instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_433>?
The molecular formula for <BB_433> (Nc1cccc(F)c1-c1nc[nH]n1) is C8H7FN4.
Describe the ring structures in building block <BB_433>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_433>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_433>.
**Token:** <BB_433> **SMILES:** Nc1cccc(F)c1-c1nc[nH]n1 **Molecular Formula:** C8H7FN4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_434>.
COCCOCc1cccc(B(O)O)c1
What is the building block token for the following molecule?
COCCOCc1cccc(B(O)O)c1
<BB_434>
What is the molecular formula for <BB_434>?
The molecular formula for <BB_434> (COCCOCc1cccc(B(O)O)c1) is C10H15BO4.
Describe the ring structures in building block <BB_434>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_434>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_434>.
**Token:** <BB_434> **SMILES:** COCCOCc1cccc(B(O)O)c1 **Molecular Formula:** C10H15BO4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_435>.
Ic1ccc(OCc2ccccn2)cc1
What is the building block token for the following molecule?
Ic1ccc(OCc2ccccn2)cc1
<BB_435>
What is the molecular formula for <BB_435>?
The molecular formula for <BB_435> (Ic1ccc(OCc2ccccn2)cc1) is C12H10INO.
Describe the ring structures in building block <BB_435>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_435>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_435>.
**Token:** <BB_435> **SMILES:** Ic1ccc(OCc2ccccn2)cc1 **Molecular Formula:** C12H10INO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_436>.
CN1CC(CN)OC1=O.Cl
What is the building block token for the following molecule?
CN1CC(CN)OC1=O.Cl
<BB_436>
What is the molecular formula for <BB_436>?
The molecular formula for <BB_436> (CN1CC(CN)OC1=O.Cl) is C5H11ClN2O2.
Describe the ring structures in building block <BB_436>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_436>.
The molecule contains the following groups: Amine, Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_436>.
**Token:** <BB_436> **SMILES:** CN1CC(CN)OC1=O.Cl **Molecular Formula:** C5H11ClN2O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amine, Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_437>.
O=C(O)c1cnsc1Br
What is the building block token for the following molecule?
O=C(O)c1cnsc1Br
<BB_437>
What is the molecular formula for <BB_437>?
The molecular formula for <BB_437> (O=C(O)c1cnsc1Br) is C4H2BrNO2S.
Describe the ring structures in building block <BB_437>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_437>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_437>.
**Token:** <BB_437> **SMILES:** O=C(O)c1cnsc1Br **Molecular Formula:** C4H2BrNO2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_438>.
O=C(O)CSc1nncn1C1CC1
What is the building block token for the following molecule?
O=C(O)CSc1nncn1C1CC1
<BB_438>
What is the molecular formula for <BB_438>?
The molecular formula for <BB_438> (O=C(O)CSc1nncn1C1CC1) is C7H9N3O2S.
Describe the ring structures in building block <BB_438>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3.
List the primary functional groups present in <BB_438>.
The molecule contains the following groups: Carboxylic Acid, Sulfide.
Provide a comprehensive chemical profile for the building block <BB_438>.
**Token:** <BB_438> **SMILES:** O=C(O)CSc1nncn1C1CC1 **Molecular Formula:** C7H9N3O2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3. **Functional Groups:** Carboxylic Acid, Sulfide
Provide the SMILES representation for the building block token <BB_439>.
O=C(O)Cn1ccc2cc(Br)ccc2c1=O
What is the building block token for the following molecule?
O=C(O)Cn1ccc2cc(Br)ccc2c1=O
<BB_439>
What is the molecular formula for <BB_439>?
The molecular formula for <BB_439> (O=C(O)Cn1ccc2cc(Br)ccc2c1=O) is C11H8BrNO3.
Describe the ring structures in building block <BB_439>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_439>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_439>.
**Token:** <BB_439> **SMILES:** O=C(O)Cn1ccc2cc(Br)ccc2c1=O **Molecular Formula:** C11H8BrNO3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_440>.
CN(Cc1ccccc1)C1CNC1.Cl.Cl
What is the building block token for the following molecule?
CN(Cc1ccccc1)C1CNC1.Cl.Cl
<BB_440>
What is the molecular formula for <BB_440>?
The molecular formula for <BB_440> (CN(Cc1ccccc1)C1CNC1.Cl.Cl) is C11H18Cl2N2.
Describe the ring structures in building block <BB_440>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 4.
List the primary functional groups present in <BB_440>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_440>.
**Token:** <BB_440> **SMILES:** CN(Cc1ccccc1)C1CNC1.Cl.Cl **Molecular Formula:** C11H18Cl2N2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 4. **Functional Groups:** Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_441>.
O=C(c1ccccc1)c1ccccc1S(=O)(=O)Cl
What is the building block token for the following molecule?
O=C(c1ccccc1)c1ccccc1S(=O)(=O)Cl
<BB_441>
What is the molecular formula for <BB_441>?
The molecular formula for <BB_441> (O=C(c1ccccc1)c1ccccc1S(=O)(=O)Cl) is C13H9ClO3S.
Describe the ring structures in building block <BB_441>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_441>.
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_441>.
**Token:** <BB_441> **SMILES:** O=C(c1ccccc1)c1ccccc1S(=O)(=O)Cl **Molecular Formula:** C13H9ClO3S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_442>.
N#CC(O)c1ccc([N+](=O)[O-])cc1
What is the building block token for the following molecule?
N#CC(O)c1ccc([N+](=O)[O-])cc1
<BB_442>
What is the molecular formula for <BB_442>?
The molecular formula for <BB_442> (N#CC(O)c1ccc([N+](=O)[O-])cc1) is C8H6N2O3.
Describe the ring structures in building block <BB_442>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_442>.
The molecule contains the following groups: Tertiary Amine, Alcohol, Nitrile, Nitro.
Provide a comprehensive chemical profile for the building block <BB_442>.
**Token:** <BB_442> **SMILES:** N#CC(O)c1ccc([N+](=O)[O-])cc1 **Molecular Formula:** C8H6N2O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Alcohol, Nitrile, Nitro
Provide the SMILES representation for the building block token <BB_443>.
N#CN1CCC(=O)CC1
What is the building block token for the following molecule?
N#CN1CCC(=O)CC1
<BB_443>
What is the molecular formula for <BB_443>?
The molecular formula for <BB_443> (N#CN1CCC(=O)CC1) is C6H8N2O.
Describe the ring structures in building block <BB_443>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_443>.
The molecule contains the following groups: Tertiary Amine, Ketone, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_443>.
**Token:** <BB_443> **SMILES:** N#CN1CCC(=O)CC1 **Molecular Formula:** C6H8N2O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Tertiary Amine, Ketone, Nitrile
Provide the SMILES representation for the building block token <BB_444>.
NS(=O)(=O)c1ccnc(C(F)(F)F)c1
What is the building block token for the following molecule?
NS(=O)(=O)c1ccnc(C(F)(F)F)c1
<BB_444>
What is the molecular formula for <BB_444>?
The molecular formula for <BB_444> (NS(=O)(=O)c1ccnc(C(F)(F)F)c1) is C6H5F3N2O2S.
Describe the ring structures in building block <BB_444>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_444>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I), Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_444>.
**Token:** <BB_444> **SMILES:** NS(=O)(=O)c1ccnc(C(F)(F)F)c1 **Molecular Formula:** C6H5F3N2O2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I), Sulfonamide
Provide the SMILES representation for the building block token <BB_445>.
Clc1nc(C2CC2)nc2sc3c(c12)CCCC3
What is the building block token for the following molecule?
Clc1nc(C2CC2)nc2sc3c(c12)CCCC3
<BB_445>
What is the molecular formula for <BB_445>?
The molecular formula for <BB_445> (Clc1nc(C2CC2)nc2sc3c(c12)CCCC3) is C13H13ClN2S.
Describe the ring structures in building block <BB_445>.
The molecule contains 4 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3, an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_445>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_445>.
**Token:** <BB_445> **SMILES:** Clc1nc(C2CC2)nc2sc3c(c12)CCCC3 **Molecular Formula:** C13H13ClN2S **Ring System:** The molecule contains 4 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3, an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_446>.
CC1CC(C=O)=CN(C(=O)OC(C)(C)C)C1
What is the building block token for the following molecule?
CC1CC(C=O)=CN(C(=O)OC(C)(C)C)C1
<BB_446>
What is the molecular formula for <BB_446>?
The molecular formula for <BB_446> (CC1CC(C=O)=CN(C(=O)OC(C)(C)C)C1) is C12H19NO3.
Describe the ring structures in building block <BB_446>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_446>.
The molecule contains the following groups: Amide, Aldehyde, Ether.
Provide a comprehensive chemical profile for the building block <BB_446>.
**Token:** <BB_446> **SMILES:** CC1CC(C=O)=CN(C(=O)OC(C)(C)C)C1 **Molecular Formula:** C12H19NO3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amide, Aldehyde, Ether
Provide the SMILES representation for the building block token <BB_447>.
CC(=O)Nc1cccc(OCCN)c1.Cl
What is the building block token for the following molecule?
CC(=O)Nc1cccc(OCCN)c1.Cl
<BB_447>
What is the molecular formula for <BB_447>?
The molecular formula for <BB_447> (CC(=O)Nc1cccc(OCCN)c1.Cl) is C10H15ClN2O2.
Describe the ring structures in building block <BB_447>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_447>.
The molecule contains the following groups: Amine, Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_447>.
**Token:** <BB_447> **SMILES:** CC(=O)Nc1cccc(OCCN)c1.Cl **Molecular Formula:** C10H15ClN2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_448>.
CCCCCCC1CCCNC1.Cl
What is the building block token for the following molecule?
CCCCCCC1CCCNC1.Cl
<BB_448>
What is the molecular formula for <BB_448>?
The molecular formula for <BB_448> (CCCCCCC1CCCNC1.Cl) is C11H24ClN.
Describe the ring structures in building block <BB_448>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_448>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_448>.
**Token:** <BB_448> **SMILES:** CCCCCCC1CCCNC1.Cl **Molecular Formula:** C11H24ClN **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_449>.
CC(C)CCCC(C)NC(=O)CCl
What is the building block token for the following molecule?
CC(C)CCCC(C)NC(=O)CCl
<BB_449>
What is the molecular formula for <BB_449>?
The molecular formula for <BB_449> (CC(C)CCCC(C)NC(=O)CCl) is C10H20ClNO.
Describe the ring structures in building block <BB_449>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_449>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_449>.
**Token:** <BB_449> **SMILES:** CC(C)CCCC(C)NC(=O)CCl **Molecular Formula:** C10H20ClNO **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amide, Halogen (F,Cl,Br,I)