instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_350>.
COC(=O)[C@@H]1CCCC[C@H]1N.Cl
What is the building block token for the following molecule?
COC(=O)[C@@H]1CCCC[C@H]1N.Cl
<BB_350>
What is the molecular formula for <BB_350>?
The molecular formula for <BB_350> (COC(=O)[C@@H]1CCCC[C@H]1N.Cl) is C8H16ClNO2.
Describe the ring structures in building block <BB_350>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_350>.
The molecule contains the following groups: Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_350>.
**Token:** <BB_350> **SMILES:** COC(=O)[C@@H]1CCCC[C@H]1N.Cl **Molecular Formula:** C8H16ClNO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_351>.
CC1(C)OB(c2c(F)cccc2C=O)OC1(C)C
What is the building block token for the following molecule?
CC1(C)OB(c2c(F)cccc2C=O)OC1(C)C
<BB_351>
What is the molecular formula for <BB_351>?
The molecular formula for <BB_351> (CC1(C)OB(c2c(F)cccc2C=O)OC1(C)C) is C13H16BFO3.
Describe the ring structures in building block <BB_351>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_351>.
The molecule contains the following groups: Aldehyde, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_351>.
**Token:** <BB_351> **SMILES:** CC1(C)OB(c2c(F)cccc2C=O)OC1(C)C **Molecular Formula:** C13H16BFO3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Aldehyde, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_352>.
O=C(O)c1ccc(S(=O)(=O)Cl)cc1C(F)(F)F
What is the building block token for the following molecule?
O=C(O)c1ccc(S(=O)(=O)Cl)cc1C(F)(F)F
<BB_352>
What is the molecular formula for <BB_352>?
The molecular formula for <BB_352> (O=C(O)c1ccc(S(=O)(=O)Cl)cc1C(F)(F)F) is C8H4ClF3O4S.
Describe the ring structures in building block <BB_352>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_352>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_352>.
**Token:** <BB_352> **SMILES:** O=C(O)c1ccc(S(=O)(=O)Cl)cc1C(F)(F)F **Molecular Formula:** C8H4ClF3O4S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_353>.
COC(=O)C1CCCCC1Br
What is the building block token for the following molecule?
COC(=O)C1CCCCC1Br
<BB_353>
What is the molecular formula for <BB_353>?
The molecular formula for <BB_353> (COC(=O)C1CCCCC1Br) is C8H13BrO2.
Describe the ring structures in building block <BB_353>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_353>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_353>.
**Token:** <BB_353> **SMILES:** COC(=O)C1CCCCC1Br **Molecular Formula:** C8H13BrO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_354>.
Fc1cnc(Br)cc1I
What is the building block token for the following molecule?
Fc1cnc(Br)cc1I
<BB_354>
What is the molecular formula for <BB_354>?
The molecular formula for <BB_354> (Fc1cnc(Br)cc1I) is C5H2BrFIN.
Describe the ring structures in building block <BB_354>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_354>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_354>.
**Token:** <BB_354> **SMILES:** Fc1cnc(Br)cc1I **Molecular Formula:** C5H2BrFIN **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_355>.
NC1CCOC2(CCCCC2)C1
What is the building block token for the following molecule?
NC1CCOC2(CCCCC2)C1
<BB_355>
What is the molecular formula for <BB_355>?
The molecular formula for <BB_355> (NC1CCOC2(CCCCC2)C1) is C10H19NO.
Describe the ring structures in building block <BB_355>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_355>.
The molecule contains the following groups: Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_355>.
**Token:** <BB_355> **SMILES:** NC1CCOC2(CCCCC2)C1 **Molecular Formula:** C10H19NO **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Amine, Ether
Provide the SMILES representation for the building block token <BB_356>.
CCOC(=O)C(Cc1ccccc1)C(=O)OCC
What is the building block token for the following molecule?
CCOC(=O)C(Cc1ccccc1)C(=O)OCC
<BB_356>
What is the molecular formula for <BB_356>?
The molecular formula for <BB_356> (CCOC(=O)C(Cc1ccccc1)C(=O)OCC) is C14H18O4.
Describe the ring structures in building block <BB_356>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_356>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_356>.
**Token:** <BB_356> **SMILES:** CCOC(=O)C(Cc1ccccc1)C(=O)OCC **Molecular Formula:** C14H18O4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_357>.
CC1(C)OB(c2ccc(C=O)c(Cl)c2)OC1(C)C
What is the building block token for the following molecule?
CC1(C)OB(c2ccc(C=O)c(Cl)c2)OC1(C)C
<BB_357>
What is the molecular formula for <BB_357>?
The molecular formula for <BB_357> (CC1(C)OB(c2ccc(C=O)c(Cl)c2)OC1(C)C) is C13H16BClO3.
Describe the ring structures in building block <BB_357>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_357>.
The molecule contains the following groups: Aldehyde, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_357>.
**Token:** <BB_357> **SMILES:** CC1(C)OB(c2ccc(C=O)c(Cl)c2)OC1(C)C **Molecular Formula:** C13H16BClO3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Aldehyde, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_358>.
CC(C)(C)OC(=O)NC[C@H]1C[C@H]1CN=[N+]=[N-]
What is the building block token for the following molecule?
CC(C)(C)OC(=O)NC[C@H]1C[C@H]1CN=[N+]=[N-]
<BB_358>
What is the molecular formula for <BB_358>?
The molecular formula for <BB_358> (CC(C)(C)OC(=O)NC[C@H]1C[C@H]1CN=[N+]=[N-]) is C10H18N4O2.
Describe the ring structures in building block <BB_358>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_358>.
The molecule contains the following groups: Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_358>.
**Token:** <BB_358> **SMILES:** CC(C)(C)OC(=O)NC[C@H]1C[C@H]1CN=[N+]=[N-] **Molecular Formula:** C10H18N4O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Amide, Ether
Provide the SMILES representation for the building block token <BB_359>.
CCOC(=O)c1[nH]c2ccc(C)cc2c1C=O
What is the building block token for the following molecule?
CCOC(=O)c1[nH]c2ccc(C)cc2c1C=O
<BB_359>
What is the molecular formula for <BB_359>?
The molecular formula for <BB_359> (CCOC(=O)c1[nH]c2ccc(C)cc2c1C=O) is C13H13NO3.
Describe the ring structures in building block <BB_359>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_359>.
The molecule contains the following groups: Ester, Aldehyde, Ether.
Provide a comprehensive chemical profile for the building block <BB_359>.
**Token:** <BB_359> **SMILES:** CCOC(=O)c1[nH]c2ccc(C)cc2c1C=O **Molecular Formula:** C13H13NO3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Ester, Aldehyde, Ether
Provide the SMILES representation for the building block token <BB_360>.
Oc1cccc(I)c1O
What is the building block token for the following molecule?
Oc1cccc(I)c1O
<BB_360>
What is the molecular formula for <BB_360>?
The molecular formula for <BB_360> (Oc1cccc(I)c1O) is C6H5IO2.
Describe the ring structures in building block <BB_360>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_360>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_360>.
**Token:** <BB_360> **SMILES:** Oc1cccc(I)c1O **Molecular Formula:** C6H5IO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_361>.
Cn1cc(NC(=O)CCC(=O)O)cn1
What is the building block token for the following molecule?
Cn1cc(NC(=O)CCC(=O)O)cn1
<BB_361>
What is the molecular formula for <BB_361>?
The molecular formula for <BB_361> (Cn1cc(NC(=O)CCC(=O)O)cn1) is C8H11N3O3.
Describe the ring structures in building block <BB_361>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_361>.
The molecule contains the following groups: Carboxylic Acid, Amide.
Provide a comprehensive chemical profile for the building block <BB_361>.
**Token:** <BB_361> **SMILES:** Cn1cc(NC(=O)CCC(=O)O)cn1 **Molecular Formula:** C8H11N3O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Amide
Provide the SMILES representation for the building block token <BB_362>.
Cl.Nc1ccc(N2CCNCC2=O)cn1
What is the building block token for the following molecule?
Cl.Nc1ccc(N2CCNCC2=O)cn1
<BB_362>
What is the molecular formula for <BB_362>?
The molecular formula for <BB_362> (Cl.Nc1ccc(N2CCNCC2=O)cn1) is C9H13ClN4O.
Describe the ring structures in building block <BB_362>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_362>.
The molecule contains the following groups: Amine, Secondary Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_362>.
**Token:** <BB_362> **SMILES:** Cl.Nc1ccc(N2CCNCC2=O)cn1 **Molecular Formula:** C9H13ClN4O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Amine, Secondary Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_363>.
CC(C)(C)c1csc(CC2CCNCC2)n1.Cl
What is the building block token for the following molecule?
CC(C)(C)c1csc(CC2CCNCC2)n1.Cl
<BB_363>
What is the molecular formula for <BB_363>?
The molecular formula for <BB_363> (CC(C)(C)c1csc(CC2CCNCC2)n1.Cl) is C13H23ClN2S.
Describe the ring structures in building block <BB_363>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_363>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_363>.
**Token:** <BB_363> **SMILES:** CC(C)(C)c1csc(CC2CCNCC2)n1.Cl **Molecular Formula:** C13H23ClN2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_364>.
C[C@H](O)c1ccc(Cl)cc1Cl
What is the building block token for the following molecule?
C[C@H](O)c1ccc(Cl)cc1Cl
<BB_364>
What is the molecular formula for <BB_364>?
The molecular formula for <BB_364> (C[C@H](O)c1ccc(Cl)cc1Cl) is C8H8Cl2O.
Describe the ring structures in building block <BB_364>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_364>.
The molecule contains the following groups: Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_364>.
**Token:** <BB_364> **SMILES:** C[C@H](O)c1ccc(Cl)cc1Cl **Molecular Formula:** C8H8Cl2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_365>.
O=C(O)CSCn1cc(Cl)cn1
What is the building block token for the following molecule?
O=C(O)CSCn1cc(Cl)cn1
<BB_365>
What is the molecular formula for <BB_365>?
The molecular formula for <BB_365> (O=C(O)CSCn1cc(Cl)cn1) is C6H7ClN2O2S.
Describe the ring structures in building block <BB_365>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_365>.
The molecule contains the following groups: Carboxylic Acid, Sulfide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_365>.
**Token:** <BB_365> **SMILES:** O=C(O)CSCn1cc(Cl)cn1 **Molecular Formula:** C6H7ClN2O2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Sulfide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_366>.
Cl.O=C(c1ccccc1)C1CCCN1
What is the building block token for the following molecule?
Cl.O=C(c1ccccc1)C1CCCN1
<BB_366>
What is the molecular formula for <BB_366>?
The molecular formula for <BB_366> (Cl.O=C(c1ccccc1)C1CCCN1) is C11H14ClNO.
Describe the ring structures in building block <BB_366>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.