instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_400>.
CC(=O)c1cc(Br)c(C)cc1F
What is the building block token for the following molecule?
CC(=O)c1cc(Br)c(C)cc1F
<BB_400>
What is the molecular formula for <BB_400>?
The molecular formula for <BB_400> (CC(=O)c1cc(Br)c(C)cc1F) is C9H8BrFO.
Describe the ring structures in building block <BB_400>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_400>.
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_400>.
**Token:** <BB_400> **SMILES:** CC(=O)c1cc(Br)c(C)cc1F **Molecular Formula:** C9H8BrFO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_401>.
CC(=O)Nc1ccc(O)cc1F
What is the building block token for the following molecule?
CC(=O)Nc1ccc(O)cc1F
<BB_401>
What is the molecular formula for <BB_401>?
The molecular formula for <BB_401> (CC(=O)Nc1ccc(O)cc1F) is C8H8FNO2.
Describe the ring structures in building block <BB_401>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_401>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_401>.
**Token:** <BB_401> **SMILES:** CC(=O)Nc1ccc(O)cc1F **Molecular Formula:** C8H8FNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_402>.
CCNS(C)(=O)=O
What is the building block token for the following molecule?
CCNS(C)(=O)=O
<BB_402>
What is the molecular formula for <BB_402>?
The molecular formula for <BB_402> (CCNS(C)(=O)=O) is C3H9NO2S.
Describe the ring structures in building block <BB_402>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_402>.
The molecule contains the following groups: Secondary Amine, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_402>.
**Token:** <BB_402> **SMILES:** CCNS(C)(=O)=O **Molecular Formula:** C3H9NO2S **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Secondary Amine, Sulfonamide
Provide the SMILES representation for the building block token <BB_403>.
C#Cc1ccnn1C1CC1(F)F
What is the building block token for the following molecule?
C#Cc1ccnn1C1CC1(F)F
<BB_403>
What is the molecular formula for <BB_403>?
The molecular formula for <BB_403> (C#Cc1ccnn1C1CC1(F)F) is C8H6F2N2.
Describe the ring structures in building block <BB_403>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3.
List the primary functional groups present in <BB_403>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_403>.
**Token:** <BB_403> **SMILES:** C#Cc1ccnn1C1CC1(F)F **Molecular Formula:** C8H6F2N2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_404>.
CC1NCCc2c(Br)ccc(F)c21.Cl
What is the building block token for the following molecule?
CC1NCCc2c(Br)ccc(F)c21.Cl
<BB_404>
What is the molecular formula for <BB_404>?
The molecular formula for <BB_404> (CC1NCCc2c(Br)ccc(F)c21.Cl) is C10H12BrClFN.
Describe the ring structures in building block <BB_404>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_404>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_404>.
**Token:** <BB_404> **SMILES:** CC1NCCc2c(Br)ccc(F)c21.Cl **Molecular Formula:** C10H12BrClFN **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_405>.
C[C@H]1COC[C@H]1O
What is the building block token for the following molecule?
C[C@H]1COC[C@H]1O
<BB_405>
What is the molecular formula for <BB_405>?
The molecular formula for <BB_405> (C[C@H]1COC[C@H]1O) is C5H10O2.
Describe the ring structures in building block <BB_405>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_405>.
The molecule contains the following groups: Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_405>.
**Token:** <BB_405> **SMILES:** C[C@H]1COC[C@H]1O **Molecular Formula:** C5H10O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Alcohol, Ether
Provide the SMILES representation for the building block token <BB_406>.
Cl.NC1(c2ccc(Br)c3ccccc23)CC1
What is the building block token for the following molecule?
Cl.NC1(c2ccc(Br)c3ccccc23)CC1
<BB_406>
What is the molecular formula for <BB_406>?
The molecular formula for <BB_406> (Cl.NC1(c2ccc(Br)c3ccccc23)CC1) is C13H13BrClN.
Describe the ring structures in building block <BB_406>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_406>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_406>.
**Token:** <BB_406> **SMILES:** Cl.NC1(c2ccc(Br)c3ccccc23)CC1 **Molecular Formula:** C13H13BrClN **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_407>.
CC1CN(c2ccc(C(=N)N)cn2)C(C)CO1.Cl.Cl
What is the building block token for the following molecule?
CC1CN(c2ccc(C(=N)N)cn2)C(C)CO1.Cl.Cl
<BB_407>
What is the molecular formula for <BB_407>?
The molecular formula for <BB_407> (CC1CN(c2ccc(C(=N)N)cn2)C(C)CO1.Cl.Cl) is C12H20Cl2N4O.
Describe the ring structures in building block <BB_407>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_407>.
The molecule contains the following groups: Amine, Tertiary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_407>.
**Token:** <BB_407> **SMILES:** CC1CN(c2ccc(C(=N)N)cn2)C(C)CO1.Cl.Cl **Molecular Formula:** C12H20Cl2N4O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_408>.
Cc1ccc(C(C)N=C=O)s1
What is the building block token for the following molecule?
Cc1ccc(C(C)N=C=O)s1
<BB_408>
What is the molecular formula for <BB_408>?
The molecular formula for <BB_408> (Cc1ccc(C(C)N=C=O)s1) is C8H9NOS.
Describe the ring structures in building block <BB_408>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_408>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_408>.
**Token:** <BB_408> **SMILES:** Cc1ccc(C(C)N=C=O)s1 **Molecular Formula:** C8H9NOS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_409>.
CC(C)n1ccnc1Br
What is the building block token for the following molecule?
CC(C)n1ccnc1Br
<BB_409>
What is the molecular formula for <BB_409>?
The molecular formula for <BB_409> (CC(C)n1ccnc1Br) is C6H9BrN2.
Describe the ring structures in building block <BB_409>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_409>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_409>.
**Token:** <BB_409> **SMILES:** CC(C)n1ccnc1Br **Molecular Formula:** C6H9BrN2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_410>.
O=C(O)c1c(Br)cc(Br)cc1Br
What is the building block token for the following molecule?
O=C(O)c1c(Br)cc(Br)cc1Br
<BB_410>
What is the molecular formula for <BB_410>?
The molecular formula for <BB_410> (O=C(O)c1c(Br)cc(Br)cc1Br) is C7H3Br3O2.
Describe the ring structures in building block <BB_410>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_410>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_410>.
**Token:** <BB_410> **SMILES:** O=C(O)c1c(Br)cc(Br)cc1Br **Molecular Formula:** C7H3Br3O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_411>.
Cl.FC1(F)CCC2(CC1)COCCN2
What is the building block token for the following molecule?
Cl.FC1(F)CCC2(CC1)COCCN2
<BB_411>
What is the molecular formula for <BB_411>?
The molecular formula for <BB_411> (Cl.FC1(F)CCC2(CC1)COCCN2) is C9H16ClF2NO.
Describe the ring structures in building block <BB_411>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_411>.
The molecule contains the following groups: Secondary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_411>.
**Token:** <BB_411> **SMILES:** Cl.FC1(F)CCC2(CC1)COCCN2 **Molecular Formula:** C9H16ClF2NO **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_412>.
Fc1cc(F)c2[nH]c(Cl)nc2c1
What is the building block token for the following molecule?
Fc1cc(F)c2[nH]c(Cl)nc2c1
<BB_412>
What is the molecular formula for <BB_412>?
The molecular formula for <BB_412> (Fc1cc(F)c2[nH]c(Cl)nc2c1) is C7H3ClF2N2.
Describe the ring structures in building block <BB_412>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_412>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_412>.
**Token:** <BB_412> **SMILES:** Fc1cc(F)c2[nH]c(Cl)nc2c1 **Molecular Formula:** C7H3ClF2N2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_413>.
O=C1OC(CI)CC12CCCC2
What is the building block token for the following molecule?
O=C1OC(CI)CC12CCCC2
<BB_413>
What is the molecular formula for <BB_413>?
The molecular formula for <BB_413> (O=C1OC(CI)CC12CCCC2) is C9H13IO2.
Describe the ring structures in building block <BB_413>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_413>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_413>.
**Token:** <BB_413> **SMILES:** O=C1OC(CI)CC12CCCC2 **Molecular Formula:** C9H13IO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_414>.
CC(C=O)=Cc1ccccc1C(F)(F)F
What is the building block token for the following molecule?
CC(C=O)=Cc1ccccc1C(F)(F)F
<BB_414>
What is the molecular formula for <BB_414>?
The molecular formula for <BB_414> (CC(C=O)=Cc1ccccc1C(F)(F)F) is C11H9F3O.
Describe the ring structures in building block <BB_414>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_414>.
The molecule contains the following groups: Aldehyde, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_414>.
**Token:** <BB_414> **SMILES:** CC(C=O)=Cc1ccccc1C(F)(F)F **Molecular Formula:** C11H9F3O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Aldehyde, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_415>.
CC(C)(N)/C=C/B1OC(C)(C)C(C)(C)O1.Cl
What is the building block token for the following molecule?
CC(C)(N)/C=C/B1OC(C)(C)C(C)(C)O1.Cl
<BB_415>
What is the molecular formula for <BB_415>?
The molecular formula for <BB_415> (CC(C)(N)/C=C/B1OC(C)(C)C(C)(C)O1.Cl) is C11H23BClNO2.
Describe the ring structures in building block <BB_415>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_415>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_415>.
**Token:** <BB_415> **SMILES:** CC(C)(N)/C=C/B1OC(C)(C)C(C)(C)O1.Cl **Molecular Formula:** C11H23BClNO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_416>.
CCOC(=O)c1cnc2c(C#N)cnn2c1C1CC1
What is the building block token for the following molecule?
CCOC(=O)c1cnc2c(C#N)cnn2c1C1CC1
<BB_416>
What is the molecular formula for <BB_416>?
The molecular formula for <BB_416> (CCOC(=O)c1cnc2c(C#N)cnn2c1C1CC1) is C13H12N4O2.
Describe the ring structures in building block <BB_416>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aliphatic ring of size 3.