instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_600>.
FC(F)(F)c1ncnc(Cl)c1Br
What is the building block token for the following molecule?
FC(F)(F)c1ncnc(Cl)c1Br
<BB_600>
What is the molecular formula for <BB_600>?
The molecular formula for <BB_600> (FC(F)(F)c1ncnc(Cl)c1Br) is C5HBrClF3N2.
Describe the ring structures in building block <BB_600>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_600>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_600>.
**Token:** <BB_600> **SMILES:** FC(F)(F)c1ncnc(Cl)c1Br **Molecular Formula:** C5HBrClF3N2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_601>.
Cc1ccc(C(=O)O)c2c1CNCC2.Cl
What is the building block token for the following molecule?
Cc1ccc(C(=O)O)c2c1CNCC2.Cl
<BB_601>
What is the molecular formula for <BB_601>?
The molecular formula for <BB_601> (Cc1ccc(C(=O)O)c2c1CNCC2.Cl) is C11H14ClNO2.
Describe the ring structures in building block <BB_601>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_601>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_601>.
**Token:** <BB_601> **SMILES:** Cc1ccc(C(=O)O)c2c1CNCC2.Cl **Molecular Formula:** C11H14ClNO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_602>.
Cl.NC(Cc1ccnc(S)c1)C(=O)O
What is the building block token for the following molecule?
Cl.NC(Cc1ccnc(S)c1)C(=O)O
<BB_602>
What is the molecular formula for <BB_602>?
The molecular formula for <BB_602> (Cl.NC(Cc1ccnc(S)c1)C(=O)O) is C8H11ClN2O2S.
Describe the ring structures in building block <BB_602>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_602>.
The molecule contains the following groups: Carboxylic Acid, Amine, Thiol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_602>.
**Token:** <BB_602> **SMILES:** Cl.NC(Cc1ccnc(S)c1)C(=O)O **Molecular Formula:** C8H11ClN2O2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amine, Thiol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_603>.
Cc1sc(Br)c(C)c1C(=O)O
What is the building block token for the following molecule?
Cc1sc(Br)c(C)c1C(=O)O
<BB_603>
What is the molecular formula for <BB_603>?
The molecular formula for <BB_603> (Cc1sc(Br)c(C)c1C(=O)O) is C7H7BrO2S.
Describe the ring structures in building block <BB_603>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_603>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_603>.
**Token:** <BB_603> **SMILES:** Cc1sc(Br)c(C)c1C(=O)O **Molecular Formula:** C7H7BrO2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_604>.
Cc1cc(C)c(S(=O)(=O)[O-])c(C)c1.N[n+]1ccsc1
What is the building block token for the following molecule?
Cc1cc(C)c(S(=O)(=O)[O-])c(C)c1.N[n+]1ccsc1
<BB_604>
What is the molecular formula for <BB_604>?
The molecular formula for <BB_604> (Cc1cc(C)c(S(=O)(=O)[O-])c(C)c1.N[n+]1ccsc1) is C12H16N2O3S2.
Describe the ring structures in building block <BB_604>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_604>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_604>.
**Token:** <BB_604> **SMILES:** Cc1cc(C)c(S(=O)(=O)[O-])c(C)c1.N[n+]1ccsc1 **Molecular Formula:** C12H16N2O3S2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_605>.
Cc1ccc(OCCBr)cc1
What is the building block token for the following molecule?
Cc1ccc(OCCBr)cc1
<BB_605>
What is the molecular formula for <BB_605>?
The molecular formula for <BB_605> (Cc1ccc(OCCBr)cc1) is C9H11BrO.
Describe the ring structures in building block <BB_605>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_605>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_605>.
**Token:** <BB_605> **SMILES:** Cc1ccc(OCCBr)cc1 **Molecular Formula:** C9H11BrO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_606>.
Ic1c[nH]c2cncnc12
What is the building block token for the following molecule?
Ic1c[nH]c2cncnc12
<BB_606>
What is the molecular formula for <BB_606>?
The molecular formula for <BB_606> (Ic1c[nH]c2cncnc12) is C6H4IN3.
Describe the ring structures in building block <BB_606>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_606>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_606>.
**Token:** <BB_606> **SMILES:** Ic1c[nH]c2cncnc12 **Molecular Formula:** C6H4IN3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_607>.
O=C(O)[C@@H]1CCCN1C(=O)OCc1ccccc1
What is the building block token for the following molecule?
O=C(O)[C@@H]1CCCN1C(=O)OCc1ccccc1
<BB_607>
What is the molecular formula for <BB_607>?
The molecular formula for <BB_607> (O=C(O)[C@@H]1CCCN1C(=O)OCc1ccccc1) is C13H15NO4.
Describe the ring structures in building block <BB_607>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_607>.
The molecule contains the following groups: Carboxylic Acid, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_607>.
**Token:** <BB_607> **SMILES:** O=C(O)[C@@H]1CCCN1C(=O)OCc1ccccc1 **Molecular Formula:** C13H15NO4 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amide, Ether
Provide the SMILES representation for the building block token <BB_608>.
CCCC[Sn](CCCC)(CCCC)c1ccnnc1
What is the building block token for the following molecule?
CCCC[Sn](CCCC)(CCCC)c1ccnnc1
<BB_608>
What is the molecular formula for <BB_608>?
The molecular formula for <BB_608> (CCCC[Sn](CCCC)(CCCC)c1ccnnc1) is C16H30N2Sn.
Describe the ring structures in building block <BB_608>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_608>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_608>.
**Token:** <BB_608> **SMILES:** CCCC[Sn](CCCC)(CCCC)c1ccnnc1 **Molecular Formula:** C16H30N2Sn **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_609>.
CC(C)(C)OC(=O)C1(C)CCNCC1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)C1(C)CCNCC1
<BB_609>
What is the molecular formula for <BB_609>?
The molecular formula for <BB_609> (CC(C)(C)OC(=O)C1(C)CCNCC1) is C11H21NO2.
Describe the ring structures in building block <BB_609>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_609>.
The molecule contains the following groups: Secondary Amine, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_609>.
**Token:** <BB_609> **SMILES:** CC(C)(C)OC(=O)C1(C)CCNCC1 **Molecular Formula:** C11H21NO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Ester, Ether
Provide the SMILES representation for the building block token <BB_610>.
CC1CCCN(Cc2ccccc2CN)C1
What is the building block token for the following molecule?
CC1CCCN(Cc2ccccc2CN)C1
<BB_610>
What is the molecular formula for <BB_610>?
The molecular formula for <BB_610> (CC1CCCN(Cc2ccccc2CN)C1) is C14H22N2.
Describe the ring structures in building block <BB_610>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_610>.
The molecule contains the following groups: Amine, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_610>.
**Token:** <BB_610> **SMILES:** CC1CCCN(Cc2ccccc2CN)C1 **Molecular Formula:** C14H22N2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine
Provide the SMILES representation for the building block token <BB_611>.
Cc1ccccc1-c1noc(C)c1C(=O)O
What is the building block token for the following molecule?
Cc1ccccc1-c1noc(C)c1C(=O)O
<BB_611>
What is the molecular formula for <BB_611>?
The molecular formula for <BB_611> (Cc1ccccc1-c1noc(C)c1C(=O)O) is C12H11NO3.
Describe the ring structures in building block <BB_611>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_611>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_611>.
**Token:** <BB_611> **SMILES:** Cc1ccccc1-c1noc(C)c1C(=O)O **Molecular Formula:** C12H11NO3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_612>.
COC(=O)CC(C)(F)F
What is the building block token for the following molecule?
COC(=O)CC(C)(F)F
<BB_612>
What is the molecular formula for <BB_612>?
The molecular formula for <BB_612> (COC(=O)CC(C)(F)F) is C5H8F2O2.
Describe the ring structures in building block <BB_612>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_612>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_612>.
**Token:** <BB_612> **SMILES:** COC(=O)CC(C)(F)F **Molecular Formula:** C5H8F2O2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_613>.
COC(=O)C(C#N)c1ccccc1
What is the building block token for the following molecule?
COC(=O)C(C#N)c1ccccc1
<BB_613>
What is the molecular formula for <BB_613>?
The molecular formula for <BB_613> (COC(=O)C(C#N)c1ccccc1) is C10H9NO2.
Describe the ring structures in building block <BB_613>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_613>.
The molecule contains the following groups: Ester, Ether, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_613>.
**Token:** <BB_613> **SMILES:** COC(=O)C(C#N)c1ccccc1 **Molecular Formula:** C10H9NO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Ether, Nitrile
Provide the SMILES representation for the building block token <BB_614>.
C[Si](C)(C)C1(CO)CC1
What is the building block token for the following molecule?
C[Si](C)(C)C1(CO)CC1
<BB_614>
What is the molecular formula for <BB_614>?
The molecular formula for <BB_614> (C[Si](C)(C)C1(CO)CC1) is C7H16OSi.
Describe the ring structures in building block <BB_614>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_614>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_614>.
**Token:** <BB_614> **SMILES:** C[Si](C)(C)C1(CO)CC1 **Molecular Formula:** C7H16OSi **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_615>.
CC(C)(C)OC(=O)N1CC(C(=O)O)CC12CCC2
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CC(C(=O)O)CC12CCC2
<BB_615>
What is the molecular formula for <BB_615>?
The molecular formula for <BB_615> (CC(C)(C)OC(=O)N1CC(C(=O)O)CC12CCC2) is C13H21NO4.
Describe the ring structures in building block <BB_615>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 4.
List the primary functional groups present in <BB_615>.
The molecule contains the following groups: Carboxylic Acid, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_615>.
**Token:** <BB_615> **SMILES:** CC(C)(C)OC(=O)N1CC(C(=O)O)CC12CCC2 **Molecular Formula:** C13H21NO4 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 4. **Functional Groups:** Carboxylic Acid, Amide, Ether
Provide the SMILES representation for the building block token <BB_616>.
Cl.Nc1cccc(F)c1OC(F)(F)F
What is the building block token for the following molecule?
Cl.Nc1cccc(F)c1OC(F)(F)F
<BB_616>
What is the molecular formula for <BB_616>?
The molecular formula for <BB_616> (Cl.Nc1cccc(F)c1OC(F)(F)F) is C7H6ClF4NO.
Describe the ring structures in building block <BB_616>.
The molecule contains 1 ring(s): an aromatic ring of size 6.