instruction
stringlengths 41
142
| input
stringlengths 0
478
| output
stringlengths 4
382
|
|---|---|---|
What is the molecular formula for <BB_333>?
|
The molecular formula for <BB_333> (C=CC1(CO)CCC1) is C7H12O.
|
|
Describe the ring structures in building block <BB_333>.
|
The molecule contains 1 ring(s): an aliphatic ring of size 4.
|
|
List the primary functional groups present in <BB_333>.
|
The molecule contains the following groups: Alcohol.
|
|
Provide a comprehensive chemical profile for the building block <BB_333>.
|
**Token:** <BB_333>
**SMILES:** C=CC1(CO)CCC1
**Molecular Formula:** C7H12O
**Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4.
**Functional Groups:** Alcohol
|
|
Provide the SMILES representation for the building block token <BB_334>.
|
[N-]=[N+]=NCC(F)(F)c1ccccc1
|
|
What is the building block token for the following molecule?
|
[N-]=[N+]=NCC(F)(F)c1ccccc1
|
<BB_334>
|
What is the molecular formula for <BB_334>?
|
The molecular formula for <BB_334> ([N-]=[N+]=NCC(F)(F)c1ccccc1) is C8H7F2N3.
|
|
Describe the ring structures in building block <BB_334>.
|
The molecule contains 1 ring(s): an aromatic ring of size 6.
|
|
List the primary functional groups present in <BB_334>.
|
The molecule contains the following groups: Halogen (F,Cl,Br,I).
|
|
Provide a comprehensive chemical profile for the building block <BB_334>.
|
**Token:** <BB_334>
**SMILES:** [N-]=[N+]=NCC(F)(F)c1ccccc1
**Molecular Formula:** C8H7F2N3
**Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6.
**Functional Groups:** Halogen (F,Cl,Br,I)
|
|
Provide the SMILES representation for the building block token <BB_335>.
|
Cl.Fc1ccc(C2CNC2)c(C(F)(F)F)c1
|
|
What is the building block token for the following molecule?
|
Cl.Fc1ccc(C2CNC2)c(C(F)(F)F)c1
|
<BB_335>
|
What is the molecular formula for <BB_335>?
|
The molecular formula for <BB_335> (Cl.Fc1ccc(C2CNC2)c(C(F)(F)F)c1) is C10H10ClF4N.
|
|
Describe the ring structures in building block <BB_335>.
|
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 4.
|
|
List the primary functional groups present in <BB_335>.
|
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
|
|
Provide a comprehensive chemical profile for the building block <BB_335>.
|
**Token:** <BB_335>
**SMILES:** Cl.Fc1ccc(C2CNC2)c(C(F)(F)F)c1
**Molecular Formula:** C10H10ClF4N
**Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 4.
**Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
|
|
Provide the SMILES representation for the building block token <BB_336>.
|
CC(C)(C)OC(=O)NC1CC(C=O)C12CCC2
|
|
What is the building block token for the following molecule?
|
CC(C)(C)OC(=O)NC1CC(C=O)C12CCC2
|
<BB_336>
|
What is the molecular formula for <BB_336>?
|
The molecular formula for <BB_336> (CC(C)(C)OC(=O)NC1CC(C=O)C12CCC2) is C13H21NO3.
|
|
Describe the ring structures in building block <BB_336>.
|
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4.
|
|
List the primary functional groups present in <BB_336>.
|
The molecule contains the following groups: Amide, Aldehyde, Ether.
|
|
Provide a comprehensive chemical profile for the building block <BB_336>.
|
**Token:** <BB_336>
**SMILES:** CC(C)(C)OC(=O)NC1CC(C=O)C12CCC2
**Molecular Formula:** C13H21NO3
**Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4.
**Functional Groups:** Amide, Aldehyde, Ether
|
|
Provide the SMILES representation for the building block token <BB_337>.
|
Cc1cc(Br)cc(C)c1CC#N
|
|
What is the building block token for the following molecule?
|
Cc1cc(Br)cc(C)c1CC#N
|
<BB_337>
|
What is the molecular formula for <BB_337>?
|
The molecular formula for <BB_337> (Cc1cc(Br)cc(C)c1CC#N) is C10H10BrN.
|
|
Describe the ring structures in building block <BB_337>.
|
The molecule contains 1 ring(s): an aromatic ring of size 6.
|
|
List the primary functional groups present in <BB_337>.
|
The molecule contains the following groups: Halogen (F,Cl,Br,I), Nitrile.
|
|
Provide a comprehensive chemical profile for the building block <BB_337>.
|
**Token:** <BB_337>
**SMILES:** Cc1cc(Br)cc(C)c1CC#N
**Molecular Formula:** C10H10BrN
**Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6.
**Functional Groups:** Halogen (F,Cl,Br,I), Nitrile
|
|
Provide the SMILES representation for the building block token <BB_338>.
|
CC1(C)OB(c2cc(O)cc(F)c2)OC1(C)C
|
|
What is the building block token for the following molecule?
|
CC1(C)OB(c2cc(O)cc(F)c2)OC1(C)C
|
<BB_338>
|
What is the molecular formula for <BB_338>?
|
The molecular formula for <BB_338> (CC1(C)OB(c2cc(O)cc(F)c2)OC1(C)C) is C12H16BFO3.
|
|
Describe the ring structures in building block <BB_338>.
|
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
|
|
List the primary functional groups present in <BB_338>.
|
The molecule contains the following groups: Halogen (F,Cl,Br,I).
|
|
Provide a comprehensive chemical profile for the building block <BB_338>.
|
**Token:** <BB_338>
**SMILES:** CC1(C)OB(c2cc(O)cc(F)c2)OC1(C)C
**Molecular Formula:** C12H16BFO3
**Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
**Functional Groups:** Halogen (F,Cl,Br,I)
|
|
Provide the SMILES representation for the building block token <BB_339>.
|
OCc1ncc(C2CCOCC2)[nH]1
|
|
What is the building block token for the following molecule?
|
OCc1ncc(C2CCOCC2)[nH]1
|
<BB_339>
|
What is the molecular formula for <BB_339>?
|
The molecular formula for <BB_339> (OCc1ncc(C2CCOCC2)[nH]1) is C9H14N2O2.
|
|
Describe the ring structures in building block <BB_339>.
|
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
|
|
List the primary functional groups present in <BB_339>.
|
The molecule contains the following groups: Alcohol, Ether.
|
|
Provide a comprehensive chemical profile for the building block <BB_339>.
|
**Token:** <BB_339>
**SMILES:** OCc1ncc(C2CCOCC2)[nH]1
**Molecular Formula:** C9H14N2O2
**Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
**Functional Groups:** Alcohol, Ether
|
|
Provide the SMILES representation for the building block token <BB_340>.
|
CC(C)CC1CC(N)CCO1
|
|
What is the building block token for the following molecule?
|
CC(C)CC1CC(N)CCO1
|
<BB_340>
|
What is the molecular formula for <BB_340>?
|
The molecular formula for <BB_340> (CC(C)CC1CC(N)CCO1) is C9H19NO.
|
|
Describe the ring structures in building block <BB_340>.
|
The molecule contains 1 ring(s): an aliphatic ring of size 6.
|
|
List the primary functional groups present in <BB_340>.
|
The molecule contains the following groups: Amine, Ether.
|
|
Provide a comprehensive chemical profile for the building block <BB_340>.
|
**Token:** <BB_340>
**SMILES:** CC(C)CC1CC(N)CCO1
**Molecular Formula:** C9H19NO
**Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6.
**Functional Groups:** Amine, Ether
|
|
Provide the SMILES representation for the building block token <BB_341>.
|
CSCCCCCO
|
|
What is the building block token for the following molecule?
|
CSCCCCCO
|
<BB_341>
|
What is the molecular formula for <BB_341>?
|
The molecular formula for <BB_341> (CSCCCCCO) is C6H14OS.
|
|
Describe the ring structures in building block <BB_341>.
|
The molecule is acyclic (contains no rings).
|
|
List the primary functional groups present in <BB_341>.
|
The molecule contains the following groups: Alcohol, Sulfide.
|
|
Provide a comprehensive chemical profile for the building block <BB_341>.
|
**Token:** <BB_341>
**SMILES:** CSCCCCCO
**Molecular Formula:** C6H14OS
**Ring System:** The molecule is acyclic (contains no rings).
**Functional Groups:** Alcohol, Sulfide
|
|
Provide the SMILES representation for the building block token <BB_342>.
|
FC(F)(Cl)c1cnc(Cl)c(Cl)c1
|
|
What is the building block token for the following molecule?
|
FC(F)(Cl)c1cnc(Cl)c(Cl)c1
|
<BB_342>
|
What is the molecular formula for <BB_342>?
|
The molecular formula for <BB_342> (FC(F)(Cl)c1cnc(Cl)c(Cl)c1) is C6H2Cl3F2N.
|
|
Describe the ring structures in building block <BB_342>.
|
The molecule contains 1 ring(s): an aromatic ring of size 6.
|
|
List the primary functional groups present in <BB_342>.
|
The molecule contains the following groups: Halogen (F,Cl,Br,I).
|
|
Provide a comprehensive chemical profile for the building block <BB_342>.
|
**Token:** <BB_342>
**SMILES:** FC(F)(Cl)c1cnc(Cl)c(Cl)c1
**Molecular Formula:** C6H2Cl3F2N
**Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6.
**Functional Groups:** Halogen (F,Cl,Br,I)
|
|
Provide the SMILES representation for the building block token <BB_343>.
|
Cc1ccccc1C(N)C(C)C
|
|
What is the building block token for the following molecule?
|
Cc1ccccc1C(N)C(C)C
|
<BB_343>
|
What is the molecular formula for <BB_343>?
|
The molecular formula for <BB_343> (Cc1ccccc1C(N)C(C)C) is C11H17N.
|
|
Describe the ring structures in building block <BB_343>.
|
The molecule contains 1 ring(s): an aromatic ring of size 6.
|
|
List the primary functional groups present in <BB_343>.
|
The molecule contains the following groups: Amine.
|
|
Provide a comprehensive chemical profile for the building block <BB_343>.
|
**Token:** <BB_343>
**SMILES:** Cc1ccccc1C(N)C(C)C
**Molecular Formula:** C11H17N
**Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6.
**Functional Groups:** Amine
|
|
Provide the SMILES representation for the building block token <BB_344>.
|
O=C(Cc1ccc(F)cc1)c1ccccc1F
|
|
What is the building block token for the following molecule?
|
O=C(Cc1ccc(F)cc1)c1ccccc1F
|
<BB_344>
|
What is the molecular formula for <BB_344>?
|
The molecular formula for <BB_344> (O=C(Cc1ccc(F)cc1)c1ccccc1F) is C14H10F2O.
|
|
Describe the ring structures in building block <BB_344>.
|
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
|
|
List the primary functional groups present in <BB_344>.
|
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I).
|
|
Provide a comprehensive chemical profile for the building block <BB_344>.
|
**Token:** <BB_344>
**SMILES:** O=C(Cc1ccc(F)cc1)c1ccccc1F
**Molecular Formula:** C14H10F2O
**Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
**Functional Groups:** Ketone, Halogen (F,Cl,Br,I)
|
|
Provide the SMILES representation for the building block token <BB_345>.
|
CCOC(=O)[C@]1(F)CNC[C@H]1CC
|
|
What is the building block token for the following molecule?
|
CCOC(=O)[C@]1(F)CNC[C@H]1CC
|
<BB_345>
|
What is the molecular formula for <BB_345>?
|
The molecular formula for <BB_345> (CCOC(=O)[C@]1(F)CNC[C@H]1CC) is C9H16FNO2.
|
|
Describe the ring structures in building block <BB_345>.
|
The molecule contains 1 ring(s): an aliphatic ring of size 5.
|
|
List the primary functional groups present in <BB_345>.
|
The molecule contains the following groups: Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I).
|
|
Provide a comprehensive chemical profile for the building block <BB_345>.
|
**Token:** <BB_345>
**SMILES:** CCOC(=O)[C@]1(F)CNC[C@H]1CC
**Molecular Formula:** C9H16FNO2
**Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5.
**Functional Groups:** Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I)
|
|
Provide the SMILES representation for the building block token <BB_346>.
|
CC(C)Oc1ccc(C(N)CC(=O)O)cc1
|
|
What is the building block token for the following molecule?
|
CC(C)Oc1ccc(C(N)CC(=O)O)cc1
|
<BB_346>
|
What is the molecular formula for <BB_346>?
|
The molecular formula for <BB_346> (CC(C)Oc1ccc(C(N)CC(=O)O)cc1) is C12H17NO3.
|
|
Describe the ring structures in building block <BB_346>.
|
The molecule contains 1 ring(s): an aromatic ring of size 6.
|
|
List the primary functional groups present in <BB_346>.
|
The molecule contains the following groups: Carboxylic Acid, Amine, Ether.
|
|
Provide a comprehensive chemical profile for the building block <BB_346>.
|
**Token:** <BB_346>
**SMILES:** CC(C)Oc1ccc(C(N)CC(=O)O)cc1
**Molecular Formula:** C12H17NO3
**Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6.
**Functional Groups:** Carboxylic Acid, Amine, Ether
|
|
Provide the SMILES representation for the building block token <BB_347>.
|
Nc1ccn(Cc2cccc(Cl)c2)n1
|
|
What is the building block token for the following molecule?
|
Nc1ccn(Cc2cccc(Cl)c2)n1
|
<BB_347>
|
What is the molecular formula for <BB_347>?
|
The molecular formula for <BB_347> (Nc1ccn(Cc2cccc(Cl)c2)n1) is C10H10ClN3.
|
|
Describe the ring structures in building block <BB_347>.
|
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
|
|
List the primary functional groups present in <BB_347>.
|
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
|
|
Provide a comprehensive chemical profile for the building block <BB_347>.
|
**Token:** <BB_347>
**SMILES:** Nc1ccn(Cc2cccc(Cl)c2)n1
**Molecular Formula:** C10H10ClN3
**Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
**Functional Groups:** Amine, Halogen (F,Cl,Br,I)
|
|
Provide the SMILES representation for the building block token <BB_348>.
|
CC(C)C(=O)N1CC(F)(CN)C1.Cl
|
|
What is the building block token for the following molecule?
|
CC(C)C(=O)N1CC(F)(CN)C1.Cl
|
<BB_348>
|
What is the molecular formula for <BB_348>?
|
The molecular formula for <BB_348> (CC(C)C(=O)N1CC(F)(CN)C1.Cl) is C8H16ClFN2O.
|
|
Describe the ring structures in building block <BB_348>.
|
The molecule contains 1 ring(s): an aliphatic ring of size 4.
|
|
List the primary functional groups present in <BB_348>.
|
The molecule contains the following groups: Amine, Amide, Halogen (F,Cl,Br,I).
|
|
Provide a comprehensive chemical profile for the building block <BB_348>.
|
**Token:** <BB_348>
**SMILES:** CC(C)C(=O)N1CC(F)(CN)C1.Cl
**Molecular Formula:** C8H16ClFN2O
**Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4.
**Functional Groups:** Amine, Amide, Halogen (F,Cl,Br,I)
|
|
Provide the SMILES representation for the building block token <BB_349>.
|
Cn1c(=O)oc2cc(Cl)c(N)cc21
|
|
What is the building block token for the following molecule?
|
Cn1c(=O)oc2cc(Cl)c(N)cc21
|
<BB_349>
|
What is the molecular formula for <BB_349>?
|
The molecular formula for <BB_349> (Cn1c(=O)oc2cc(Cl)c(N)cc21) is C8H7ClN2O2.
|
|
Describe the ring structures in building block <BB_349>.
|
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
|
|
List the primary functional groups present in <BB_349>.
|
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
|
|
Provide a comprehensive chemical profile for the building block <BB_349>.
|
**Token:** <BB_349>
**SMILES:** Cn1c(=O)oc2cc(Cl)c(N)cc21
**Molecular Formula:** C8H7ClN2O2
**Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
**Functional Groups:** Amine, Halogen (F,Cl,Br,I)
|
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.