMILES:** Cc1nc2c(=O)[nH]nc(-c3ccccc3)c2s1 **Molecular Formula:** C12H9N3OS **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 5, an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_3017>.
COC(=O)CNCc1ccc(Br)cc1
What is the building block token for the following molecule?
COC(=O)CNCc1ccc(Br)cc1
<BB_3017>
What is the molecular formula for <BB_3017>?
The molecular formula for <BB_3017> (COC(=O)CNCc1ccc(Br)cc1) is C10H12BrNO2.
Describe the ring structures in building block <BB_3017>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3017>.
The molecule contains the following groups: Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3017>.
**Token:** <BB_3017> **SMILES:** COC(=O)CNCc1ccc(Br)cc1 **Molecular Formula:** C10H12BrNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3018>.
CC(C)(C)OC(=O)NC1(CCF)CC(O)C1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)NC1(CCF)CC(O)C1
<BB_3018>
What is the molecular formula for <BB_3018>?
The molecular formula for <BB_3018> (CC(C)(C)OC(=O)NC1(CCF)CC(O)C1) is C11H20FNO3.
Describe the ring structures in building block <BB_3018>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_3018>.
The molecule contains the following groups: Amide, Alcohol, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3018>.
**Token:** <BB_3018> **SMILES:** CC(C)(C)OC(=O)NC1(CCF)CC(O)C1 **Molecular Formula:** C11H20FNO3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Amide, Alcohol, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3019>.
CN[C@@H](C)C1CC1.Cl
What is the building block token for the following molecule?
CN[C@@H](C)C1CC1.Cl
<BB_3019>
What is the molecular formula for <BB_3019>?
The molecular formula for <BB_3019> (CN[C@@H](C)C1CC1.Cl) is C6H14ClN.
Describe the ring structures in building block <BB_3019>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_3019>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3019>.
**Token:** <BB_3019> **SMILES:** CN[C@@H](C)C1CC1.Cl **Molecular Formula:** C6H14ClN **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3020>.
O=C(O)C(CCCO)Cc1cccc(Cl)c1
What is the building block token for the following molecule?
O=C(O)C(CCCO)Cc1cccc(Cl)c1
<BB_3020>
What is the molecular formula for <BB_3020>?
The molecular formula for <BB_3020> (O=C(O)C(CCCO)Cc1cccc(Cl)c1) is C12H15ClO3.
Describe the ring structures in building block <BB_3020>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3020>.
The molecule contains the following groups: Carboxylic Acid, Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3020>.
**Token:** <BB_3020> **SMILES:** O=C(O)C(CCCO)Cc1cccc(Cl)c1 **Molecular Formula:** C12H15ClO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3021>.
COc1cc(C(=O)O)cc(Br)c1OCC#N
What is the building block token for the following molecule?
COc1cc(C(=O)O)cc(Br)c1OCC#N
<BB_3021>
What is the molecular formula for <BB_3021>?
The molecular formula for <BB_3021> (COc1cc(C(=O)O)cc(Br)c1OCC#N) is C10H8BrNO4.
Describe the ring structures in building block <BB_3021>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3021>.
The molecule contains the following groups: Carboxylic Acid, Ether, Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_3021>.
**Token:** <BB_3021> **SMILES:** COc1cc(C(=O)O)cc(Br)c1OCC#N **Molecular Formula:** C10H8BrNO4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ether, Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_3022>.
O=Cc1cccn1CC(=O)O
What is the building block token for the following molecule?
O=Cc1cccn1CC(=O)O
<BB_3022>
What is the molecular formula for <BB_3022>?
The molecular formula for <BB_3022> (O=Cc1cccn1CC(=O)O) is C7H7NO3.
Describe the ring structures in building block <BB_3022>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_3022>.
The molecule contains the following groups: Carboxylic Acid, Aldehyde.
Provide a comprehensive chemical profile for the building block <BB_3022>.
**Token:** <BB_3022> **SMILES:** O=Cc1cccn1CC(=O)O **Molecular Formula:** C7H7NO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Aldehyde
Provide the SMILES representation for the building block token <BB_3023>.
O=C([O-])COc1ccon1.[K+]
What is the building block token for the following molecule?
O=C([O-])COc1ccon1.[K+]
<BB_3023>
What is the molecular formula for <BB_3023>?
The molecular formula for <BB_3023> (O=C([O-])COc1ccon1.[K+]) is C5H4KNO4.
Describe the ring structures in building block <BB_3023>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_3023>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_3023>.
**Token:** <BB_3023> **SMILES:** O=C([O-])COc1ccon1.[K+] **Molecular Formula:** C5H4KNO4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_3024>.
CC(C)(O)c1ccc(O)c(F)c1
What is the building block token for the following molecule?
CC(C)(O)c1ccc(O)c(F)c1
<BB_3024>
What is the molecular formula for <BB_3024>?
The molecular formula for <BB_3024> (CC(C)(O)c1ccc(O)c(F)c1) is C9H11FO2.
Describe the ring structures in building block <BB_3024>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3024>.
The molecule contains the following groups: Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3024>.
**Token:** <BB_3024> **SMILES:** CC(C)(O)c1ccc(O)c(F)c1 **Molecular Formula:** C9H11FO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3025>.
N=C(N)Nc1nccc2c(C(=O)O)cccc12
What is the building block token for the following molecule?
N=C(N)Nc1nccc2c(C(=O)O)cccc12
<BB_3025>
What is the molecular formula for <BB_3025>?
The molecular formula for <BB_3025> (N=C(N)Nc1nccc2c(C(=O)O)cccc12) is C11H10N4O2.
Describe the ring structures in building block <BB_3025>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_3025>.
The molecule contains the following groups: Carboxylic Acid, Amine, Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_3025>.
**Token:** <BB_3025> **SMILES:** N=C(N)Nc1nccc2c(C(=O)O)cccc12 **Molecular Formula:** C11H10N4O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amine, Secondary Amine
Provide the SMILES representation for the building block token <BB_3026>.
O=c1ccn(C(F)F)cc1Br
What is the building block token for the following molecule?
O=c1ccn(C(F)F)cc1Br
<BB_3026>
What is the molecular formula for <BB_3026>?
The molecular formula for <BB_3026> (O=c1ccn(C(F)F)cc1Br) is C6H4BrF2NO.
Describe the ring structures in building block <BB_3026>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3026>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3026>.
**Token:** <BB_3026> **SMILES:** O=c1ccn(C(F)F)cc1Br **Molecular Formula:** C6H4BrF2NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3027>.
CC(C)C(CC(=O)O)c1c[nH]c2c(Br)cccc12
What is the building block token for the following molecule?
CC(C)C(CC(=O)O)c1c[nH]c2c(Br)cccc12
<BB_3027>
What is the molecular formula for <BB_3027>?
The molecular formula for <BB_3027> (CC(C)C(CC(=O)O)c1c[nH]c2c(Br)cccc12) is C14H16BrNO2.
Describe the ring structures in building block <BB_3027>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_3027>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3027>.
**Token:** <BB_3027> **SMILES:** CC(C)C(CC(=O)O)c1c[nH]c2c(Br)cccc12 **Molecular Formula:** C14H16BrNO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3028>.
N#Cc1ccc(C(F)(F)F)o1
What is the building block token for the following molecule?
N#Cc1ccc(C(F)(F)F)o1
<BB_3028>
What is the molecular formula for <BB_3028>?
The molecular formula for <BB_3028> (N#Cc1ccc(C(F)(F)F)o1) is C6H2F3NO.
Describe the ring structures in building block <BB_3028>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_3028>.
The molecule contains the following groups: Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_3028>.
**Token:** <BB_3028> **SMILES:** N#Cc1ccc(C(F)(F)F)o1 **Molecular Formula:** C6H2F3NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_3029>.
O=Cc1cnc(-c2ccccc2)nc1
What is the building block token for the following molecule?
O=Cc1cnc(-c2ccccc2)nc1
<BB_3029>
What is the molecular formula for <BB_3029>?
The molecular formula for <BB_3029> (O=Cc1cnc(-c2ccccc2)nc1) is C11H8N2O.
Describe the ring structures in building block <BB_3029>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_3029>.
The molecule contains the following groups: Aldehyde.
Provide a comprehensive chemical profile for the building block <BB_3029>.
**Token:** <BB_3029> **SMILES:** O=Cc1cnc(-c2ccccc2)nc1 **Molecular Formula:** C11H8N2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Aldehyde
Provide the SMILES representation for the building block token <BB_3030>.
Cc1ccc(C(=O)O)c(=O)n1C
What is the building block token for the following molecule?
Cc1ccc(C(=O)O)c(=O)n1C
<BB_3030>
What is the molecular formula for <BB_3030>?
The molecular formula for <BB_3030> (Cc1ccc(C(=O)O)c(=O)n1C) is C8H9NO3.
Describe the ring structures in building block <BB_3030>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3030>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_3030>.
**Token:** <BB_3030> **SMILES:** Cc1ccc(C(=O)O)c(=O)n1C **Molecular Formula:** C8H9NO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_3031>.
CC1(NC(=O)OC(C)(C)C)CCNCC1
What is the building block token for the following molecule?
CC1(NC(=O)OC(C)(C)C)CCNCC1
<BB_3031>
What is the molecular formula for <BB_3031>?
The molecular formula for <BB_3031> (CC1(NC(=O)OC(C)(C)C)CCNCC1) is C11H22N2O2.
Describe the ring structures in building block <BB_3031>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_3031>.
The molecule contains the following groups: Secondary Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_3031>.
**Token:** <BB_3031> **SMILES:** CC1(NC(=O)OC(C)(C)C)CCNCC1 **Molecular Formula:** C11H22N2O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_3032>.
CC(C)(C)OC(=O)N1CCNC2CCCCC2C1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CCNC2CCCCC2C1
<BB_3032>
What is the molecular formula for <BB_3032>?
The molecular formula for <BB_3032> (CC(C)(C)OC(=O)N1CCNC2CCCCC2C1) is C14H26N2O2.
Describe the ring structures in building block <BB_3032>.
The molecule contains 2 ring(s): an aliphatic ring of size 7, an aliphatic ring of size 6.
List the primary functional groups present in <BB_3032>.
The molecule contains the following groups: Secondary Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_3032>.
**Token:** <BB_3032> **SMILES:** CC(C)(C)OC(=O)N1CCNC2CCCCC2C1 **Molecular Formula:** C14H26N2O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 7, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_3033>.
CCOC(=O)CCC(=O)C(F)(F)F
What is the building block token for the following molecule?
CCOC(=O)CCC(=O)C(F)(F)F
<BB_3033>