instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_466>.
The molecule contains the following groups: Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_466>.
**Token:** <BB_466> **SMILES:** Cn1ncc(C#N)c1F **Molecular Formula:** C5H4FN3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_467>.
C[C@H](N)c1cccc(Cl)c1Cl.Cl
What is the building block token for the following molecule?
C[C@H](N)c1cccc(Cl)c1Cl.Cl
<BB_467>
What is the molecular formula for <BB_467>?
The molecular formula for <BB_467> (C[C@H](N)c1cccc(Cl)c1Cl.Cl) is C8H10Cl3N.
Describe the ring structures in building block <BB_467>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_467>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_467>.
**Token:** <BB_467> **SMILES:** C[C@H](N)c1cccc(Cl)c1Cl.Cl **Molecular Formula:** C8H10Cl3N **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_468>.
Cl.O=C(C1CCOCC1)N1CCNCC1
What is the building block token for the following molecule?
Cl.O=C(C1CCOCC1)N1CCNCC1
<BB_468>
What is the molecular formula for <BB_468>?
The molecular formula for <BB_468> (Cl.O=C(C1CCOCC1)N1CCNCC1) is C10H19ClN2O2.
Describe the ring structures in building block <BB_468>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_468>.
The molecule contains the following groups: Secondary Amine, Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_468>.
**Token:** <BB_468> **SMILES:** Cl.O=C(C1CCOCC1)N1CCNCC1 **Molecular Formula:** C10H19ClN2O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_469>.
OCc1csc(C2OCCO2)n1
What is the building block token for the following molecule?
OCc1csc(C2OCCO2)n1
<BB_469>
What is the molecular formula for <BB_469>?
The molecular formula for <BB_469> (OCc1csc(C2OCCO2)n1) is C7H9NO3S.
Describe the ring structures in building block <BB_469>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_469>.
The molecule contains the following groups: Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_469>.
**Token:** <BB_469> **SMILES:** OCc1csc(C2OCCO2)n1 **Molecular Formula:** C7H9NO3S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Alcohol, Ether
Provide the SMILES representation for the building block token <BB_470>.
c1cnoc1
What is the building block token for the following molecule?
c1cnoc1
<BB_470>
What is the molecular formula for <BB_470>?
The molecular formula for <BB_470> (c1cnoc1) is C3H3NO.
Describe the ring structures in building block <BB_470>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_470>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_470>.
**Token:** <BB_470> **SMILES:** c1cnoc1 **Molecular Formula:** C3H3NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_471>.
O=C(NCC(F)(F)F)c1ccccc1
What is the building block token for the following molecule?
O=C(NCC(F)(F)F)c1ccccc1
<BB_471>
What is the molecular formula for <BB_471>?
The molecular formula for <BB_471> (O=C(NCC(F)(F)F)c1ccccc1) is C9H8F3NO.
Describe the ring structures in building block <BB_471>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_471>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_471>.
**Token:** <BB_471> **SMILES:** O=C(NCC(F)(F)F)c1ccccc1 **Molecular Formula:** C9H8F3NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_472>.
Nc1n[nH]c2cc(Br)ccc12
What is the building block token for the following molecule?
Nc1n[nH]c2cc(Br)ccc12
<BB_472>
What is the molecular formula for <BB_472>?
The molecular formula for <BB_472> (Nc1n[nH]c2cc(Br)ccc12) is C7H6BrN3.
Describe the ring structures in building block <BB_472>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_472>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_472>.
**Token:** <BB_472> **SMILES:** Nc1n[nH]c2cc(Br)ccc12 **Molecular Formula:** C7H6BrN3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_473>.
Cc1nn(C2CCCCO2)c(C)c1Br
What is the building block token for the following molecule?
Cc1nn(C2CCCCO2)c(C)c1Br
<BB_473>
What is the molecular formula for <BB_473>?
The molecular formula for <BB_473> (Cc1nn(C2CCCCO2)c(C)c1Br) is C10H15BrN2O.
Describe the ring structures in building block <BB_473>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_473>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_473>.
**Token:** <BB_473> **SMILES:** Cc1nn(C2CCCCO2)c(C)c1Br **Molecular Formula:** C10H15BrN2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_474>.
Cc1ccc(N)nc1C(=O)O
What is the building block token for the following molecule?
Cc1ccc(N)nc1C(=O)O
<BB_474>
What is the molecular formula for <BB_474>?
The molecular formula for <BB_474> (Cc1ccc(N)nc1C(=O)O) is C7H8N2O2.
Describe the ring structures in building block <BB_474>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_474>.
The molecule contains the following groups: Carboxylic Acid, Amine.
Provide a comprehensive chemical profile for the building block <BB_474>.
**Token:** <BB_474> **SMILES:** Cc1ccc(N)nc1C(=O)O **Molecular Formula:** C7H8N2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amine
Provide the SMILES representation for the building block token <BB_475>.
O=CCCc1ccccn1
What is the building block token for the following molecule?
O=CCCc1ccccn1
<BB_475>
What is the molecular formula for <BB_475>?
The molecular formula for <BB_475> (O=CCCc1ccccn1) is C8H9NO.
Describe the ring structures in building block <BB_475>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_475>.
The molecule contains the following groups: Aldehyde.
Provide a comprehensive chemical profile for the building block <BB_475>.
**Token:** <BB_475> **SMILES:** O=CCCc1ccccn1 **Molecular Formula:** C8H9NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Aldehyde
Provide the SMILES representation for the building block token <BB_476>.
C#CC1CCC2(CCC2)C1
What is the building block token for the following molecule?
C#CC1CCC2(CCC2)C1
<BB_476>
What is the molecular formula for <BB_476>?
The molecular formula for <BB_476> (C#CC1CCC2(CCC2)C1) is C10H14.
Describe the ring structures in building block <BB_476>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 4.
List the primary functional groups present in <BB_476>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_476>.
**Token:** <BB_476> **SMILES:** C#CC1CCC2(CCC2)C1 **Molecular Formula:** C10H14 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 4. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_477>.
O=C(N[C@@H]1C[C@@H]2C[C@@H]2C1)c1ccccc1
What is the building block token for the following molecule?
O=C(N[C@@H]1C[C@@H]2C[C@@H]2C1)c1ccccc1
<BB_477>
What is the molecular formula for <BB_477>?
The molecular formula for <BB_477> (O=C(N[C@@H]1C[C@@H]2C[C@@H]2C1)c1ccccc1) is C13H15NO.
Describe the ring structures in building block <BB_477>.
The molecule contains 3 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 3, an aromatic ring of size 6.
List the primary functional groups present in <BB_477>.
The molecule contains the following groups: Amide.
Provide a comprehensive chemical profile for the building block <BB_477>.
**Token:** <BB_477> **SMILES:** O=C(N[C@@H]1C[C@@H]2C[C@@H]2C1)c1ccccc1 **Molecular Formula:** C13H15NO **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 3, an aromatic ring of size 6. **Functional Groups:** Amide
Provide the SMILES representation for the building block token <BB_478>.
CCOC(=O)[C@]1(C)C[C@H]1C(=O)O
What is the building block token for the following molecule?
CCOC(=O)[C@]1(C)C[C@H]1C(=O)O
<BB_478>
What is the molecular formula for <BB_478>?
The molecular formula for <BB_478> (CCOC(=O)[C@]1(C)C[C@H]1C(=O)O) is C8H12O4.
Describe the ring structures in building block <BB_478>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_478>.
The molecule contains the following groups: Carboxylic Acid, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_478>.
**Token:** <BB_478> **SMILES:** CCOC(=O)[C@]1(C)C[C@H]1C(=O)O **Molecular Formula:** C8H12O4 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Carboxylic Acid, Ester, Ether
Provide the SMILES representation for the building block token <BB_479>.
Cc1ccc(O)nc1Cl
What is the building block token for the following molecule?
Cc1ccc(O)nc1Cl
<BB_479>
What is the molecular formula for <BB_479>?
The molecular formula for <BB_479> (Cc1ccc(O)nc1Cl) is C6H6ClNO.
Describe the ring structures in building block <BB_479>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_479>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_479>.
**Token:** <BB_479> **SMILES:** Cc1ccc(O)nc1Cl **Molecular Formula:** C6H6ClNO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_480>.
Clc1cc2c(nn1)-c1ccccc1CCC2
What is the building block token for the following molecule?
Clc1cc2c(nn1)-c1ccccc1CCC2
<BB_480>
What is the molecular formula for <BB_480>?
The molecular formula for <BB_480> (Clc1cc2c(nn1)-c1ccccc1CCC2) is C13H11ClN2.
Describe the ring structures in building block <BB_480>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 6, an aliphatic ring of size 7.
List the primary functional groups present in <BB_480>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_480>.
**Token:** <BB_480> **SMILES:** Clc1cc2c(nn1)-c1ccccc1CCC2 **Molecular Formula:** C13H11ClN2 **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 6, an aliphatic ring of size 7. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_481>.
Cc1cc(I)cc(C(=O)O)c1
What is the building block token for the following molecule?
Cc1cc(I)cc(C(=O)O)c1
<BB_481>
What is the molecular formula for <BB_481>?
The molecular formula for <BB_481> (Cc1cc(I)cc(C(=O)O)c1) is C8H7IO2.
Describe the ring structures in building block <BB_481>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_481>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_481>.
**Token:** <BB_481> **SMILES:** Cc1cc(I)cc(C(=O)O)c1 **Molecular Formula:** C8H7IO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_482>.
O=C1CCc2cc(O)ccc2O1
What is the building block token for the following molecule?
O=C1CCc2cc(O)ccc2O1
<BB_482>
What is the molecular formula for <BB_482>?
The molecular formula for <BB_482> (O=C1CCc2cc(O)ccc2O1) is C9H8O3.
Describe the ring structures in building block <BB_482>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_482>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_482>.
**Token:** <BB_482> **SMILES:** O=C1CCc2cc(O)ccc2O1 **Molecular Formula:** C9H8O3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_483>.
Cc1ncn(C)c1C(=O)[O-].[K+]
What is the building block token for the following molecule?
Cc1ncn(C)c1C(=O)[O-].[K+]
<BB_483>