instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_333>?
The molecular formula for <BB_333> (C=CC1(CO)CCC1) is C7H12O.
Describe the ring structures in building block <BB_333>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_333>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_333>.
**Token:** <BB_333> **SMILES:** C=CC1(CO)CCC1 **Molecular Formula:** C7H12O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_334>.
[N-]=[N+]=NCC(F)(F)c1ccccc1
What is the building block token for the following molecule?
[N-]=[N+]=NCC(F)(F)c1ccccc1
<BB_334>
What is the molecular formula for <BB_334>?
The molecular formula for <BB_334> ([N-]=[N+]=NCC(F)(F)c1ccccc1) is C8H7F2N3.
Describe the ring structures in building block <BB_334>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_334>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_334>.
**Token:** <BB_334> **SMILES:** [N-]=[N+]=NCC(F)(F)c1ccccc1 **Molecular Formula:** C8H7F2N3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_335>.
Cl.Fc1ccc(C2CNC2)c(C(F)(F)F)c1
What is the building block token for the following molecule?
Cl.Fc1ccc(C2CNC2)c(C(F)(F)F)c1
<BB_335>
What is the molecular formula for <BB_335>?
The molecular formula for <BB_335> (Cl.Fc1ccc(C2CNC2)c(C(F)(F)F)c1) is C10H10ClF4N.
Describe the ring structures in building block <BB_335>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 4.
List the primary functional groups present in <BB_335>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_335>.
**Token:** <BB_335> **SMILES:** Cl.Fc1ccc(C2CNC2)c(C(F)(F)F)c1 **Molecular Formula:** C10H10ClF4N **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 4. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_336>.
CC(C)(C)OC(=O)NC1CC(C=O)C12CCC2
What is the building block token for the following molecule?
CC(C)(C)OC(=O)NC1CC(C=O)C12CCC2
<BB_336>
What is the molecular formula for <BB_336>?
The molecular formula for <BB_336> (CC(C)(C)OC(=O)NC1CC(C=O)C12CCC2) is C13H21NO3.
Describe the ring structures in building block <BB_336>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4.
List the primary functional groups present in <BB_336>.
The molecule contains the following groups: Amide, Aldehyde, Ether.
Provide a comprehensive chemical profile for the building block <BB_336>.
**Token:** <BB_336> **SMILES:** CC(C)(C)OC(=O)NC1CC(C=O)C12CCC2 **Molecular Formula:** C13H21NO3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4. **Functional Groups:** Amide, Aldehyde, Ether
Provide the SMILES representation for the building block token <BB_337>.
Cc1cc(Br)cc(C)c1CC#N
What is the building block token for the following molecule?
Cc1cc(Br)cc(C)c1CC#N
<BB_337>
What is the molecular formula for <BB_337>?
The molecular formula for <BB_337> (Cc1cc(Br)cc(C)c1CC#N) is C10H10BrN.
Describe the ring structures in building block <BB_337>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_337>.
The molecule contains the following groups: Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_337>.
**Token:** <BB_337> **SMILES:** Cc1cc(Br)cc(C)c1CC#N **Molecular Formula:** C10H10BrN **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_338>.
CC1(C)OB(c2cc(O)cc(F)c2)OC1(C)C
What is the building block token for the following molecule?
CC1(C)OB(c2cc(O)cc(F)c2)OC1(C)C
<BB_338>
What is the molecular formula for <BB_338>?
The molecular formula for <BB_338> (CC1(C)OB(c2cc(O)cc(F)c2)OC1(C)C) is C12H16BFO3.
Describe the ring structures in building block <BB_338>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_338>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_338>.
**Token:** <BB_338> **SMILES:** CC1(C)OB(c2cc(O)cc(F)c2)OC1(C)C **Molecular Formula:** C12H16BFO3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_339>.
OCc1ncc(C2CCOCC2)[nH]1
What is the building block token for the following molecule?
OCc1ncc(C2CCOCC2)[nH]1
<BB_339>
What is the molecular formula for <BB_339>?
The molecular formula for <BB_339> (OCc1ncc(C2CCOCC2)[nH]1) is C9H14N2O2.
Describe the ring structures in building block <BB_339>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_339>.
The molecule contains the following groups: Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_339>.
**Token:** <BB_339> **SMILES:** OCc1ncc(C2CCOCC2)[nH]1 **Molecular Formula:** C9H14N2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Alcohol, Ether
Provide the SMILES representation for the building block token <BB_340>.
CC(C)CC1CC(N)CCO1
What is the building block token for the following molecule?
CC(C)CC1CC(N)CCO1
<BB_340>
What is the molecular formula for <BB_340>?
The molecular formula for <BB_340> (CC(C)CC1CC(N)CCO1) is C9H19NO.
Describe the ring structures in building block <BB_340>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_340>.
The molecule contains the following groups: Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_340>.
**Token:** <BB_340> **SMILES:** CC(C)CC1CC(N)CCO1 **Molecular Formula:** C9H19NO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amine, Ether
Provide the SMILES representation for the building block token <BB_341>.
CSCCCCCO
What is the building block token for the following molecule?
CSCCCCCO
<BB_341>
What is the molecular formula for <BB_341>?
The molecular formula for <BB_341> (CSCCCCCO) is C6H14OS.
Describe the ring structures in building block <BB_341>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_341>.
The molecule contains the following groups: Alcohol, Sulfide.
Provide a comprehensive chemical profile for the building block <BB_341>.
**Token:** <BB_341> **SMILES:** CSCCCCCO **Molecular Formula:** C6H14OS **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Alcohol, Sulfide
Provide the SMILES representation for the building block token <BB_342>.
FC(F)(Cl)c1cnc(Cl)c(Cl)c1
What is the building block token for the following molecule?
FC(F)(Cl)c1cnc(Cl)c(Cl)c1
<BB_342>
What is the molecular formula for <BB_342>?
The molecular formula for <BB_342> (FC(F)(Cl)c1cnc(Cl)c(Cl)c1) is C6H2Cl3F2N.
Describe the ring structures in building block <BB_342>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_342>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_342>.
**Token:** <BB_342> **SMILES:** FC(F)(Cl)c1cnc(Cl)c(Cl)c1 **Molecular Formula:** C6H2Cl3F2N **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_343>.
Cc1ccccc1C(N)C(C)C
What is the building block token for the following molecule?
Cc1ccccc1C(N)C(C)C
<BB_343>
What is the molecular formula for <BB_343>?
The molecular formula for <BB_343> (Cc1ccccc1C(N)C(C)C) is C11H17N.
Describe the ring structures in building block <BB_343>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_343>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_343>.
**Token:** <BB_343> **SMILES:** Cc1ccccc1C(N)C(C)C **Molecular Formula:** C11H17N **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_344>.
O=C(Cc1ccc(F)cc1)c1ccccc1F
What is the building block token for the following molecule?
O=C(Cc1ccc(F)cc1)c1ccccc1F
<BB_344>
What is the molecular formula for <BB_344>?
The molecular formula for <BB_344> (O=C(Cc1ccc(F)cc1)c1ccccc1F) is C14H10F2O.
Describe the ring structures in building block <BB_344>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_344>.
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_344>.
**Token:** <BB_344> **SMILES:** O=C(Cc1ccc(F)cc1)c1ccccc1F **Molecular Formula:** C14H10F2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_345>.
CCOC(=O)[C@]1(F)CNC[C@H]1CC
What is the building block token for the following molecule?
CCOC(=O)[C@]1(F)CNC[C@H]1CC
<BB_345>
What is the molecular formula for <BB_345>?
The molecular formula for <BB_345> (CCOC(=O)[C@]1(F)CNC[C@H]1CC) is C9H16FNO2.
Describe the ring structures in building block <BB_345>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_345>.
The molecule contains the following groups: Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_345>.
**Token:** <BB_345> **SMILES:** CCOC(=O)[C@]1(F)CNC[C@H]1CC **Molecular Formula:** C9H16FNO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_346>.
CC(C)Oc1ccc(C(N)CC(=O)O)cc1
What is the building block token for the following molecule?
CC(C)Oc1ccc(C(N)CC(=O)O)cc1
<BB_346>
What is the molecular formula for <BB_346>?
The molecular formula for <BB_346> (CC(C)Oc1ccc(C(N)CC(=O)O)cc1) is C12H17NO3.
Describe the ring structures in building block <BB_346>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_346>.
The molecule contains the following groups: Carboxylic Acid, Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_346>.
**Token:** <BB_346> **SMILES:** CC(C)Oc1ccc(C(N)CC(=O)O)cc1 **Molecular Formula:** C12H17NO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amine, Ether
Provide the SMILES representation for the building block token <BB_347>.
Nc1ccn(Cc2cccc(Cl)c2)n1
What is the building block token for the following molecule?
Nc1ccn(Cc2cccc(Cl)c2)n1
<BB_347>
What is the molecular formula for <BB_347>?
The molecular formula for <BB_347> (Nc1ccn(Cc2cccc(Cl)c2)n1) is C10H10ClN3.
Describe the ring structures in building block <BB_347>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_347>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_347>.
**Token:** <BB_347> **SMILES:** Nc1ccn(Cc2cccc(Cl)c2)n1 **Molecular Formula:** C10H10ClN3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_348>.
CC(C)C(=O)N1CC(F)(CN)C1.Cl
What is the building block token for the following molecule?
CC(C)C(=O)N1CC(F)(CN)C1.Cl
<BB_348>
What is the molecular formula for <BB_348>?
The molecular formula for <BB_348> (CC(C)C(=O)N1CC(F)(CN)C1.Cl) is C8H16ClFN2O.
Describe the ring structures in building block <BB_348>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_348>.
The molecule contains the following groups: Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_348>.
**Token:** <BB_348> **SMILES:** CC(C)C(=O)N1CC(F)(CN)C1.Cl **Molecular Formula:** C8H16ClFN2O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_349>.
Cn1c(=O)oc2cc(Cl)c(N)cc21
What is the building block token for the following molecule?
Cn1c(=O)oc2cc(Cl)c(N)cc21
<BB_349>
What is the molecular formula for <BB_349>?
The molecular formula for <BB_349> (Cn1c(=O)oc2cc(Cl)c(N)cc21) is C8H7ClN2O2.
Describe the ring structures in building block <BB_349>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_349>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_349>.
**Token:** <BB_349> **SMILES:** Cn1c(=O)oc2cc(Cl)c(N)cc21 **Molecular Formula:** C8H7ClN2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)