Datasets:
virx
/
molecule

Dataset card Data Studio Files
xet
Community
1
instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_566>.
The molecule contains the following groups: Secondary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_566>.
**Token:** <BB_566> **SMILES:** C1CO[C@H]2CCCN[C@H]2C1.Cl **Molecular Formula:** C8H16ClNO **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_567>.
CSCC(N)c1ccccc1.Cl
What is the building block token for the following molecule?
CSCC(N)c1ccccc1.Cl
<BB_567>
What is the molecular formula for <BB_567>?
The molecular formula for <BB_567> (CSCC(N)c1ccccc1.Cl) is C9H14ClNS.
Describe the ring structures in building block <BB_567>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_567>.
The molecule contains the following groups: Amine, Sulfide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_567>.
**Token:** <BB_567> **SMILES:** CSCC(N)c1ccccc1.Cl **Molecular Formula:** C9H14ClNS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Sulfide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_568>.
CCCCCCCCNCCCCCCCC.Cl
What is the building block token for the following molecule?
CCCCCCCCNCCCCCCCC.Cl
<BB_568>
What is the molecular formula for <BB_568>?
The molecular formula for <BB_568> (CCCCCCCCNCCCCCCCC.Cl) is C16H36ClN.
Describe the ring structures in building block <BB_568>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_568>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_568>.
**Token:** <BB_568> **SMILES:** CCCCCCCCNCCCCCCCC.Cl **Molecular Formula:** C16H36ClN **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_569>.
Cn1nc(NN)c(=O)n(C)c1=O
What is the building block token for the following molecule?
Cn1nc(NN)c(=O)n(C)c1=O
<BB_569>
What is the molecular formula for <BB_569>?
The molecular formula for <BB_569> (Cn1nc(NN)c(=O)n(C)c1=O) is C5H9N5O2.
Describe the ring structures in building block <BB_569>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_569>.
The molecule contains the following groups: Amine, Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_569>.
**Token:** <BB_569> **SMILES:** Cn1nc(NN)c(=O)n(C)c1=O **Molecular Formula:** C5H9N5O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Secondary Amine
Provide the SMILES representation for the building block token <BB_570>.
O=C=NC1CC2(CCC2)C1
What is the building block token for the following molecule?
O=C=NC1CC2(CCC2)C1
<BB_570>
What is the molecular formula for <BB_570>?
The molecular formula for <BB_570> (O=C=NC1CC2(CCC2)C1) is C8H11NO.
Describe the ring structures in building block <BB_570>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4.
List the primary functional groups present in <BB_570>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_570>.
**Token:** <BB_570> **SMILES:** O=C=NC1CC2(CCC2)C1 **Molecular Formula:** C8H11NO **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_571>.
CCC(O)Cc1ccccc1
What is the building block token for the following molecule?
CCC(O)Cc1ccccc1
<BB_571>
What is the molecular formula for <BB_571>?
The molecular formula for <BB_571> (CCC(O)Cc1ccccc1) is C10H14O.
Describe the ring structures in building block <BB_571>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_571>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_571>.
**Token:** <BB_571> **SMILES:** CCC(O)Cc1ccccc1 **Molecular Formula:** C10H14O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_572>.
Cc1cc(Cl)ncc1B1OC(C)(C)C(C)(C)O1
What is the building block token for the following molecule?
Cc1cc(Cl)ncc1B1OC(C)(C)C(C)(C)O1
<BB_572>
What is the molecular formula for <BB_572>?
The molecular formula for <BB_572> (Cc1cc(Cl)ncc1B1OC(C)(C)C(C)(C)O1) is C12H17BClNO2.
Describe the ring structures in building block <BB_572>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_572>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_572>.
**Token:** <BB_572> **SMILES:** Cc1cc(Cl)ncc1B1OC(C)(C)C(C)(C)O1 **Molecular Formula:** C12H17BClNO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_573>.
CCC(=O)c1ccc(OC)cc1
What is the building block token for the following molecule?
CCC(=O)c1ccc(OC)cc1
<BB_573>
What is the molecular formula for <BB_573>?
The molecular formula for <BB_573> (CCC(=O)c1ccc(OC)cc1) is C10H12O2.
Describe the ring structures in building block <BB_573>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_573>.
The molecule contains the following groups: Ketone, Ether.
Provide a comprehensive chemical profile for the building block <BB_573>.
**Token:** <BB_573> **SMILES:** CCC(=O)c1ccc(OC)cc1 **Molecular Formula:** C10H12O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ketone, Ether
Provide the SMILES representation for the building block token <BB_574>.
COc1ccc(B2OC(C)(C)C(C)(C)O2)s1
What is the building block token for the following molecule?
COc1ccc(B2OC(C)(C)C(C)(C)O2)s1
<BB_574>
What is the molecular formula for <BB_574>?
The molecular formula for <BB_574> (COc1ccc(B2OC(C)(C)C(C)(C)O2)s1) is C11H17BO3S.
Describe the ring structures in building block <BB_574>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_574>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_574>.
**Token:** <BB_574> **SMILES:** COc1ccc(B2OC(C)(C)C(C)(C)O2)s1 **Molecular Formula:** C11H17BO3S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_575>.
O=C(O)c1ccc(C(F)(F)Br)nc1
What is the building block token for the following molecule?
O=C(O)c1ccc(C(F)(F)Br)nc1
<BB_575>
What is the molecular formula for <BB_575>?
The molecular formula for <BB_575> (O=C(O)c1ccc(C(F)(F)Br)nc1) is C7H4BrF2NO2.
Describe the ring structures in building block <BB_575>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_575>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_575>.
**Token:** <BB_575> **SMILES:** O=C(O)c1ccc(C(F)(F)Br)nc1 **Molecular Formula:** C7H4BrF2NO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_576>.
O=C1CC(F)(F)CO1
What is the building block token for the following molecule?
O=C1CC(F)(F)CO1
<BB_576>
What is the molecular formula for <BB_576>?
The molecular formula for <BB_576> (O=C1CC(F)(F)CO1) is C4H4F2O2.
Describe the ring structures in building block <BB_576>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_576>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_576>.
**Token:** <BB_576> **SMILES:** O=C1CC(F)(F)CO1 **Molecular Formula:** C4H4F2O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_577>.
O=Cc1cc(Cl)cc(Cl)c1Br
What is the building block token for the following molecule?
O=Cc1cc(Cl)cc(Cl)c1Br
<BB_577>
What is the molecular formula for <BB_577>?
The molecular formula for <BB_577> (O=Cc1cc(Cl)cc(Cl)c1Br) is C7H3BrCl2O.
Describe the ring structures in building block <BB_577>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_577>.
The molecule contains the following groups: Aldehyde, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_577>.
**Token:** <BB_577> **SMILES:** O=Cc1cc(Cl)cc(Cl)c1Br **Molecular Formula:** C7H3BrCl2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Aldehyde, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_578>.
Fc1cc(Br)ccc1CCBr
What is the building block token for the following molecule?
Fc1cc(Br)ccc1CCBr
<BB_578>
What is the molecular formula for <BB_578>?
The molecular formula for <BB_578> (Fc1cc(Br)ccc1CCBr) is C8H7Br2F.
Describe the ring structures in building block <BB_578>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_578>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_578>.
**Token:** <BB_578> **SMILES:** Fc1cc(Br)ccc1CCBr **Molecular Formula:** C8H7Br2F **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_579>.
C=CCNCC(=O)OC(C)(C)C
What is the building block token for the following molecule?
C=CCNCC(=O)OC(C)(C)C
<BB_579>
What is the molecular formula for <BB_579>?
The molecular formula for <BB_579> (C=CCNCC(=O)OC(C)(C)C) is C9H17NO2.
Describe the ring structures in building block <BB_579>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_579>.
The molecule contains the following groups: Secondary Amine, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_579>.
**Token:** <BB_579> **SMILES:** C=CCNCC(=O)OC(C)(C)C **Molecular Formula:** C9H17NO2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Secondary Amine, Ester, Ether
Provide the SMILES representation for the building block token <BB_580>.
Cc1cccc2c(=O)[nH]ccc12
What is the building block token for the following molecule?
Cc1cccc2c(=O)[nH]ccc12
<BB_580>
What is the molecular formula for <BB_580>?
The molecular formula for <BB_580> (Cc1cccc2c(=O)[nH]ccc12) is C10H9NO.
Describe the ring structures in building block <BB_580>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_580>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_580>.
**Token:** <BB_580> **SMILES:** Cc1cccc2c(=O)[nH]ccc12 **Molecular Formula:** C10H9NO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_581>.
CC(C)(C)OC(=O)N1CCNC1=O
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CCNC1=O
<BB_581>
What is the molecular formula for <BB_581>?
The molecular formula for <BB_581> (CC(C)(C)OC(=O)N1CCNC1=O) is C8H14N2O3.
Describe the ring structures in building block <BB_581>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_581>.
The molecule contains the following groups: Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_581>.
**Token:** <BB_581> **SMILES:** CC(C)(C)OC(=O)N1CCNC1=O **Molecular Formula:** C8H14N2O3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amide, Ether
Provide the SMILES representation for the building block token <BB_582>.
CO[B-](OC)(OC)OC.[Na+]
What is the building block token for the following molecule?
CO[B-](OC)(OC)OC.[Na+]
<BB_582>
What is the molecular formula for <BB_582>?
The molecular formula for <BB_582> (CO[B-](OC)(OC)OC.[Na+]) is C4H12BNaO4.
Describe the ring structures in building block <BB_582>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_582>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_582>.
**Token:** <BB_582> **SMILES:** CO[B-](OC)(OC)OC.[Na+] **Molecular Formula:** C4H12BNaO4 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_583>.
Cn1ncc2nc3c(c(Cl)c21)CCCC3
What is the building block token for the following molecule?
Cn1ncc2nc3c(c(Cl)c21)CCCC3
<BB_583>