instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_500>.
Cl.O=C(O)[C@H]1[C@@H]2CCNC[C@@H]21
What is the building block token for the following molecule?
Cl.O=C(O)[C@H]1[C@@H]2CCNC[C@@H]21
<BB_500>
What is the molecular formula for <BB_500>?
The molecular formula for <BB_500> (Cl.O=C(O)[C@H]1[C@@H]2CCNC[C@@H]21) is C7H12ClNO2.
Describe the ring structures in building block <BB_500>.
The molecule contains 2 ring(s): an aliphatic ring of size 3, an aliphatic ring of size 6.
List the primary functional groups present in <BB_500>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_500>.
**Token:** <BB_500> **SMILES:** Cl.O=C(O)[C@H]1[C@@H]2CCNC[C@@H]21 **Molecular Formula:** C7H12ClNO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 3, an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_501>.
O=C(O)C1CCCN1c1ccccc1
What is the building block token for the following molecule?
O=C(O)C1CCCN1c1ccccc1
<BB_501>
What is the molecular formula for <BB_501>?
The molecular formula for <BB_501> (O=C(O)C1CCCN1c1ccccc1) is C11H13NO2.
Describe the ring structures in building block <BB_501>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_501>.
The molecule contains the following groups: Carboxylic Acid, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_501>.
**Token:** <BB_501> **SMILES:** O=C(O)C1CCCN1c1ccccc1 **Molecular Formula:** C11H13NO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Tertiary Amine
Provide the SMILES representation for the building block token <BB_502>.
Cl.OCCNC1CCCSC1
What is the building block token for the following molecule?
Cl.OCCNC1CCCSC1
<BB_502>
What is the molecular formula for <BB_502>?
The molecular formula for <BB_502> (Cl.OCCNC1CCCSC1) is C7H16ClNOS.
Describe the ring structures in building block <BB_502>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_502>.
The molecule contains the following groups: Secondary Amine, Alcohol, Sulfide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_502>.
**Token:** <BB_502> **SMILES:** Cl.OCCNC1CCCSC1 **Molecular Formula:** C7H16ClNOS **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Alcohol, Sulfide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_503>.
CC(=O)c1cc(Br)ccc1N
What is the building block token for the following molecule?
CC(=O)c1cc(Br)ccc1N
<BB_503>
What is the molecular formula for <BB_503>?
The molecular formula for <BB_503> (CC(=O)c1cc(Br)ccc1N) is C8H8BrNO.
Describe the ring structures in building block <BB_503>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_503>.
The molecule contains the following groups: Amine, Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_503>.
**Token:** <BB_503> **SMILES:** CC(=O)c1cc(Br)ccc1N **Molecular Formula:** C8H8BrNO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_504>.
[N-]=[N+]=NCc1ccnc(F)c1Cl
What is the building block token for the following molecule?
[N-]=[N+]=NCc1ccnc(F)c1Cl
<BB_504>
What is the molecular formula for <BB_504>?
The molecular formula for <BB_504> ([N-]=[N+]=NCc1ccnc(F)c1Cl) is C6H4ClFN4.
Describe the ring structures in building block <BB_504>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_504>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_504>.
**Token:** <BB_504> **SMILES:** [N-]=[N+]=NCc1ccnc(F)c1Cl **Molecular Formula:** C6H4ClFN4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_505>.
Cc1cc(NC(N)=O)ccc1Br
What is the building block token for the following molecule?
Cc1cc(NC(N)=O)ccc1Br
<BB_505>
What is the molecular formula for <BB_505>?
The molecular formula for <BB_505> (Cc1cc(NC(N)=O)ccc1Br) is C8H9BrN2O.
Describe the ring structures in building block <BB_505>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_505>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_505>.
**Token:** <BB_505> **SMILES:** Cc1cc(NC(N)=O)ccc1Br **Molecular Formula:** C8H9BrN2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_506>.
C=C(NC(C)=O)C(=O)NCc1ccccc1
What is the building block token for the following molecule?
C=C(NC(C)=O)C(=O)NCc1ccccc1
<BB_506>
What is the molecular formula for <BB_506>?
The molecular formula for <BB_506> (C=C(NC(C)=O)C(=O)NCc1ccccc1) is C12H14N2O2.
Describe the ring structures in building block <BB_506>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_506>.
The molecule contains the following groups: Amide.
Provide a comprehensive chemical profile for the building block <BB_506>.
**Token:** <BB_506> **SMILES:** C=C(NC(C)=O)C(=O)NCc1ccccc1 **Molecular Formula:** C12H14N2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amide
Provide the SMILES representation for the building block token <BB_507>.
CCOC(=O)C1CC(Br)=NO1
What is the building block token for the following molecule?
CCOC(=O)C1CC(Br)=NO1
<BB_507>
What is the molecular formula for <BB_507>?
The molecular formula for <BB_507> (CCOC(=O)C1CC(Br)=NO1) is C6H8BrNO3.
Describe the ring structures in building block <BB_507>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_507>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_507>.
**Token:** <BB_507> **SMILES:** CCOC(=O)C1CC(Br)=NO1 **Molecular Formula:** C6H8BrNO3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_508>.
N#CC1CCN(C(=O)Cl)CC1
What is the building block token for the following molecule?
N#CC1CCN(C(=O)Cl)CC1
<BB_508>
What is the molecular formula for <BB_508>?
The molecular formula for <BB_508> (N#CC1CCN(C(=O)Cl)CC1) is C7H9ClN2O.
Describe the ring structures in building block <BB_508>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_508>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_508>.
**Token:** <BB_508> **SMILES:** N#CC1CCN(C(=O)Cl)CC1 **Molecular Formula:** C7H9ClN2O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amide, Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_509>.
CN(CCCCCCN=[N+]=[N-])C(=O)OC(C)(C)C
What is the building block token for the following molecule?
CN(CCCCCCN=[N+]=[N-])C(=O)OC(C)(C)C
<BB_509>
What is the molecular formula for <BB_509>?
The molecular formula for <BB_509> (CN(CCCCCCN=[N+]=[N-])C(=O)OC(C)(C)C) is C12H24N4O2.
Describe the ring structures in building block <BB_509>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_509>.
The molecule contains the following groups: Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_509>.
**Token:** <BB_509> **SMILES:** CN(CCCCCCN=[N+]=[N-])C(=O)OC(C)(C)C **Molecular Formula:** C12H24N4O2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amide, Ether
Provide the SMILES representation for the building block token <BB_510>.
COC(=O)c1sc2c(c1N)c(=O)n(C)c(=O)n2C
What is the building block token for the following molecule?
COC(=O)c1sc2c(c1N)c(=O)n(C)c(=O)n2C
<BB_510>
What is the molecular formula for <BB_510>?
The molecular formula for <BB_510> (COC(=O)c1sc2c(c1N)c(=O)n(C)c(=O)n2C) is C10H11N3O4S.
Describe the ring structures in building block <BB_510>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_510>.
The molecule contains the following groups: Amine, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_510>.
**Token:** <BB_510> **SMILES:** COC(=O)c1sc2c(c1N)c(=O)n(C)c(=O)n2C **Molecular Formula:** C10H11N3O4S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Ester, Ether
Provide the SMILES representation for the building block token <BB_511>.
C=CC1=CCCN(C(=O)C(F)(F)F)C1
What is the building block token for the following molecule?
C=CC1=CCCN(C(=O)C(F)(F)F)C1
<BB_511>
What is the molecular formula for <BB_511>?
The molecular formula for <BB_511> (C=CC1=CCCN(C(=O)C(F)(F)F)C1) is C9H10F3NO.
Describe the ring structures in building block <BB_511>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_511>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_511>.
**Token:** <BB_511> **SMILES:** C=CC1=CCCN(C(=O)C(F)(F)F)C1 **Molecular Formula:** C9H10F3NO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_512>.
NS(=O)(=O)c1cc(Br)c(Cl)c(C(=O)O)c1
What is the building block token for the following molecule?
NS(=O)(=O)c1cc(Br)c(Cl)c(C(=O)O)c1
<BB_512>
What is the molecular formula for <BB_512>?
The molecular formula for <BB_512> (NS(=O)(=O)c1cc(Br)c(Cl)c(C(=O)O)c1) is C7H5BrClNO4S.
Describe the ring structures in building block <BB_512>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_512>.
The molecule contains the following groups: Carboxylic Acid, Amine, Halogen (F,Cl,Br,I), Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_512>.
**Token:** <BB_512> **SMILES:** NS(=O)(=O)c1cc(Br)c(Cl)c(C(=O)O)c1 **Molecular Formula:** C7H5BrClNO4S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amine, Halogen (F,Cl,Br,I), Sulfonamide
Provide the SMILES representation for the building block token <BB_513>.
Nc1cnc(-c2ncccn2)nc1
What is the building block token for the following molecule?
Nc1cnc(-c2ncccn2)nc1
<BB_513>
What is the molecular formula for <BB_513>?
The molecular formula for <BB_513> (Nc1cnc(-c2ncccn2)nc1) is C8H7N5.
Describe the ring structures in building block <BB_513>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_513>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_513>.
**Token:** <BB_513> **SMILES:** Nc1cnc(-c2ncccn2)nc1 **Molecular Formula:** C8H7N5 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_514>.
CCOC(=O)COC(C)C
What is the building block token for the following molecule?
CCOC(=O)COC(C)C
<BB_514>
What is the molecular formula for <BB_514>?
The molecular formula for <BB_514> (CCOC(=O)COC(C)C) is C7H14O3.
Describe the ring structures in building block <BB_514>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_514>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_514>.
**Token:** <BB_514> **SMILES:** CCOC(=O)COC(C)C **Molecular Formula:** C7H14O3 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_515>.
CC(C)(O)CNN.Cl
What is the building block token for the following molecule?
CC(C)(O)CNN.Cl
<BB_515>
What is the molecular formula for <BB_515>?
The molecular formula for <BB_515> (CC(C)(O)CNN.Cl) is C4H13ClN2O.
Describe the ring structures in building block <BB_515>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_515>.
The molecule contains the following groups: Amine, Secondary Amine, Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_515>.
**Token:** <BB_515> **SMILES:** CC(C)(O)CNN.Cl **Molecular Formula:** C4H13ClN2O **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Secondary Amine, Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_516>.
O=[N+]([O-])c1cnn2c1NCCC2C(F)(F)F
What is the building block token for the following molecule?
O=[N+]([O-])c1cnn2c1NCCC2C(F)(F)F
<BB_516>
What is the molecular formula for <BB_516>?
The molecular formula for <BB_516> (O=[N+]([O-])c1cnn2c1NCCC2C(F)(F)F) is C7H7F3N4O2.
Describe the ring structures in building block <BB_516>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.