instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_533>?
The molecular formula for <BB_533> (CCc1ccccc1[C@@H]1C[C@H]1C(=O)O) is C12H14O2.
Describe the ring structures in building block <BB_533>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_533>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_533>.
**Token:** <BB_533> **SMILES:** CCc1ccccc1[C@@H]1C[C@H]1C(=O)O **Molecular Formula:** C12H14O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_534>.
CCOc1ccc(/C=C/c2ccncc2)cc1
What is the building block token for the following molecule?
CCOc1ccc(/C=C/c2ccncc2)cc1
<BB_534>
What is the molecular formula for <BB_534>?
The molecular formula for <BB_534> (CCOc1ccc(/C=C/c2ccncc2)cc1) is C15H15NO.
Describe the ring structures in building block <BB_534>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_534>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_534>.
**Token:** <BB_534> **SMILES:** CCOc1ccc(/C=C/c2ccncc2)cc1 **Molecular Formula:** C15H15NO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_535>.
O=C(O)Cn1cc(C(=O)O)c2ccccc21
What is the building block token for the following molecule?
O=C(O)Cn1cc(C(=O)O)c2ccccc21
<BB_535>
What is the molecular formula for <BB_535>?
The molecular formula for <BB_535> (O=C(O)Cn1cc(C(=O)O)c2ccccc21) is C11H9NO4.
Describe the ring structures in building block <BB_535>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_535>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_535>.
**Token:** <BB_535> **SMILES:** O=C(O)Cn1cc(C(=O)O)c2ccccc21 **Molecular Formula:** C11H9NO4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_536>.
CN(C)CCOc1ccccc1N1CCNCC1
What is the building block token for the following molecule?
CN(C)CCOc1ccccc1N1CCNCC1
<BB_536>
What is the molecular formula for <BB_536>?
The molecular formula for <BB_536> (CN(C)CCOc1ccccc1N1CCNCC1) is C14H23N3O.
Describe the ring structures in building block <BB_536>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_536>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_536>.
**Token:** <BB_536> **SMILES:** CN(C)CCOc1ccccc1N1CCNCC1 **Molecular Formula:** C14H23N3O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Tertiary Amine, Ether
Provide the SMILES representation for the building block token <BB_537>.
C=COc1ccc(Br)cc1
What is the building block token for the following molecule?
C=COc1ccc(Br)cc1
<BB_537>
What is the molecular formula for <BB_537>?
The molecular formula for <BB_537> (C=COc1ccc(Br)cc1) is C8H7BrO.
Describe the ring structures in building block <BB_537>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_537>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_537>.
**Token:** <BB_537> **SMILES:** C=COc1ccc(Br)cc1 **Molecular Formula:** C8H7BrO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_538>.
CN1Cc2[nH]nc(Br)c2C1
What is the building block token for the following molecule?
CN1Cc2[nH]nc(Br)c2C1
<BB_538>
What is the molecular formula for <BB_538>?
The molecular formula for <BB_538> (CN1Cc2[nH]nc(Br)c2C1) is C6H8BrN3.
Describe the ring structures in building block <BB_538>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 5.
List the primary functional groups present in <BB_538>.
The molecule contains the following groups: Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_538>.
**Token:** <BB_538> **SMILES:** CN1Cc2[nH]nc(Br)c2C1 **Molecular Formula:** C6H8BrN3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 5. **Functional Groups:** Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_539>.
O=S(=O)(Cl)CCc1noc2ccccc12
What is the building block token for the following molecule?
O=S(=O)(Cl)CCc1noc2ccccc12
<BB_539>
What is the molecular formula for <BB_539>?
The molecular formula for <BB_539> (O=S(=O)(Cl)CCc1noc2ccccc12) is C9H8ClNO3S.
Describe the ring structures in building block <BB_539>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_539>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_539>.
**Token:** <BB_539> **SMILES:** O=S(=O)(Cl)CCc1noc2ccccc12 **Molecular Formula:** C9H8ClNO3S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_540>.
COc1ccc(Br)c2c1CNCC2
What is the building block token for the following molecule?
COc1ccc(Br)c2c1CNCC2
<BB_540>
What is the molecular formula for <BB_540>?
The molecular formula for <BB_540> (COc1ccc(Br)c2c1CNCC2) is C10H12BrNO.
Describe the ring structures in building block <BB_540>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_540>.
The molecule contains the following groups: Secondary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_540>.
**Token:** <BB_540> **SMILES:** COc1ccc(Br)c2c1CNCC2 **Molecular Formula:** C10H12BrNO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_541>.
Cc1ccc(Br)cc1NN.Cl
What is the building block token for the following molecule?
Cc1ccc(Br)cc1NN.Cl
<BB_541>
What is the molecular formula for <BB_541>?
The molecular formula for <BB_541> (Cc1ccc(Br)cc1NN.Cl) is C7H10BrClN2.
Describe the ring structures in building block <BB_541>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_541>.
The molecule contains the following groups: Amine, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_541>.
**Token:** <BB_541> **SMILES:** Cc1ccc(Br)cc1NN.Cl **Molecular Formula:** C7H10BrClN2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_542>.
Br.BrCc1cncs1
What is the building block token for the following molecule?
Br.BrCc1cncs1
<BB_542>
What is the molecular formula for <BB_542>?
The molecular formula for <BB_542> (Br.BrCc1cncs1) is C4H5Br2NS.
Describe the ring structures in building block <BB_542>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_542>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_542>.
**Token:** <BB_542> **SMILES:** Br.BrCc1cncs1 **Molecular Formula:** C4H5Br2NS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_543>.
COC(=O)C1CCC(=O)N1C(C)C
What is the building block token for the following molecule?
COC(=O)C1CCC(=O)N1C(C)C
<BB_543>
What is the molecular formula for <BB_543>?
The molecular formula for <BB_543> (COC(=O)C1CCC(=O)N1C(C)C) is C9H15NO3.
Describe the ring structures in building block <BB_543>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_543>.
The molecule contains the following groups: Amide, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_543>.
**Token:** <BB_543> **SMILES:** COC(=O)C1CCC(=O)N1C(C)C **Molecular Formula:** C9H15NO3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amide, Ester, Ether
Provide the SMILES representation for the building block token <BB_544>.
Brc1sc(Br)c2nccnc12
What is the building block token for the following molecule?
Brc1sc(Br)c2nccnc12
<BB_544>
What is the molecular formula for <BB_544>?
The molecular formula for <BB_544> (Brc1sc(Br)c2nccnc12) is C6H2Br2N2S.
Describe the ring structures in building block <BB_544>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_544>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_544>.
**Token:** <BB_544> **SMILES:** Brc1sc(Br)c2nccnc12 **Molecular Formula:** C6H2Br2N2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_545>.
Cl.NCC12CC(C(=O)O)(CCO1)C2
What is the building block token for the following molecule?
Cl.NCC12CC(C(=O)O)(CCO1)C2
<BB_545>
What is the molecular formula for <BB_545>?
The molecular formula for <BB_545> (Cl.NCC12CC(C(=O)O)(CCO1)C2) is C8H14ClNO3.
Describe the ring structures in building block <BB_545>.
The molecule contains 3 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_545>.
The molecule contains the following groups: Carboxylic Acid, Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_545>.
**Token:** <BB_545> **SMILES:** Cl.NCC12CC(C(=O)O)(CCO1)C2 **Molecular Formula:** C8H14ClNO3 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_546>.
O=C1C=CC(=O)N1c1ccc(Cl)c(Cl)c1
What is the building block token for the following molecule?
O=C1C=CC(=O)N1c1ccc(Cl)c(Cl)c1
<BB_546>
What is the molecular formula for <BB_546>?
The molecular formula for <BB_546> (O=C1C=CC(=O)N1c1ccc(Cl)c(Cl)c1) is C10H5Cl2NO2.
Describe the ring structures in building block <BB_546>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_546>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_546>.
**Token:** <BB_546> **SMILES:** O=C1C=CC(=O)N1c1ccc(Cl)c(Cl)c1 **Molecular Formula:** C10H5Cl2NO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_547>.
Cn1cncc1NC(=O)OC(C)(C)C
What is the building block token for the following molecule?
Cn1cncc1NC(=O)OC(C)(C)C
<BB_547>
What is the molecular formula for <BB_547>?
The molecular formula for <BB_547> (Cn1cncc1NC(=O)OC(C)(C)C) is C9H15N3O2.
Describe the ring structures in building block <BB_547>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_547>.
The molecule contains the following groups: Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_547>.
**Token:** <BB_547> **SMILES:** Cn1cncc1NC(=O)OC(C)(C)C **Molecular Formula:** C9H15N3O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amide, Ether
Provide the SMILES representation for the building block token <BB_548>.
Nc1nc(-c2ccc([N+](=O)[O-])cc2)c[nH]1
What is the building block token for the following molecule?
Nc1nc(-c2ccc([N+](=O)[O-])cc2)c[nH]1
<BB_548>
What is the molecular formula for <BB_548>?
The molecular formula for <BB_548> (Nc1nc(-c2ccc([N+](=O)[O-])cc2)c[nH]1) is C9H8N4O2.
Describe the ring structures in building block <BB_548>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_548>.
The molecule contains the following groups: Amine, Tertiary Amine, Nitro.
Provide a comprehensive chemical profile for the building block <BB_548>.
**Token:** <BB_548> **SMILES:** Nc1nc(-c2ccc([N+](=O)[O-])cc2)c[nH]1 **Molecular Formula:** C9H8N4O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Nitro
Provide the SMILES representation for the building block token <BB_549>.
CCn1c(CCCCCN)nnc1SC.I
What is the building block token for the following molecule?
CCn1c(CCCCCN)nnc1SC.I
<BB_549>
What is the molecular formula for <BB_549>?
The molecular formula for <BB_549> (CCn1c(CCCCCN)nnc1SC.I) is C10H21IN4S.
Describe the ring structures in building block <BB_549>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_549>.
The molecule contains the following groups: Amine, Sulfide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_549>.
**Token:** <BB_549> **SMILES:** CCn1c(CCCCCN)nnc1SC.I **Molecular Formula:** C10H21IN4S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Sulfide, Halogen (F,Cl,Br,I)