instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_483>?
The molecular formula for <BB_483> (Cc1ncn(C)c1C(=O)[O-].[K+]) is C6H7KN2O2.
Describe the ring structures in building block <BB_483>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_483>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_483>.
**Token:** <BB_483> **SMILES:** Cc1ncn(C)c1C(=O)[O-].[K+] **Molecular Formula:** C6H7KN2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_484>.
CCOC(=O)Cc1ccc(O)c(C)c1
What is the building block token for the following molecule?
CCOC(=O)Cc1ccc(O)c(C)c1
<BB_484>
What is the molecular formula for <BB_484>?
The molecular formula for <BB_484> (CCOC(=O)Cc1ccc(O)c(C)c1) is C11H14O3.
Describe the ring structures in building block <BB_484>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_484>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_484>.
**Token:** <BB_484> **SMILES:** CCOC(=O)Cc1ccc(O)c(C)c1 **Molecular Formula:** C11H14O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_485>.
O=C(O)CC1(C(F)(F)F)CNC(=O)C1
What is the building block token for the following molecule?
O=C(O)CC1(C(F)(F)F)CNC(=O)C1
<BB_485>
What is the molecular formula for <BB_485>?
The molecular formula for <BB_485> (O=C(O)CC1(C(F)(F)F)CNC(=O)C1) is C7H8F3NO3.
Describe the ring structures in building block <BB_485>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_485>.
The molecule contains the following groups: Carboxylic Acid, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_485>.
**Token:** <BB_485> **SMILES:** O=C(O)CC1(C(F)(F)F)CNC(=O)C1 **Molecular Formula:** C7H8F3NO3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_486>.
C#CCCN1CCCC2(C1)OCCO2
What is the building block token for the following molecule?
C#CCCN1CCCC2(C1)OCCO2
<BB_486>
What is the molecular formula for <BB_486>?
The molecular formula for <BB_486> (C#CCCN1CCCC2(C1)OCCO2) is C11H17NO2.
Describe the ring structures in building block <BB_486>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_486>.
The molecule contains the following groups: Tertiary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_486>.
**Token:** <BB_486> **SMILES:** C#CCCN1CCCC2(C1)OCCO2 **Molecular Formula:** C11H17NO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Tertiary Amine, Ether
Provide the SMILES representation for the building block token <BB_487>.
CC(C)Oc1nccc(CN)n1
What is the building block token for the following molecule?
CC(C)Oc1nccc(CN)n1
<BB_487>
What is the molecular formula for <BB_487>?
The molecular formula for <BB_487> (CC(C)Oc1nccc(CN)n1) is C8H13N3O.
Describe the ring structures in building block <BB_487>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_487>.
The molecule contains the following groups: Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_487>.
**Token:** <BB_487> **SMILES:** CC(C)Oc1nccc(CN)n1 **Molecular Formula:** C8H13N3O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ether
Provide the SMILES representation for the building block token <BB_488>.
COc1cnc(CO)c(C)c1
What is the building block token for the following molecule?
COc1cnc(CO)c(C)c1
<BB_488>
What is the molecular formula for <BB_488>?
The molecular formula for <BB_488> (COc1cnc(CO)c(C)c1) is C8H11NO2.
Describe the ring structures in building block <BB_488>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_488>.
The molecule contains the following groups: Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_488>.
**Token:** <BB_488> **SMILES:** COc1cnc(CO)c(C)c1 **Molecular Formula:** C8H11NO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Alcohol, Ether
Provide the SMILES representation for the building block token <BB_489>.
Cc1cc(I)ccc1N
What is the building block token for the following molecule?
Cc1cc(I)ccc1N
<BB_489>
What is the molecular formula for <BB_489>?
The molecular formula for <BB_489> (Cc1cc(I)ccc1N) is C7H8IN.
Describe the ring structures in building block <BB_489>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_489>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_489>.
**Token:** <BB_489> **SMILES:** Cc1cc(I)ccc1N **Molecular Formula:** C7H8IN **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_490>.
Sc1ccc2[nH]ccc2c1
What is the building block token for the following molecule?
Sc1ccc2[nH]ccc2c1
<BB_490>
What is the molecular formula for <BB_490>?
The molecular formula for <BB_490> (Sc1ccc2[nH]ccc2c1) is C8H7NS.
Describe the ring structures in building block <BB_490>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_490>.
The molecule contains the following groups: Thiol.
Provide a comprehensive chemical profile for the building block <BB_490>.
**Token:** <BB_490> **SMILES:** Sc1ccc2[nH]ccc2c1 **Molecular Formula:** C8H7NS **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Thiol
Provide the SMILES representation for the building block token <BB_491>.
CCc1ccc(CBr)c(C)c1
What is the building block token for the following molecule?
CCc1ccc(CBr)c(C)c1
<BB_491>
What is the molecular formula for <BB_491>?
The molecular formula for <BB_491> (CCc1ccc(CBr)c(C)c1) is C10H13Br.
Describe the ring structures in building block <BB_491>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_491>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_491>.
**Token:** <BB_491> **SMILES:** CCc1ccc(CBr)c(C)c1 **Molecular Formula:** C10H13Br **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_492>.
Cc1c(Cl)cc(C=O)cc1Cl
What is the building block token for the following molecule?
Cc1c(Cl)cc(C=O)cc1Cl
<BB_492>
What is the molecular formula for <BB_492>?
The molecular formula for <BB_492> (Cc1c(Cl)cc(C=O)cc1Cl) is C8H6Cl2O.
Describe the ring structures in building block <BB_492>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_492>.
The molecule contains the following groups: Aldehyde, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_492>.
**Token:** <BB_492> **SMILES:** Cc1c(Cl)cc(C=O)cc1Cl **Molecular Formula:** C8H6Cl2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Aldehyde, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_493>.
Cc1c(N)nc(-c2ccccn2)nc1Cl
What is the building block token for the following molecule?
Cc1c(N)nc(-c2ccccn2)nc1Cl
<BB_493>
What is the molecular formula for <BB_493>?
The molecular formula for <BB_493> (Cc1c(N)nc(-c2ccccn2)nc1Cl) is C10H9ClN4.
Describe the ring structures in building block <BB_493>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_493>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_493>.
**Token:** <BB_493> **SMILES:** Cc1c(N)nc(-c2ccccn2)nc1Cl **Molecular Formula:** C10H9ClN4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_494>.
COC(=O)C1COC(=O)N1
What is the building block token for the following molecule?
COC(=O)C1COC(=O)N1
<BB_494>
What is the molecular formula for <BB_494>?
The molecular formula for <BB_494> (COC(=O)C1COC(=O)N1) is C5H7NO4.
Describe the ring structures in building block <BB_494>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_494>.
The molecule contains the following groups: Amide, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_494>.
**Token:** <BB_494> **SMILES:** COC(=O)C1COC(=O)N1 **Molecular Formula:** C5H7NO4 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amide, Ester, Ether
Provide the SMILES representation for the building block token <BB_495>.
CC1(C=O)CCC1
What is the building block token for the following molecule?
CC1(C=O)CCC1
<BB_495>
What is the molecular formula for <BB_495>?
The molecular formula for <BB_495> (CC1(C=O)CCC1) is C6H10O.
Describe the ring structures in building block <BB_495>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_495>.
The molecule contains the following groups: Aldehyde.
Provide a comprehensive chemical profile for the building block <BB_495>.
**Token:** <BB_495> **SMILES:** CC1(C=O)CCC1 **Molecular Formula:** C6H10O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Aldehyde
Provide the SMILES representation for the building block token <BB_496>.
Cc1cc(CO)cc(C=O)n1
What is the building block token for the following molecule?
Cc1cc(CO)cc(C=O)n1
<BB_496>
What is the molecular formula for <BB_496>?
The molecular formula for <BB_496> (Cc1cc(CO)cc(C=O)n1) is C8H9NO2.
Describe the ring structures in building block <BB_496>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_496>.
The molecule contains the following groups: Aldehyde, Alcohol.
Provide a comprehensive chemical profile for the building block <BB_496>.
**Token:** <BB_496> **SMILES:** Cc1cc(CO)cc(C=O)n1 **Molecular Formula:** C8H9NO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Aldehyde, Alcohol
Provide the SMILES representation for the building block token <BB_497>.
Nc1cccc(-n2ccnc2)c1
What is the building block token for the following molecule?
Nc1cccc(-n2ccnc2)c1
<BB_497>
What is the molecular formula for <BB_497>?
The molecular formula for <BB_497> (Nc1cccc(-n2ccnc2)c1) is C9H9N3.
Describe the ring structures in building block <BB_497>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_497>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_497>.
**Token:** <BB_497> **SMILES:** Nc1cccc(-n2ccnc2)c1 **Molecular Formula:** C9H9N3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_498>.
O=CC[C@@]12CCC[C@@H]1C2
What is the building block token for the following molecule?
O=CC[C@@]12CCC[C@@H]1C2
<BB_498>
What is the molecular formula for <BB_498>?
The molecular formula for <BB_498> (O=CC[C@@]12CCC[C@@H]1C2) is C8H12O.
Describe the ring structures in building block <BB_498>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 3.
List the primary functional groups present in <BB_498>.
The molecule contains the following groups: Aldehyde.
Provide a comprehensive chemical profile for the building block <BB_498>.
**Token:** <BB_498> **SMILES:** O=CC[C@@]12CCC[C@@H]1C2 **Molecular Formula:** C8H12O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 3. **Functional Groups:** Aldehyde
Provide the SMILES representation for the building block token <BB_499>.
Nc1ncc(Cl)c(F)n1
What is the building block token for the following molecule?
Nc1ncc(Cl)c(F)n1
<BB_499>
What is the molecular formula for <BB_499>?
The molecular formula for <BB_499> (Nc1ncc(Cl)c(F)n1) is C4H3ClFN3.
Describe the ring structures in building block <BB_499>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_499>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_499>.
**Token:** <BB_499> **SMILES:** Nc1ncc(Cl)c(F)n1 **Molecular Formula:** C4H3ClFN3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)