instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_450>.
Cc1nc2ccccc2n1C(F)F
What is the building block token for the following molecule?
Cc1nc2ccccc2n1C(F)F
<BB_450>
What is the molecular formula for <BB_450>?
The molecular formula for <BB_450> (Cc1nc2ccccc2n1C(F)F) is C9H8F2N2.
Describe the ring structures in building block <BB_450>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_450>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_450>.
**Token:** <BB_450> **SMILES:** Cc1nc2ccccc2n1C(F)F **Molecular Formula:** C9H8F2N2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_451>.
O=C(NC1CCCC1C(=O)O)c1nnn[nH]1
What is the building block token for the following molecule?
O=C(NC1CCCC1C(=O)O)c1nnn[nH]1
<BB_451>
What is the molecular formula for <BB_451>?
The molecular formula for <BB_451> (O=C(NC1CCCC1C(=O)O)c1nnn[nH]1) is C8H11N5O3.
Describe the ring structures in building block <BB_451>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 5.
List the primary functional groups present in <BB_451>.
The molecule contains the following groups: Carboxylic Acid, Amide.
Provide a comprehensive chemical profile for the building block <BB_451>.
**Token:** <BB_451> **SMILES:** O=C(NC1CCCC1C(=O)O)c1nnn[nH]1 **Molecular Formula:** C8H11N5O3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Amide
Provide the SMILES representation for the building block token <BB_452>.
C#CCN1CCOC[C@H]1C
What is the building block token for the following molecule?
C#CCN1CCOC[C@H]1C
<BB_452>
What is the molecular formula for <BB_452>?
The molecular formula for <BB_452> (C#CCN1CCOC[C@H]1C) is C8H13NO.
Describe the ring structures in building block <BB_452>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_452>.
The molecule contains the following groups: Tertiary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_452>.
**Token:** <BB_452> **SMILES:** C#CCN1CCOC[C@H]1C **Molecular Formula:** C8H13NO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Tertiary Amine, Ether
Provide the SMILES representation for the building block token <BB_453>.
O[C@@H]1COC[C@H]1c1ccc(Br)cc1
What is the building block token for the following molecule?
O[C@@H]1COC[C@H]1c1ccc(Br)cc1
<BB_453>
What is the molecular formula for <BB_453>?
The molecular formula for <BB_453> (O[C@@H]1COC[C@H]1c1ccc(Br)cc1) is C10H11BrO2.
Describe the ring structures in building block <BB_453>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_453>.
The molecule contains the following groups: Alcohol, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_453>.
**Token:** <BB_453> **SMILES:** O[C@@H]1COC[C@H]1c1ccc(Br)cc1 **Molecular Formula:** C10H11BrO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Alcohol, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_454>.
CC(Cl)CCC#N
What is the building block token for the following molecule?
CC(Cl)CCC#N
<BB_454>
What is the molecular formula for <BB_454>?
The molecular formula for <BB_454> (CC(Cl)CCC#N) is C5H8ClN.
Describe the ring structures in building block <BB_454>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_454>.
The molecule contains the following groups: Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_454>.
**Token:** <BB_454> **SMILES:** CC(Cl)CCC#N **Molecular Formula:** C5H8ClN **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_455>.
O=C1CCC(=O)c2ccccc2N1
What is the building block token for the following molecule?
O=C1CCC(=O)c2ccccc2N1
<BB_455>
What is the molecular formula for <BB_455>?
The molecular formula for <BB_455> (O=C1CCC(=O)c2ccccc2N1) is C10H9NO2.
Describe the ring structures in building block <BB_455>.
The molecule contains 2 ring(s): an aliphatic ring of size 7, an aromatic ring of size 6.
List the primary functional groups present in <BB_455>.
The molecule contains the following groups: Amide, Ketone.
Provide a comprehensive chemical profile for the building block <BB_455>.
**Token:** <BB_455> **SMILES:** O=C1CCC(=O)c2ccccc2N1 **Molecular Formula:** C10H9NO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 7, an aromatic ring of size 6. **Functional Groups:** Amide, Ketone
Provide the SMILES representation for the building block token <BB_456>.
COc1ccc(Cl)cc1CCl
What is the building block token for the following molecule?
COc1ccc(Cl)cc1CCl
<BB_456>
What is the molecular formula for <BB_456>?
The molecular formula for <BB_456> (COc1ccc(Cl)cc1CCl) is C8H8Cl2O.
Describe the ring structures in building block <BB_456>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_456>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_456>.
**Token:** <BB_456> **SMILES:** COc1ccc(Cl)cc1CCl **Molecular Formula:** C8H8Cl2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_457>.
CC[C@H](C)[C@@H](NC(=O)OCc1ccccc1)C(=O)O
What is the building block token for the following molecule?
CC[C@H](C)[C@@H](NC(=O)OCc1ccccc1)C(=O)O
<BB_457>
What is the molecular formula for <BB_457>?
The molecular formula for <BB_457> (CC[C@H](C)[C@@H](NC(=O)OCc1ccccc1)C(=O)O) is C14H19NO4.
Describe the ring structures in building block <BB_457>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_457>.
The molecule contains the following groups: Carboxylic Acid, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_457>.
**Token:** <BB_457> **SMILES:** CC[C@H](C)[C@@H](NC(=O)OCc1ccccc1)C(=O)O **Molecular Formula:** C14H19NO4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amide, Ether
Provide the SMILES representation for the building block token <BB_458>.
C[C@@H](N)c1cncs1.Cl.Cl
What is the building block token for the following molecule?
C[C@@H](N)c1cncs1.Cl.Cl
<BB_458>
What is the molecular formula for <BB_458>?
The molecular formula for <BB_458> (C[C@@H](N)c1cncs1.Cl.Cl) is C5H10Cl2N2S.
Describe the ring structures in building block <BB_458>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_458>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_458>.
**Token:** <BB_458> **SMILES:** C[C@@H](N)c1cncs1.Cl.Cl **Molecular Formula:** C5H10Cl2N2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_459>.
Cc1ccc(NCC(F)F)cc1
What is the building block token for the following molecule?
Cc1ccc(NCC(F)F)cc1
<BB_459>
What is the molecular formula for <BB_459>?
The molecular formula for <BB_459> (Cc1ccc(NCC(F)F)cc1) is C9H11F2N.
Describe the ring structures in building block <BB_459>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_459>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_459>.
**Token:** <BB_459> **SMILES:** Cc1ccc(NCC(F)F)cc1 **Molecular Formula:** C9H11F2N **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_460>.
COc1ccccc1-c1noc(CCl)n1
What is the building block token for the following molecule?
COc1ccccc1-c1noc(CCl)n1
<BB_460>
What is the molecular formula for <BB_460>?
The molecular formula for <BB_460> (COc1ccccc1-c1noc(CCl)n1) is C10H9ClN2O2.
Describe the ring structures in building block <BB_460>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_460>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_460>.
**Token:** <BB_460> **SMILES:** COc1ccccc1-c1noc(CCl)n1 **Molecular Formula:** C10H9ClN2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_461>.
Cl.N[C@H](CCc1ccccc1)CC(=O)O
What is the building block token for the following molecule?
Cl.N[C@H](CCc1ccccc1)CC(=O)O
<BB_461>
What is the molecular formula for <BB_461>?
The molecular formula for <BB_461> (Cl.N[C@H](CCc1ccccc1)CC(=O)O) is C11H16ClNO2.
Describe the ring structures in building block <BB_461>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_461>.
The molecule contains the following groups: Carboxylic Acid, Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_461>.
**Token:** <BB_461> **SMILES:** Cl.N[C@H](CCc1ccccc1)CC(=O)O **Molecular Formula:** C11H16ClNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_462>.
NNC(=O)c1cnc[nH]1
What is the building block token for the following molecule?
NNC(=O)c1cnc[nH]1
<BB_462>
What is the molecular formula for <BB_462>?
The molecular formula for <BB_462> (NNC(=O)c1cnc[nH]1) is C4H6N4O.
Describe the ring structures in building block <BB_462>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_462>.
The molecule contains the following groups: Amine, Amide.
Provide a comprehensive chemical profile for the building block <BB_462>.
**Token:** <BB_462> **SMILES:** NNC(=O)c1cnc[nH]1 **Molecular Formula:** C4H6N4O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Amide
Provide the SMILES representation for the building block token <BB_463>.
Cl.N[C@H]1C[C@H](c2ccon2)C1
What is the building block token for the following molecule?
Cl.N[C@H]1C[C@H](c2ccon2)C1
<BB_463>
What is the molecular formula for <BB_463>?
The molecular formula for <BB_463> (Cl.N[C@H]1C[C@H](c2ccon2)C1) is C7H11ClN2O.
Describe the ring structures in building block <BB_463>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aromatic ring of size 5.
List the primary functional groups present in <BB_463>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_463>.
**Token:** <BB_463> **SMILES:** Cl.N[C@H]1C[C@H](c2ccon2)C1 **Molecular Formula:** C7H11ClN2O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aromatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_464>.
C=Cc1ccc(C(=O)OC)nc1
What is the building block token for the following molecule?
C=Cc1ccc(C(=O)OC)nc1
<BB_464>
What is the molecular formula for <BB_464>?
The molecular formula for <BB_464> (C=Cc1ccc(C(=O)OC)nc1) is C9H9NO2.
Describe the ring structures in building block <BB_464>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_464>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_464>.
**Token:** <BB_464> **SMILES:** C=Cc1ccc(C(=O)OC)nc1 **Molecular Formula:** C9H9NO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_465>.
COC(=O)C(CO)c1ccccc1
What is the building block token for the following molecule?
COC(=O)C(CO)c1ccccc1
<BB_465>
What is the molecular formula for <BB_465>?
The molecular formula for <BB_465> (COC(=O)C(CO)c1ccccc1) is C10H12O3.
Describe the ring structures in building block <BB_465>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_465>.
The molecule contains the following groups: Ester, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_465>.
**Token:** <BB_465> **SMILES:** COC(=O)C(CO)c1ccccc1 **Molecular Formula:** C10H12O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_466>.
Cn1ncc(C#N)c1F
What is the building block token for the following molecule?
Cn1ncc(C#N)c1F
<BB_466>
What is the molecular formula for <BB_466>?
The molecular formula for <BB_466> (Cn1ncc(C#N)c1F) is C5H4FN3.
Describe the ring structures in building block <BB_466>.
The molecule contains 1 ring(s): an aromatic ring of size 5.