instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_383>?
The molecular formula for <BB_383> (Cc1cc2[nH]c(=O)c(C(=O)O)cn2n1) is C8H7N3O3.
Describe the ring structures in building block <BB_383>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_383>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_383>.
**Token:** <BB_383> **SMILES:** Cc1cc2[nH]c(=O)c(C(=O)O)cn2n1 **Molecular Formula:** C8H7N3O3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_384>.
CCOC(=O)c1nc2ccccn2n1
What is the building block token for the following molecule?
CCOC(=O)c1nc2ccccn2n1
<BB_384>
What is the molecular formula for <BB_384>?
The molecular formula for <BB_384> (CCOC(=O)c1nc2ccccn2n1) is C9H9N3O2.
Describe the ring structures in building block <BB_384>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_384>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_384>.
**Token:** <BB_384> **SMILES:** CCOC(=O)c1nc2ccccn2n1 **Molecular Formula:** C9H9N3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_385>.
CNC(C)C(C)c1ccc(Cl)cc1
What is the building block token for the following molecule?
CNC(C)C(C)c1ccc(Cl)cc1
<BB_385>
What is the molecular formula for <BB_385>?
The molecular formula for <BB_385> (CNC(C)C(C)c1ccc(Cl)cc1) is C11H16ClN.
Describe the ring structures in building block <BB_385>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_385>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_385>.
**Token:** <BB_385> **SMILES:** CNC(C)C(C)c1ccc(Cl)cc1 **Molecular Formula:** C11H16ClN **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_386>.
CC(C)n1cc(CO)cn1
What is the building block token for the following molecule?
CC(C)n1cc(CO)cn1
<BB_386>
What is the molecular formula for <BB_386>?
The molecular formula for <BB_386> (CC(C)n1cc(CO)cn1) is C7H12N2O.
Describe the ring structures in building block <BB_386>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_386>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_386>.
**Token:** <BB_386> **SMILES:** CC(C)n1cc(CO)cn1 **Molecular Formula:** C7H12N2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_387>.
CN(CC(=O)O)C1CCNCC1.Cl.Cl
What is the building block token for the following molecule?
CN(CC(=O)O)C1CCNCC1.Cl.Cl
<BB_387>
What is the molecular formula for <BB_387>?
The molecular formula for <BB_387> (CN(CC(=O)O)C1CCNCC1.Cl.Cl) is C8H18Cl2N2O2.
Describe the ring structures in building block <BB_387>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_387>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_387>.
**Token:** <BB_387> **SMILES:** CN(CC(=O)O)C1CCNCC1.Cl.Cl **Molecular Formula:** C8H18Cl2N2O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_388>.
CC1CCC(F)(F)C(=O)N1
What is the building block token for the following molecule?
CC1CCC(F)(F)C(=O)N1
<BB_388>
What is the molecular formula for <BB_388>?
The molecular formula for <BB_388> (CC1CCC(F)(F)C(=O)N1) is C6H9F2NO.
Describe the ring structures in building block <BB_388>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_388>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_388>.
**Token:** <BB_388> **SMILES:** CC1CCC(F)(F)C(=O)N1 **Molecular Formula:** C6H9F2NO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_389>.
N#CC(=CC1CCSC1)C(=O)O
What is the building block token for the following molecule?
N#CC(=CC1CCSC1)C(=O)O
<BB_389>
What is the molecular formula for <BB_389>?
The molecular formula for <BB_389> (N#CC(=CC1CCSC1)C(=O)O) is C8H9NO2S.
Describe the ring structures in building block <BB_389>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_389>.
The molecule contains the following groups: Carboxylic Acid, Sulfide, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_389>.
**Token:** <BB_389> **SMILES:** N#CC(=CC1CCSC1)C(=O)O **Molecular Formula:** C8H9NO2S **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid, Sulfide, Nitrile
Provide the SMILES representation for the building block token <BB_390>.
CCCCOc1cc(OC)ccc1C(=O)OC
What is the building block token for the following molecule?
CCCCOc1cc(OC)ccc1C(=O)OC
<BB_390>
What is the molecular formula for <BB_390>?
The molecular formula for <BB_390> (CCCCOc1cc(OC)ccc1C(=O)OC) is C13H18O4.
Describe the ring structures in building block <BB_390>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_390>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_390>.
**Token:** <BB_390> **SMILES:** CCCCOc1cc(OC)ccc1C(=O)OC **Molecular Formula:** C13H18O4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_391>.
CNC(=O)n1cnc(C(N)=O)c1N
What is the building block token for the following molecule?
CNC(=O)n1cnc(C(N)=O)c1N
<BB_391>
What is the molecular formula for <BB_391>?
The molecular formula for <BB_391> (CNC(=O)n1cnc(C(N)=O)c1N) is C6H9N5O2.
Describe the ring structures in building block <BB_391>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_391>.
The molecule contains the following groups: Amine, Amide.
Provide a comprehensive chemical profile for the building block <BB_391>.
**Token:** <BB_391> **SMILES:** CNC(=O)n1cnc(C(N)=O)c1N **Molecular Formula:** C6H9N5O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Amide
Provide the SMILES representation for the building block token <BB_392>.
CNC(=O)c1cc(C#N)cc(C)c1N
What is the building block token for the following molecule?
CNC(=O)c1cc(C#N)cc(C)c1N
<BB_392>
What is the molecular formula for <BB_392>?
The molecular formula for <BB_392> (CNC(=O)c1cc(C#N)cc(C)c1N) is C10H11N3O.
Describe the ring structures in building block <BB_392>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_392>.
The molecule contains the following groups: Amine, Amide, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_392>.
**Token:** <BB_392> **SMILES:** CNC(=O)c1cc(C#N)cc(C)c1N **Molecular Formula:** C10H11N3O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Amide, Nitrile
Provide the SMILES representation for the building block token <BB_393>.
COc1ccc(F)cc1C(=O)O
What is the building block token for the following molecule?
COc1ccc(F)cc1C(=O)O
<BB_393>
What is the molecular formula for <BB_393>?
The molecular formula for <BB_393> (COc1ccc(F)cc1C(=O)O) is C8H7FO3.
Describe the ring structures in building block <BB_393>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_393>.
The molecule contains the following groups: Carboxylic Acid, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_393>.
**Token:** <BB_393> **SMILES:** COc1ccc(F)cc1C(=O)O **Molecular Formula:** C8H7FO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_394>.
COC(=O)Cc1nc(C(=O)O)cs1
What is the building block token for the following molecule?
COC(=O)Cc1nc(C(=O)O)cs1
<BB_394>
What is the molecular formula for <BB_394>?
The molecular formula for <BB_394> (COC(=O)Cc1nc(C(=O)O)cs1) is C7H7NO4S.
Describe the ring structures in building block <BB_394>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_394>.
The molecule contains the following groups: Carboxylic Acid, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_394>.
**Token:** <BB_394> **SMILES:** COC(=O)Cc1nc(C(=O)O)cs1 **Molecular Formula:** C7H7NO4S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Ester, Ether
Provide the SMILES representation for the building block token <BB_395>.
O=Cc1c(Br)cc(F)c(F)c1N1CCCCC1
What is the building block token for the following molecule?
O=Cc1c(Br)cc(F)c(F)c1N1CCCCC1
<BB_395>
What is the molecular formula for <BB_395>?
The molecular formula for <BB_395> (O=Cc1c(Br)cc(F)c(F)c1N1CCCCC1) is C12H12BrF2NO.
Describe the ring structures in building block <BB_395>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_395>.
The molecule contains the following groups: Tertiary Amine, Aldehyde, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_395>.
**Token:** <BB_395> **SMILES:** O=Cc1c(Br)cc(F)c(F)c1N1CCCCC1 **Molecular Formula:** C12H12BrF2NO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Tertiary Amine, Aldehyde, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_396>.
CC(Br)c1cc(Br)ccc1F
What is the building block token for the following molecule?
CC(Br)c1cc(Br)ccc1F
<BB_396>
What is the molecular formula for <BB_396>?
The molecular formula for <BB_396> (CC(Br)c1cc(Br)ccc1F) is C8H7Br2F.
Describe the ring structures in building block <BB_396>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_396>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_396>.
**Token:** <BB_396> **SMILES:** CC(Br)c1cc(Br)ccc1F **Molecular Formula:** C8H7Br2F **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_397>.
CON(C)C(=O)CCCl
What is the building block token for the following molecule?
CON(C)C(=O)CCCl
<BB_397>
What is the molecular formula for <BB_397>?
The molecular formula for <BB_397> (CON(C)C(=O)CCCl) is C5H10ClNO2.
Describe the ring structures in building block <BB_397>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_397>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_397>.
**Token:** <BB_397> **SMILES:** CON(C)C(=O)CCCl **Molecular Formula:** C5H10ClNO2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_398>.
CNCCCC1CNCCN1C.Cl.Cl.Cl
What is the building block token for the following molecule?
CNCCCC1CNCCN1C.Cl.Cl.Cl
<BB_398>
What is the molecular formula for <BB_398>?
The molecular formula for <BB_398> (CNCCCC1CNCCN1C.Cl.Cl.Cl) is C9H24Cl3N3.
Describe the ring structures in building block <BB_398>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_398>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_398>.
**Token:** <BB_398> **SMILES:** CNCCCC1CNCCN1C.Cl.Cl.Cl **Molecular Formula:** C9H24Cl3N3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_399>.
CC(Oc1ccc(Br)cc1)c1ccc([N+](=O)[O-])cc1
What is the building block token for the following molecule?
CC(Oc1ccc(Br)cc1)c1ccc([N+](=O)[O-])cc1
<BB_399>
What is the molecular formula for <BB_399>?
The molecular formula for <BB_399> (CC(Oc1ccc(Br)cc1)c1ccc([N+](=O)[O-])cc1) is C14H12BrNO3.
Describe the ring structures in building block <BB_399>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_399>.
The molecule contains the following groups: Tertiary Amine, Ether, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_399>.
**Token:** <BB_399> **SMILES:** CC(Oc1ccc(Br)cc1)c1ccc([N+](=O)[O-])cc1 **Molecular Formula:** C14H12BrNO3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Ether, Halogen (F,Cl,Br,I), Nitro