instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_366>.
The molecule contains the following groups: Secondary Amine, Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_366>.
**Token:** <BB_366> **SMILES:** Cl.O=C(c1ccccc1)C1CCCN1 **Molecular Formula:** C11H14ClNO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_367>.
O=C1C[C@@H]2CS(=O)(=O)C[C@@H]2C1
What is the building block token for the following molecule?
O=C1C[C@@H]2CS(=O)(=O)C[C@@H]2C1
<BB_367>
What is the molecular formula for <BB_367>?
The molecular formula for <BB_367> (O=C1C[C@@H]2CS(=O)(=O)C[C@@H]2C1) is C7H10O3S.
Describe the ring structures in building block <BB_367>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_367>.
The molecule contains the following groups: Ketone.
Provide a comprehensive chemical profile for the building block <BB_367>.
**Token:** <BB_367> **SMILES:** O=C1C[C@@H]2CS(=O)(=O)C[C@@H]2C1 **Molecular Formula:** C7H10O3S **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Ketone
Provide the SMILES representation for the building block token <BB_368>.
CCc1ccc2occ(C=O)c(=O)c2c1
What is the building block token for the following molecule?
CCc1ccc2occ(C=O)c(=O)c2c1
<BB_368>
What is the molecular formula for <BB_368>?
The molecular formula for <BB_368> (CCc1ccc2occ(C=O)c(=O)c2c1) is C12H10O3.
Describe the ring structures in building block <BB_368>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_368>.
The molecule contains the following groups: Aldehyde.
Provide a comprehensive chemical profile for the building block <BB_368>.
**Token:** <BB_368> **SMILES:** CCc1ccc2occ(C=O)c(=O)c2c1 **Molecular Formula:** C12H10O3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Aldehyde
Provide the SMILES representation for the building block token <BB_369>.
Ic1ccc(-c2ccccc2)nc1
What is the building block token for the following molecule?
Ic1ccc(-c2ccccc2)nc1
<BB_369>
What is the molecular formula for <BB_369>?
The molecular formula for <BB_369> (Ic1ccc(-c2ccccc2)nc1) is C11H8IN.
Describe the ring structures in building block <BB_369>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_369>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_369>.
**Token:** <BB_369> **SMILES:** Ic1ccc(-c2ccccc2)nc1 **Molecular Formula:** C11H8IN **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_370>.
CC(=O)N1CCC(C(=O)Cl)CC1
What is the building block token for the following molecule?
CC(=O)N1CCC(C(=O)Cl)CC1
<BB_370>
What is the molecular formula for <BB_370>?
The molecular formula for <BB_370> (CC(=O)N1CCC(C(=O)Cl)CC1) is C8H12ClNO2.
Describe the ring structures in building block <BB_370>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_370>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_370>.
**Token:** <BB_370> **SMILES:** CC(=O)N1CCC(C(=O)Cl)CC1 **Molecular Formula:** C8H12ClNO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_371>.
CNC(C(=O)O)c1ccccc1C(F)(F)F
What is the building block token for the following molecule?
CNC(C(=O)O)c1ccccc1C(F)(F)F
<BB_371>
What is the molecular formula for <BB_371>?
The molecular formula for <BB_371> (CNC(C(=O)O)c1ccccc1C(F)(F)F) is C10H10F3NO2.
Describe the ring structures in building block <BB_371>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_371>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_371>.
**Token:** <BB_371> **SMILES:** CNC(C(=O)O)c1ccccc1C(F)(F)F **Molecular Formula:** C10H10F3NO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_372>.
Cl.Cl.c1cncc([C@@H]2CCCN2)c1
What is the building block token for the following molecule?
Cl.Cl.c1cncc([C@@H]2CCCN2)c1
<BB_372>
What is the molecular formula for <BB_372>?
The molecular formula for <BB_372> (Cl.Cl.c1cncc([C@@H]2CCCN2)c1) is C9H14Cl2N2.
Describe the ring structures in building block <BB_372>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_372>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_372>.
**Token:** <BB_372> **SMILES:** Cl.Cl.c1cncc([C@@H]2CCCN2)c1 **Molecular Formula:** C9H14Cl2N2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_373>.
C#CCOc1ccc(C=O)cc1C(=O)OC
What is the building block token for the following molecule?
C#CCOc1ccc(C=O)cc1C(=O)OC
<BB_373>
What is the molecular formula for <BB_373>?
The molecular formula for <BB_373> (C#CCOc1ccc(C=O)cc1C(=O)OC) is C12H10O4.
Describe the ring structures in building block <BB_373>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_373>.
The molecule contains the following groups: Ester, Aldehyde, Ether.
Provide a comprehensive chemical profile for the building block <BB_373>.
**Token:** <BB_373> **SMILES:** C#CCOc1ccc(C=O)cc1C(=O)OC **Molecular Formula:** C12H10O4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Aldehyde, Ether
Provide the SMILES representation for the building block token <BB_374>.
N#Cc1c(F)ccc(F)c1F
What is the building block token for the following molecule?
N#Cc1c(F)ccc(F)c1F
<BB_374>
What is the molecular formula for <BB_374>?
The molecular formula for <BB_374> (N#Cc1c(F)ccc(F)c1F) is C7H2F3N.
Describe the ring structures in building block <BB_374>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_374>.
The molecule contains the following groups: Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_374>.
**Token:** <BB_374> **SMILES:** N#Cc1c(F)ccc(F)c1F **Molecular Formula:** C7H2F3N **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_375>.
CC1(C)CC(CO)CCO1
What is the building block token for the following molecule?
CC1(C)CC(CO)CCO1
<BB_375>
What is the molecular formula for <BB_375>?
The molecular formula for <BB_375> (CC1(C)CC(CO)CCO1) is C8H16O2.
Describe the ring structures in building block <BB_375>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_375>.
The molecule contains the following groups: Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_375>.
**Token:** <BB_375> **SMILES:** CC1(C)CC(CO)CCO1 **Molecular Formula:** C8H16O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Alcohol, Ether
Provide the SMILES representation for the building block token <BB_376>.
CC(=O)c1cccc(N2Cc3ccccc3C2=N)c1
What is the building block token for the following molecule?
CC(=O)c1cccc(N2Cc3ccccc3C2=N)c1
<BB_376>
What is the molecular formula for <BB_376>?
The molecular formula for <BB_376> (CC(=O)c1cccc(N2Cc3ccccc3C2=N)c1) is C16H14N2O.
Describe the ring structures in building block <BB_376>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_376>.
The molecule contains the following groups: Tertiary Amine, Ketone.
Provide a comprehensive chemical profile for the building block <BB_376>.
**Token:** <BB_376> **SMILES:** CC(=O)c1cccc(N2Cc3ccccc3C2=N)c1 **Molecular Formula:** C16H14N2O **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Ketone
Provide the SMILES representation for the building block token <BB_377>.
COC(=O)C(C)NC(=O)c1ccc(Cl)c([N+](=O)[O-])c1
What is the building block token for the following molecule?
COC(=O)C(C)NC(=O)c1ccc(Cl)c([N+](=O)[O-])c1
<BB_377>
What is the molecular formula for <BB_377>?
The molecular formula for <BB_377> (COC(=O)C(C)NC(=O)c1ccc(Cl)c([N+](=O)[O-])c1) is C11H11ClN2O5.
Describe the ring structures in building block <BB_377>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_377>.
The molecule contains the following groups: Tertiary Amine, Amide, Ester, Ether, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_377>.
**Token:** <BB_377> **SMILES:** COC(=O)C(C)NC(=O)c1ccc(Cl)c([N+](=O)[O-])c1 **Molecular Formula:** C11H11ClN2O5 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Amide, Ester, Ether, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_378>.
Cc1ccc(CBr)s1
What is the building block token for the following molecule?
Cc1ccc(CBr)s1
<BB_378>
What is the molecular formula for <BB_378>?
The molecular formula for <BB_378> (Cc1ccc(CBr)s1) is C6H7BrS.
Describe the ring structures in building block <BB_378>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_378>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_378>.
**Token:** <BB_378> **SMILES:** Cc1ccc(CBr)s1 **Molecular Formula:** C6H7BrS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_379>.
O=S([O-])c1ccccc1C(F)(F)F.[Na+]
What is the building block token for the following molecule?
O=S([O-])c1ccccc1C(F)(F)F.[Na+]
<BB_379>
What is the molecular formula for <BB_379>?
The molecular formula for <BB_379> (O=S([O-])c1ccccc1C(F)(F)F.[Na+]) is C7H4F3NaO2S.
Describe the ring structures in building block <BB_379>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_379>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_379>.
**Token:** <BB_379> **SMILES:** O=S([O-])c1ccccc1C(F)(F)F.[Na+] **Molecular Formula:** C7H4F3NaO2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_380>.
CC(=O)NCCNC(=O)c1ccccc1N
What is the building block token for the following molecule?
CC(=O)NCCNC(=O)c1ccccc1N
<BB_380>
What is the molecular formula for <BB_380>?
The molecular formula for <BB_380> (CC(=O)NCCNC(=O)c1ccccc1N) is C11H15N3O2.
Describe the ring structures in building block <BB_380>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_380>.
The molecule contains the following groups: Amine, Amide.
Provide a comprehensive chemical profile for the building block <BB_380>.
**Token:** <BB_380> **SMILES:** CC(=O)NCCNC(=O)c1ccccc1N **Molecular Formula:** C11H15N3O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Amide
Provide the SMILES representation for the building block token <BB_381>.
CC(C)(C)OC(=O)N1C(CN)CCC1(C)C
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1C(CN)CCC1(C)C
<BB_381>
What is the molecular formula for <BB_381>?
The molecular formula for <BB_381> (CC(C)(C)OC(=O)N1C(CN)CCC1(C)C) is C12H24N2O2.
Describe the ring structures in building block <BB_381>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_381>.
The molecule contains the following groups: Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_381>.
**Token:** <BB_381> **SMILES:** CC(C)(C)OC(=O)N1C(CN)CCC1(C)C **Molecular Formula:** C12H24N2O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_382>.
Clc1ncc(-c2ccccc2)o1
What is the building block token for the following molecule?
Clc1ncc(-c2ccccc2)o1
<BB_382>
What is the molecular formula for <BB_382>?
The molecular formula for <BB_382> (Clc1ncc(-c2ccccc2)o1) is C9H6ClNO.
Describe the ring structures in building block <BB_382>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_382>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_382>.
**Token:** <BB_382> **SMILES:** Clc1ncc(-c2ccccc2)o1 **Molecular Formula:** C9H6ClNO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_383>.
Cc1cc2[nH]c(=O)c(C(=O)O)cn2n1
What is the building block token for the following molecule?
Cc1cc2[nH]c(=O)c(C(=O)O)cn2n1
<BB_383>