instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_550>.
Cl.N[C@@H]1CCCN(S(=O)(=O)C2CC2)C1
What is the building block token for the following molecule?
Cl.N[C@@H]1CCCN(S(=O)(=O)C2CC2)C1
<BB_550>
What is the molecular formula for <BB_550>?
The molecular formula for <BB_550> (Cl.N[C@@H]1CCCN(S(=O)(=O)C2CC2)C1) is C8H17ClN2O2S.
Describe the ring structures in building block <BB_550>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_550>.
The molecule contains the following groups: Amine, Tertiary Amine, Halogen (F,Cl,Br,I), Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_550>.
**Token:** <BB_550> **SMILES:** Cl.N[C@@H]1CCCN(S(=O)(=O)C2CC2)C1 **Molecular Formula:** C8H17ClN2O2S **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Amine, Tertiary Amine, Halogen (F,Cl,Br,I), Sulfonamide
Provide the SMILES representation for the building block token <BB_551>.
O=C(Cl)N1C[C@H]2CC[C@H]2C1
What is the building block token for the following molecule?
O=C(Cl)N1C[C@H]2CC[C@H]2C1
<BB_551>
What is the molecular formula for <BB_551>?
The molecular formula for <BB_551> (O=C(Cl)N1C[C@H]2CC[C@H]2C1) is C7H10ClNO.
Describe the ring structures in building block <BB_551>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 4.
List the primary functional groups present in <BB_551>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_551>.
**Token:** <BB_551> **SMILES:** O=C(Cl)N1C[C@H]2CC[C@H]2C1 **Molecular Formula:** C7H10ClNO **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 4. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_552>.
Cc1cccc2[nH]c(CN)nc12.Cl
What is the building block token for the following molecule?
Cc1cccc2[nH]c(CN)nc12.Cl
<BB_552>
What is the molecular formula for <BB_552>?
The molecular formula for <BB_552> (Cc1cccc2[nH]c(CN)nc12.Cl) is C9H12ClN3.
Describe the ring structures in building block <BB_552>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_552>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_552>.
**Token:** <BB_552> **SMILES:** Cc1cccc2[nH]c(CN)nc12.Cl **Molecular Formula:** C9H12ClN3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_553>.
Cn1nc(Br)c2ncnc(Cl)c21
What is the building block token for the following molecule?
Cn1nc(Br)c2ncnc(Cl)c21
<BB_553>
What is the molecular formula for <BB_553>?
The molecular formula for <BB_553> (Cn1nc(Br)c2ncnc(Cl)c21) is C6H4BrClN4.
Describe the ring structures in building block <BB_553>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_553>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_553>.
**Token:** <BB_553> **SMILES:** Cn1nc(Br)c2ncnc(Cl)c21 **Molecular Formula:** C6H4BrClN4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_554>.
CCCC(C(=O)O)n1ccc(N)n1
What is the building block token for the following molecule?
CCCC(C(=O)O)n1ccc(N)n1
<BB_554>
What is the molecular formula for <BB_554>?
The molecular formula for <BB_554> (CCCC(C(=O)O)n1ccc(N)n1) is C8H13N3O2.
Describe the ring structures in building block <BB_554>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_554>.
The molecule contains the following groups: Carboxylic Acid, Amine.
Provide a comprehensive chemical profile for the building block <BB_554>.
**Token:** <BB_554> **SMILES:** CCCC(C(=O)O)n1ccc(N)n1 **Molecular Formula:** C8H13N3O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Amine
Provide the SMILES representation for the building block token <BB_555>.
CCn1c(=O)ccc2cnc(SC)nc21
What is the building block token for the following molecule?
CCn1c(=O)ccc2cnc(SC)nc21
<BB_555>
What is the molecular formula for <BB_555>?
The molecular formula for <BB_555> (CCn1c(=O)ccc2cnc(SC)nc21) is C10H11N3OS.
Describe the ring structures in building block <BB_555>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_555>.
The molecule contains the following groups: Sulfide.
Provide a comprehensive chemical profile for the building block <BB_555>.
**Token:** <BB_555> **SMILES:** CCn1c(=O)ccc2cnc(SC)nc21 **Molecular Formula:** C10H11N3OS **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Sulfide
Provide the SMILES representation for the building block token <BB_556>.
C#CCOCCC(=O)O
What is the building block token for the following molecule?
C#CCOCCC(=O)O
<BB_556>
What is the molecular formula for <BB_556>?
The molecular formula for <BB_556> (C#CCOCCC(=O)O) is C6H8O3.
Describe the ring structures in building block <BB_556>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_556>.
The molecule contains the following groups: Carboxylic Acid, Ether.
Provide a comprehensive chemical profile for the building block <BB_556>.
**Token:** <BB_556> **SMILES:** C#CCOCCC(=O)O **Molecular Formula:** C6H8O3 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid, Ether
Provide the SMILES representation for the building block token <BB_557>.
Cc1nnc2n1CC(C(=O)O)C2.Cl
What is the building block token for the following molecule?
Cc1nnc2n1CC(C(=O)O)C2.Cl
<BB_557>
What is the molecular formula for <BB_557>?
The molecular formula for <BB_557> (Cc1nnc2n1CC(C(=O)O)C2.Cl) is C7H10ClN3O2.
Describe the ring structures in building block <BB_557>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_557>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_557>.
**Token:** <BB_557> **SMILES:** Cc1nnc2n1CC(C(=O)O)C2.Cl **Molecular Formula:** C7H10ClN3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_558>.
O=C(O)CC(Br)CC(=O)O
What is the building block token for the following molecule?
O=C(O)CC(Br)CC(=O)O
<BB_558>
What is the molecular formula for <BB_558>?
The molecular formula for <BB_558> (O=C(O)CC(Br)CC(=O)O) is C5H7BrO4.
Describe the ring structures in building block <BB_558>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_558>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_558>.
**Token:** <BB_558> **SMILES:** O=C(O)CC(Br)CC(=O)O **Molecular Formula:** C5H7BrO4 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_559>.
COC(=O)c1ccn2nccc2c1Cl
What is the building block token for the following molecule?
COC(=O)c1ccn2nccc2c1Cl
<BB_559>
What is the molecular formula for <BB_559>?
The molecular formula for <BB_559> (COC(=O)c1ccn2nccc2c1Cl) is C9H7ClN2O2.
Describe the ring structures in building block <BB_559>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_559>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_559>.
**Token:** <BB_559> **SMILES:** COC(=O)c1ccn2nccc2c1Cl **Molecular Formula:** C9H7ClN2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_560>.
Cl.O=C1CNCCN1c1ccc(F)cc1
What is the building block token for the following molecule?
Cl.O=C1CNCCN1c1ccc(F)cc1
<BB_560>
What is the molecular formula for <BB_560>?
The molecular formula for <BB_560> (Cl.O=C1CNCCN1c1ccc(F)cc1) is C10H12ClFN2O.
Describe the ring structures in building block <BB_560>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_560>.
The molecule contains the following groups: Secondary Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_560>.
**Token:** <BB_560> **SMILES:** Cl.O=C1CNCCN1c1ccc(F)cc1 **Molecular Formula:** C10H12ClFN2O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_561>.
COC(=O)c1nc(C2CCNCC2)sc1C
What is the building block token for the following molecule?
COC(=O)c1nc(C2CCNCC2)sc1C
<BB_561>
What is the molecular formula for <BB_561>?
The molecular formula for <BB_561> (COC(=O)c1nc(C2CCNCC2)sc1C) is C11H16N2O2S.
Describe the ring structures in building block <BB_561>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_561>.
The molecule contains the following groups: Secondary Amine, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_561>.
**Token:** <BB_561> **SMILES:** COC(=O)c1nc(C2CCNCC2)sc1C **Molecular Formula:** C11H16N2O2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Ester, Ether
Provide the SMILES representation for the building block token <BB_562>.
N#Cc1cc(Br)ccc1O
What is the building block token for the following molecule?
N#Cc1cc(Br)ccc1O
<BB_562>
What is the molecular formula for <BB_562>?
The molecular formula for <BB_562> (N#Cc1cc(Br)ccc1O) is C7H4BrNO.
Describe the ring structures in building block <BB_562>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_562>.
The molecule contains the following groups: Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_562>.
**Token:** <BB_562> **SMILES:** N#Cc1cc(Br)ccc1O **Molecular Formula:** C7H4BrNO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_563>.
Cn1nc([N+](=O)[O-])cc1C(=O)O
What is the building block token for the following molecule?
Cn1nc([N+](=O)[O-])cc1C(=O)O
<BB_563>
What is the molecular formula for <BB_563>?
The molecular formula for <BB_563> (Cn1nc([N+](=O)[O-])cc1C(=O)O) is C5H5N3O4.
Describe the ring structures in building block <BB_563>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_563>.
The molecule contains the following groups: Carboxylic Acid, Tertiary Amine, Nitro.
Provide a comprehensive chemical profile for the building block <BB_563>.
**Token:** <BB_563> **SMILES:** Cn1nc([N+](=O)[O-])cc1C(=O)O **Molecular Formula:** C5H5N3O4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Tertiary Amine, Nitro
Provide the SMILES representation for the building block token <BB_564>.
CCOC(OCC)c1ncc(Br)cn1
What is the building block token for the following molecule?
CCOC(OCC)c1ncc(Br)cn1
<BB_564>
What is the molecular formula for <BB_564>?
The molecular formula for <BB_564> (CCOC(OCC)c1ncc(Br)cn1) is C9H13BrN2O2.
Describe the ring structures in building block <BB_564>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_564>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_564>.
**Token:** <BB_564> **SMILES:** CCOC(OCC)c1ncc(Br)cn1 **Molecular Formula:** C9H13BrN2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_565>.
COCc1cc(N)ccc1Cl
What is the building block token for the following molecule?
COCc1cc(N)ccc1Cl
<BB_565>
What is the molecular formula for <BB_565>?
The molecular formula for <BB_565> (COCc1cc(N)ccc1Cl) is C8H10ClNO.
Describe the ring structures in building block <BB_565>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_565>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_565>.
**Token:** <BB_565> **SMILES:** COCc1cc(N)ccc1Cl **Molecular Formula:** C8H10ClNO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_566>.
C1CO[C@H]2CCCN[C@H]2C1.Cl
What is the building block token for the following molecule?
C1CO[C@H]2CCCN[C@H]2C1.Cl
<BB_566>
What is the molecular formula for <BB_566>?
The molecular formula for <BB_566> (C1CO[C@H]2CCCN[C@H]2C1.Cl) is C8H16ClNO.
Describe the ring structures in building block <BB_566>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6.