instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_516>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_516>.
**Token:** <BB_516> **SMILES:** O=[N+]([O-])c1cnn2c1NCCC2C(F)(F)F **Molecular Formula:** C7H7F3N4O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_517>.
COCn1ncc(Br)n1
What is the building block token for the following molecule?
COCn1ncc(Br)n1
<BB_517>
What is the molecular formula for <BB_517>?
The molecular formula for <BB_517> (COCn1ncc(Br)n1) is C4H6BrN3O.
Describe the ring structures in building block <BB_517>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_517>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_517>.
**Token:** <BB_517> **SMILES:** COCn1ncc(Br)n1 **Molecular Formula:** C4H6BrN3O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_518>.
O=C(O)CCCc1cc(Cl)sc1Cl
What is the building block token for the following molecule?
O=C(O)CCCc1cc(Cl)sc1Cl
<BB_518>
What is the molecular formula for <BB_518>?
The molecular formula for <BB_518> (O=C(O)CCCc1cc(Cl)sc1Cl) is C8H8Cl2O2S.
Describe the ring structures in building block <BB_518>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_518>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_518>.
**Token:** <BB_518> **SMILES:** O=C(O)CCCc1cc(Cl)sc1Cl **Molecular Formula:** C8H8Cl2O2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_519>.
CCC(C)(N)CO
What is the building block token for the following molecule?
CCC(C)(N)CO
<BB_519>
What is the molecular formula for <BB_519>?
The molecular formula for <BB_519> (CCC(C)(N)CO) is C5H13NO.
Describe the ring structures in building block <BB_519>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_519>.
The molecule contains the following groups: Amine, Alcohol.
Provide a comprehensive chemical profile for the building block <BB_519>.
**Token:** <BB_519> **SMILES:** CCC(C)(N)CO **Molecular Formula:** C5H13NO **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Alcohol
Provide the SMILES representation for the building block token <BB_520>.
Nc1ccccc1Nc1cccc(C(F)(F)F)c1
What is the building block token for the following molecule?
Nc1ccccc1Nc1cccc(C(F)(F)F)c1
<BB_520>
What is the molecular formula for <BB_520>?
The molecular formula for <BB_520> (Nc1ccccc1Nc1cccc(C(F)(F)F)c1) is C13H11F3N2.
Describe the ring structures in building block <BB_520>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_520>.
The molecule contains the following groups: Amine, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_520>.
**Token:** <BB_520> **SMILES:** Nc1ccccc1Nc1cccc(C(F)(F)F)c1 **Molecular Formula:** C13H11F3N2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_521>.
C=CCCc1cccnc1N
What is the building block token for the following molecule?
C=CCCc1cccnc1N
<BB_521>
What is the molecular formula for <BB_521>?
The molecular formula for <BB_521> (C=CCCc1cccnc1N) is C9H12N2.
Describe the ring structures in building block <BB_521>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_521>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_521>.
**Token:** <BB_521> **SMILES:** C=CCCc1cccnc1N **Molecular Formula:** C9H12N2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_522>.
O=C(O)C1CCCN(C(=O)Nc2ccccc2F)C1
What is the building block token for the following molecule?
O=C(O)C1CCCN(C(=O)Nc2ccccc2F)C1
<BB_522>
What is the molecular formula for <BB_522>?
The molecular formula for <BB_522> (O=C(O)C1CCCN(C(=O)Nc2ccccc2F)C1) is C13H15FN2O3.
Describe the ring structures in building block <BB_522>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_522>.
The molecule contains the following groups: Carboxylic Acid, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_522>.
**Token:** <BB_522> **SMILES:** O=C(O)C1CCCN(C(=O)Nc2ccccc2F)C1 **Molecular Formula:** C13H15FN2O3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_523>.
COCC(=O)C1(C(=O)OC)CC1
What is the building block token for the following molecule?
COCC(=O)C1(C(=O)OC)CC1
<BB_523>
What is the molecular formula for <BB_523>?
The molecular formula for <BB_523> (COCC(=O)C1(C(=O)OC)CC1) is C8H12O4.
Describe the ring structures in building block <BB_523>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_523>.
The molecule contains the following groups: Ester, Ketone, Ether.
Provide a comprehensive chemical profile for the building block <BB_523>.
**Token:** <BB_523> **SMILES:** COCC(=O)C1(C(=O)OC)CC1 **Molecular Formula:** C8H12O4 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Ester, Ketone, Ether
Provide the SMILES representation for the building block token <BB_524>.
[N-]=[N+]=Nc1ccc(C(F)(F)F)cn1
What is the building block token for the following molecule?
[N-]=[N+]=Nc1ccc(C(F)(F)F)cn1
<BB_524>
What is the molecular formula for <BB_524>?
The molecular formula for <BB_524> ([N-]=[N+]=Nc1ccc(C(F)(F)F)cn1) is C6H3F3N4.
Describe the ring structures in building block <BB_524>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_524>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_524>.
**Token:** <BB_524> **SMILES:** [N-]=[N+]=Nc1ccc(C(F)(F)F)cn1 **Molecular Formula:** C6H3F3N4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_525>.
O=C1N[C@@H]2CC[C@H]1C2
What is the building block token for the following molecule?
O=C1N[C@@H]2CC[C@H]1C2
<BB_525>
What is the molecular formula for <BB_525>?
The molecular formula for <BB_525> (O=C1N[C@@H]2CC[C@H]1C2) is C6H9NO.
Describe the ring structures in building block <BB_525>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_525>.
The molecule contains the following groups: Amide.
Provide a comprehensive chemical profile for the building block <BB_525>.
**Token:** <BB_525> **SMILES:** O=C1N[C@@H]2CC[C@H]1C2 **Molecular Formula:** C6H9NO **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Amide
Provide the SMILES representation for the building block token <BB_526>.
CNC1CCN(CC(F)(F)F)CC1
What is the building block token for the following molecule?
CNC1CCN(CC(F)(F)F)CC1
<BB_526>
What is the molecular formula for <BB_526>?
The molecular formula for <BB_526> (CNC1CCN(CC(F)(F)F)CC1) is C8H15F3N2.
Describe the ring structures in building block <BB_526>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_526>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_526>.
**Token:** <BB_526> **SMILES:** CNC1CCN(CC(F)(F)F)CC1 **Molecular Formula:** C8H15F3N2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_527>.
OC[C@H]1C[C@H](F)C1
What is the building block token for the following molecule?
OC[C@H]1C[C@H](F)C1
<BB_527>
What is the molecular formula for <BB_527>?
The molecular formula for <BB_527> (OC[C@H]1C[C@H](F)C1) is C5H9FO.
Describe the ring structures in building block <BB_527>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_527>.
The molecule contains the following groups: Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_527>.
**Token:** <BB_527> **SMILES:** OC[C@H]1C[C@H](F)C1 **Molecular Formula:** C5H9FO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_528>.
Cl.Cl.O=c1[nH]c2ccccc2cc1C1=CCNCC1
What is the building block token for the following molecule?
Cl.Cl.O=c1[nH]c2ccccc2cc1C1=CCNCC1
<BB_528>
What is the molecular formula for <BB_528>?
The molecular formula for <BB_528> (Cl.Cl.O=c1[nH]c2ccccc2cc1C1=CCNCC1) is C14H16Cl2N2O.
Describe the ring structures in building block <BB_528>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_528>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_528>.
**Token:** <BB_528> **SMILES:** Cl.Cl.O=c1[nH]c2ccccc2cc1C1=CCNCC1 **Molecular Formula:** C14H16Cl2N2O **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_529>.
N[C@]1(C(F)(F)F)C[C@@H](C(=O)O)C1
What is the building block token for the following molecule?
N[C@]1(C(F)(F)F)C[C@@H](C(=O)O)C1
<BB_529>
What is the molecular formula for <BB_529>?
The molecular formula for <BB_529> (N[C@]1(C(F)(F)F)C[C@@H](C(=O)O)C1) is C6H8F3NO2.
Describe the ring structures in building block <BB_529>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_529>.
The molecule contains the following groups: Carboxylic Acid, Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_529>.
**Token:** <BB_529> **SMILES:** N[C@]1(C(F)(F)F)C[C@@H](C(=O)O)C1 **Molecular Formula:** C6H8F3NO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Carboxylic Acid, Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_530>.
Cc1cccc(-c2ccc(C(N)=O)cc2)c1
What is the building block token for the following molecule?
Cc1cccc(-c2ccc(C(N)=O)cc2)c1
<BB_530>
What is the molecular formula for <BB_530>?
The molecular formula for <BB_530> (Cc1cccc(-c2ccc(C(N)=O)cc2)c1) is C14H13NO.
Describe the ring structures in building block <BB_530>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_530>.
The molecule contains the following groups: Amide.
Provide a comprehensive chemical profile for the building block <BB_530>.
**Token:** <BB_530> **SMILES:** Cc1cccc(-c2ccc(C(N)=O)cc2)c1 **Molecular Formula:** C14H13NO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amide
Provide the SMILES representation for the building block token <BB_531>.
CC(C)(C)OC(=O)N1CC(O)Cc2ccccc21
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CC(O)Cc2ccccc21
<BB_531>
What is the molecular formula for <BB_531>?
The molecular formula for <BB_531> (CC(C)(C)OC(=O)N1CC(O)Cc2ccccc21) is C14H19NO3.
Describe the ring structures in building block <BB_531>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_531>.
The molecule contains the following groups: Amide, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_531>.
**Token:** <BB_531> **SMILES:** CC(C)(C)OC(=O)N1CC(O)Cc2ccccc21 **Molecular Formula:** C14H19NO3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amide, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_532>.
Cc1nc(N)n(Cc2ccc(F)cc2)n1
What is the building block token for the following molecule?
Cc1nc(N)n(Cc2ccc(F)cc2)n1
<BB_532>
What is the molecular formula for <BB_532>?
The molecular formula for <BB_532> (Cc1nc(N)n(Cc2ccc(F)cc2)n1) is C10H11FN4.
Describe the ring structures in building block <BB_532>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_532>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_532>.
**Token:** <BB_532> **SMILES:** Cc1nc(N)n(Cc2ccc(F)cc2)n1 **Molecular Formula:** C10H11FN4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_533>.
CCc1ccccc1[C@@H]1C[C@H]1C(=O)O
What is the building block token for the following molecule?
CCc1ccccc1[C@@H]1C[C@H]1C(=O)O
<BB_533>