instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_583>?
The molecular formula for <BB_583> (Cn1ncc2nc3c(c(Cl)c21)CCCC3) is C11H12ClN3.
Describe the ring structures in building block <BB_583>.
The molecule contains 3 ring(s): an aromatic ring of size 5, an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_583>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_583>.
**Token:** <BB_583> **SMILES:** Cn1ncc2nc3c(c(Cl)c21)CCCC3 **Molecular Formula:** C11H12ClN3 **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 5, an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_584>.
Brc1c(NC2=NCCN2)ccc2nccnc12
What is the building block token for the following molecule?
Brc1c(NC2=NCCN2)ccc2nccnc12
<BB_584>
What is the molecular formula for <BB_584>?
The molecular formula for <BB_584> (Brc1c(NC2=NCCN2)ccc2nccnc12) is C11H10BrN5.
Describe the ring structures in building block <BB_584>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_584>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_584>.
**Token:** <BB_584> **SMILES:** Brc1c(NC2=NCCN2)ccc2nccnc12 **Molecular Formula:** C11H10BrN5 **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_585>.
NCCN1CCC(OCC(F)F)CC1
What is the building block token for the following molecule?
NCCN1CCC(OCC(F)F)CC1
<BB_585>
What is the molecular formula for <BB_585>?
The molecular formula for <BB_585> (NCCN1CCC(OCC(F)F)CC1) is C9H18F2N2O.
Describe the ring structures in building block <BB_585>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_585>.
The molecule contains the following groups: Amine, Tertiary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_585>.
**Token:** <BB_585> **SMILES:** NCCN1CCC(OCC(F)F)CC1 **Molecular Formula:** C9H18F2N2O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_586>.
CNCC1COc2ccccc2O1
What is the building block token for the following molecule?
CNCC1COc2ccccc2O1
<BB_586>
What is the molecular formula for <BB_586>?
The molecular formula for <BB_586> (CNCC1COc2ccccc2O1) is C10H13NO2.
Describe the ring structures in building block <BB_586>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_586>.
The molecule contains the following groups: Secondary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_586>.
**Token:** <BB_586> **SMILES:** CNCC1COc2ccccc2O1 **Molecular Formula:** C10H13NO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Ether
Provide the SMILES representation for the building block token <BB_587>.
O=c1[nH]c2cc(Cl)c([N+](=O)[O-])cc2o1
What is the building block token for the following molecule?
O=c1[nH]c2cc(Cl)c([N+](=O)[O-])cc2o1
<BB_587>
What is the molecular formula for <BB_587>?
The molecular formula for <BB_587> (O=c1[nH]c2cc(Cl)c([N+](=O)[O-])cc2o1) is C7H3ClN2O4.
Describe the ring structures in building block <BB_587>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_587>.
The molecule contains the following groups: Tertiary Amine, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_587>.
**Token:** <BB_587> **SMILES:** O=c1[nH]c2cc(Cl)c([N+](=O)[O-])cc2o1 **Molecular Formula:** C7H3ClN2O4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_588>.
Cc1cc(N)cc2cc[nH]c12
What is the building block token for the following molecule?
Cc1cc(N)cc2cc[nH]c12
<BB_588>
What is the molecular formula for <BB_588>?
The molecular formula for <BB_588> (Cc1cc(N)cc2cc[nH]c12) is C9H10N2.
Describe the ring structures in building block <BB_588>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_588>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_588>.
**Token:** <BB_588> **SMILES:** Cc1cc(N)cc2cc[nH]c12 **Molecular Formula:** C9H10N2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_589>.
CC(=O)O.CC(C)(NS(C)(=O)=O)C(=N)N
What is the building block token for the following molecule?
CC(=O)O.CC(C)(NS(C)(=O)=O)C(=N)N
<BB_589>
What is the molecular formula for <BB_589>?
The molecular formula for <BB_589> (CC(=O)O.CC(C)(NS(C)(=O)=O)C(=N)N) is C7H17N3O4S.
Describe the ring structures in building block <BB_589>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_589>.
The molecule contains the following groups: Carboxylic Acid, Amine, Secondary Amine, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_589>.
**Token:** <BB_589> **SMILES:** CC(=O)O.CC(C)(NS(C)(=O)=O)C(=N)N **Molecular Formula:** C7H17N3O4S **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid, Amine, Secondary Amine, Sulfonamide
Provide the SMILES representation for the building block token <BB_590>.
O=C(O)c1cc(Br)cc2cc[nH]c12
What is the building block token for the following molecule?
O=C(O)c1cc(Br)cc2cc[nH]c12
<BB_590>
What is the molecular formula for <BB_590>?
The molecular formula for <BB_590> (O=C(O)c1cc(Br)cc2cc[nH]c12) is C9H6BrNO2.
Describe the ring structures in building block <BB_590>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_590>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_590>.
**Token:** <BB_590> **SMILES:** O=C(O)c1cc(Br)cc2cc[nH]c12 **Molecular Formula:** C9H6BrNO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_591>.
O=C(O)c1coc2c1C(=O)NCC2
What is the building block token for the following molecule?
O=C(O)c1coc2c1C(=O)NCC2
<BB_591>
What is the molecular formula for <BB_591>?
The molecular formula for <BB_591> (O=C(O)c1coc2c1C(=O)NCC2) is C8H7NO4.
Describe the ring structures in building block <BB_591>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_591>.
The molecule contains the following groups: Carboxylic Acid, Amide.
Provide a comprehensive chemical profile for the building block <BB_591>.
**Token:** <BB_591> **SMILES:** O=C(O)c1coc2c1C(=O)NCC2 **Molecular Formula:** C8H7NO4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amide
Provide the SMILES representation for the building block token <BB_592>.
Nc1c(C(F)(F)F)nc2cnccn12
What is the building block token for the following molecule?
Nc1c(C(F)(F)F)nc2cnccn12
<BB_592>
What is the molecular formula for <BB_592>?
The molecular formula for <BB_592> (Nc1c(C(F)(F)F)nc2cnccn12) is C7H5F3N4.
Describe the ring structures in building block <BB_592>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_592>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_592>.
**Token:** <BB_592> **SMILES:** Nc1c(C(F)(F)F)nc2cnccn12 **Molecular Formula:** C7H5F3N4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_593>.
NNC(=O)Cc1ccc2ccccc2c1
What is the building block token for the following molecule?
NNC(=O)Cc1ccc2ccccc2c1
<BB_593>
What is the molecular formula for <BB_593>?
The molecular formula for <BB_593> (NNC(=O)Cc1ccc2ccccc2c1) is C12H12N2O.
Describe the ring structures in building block <BB_593>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_593>.
The molecule contains the following groups: Amine, Amide.
Provide a comprehensive chemical profile for the building block <BB_593>.
**Token:** <BB_593> **SMILES:** NNC(=O)Cc1ccc2ccccc2c1 **Molecular Formula:** C12H12N2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Amide
Provide the SMILES representation for the building block token <BB_594>.
C[C@H]1CNCO1
What is the building block token for the following molecule?
C[C@H]1CNCO1
<BB_594>
What is the molecular formula for <BB_594>?
The molecular formula for <BB_594> (C[C@H]1CNCO1) is C4H9NO.
Describe the ring structures in building block <BB_594>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_594>.
The molecule contains the following groups: Secondary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_594>.
**Token:** <BB_594> **SMILES:** C[C@H]1CNCO1 **Molecular Formula:** C4H9NO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Ether
Provide the SMILES representation for the building block token <BB_595>.
CNCc1cc(F)c(F)c(F)c1
What is the building block token for the following molecule?
CNCc1cc(F)c(F)c(F)c1
<BB_595>
What is the molecular formula for <BB_595>?
The molecular formula for <BB_595> (CNCc1cc(F)c(F)c(F)c1) is C8H8F3N.
Describe the ring structures in building block <BB_595>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_595>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_595>.
**Token:** <BB_595> **SMILES:** CNCc1cc(F)c(F)c(F)c1 **Molecular Formula:** C8H8F3N **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_596>.
COC(=O)C(C)(N)c1cc(F)ccc1F.Cl
What is the building block token for the following molecule?
COC(=O)C(C)(N)c1cc(F)ccc1F.Cl
<BB_596>
What is the molecular formula for <BB_596>?
The molecular formula for <BB_596> (COC(=O)C(C)(N)c1cc(F)ccc1F.Cl) is C10H12ClF2NO2.
Describe the ring structures in building block <BB_596>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_596>.
The molecule contains the following groups: Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_596>.
**Token:** <BB_596> **SMILES:** COC(=O)C(C)(N)c1cc(F)ccc1F.Cl **Molecular Formula:** C10H12ClF2NO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_597>.
COc1ccc(Cl)nc1CCl
What is the building block token for the following molecule?
COc1ccc(Cl)nc1CCl
<BB_597>
What is the molecular formula for <BB_597>?
The molecular formula for <BB_597> (COc1ccc(Cl)nc1CCl) is C7H7Cl2NO.
Describe the ring structures in building block <BB_597>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_597>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_597>.
**Token:** <BB_597> **SMILES:** COc1ccc(Cl)nc1CCl **Molecular Formula:** C7H7Cl2NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_598>.
CC(C)(C#N)c1nnn[nH]1
What is the building block token for the following molecule?
CC(C)(C#N)c1nnn[nH]1
<BB_598>
What is the molecular formula for <BB_598>?
The molecular formula for <BB_598> (CC(C)(C#N)c1nnn[nH]1) is C5H7N5.
Describe the ring structures in building block <BB_598>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_598>.
The molecule contains the following groups: Nitrile.
Provide a comprehensive chemical profile for the building block <BB_598>.
**Token:** <BB_598> **SMILES:** CC(C)(C#N)c1nnn[nH]1 **Molecular Formula:** C5H7N5 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Nitrile
Provide the SMILES representation for the building block token <BB_599>.
CC(C)(C)OC(=O)N1CCC2(CO2)CC12CC2
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CCC2(CO2)CC12CC2
<BB_599>
What is the molecular formula for <BB_599>?
The molecular formula for <BB_599> (CC(C)(C)OC(=O)N1CCC2(CO2)CC12CC2) is C13H21NO3.
Describe the ring structures in building block <BB_599>.
The molecule contains 3 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 3, an aliphatic ring of size 3.
List the primary functional groups present in <BB_599>.
The molecule contains the following groups: Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_599>.
**Token:** <BB_599> **SMILES:** CC(C)(C)OC(=O)N1CCC2(CO2)CC12CC2 **Molecular Formula:** C13H21NO3 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 3, an aliphatic ring of size 3. **Functional Groups:** Amide, Ether