instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_416>.
The molecule contains the following groups: Ester, Ether, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_416>.
**Token:** <BB_416> **SMILES:** CCOC(=O)c1cnc2c(C#N)cnn2c1C1CC1 **Molecular Formula:** C13H12N4O2 **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aliphatic ring of size 3. **Functional Groups:** Ester, Ether, Nitrile
Provide the SMILES representation for the building block token <BB_417>.
CCCSc1ncc([N+](=O)[O-])c(Cl)n1
What is the building block token for the following molecule?
CCCSc1ncc([N+](=O)[O-])c(Cl)n1
<BB_417>
What is the molecular formula for <BB_417>?
The molecular formula for <BB_417> (CCCSc1ncc([N+](=O)[O-])c(Cl)n1) is C7H8ClN3O2S.
Describe the ring structures in building block <BB_417>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_417>.
The molecule contains the following groups: Tertiary Amine, Sulfide, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_417>.
**Token:** <BB_417> **SMILES:** CCCSc1ncc([N+](=O)[O-])c(Cl)n1 **Molecular Formula:** C7H8ClN3O2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Sulfide, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_418>.
Nc1ncc(Br)c(OCC(F)(F)F)n1
What is the building block token for the following molecule?
Nc1ncc(Br)c(OCC(F)(F)F)n1
<BB_418>
What is the molecular formula for <BB_418>?
The molecular formula for <BB_418> (Nc1ncc(Br)c(OCC(F)(F)F)n1) is C6H5BrF3N3O.
Describe the ring structures in building block <BB_418>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_418>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_418>.
**Token:** <BB_418> **SMILES:** Nc1ncc(Br)c(OCC(F)(F)F)n1 **Molecular Formula:** C6H5BrF3N3O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_419>.
COC(=O)c1nn(C)c2c1CCNC2.Cl
What is the building block token for the following molecule?
COC(=O)c1nn(C)c2c1CCNC2.Cl
<BB_419>
What is the molecular formula for <BB_419>?
The molecular formula for <BB_419> (COC(=O)c1nn(C)c2c1CCNC2.Cl) is C9H14ClN3O2.
Describe the ring structures in building block <BB_419>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_419>.
The molecule contains the following groups: Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_419>.
**Token:** <BB_419> **SMILES:** COC(=O)c1nn(C)c2c1CCNC2.Cl **Molecular Formula:** C9H14ClN3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_420>.
Cl.Cl.NNCCC1CC1
What is the building block token for the following molecule?
Cl.Cl.NNCCC1CC1
<BB_420>
What is the molecular formula for <BB_420>?
The molecular formula for <BB_420> (Cl.Cl.NNCCC1CC1) is C5H14Cl2N2.
Describe the ring structures in building block <BB_420>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_420>.
The molecule contains the following groups: Amine, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_420>.
**Token:** <BB_420> **SMILES:** Cl.Cl.NNCCC1CC1 **Molecular Formula:** C5H14Cl2N2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Amine, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_421>.
CCc1n[nH]c(Cl)c1C(=O)O
What is the building block token for the following molecule?
CCc1n[nH]c(Cl)c1C(=O)O
<BB_421>
What is the molecular formula for <BB_421>?
The molecular formula for <BB_421> (CCc1n[nH]c(Cl)c1C(=O)O) is C6H7ClN2O2.
Describe the ring structures in building block <BB_421>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_421>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_421>.
**Token:** <BB_421> **SMILES:** CCc1n[nH]c(Cl)c1C(=O)O **Molecular Formula:** C6H7ClN2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_422>.
OCc1nnc2n1CCCC2
What is the building block token for the following molecule?
OCc1nnc2n1CCCC2
<BB_422>
What is the molecular formula for <BB_422>?
The molecular formula for <BB_422> (OCc1nnc2n1CCCC2) is C7H11N3O.
Describe the ring structures in building block <BB_422>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_422>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_422>.
**Token:** <BB_422> **SMILES:** OCc1nnc2n1CCCC2 **Molecular Formula:** C7H11N3O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_423>.
CC(C)(C)Cc1nc2ccccc2[nH]1
What is the building block token for the following molecule?
CC(C)(C)Cc1nc2ccccc2[nH]1
<BB_423>
What is the molecular formula for <BB_423>?
The molecular formula for <BB_423> (CC(C)(C)Cc1nc2ccccc2[nH]1) is C12H16N2.
Describe the ring structures in building block <BB_423>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_423>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_423>.
**Token:** <BB_423> **SMILES:** CC(C)(C)Cc1nc2ccccc2[nH]1 **Molecular Formula:** C12H16N2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_424>.
Cc1c[nH]c2cc(Cl)ccc12
What is the building block token for the following molecule?
Cc1c[nH]c2cc(Cl)ccc12
<BB_424>
What is the molecular formula for <BB_424>?
The molecular formula for <BB_424> (Cc1c[nH]c2cc(Cl)ccc12) is C9H8ClN.
Describe the ring structures in building block <BB_424>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_424>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_424>.
**Token:** <BB_424> **SMILES:** Cc1c[nH]c2cc(Cl)ccc12 **Molecular Formula:** C9H8ClN **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_425>.
CCOc1ccc(Br)cc1CC(=O)O
What is the building block token for the following molecule?
CCOc1ccc(Br)cc1CC(=O)O
<BB_425>
What is the molecular formula for <BB_425>?
The molecular formula for <BB_425> (CCOc1ccc(Br)cc1CC(=O)O) is C10H11BrO3.
Describe the ring structures in building block <BB_425>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_425>.
The molecule contains the following groups: Carboxylic Acid, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_425>.
**Token:** <BB_425> **SMILES:** CCOc1ccc(Br)cc1CC(=O)O **Molecular Formula:** C10H11BrO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_426>.
CC1(C)CCNc2ccc(Cl)cc21
What is the building block token for the following molecule?
CC1(C)CCNc2ccc(Cl)cc21
<BB_426>
What is the molecular formula for <BB_426>?
The molecular formula for <BB_426> (CC1(C)CCNc2ccc(Cl)cc21) is C11H14ClN.
Describe the ring structures in building block <BB_426>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_426>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_426>.
**Token:** <BB_426> **SMILES:** CC1(C)CCNc2ccc(Cl)cc21 **Molecular Formula:** C11H14ClN **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_427>.
CC(C)(C)OC(=O)N1CCC1c1csc(N)n1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CCC1c1csc(N)n1
<BB_427>
What is the molecular formula for <BB_427>?
The molecular formula for <BB_427> (CC(C)(C)OC(=O)N1CCC1c1csc(N)n1) is C11H17N3O2S.
Describe the ring structures in building block <BB_427>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aromatic ring of size 5.
List the primary functional groups present in <BB_427>.
The molecule contains the following groups: Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_427>.
**Token:** <BB_427> **SMILES:** CC(C)(C)OC(=O)N1CCC1c1csc(N)n1 **Molecular Formula:** C11H17N3O2S **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aromatic ring of size 5. **Functional Groups:** Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_428>.
CSC1(CO)CC1(C)C
What is the building block token for the following molecule?
CSC1(CO)CC1(C)C
<BB_428>
What is the molecular formula for <BB_428>?
The molecular formula for <BB_428> (CSC1(CO)CC1(C)C) is C7H14OS.
Describe the ring structures in building block <BB_428>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_428>.
The molecule contains the following groups: Alcohol, Sulfide.
Provide a comprehensive chemical profile for the building block <BB_428>.
**Token:** <BB_428> **SMILES:** CSC1(CO)CC1(C)C **Molecular Formula:** C7H14OS **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Alcohol, Sulfide
Provide the SMILES representation for the building block token <BB_429>.
CCCn1c(S)nnc1Cc1ccccc1
What is the building block token for the following molecule?
CCCn1c(S)nnc1Cc1ccccc1
<BB_429>
What is the molecular formula for <BB_429>?
The molecular formula for <BB_429> (CCCn1c(S)nnc1Cc1ccccc1) is C12H15N3S.
Describe the ring structures in building block <BB_429>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_429>.
The molecule contains the following groups: Thiol.
Provide a comprehensive chemical profile for the building block <BB_429>.
**Token:** <BB_429> **SMILES:** CCCn1c(S)nnc1Cc1ccccc1 **Molecular Formula:** C12H15N3S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Thiol
Provide the SMILES representation for the building block token <BB_430>.
CC(C)Oc1ccc(N)cn1
What is the building block token for the following molecule?
CC(C)Oc1ccc(N)cn1
<BB_430>
What is the molecular formula for <BB_430>?
The molecular formula for <BB_430> (CC(C)Oc1ccc(N)cn1) is C8H12N2O.
Describe the ring structures in building block <BB_430>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_430>.
The molecule contains the following groups: Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_430>.
**Token:** <BB_430> **SMILES:** CC(C)Oc1ccc(N)cn1 **Molecular Formula:** C8H12N2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ether
Provide the SMILES representation for the building block token <BB_431>.
[N-]=[N+]=Nc1cc(Br)ccc1C=O
What is the building block token for the following molecule?
[N-]=[N+]=Nc1cc(Br)ccc1C=O
<BB_431>
What is the molecular formula for <BB_431>?
The molecular formula for <BB_431> ([N-]=[N+]=Nc1cc(Br)ccc1C=O) is C7H4BrN3O.
Describe the ring structures in building block <BB_431>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_431>.
The molecule contains the following groups: Aldehyde, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_431>.
**Token:** <BB_431> **SMILES:** [N-]=[N+]=Nc1cc(Br)ccc1C=O **Molecular Formula:** C7H4BrN3O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Aldehyde, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_432>.
COC(=O)[C@@H]1C[C@H](N)[C@H]2C[C@H]21.Cl
What is the building block token for the following molecule?
COC(=O)[C@@H]1C[C@H](N)[C@H]2C[C@H]21.Cl
<BB_432>
What is the molecular formula for <BB_432>?
The molecular formula for <BB_432> (COC(=O)[C@@H]1C[C@H](N)[C@H]2C[C@H]21.Cl) is C8H14ClNO2.
Describe the ring structures in building block <BB_432>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 3.
List the primary functional groups present in <BB_432>.
The molecule contains the following groups: Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_432>.
**Token:** <BB_432> **SMILES:** COC(=O)[C@@H]1C[C@H](N)[C@H]2C[C@H]21.Cl **Molecular Formula:** C8H14ClNO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 3. **Functional Groups:** Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_433>.
Nc1cccc(F)c1-c1nc[nH]n1
What is the building block token for the following molecule?
Nc1cccc(F)c1-c1nc[nH]n1
<BB_433>