instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_616>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_616>.
**Token:** <BB_616> **SMILES:** Cl.Nc1cccc(F)c1OC(F)(F)F **Molecular Formula:** C7H6ClF4NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_617>.
Cl.NCCCl
What is the building block token for the following molecule?
Cl.NCCCl
<BB_617>
What is the molecular formula for <BB_617>?
The molecular formula for <BB_617> (Cl.NCCCl) is C2H7Cl2N.
Describe the ring structures in building block <BB_617>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_617>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_617>.
**Token:** <BB_617> **SMILES:** Cl.NCCCl **Molecular Formula:** C2H7Cl2N **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_618>.
Cc1cc(N)c(N)c(F)c1.Cl.Cl
What is the building block token for the following molecule?
Cc1cc(N)c(N)c(F)c1.Cl.Cl
<BB_618>
What is the molecular formula for <BB_618>?
The molecular formula for <BB_618> (Cc1cc(N)c(N)c(F)c1.Cl.Cl) is C7H11Cl2FN2.
Describe the ring structures in building block <BB_618>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_618>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_618>.
**Token:** <BB_618> **SMILES:** Cc1cc(N)c(N)c(F)c1.Cl.Cl **Molecular Formula:** C7H11Cl2FN2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_619>.
COc1ccccc1CC(=O)C(=O)O
What is the building block token for the following molecule?
COc1ccccc1CC(=O)C(=O)O
<BB_619>
What is the molecular formula for <BB_619>?
The molecular formula for <BB_619> (COc1ccccc1CC(=O)C(=O)O) is C10H10O4.
Describe the ring structures in building block <BB_619>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_619>.
The molecule contains the following groups: Carboxylic Acid, Ketone, Ether.
Provide a comprehensive chemical profile for the building block <BB_619>.
**Token:** <BB_619> **SMILES:** COc1ccccc1CC(=O)C(=O)O **Molecular Formula:** C10H10O4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ketone, Ether
Provide the SMILES representation for the building block token <BB_620>.
CC1(N)CCN(c2ccc(F)cc2)C1.Cl.Cl
What is the building block token for the following molecule?
CC1(N)CCN(c2ccc(F)cc2)C1.Cl.Cl
<BB_620>
What is the molecular formula for <BB_620>?
The molecular formula for <BB_620> (CC1(N)CCN(c2ccc(F)cc2)C1.Cl.Cl) is C11H17Cl2FN2.
Describe the ring structures in building block <BB_620>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_620>.
The molecule contains the following groups: Amine, Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_620>.
**Token:** <BB_620> **SMILES:** CC1(N)CCN(c2ccc(F)cc2)C1.Cl.Cl **Molecular Formula:** C11H17Cl2FN2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_621>.
O=C(O)C1CC12CCCCCC2
What is the building block token for the following molecule?
O=C(O)C1CC12CCCCCC2
<BB_621>
What is the molecular formula for <BB_621>?
The molecular formula for <BB_621> (O=C(O)C1CC12CCCCCC2) is C10H16O2.
Describe the ring structures in building block <BB_621>.
The molecule contains 2 ring(s): an aliphatic ring of size 3, an aliphatic ring of size 7.
List the primary functional groups present in <BB_621>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_621>.
**Token:** <BB_621> **SMILES:** O=C(O)C1CC12CCCCCC2 **Molecular Formula:** C10H16O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 3, an aliphatic ring of size 7. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_622>.
CSc1cccc(C(N)=O)c1N
What is the building block token for the following molecule?
CSc1cccc(C(N)=O)c1N
<BB_622>
What is the molecular formula for <BB_622>?
The molecular formula for <BB_622> (CSc1cccc(C(N)=O)c1N) is C8H10N2OS.
Describe the ring structures in building block <BB_622>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_622>.
The molecule contains the following groups: Amine, Amide, Sulfide.
Provide a comprehensive chemical profile for the building block <BB_622>.
**Token:** <BB_622> **SMILES:** CSc1cccc(C(N)=O)c1N **Molecular Formula:** C8H10N2OS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Amide, Sulfide
Provide the SMILES representation for the building block token <BB_623>.
O=C(O)C12CC1CCNC2=O
What is the building block token for the following molecule?
O=C(O)C12CC1CCNC2=O
<BB_623>
What is the molecular formula for <BB_623>?
The molecular formula for <BB_623> (O=C(O)C12CC1CCNC2=O) is C7H9NO3.
Describe the ring structures in building block <BB_623>.
The molecule contains 2 ring(s): an aliphatic ring of size 3, an aliphatic ring of size 6.
List the primary functional groups present in <BB_623>.
The molecule contains the following groups: Carboxylic Acid, Amide.
Provide a comprehensive chemical profile for the building block <BB_623>.
**Token:** <BB_623> **SMILES:** O=C(O)C12CC1CCNC2=O **Molecular Formula:** C7H9NO3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 3, an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amide
Provide the SMILES representation for the building block token <BB_624>.
OCC1CCCC2(CC2)C1
What is the building block token for the following molecule?
OCC1CCCC2(CC2)C1
<BB_624>
What is the molecular formula for <BB_624>?
The molecular formula for <BB_624> (OCC1CCCC2(CC2)C1) is C9H16O.
Describe the ring structures in building block <BB_624>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_624>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_624>.
**Token:** <BB_624> **SMILES:** OCC1CCCC2(CC2)C1 **Molecular Formula:** C9H16O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_625>.
N#CCn1cccc(Br)c1=O
What is the building block token for the following molecule?
N#CCn1cccc(Br)c1=O
<BB_625>
What is the molecular formula for <BB_625>?
The molecular formula for <BB_625> (N#CCn1cccc(Br)c1=O) is C7H5BrN2O.
Describe the ring structures in building block <BB_625>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_625>.
The molecule contains the following groups: Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_625>.
**Token:** <BB_625> **SMILES:** N#CCn1cccc(Br)c1=O **Molecular Formula:** C7H5BrN2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_626>.
CN(C)C(=O)Sc1ccc2c(c1)CCCC2=O
What is the building block token for the following molecule?
CN(C)C(=O)Sc1ccc2c(c1)CCCC2=O
<BB_626>
What is the molecular formula for <BB_626>?
The molecular formula for <BB_626> (CN(C)C(=O)Sc1ccc2c(c1)CCCC2=O) is C13H15NO2S.
Describe the ring structures in building block <BB_626>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_626>.
The molecule contains the following groups: Amide, Ketone, Sulfide.
Provide a comprehensive chemical profile for the building block <BB_626>.
**Token:** <BB_626> **SMILES:** CN(C)C(=O)Sc1ccc2c(c1)CCCC2=O **Molecular Formula:** C13H15NO2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Amide, Ketone, Sulfide
Provide the SMILES representation for the building block token <BB_627>.
O=C(O)c1ccccc1-c1nc2ccccc2s1
What is the building block token for the following molecule?
O=C(O)c1ccccc1-c1nc2ccccc2s1
<BB_627>
What is the molecular formula for <BB_627>?
The molecular formula for <BB_627> (O=C(O)c1ccccc1-c1nc2ccccc2s1) is C14H9NO2S.
Describe the ring structures in building block <BB_627>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_627>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_627>.
**Token:** <BB_627> **SMILES:** O=C(O)c1ccccc1-c1nc2ccccc2s1 **Molecular Formula:** C14H9NO2S **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_628>.
CC(C)(O)/C=C/B1OC(C)(C)C(C)(C)O1
What is the building block token for the following molecule?
CC(C)(O)/C=C/B1OC(C)(C)C(C)(C)O1
<BB_628>
What is the molecular formula for <BB_628>?
The molecular formula for <BB_628> (CC(C)(O)/C=C/B1OC(C)(C)C(C)(C)O1) is C11H21BO3.
Describe the ring structures in building block <BB_628>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_628>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_628>.
**Token:** <BB_628> **SMILES:** CC(C)(O)/C=C/B1OC(C)(C)C(C)(C)O1 **Molecular Formula:** C11H21BO3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_629>.
Cc1nc2sccn2c1C#N
What is the building block token for the following molecule?
Cc1nc2sccn2c1C#N
<BB_629>
What is the molecular formula for <BB_629>?
The molecular formula for <BB_629> (Cc1nc2sccn2c1C#N) is C7H5N3S.
Describe the ring structures in building block <BB_629>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5.
List the primary functional groups present in <BB_629>.
The molecule contains the following groups: Nitrile.
Provide a comprehensive chemical profile for the building block <BB_629>.
**Token:** <BB_629> **SMILES:** Cc1nc2sccn2c1C#N **Molecular Formula:** C7H5N3S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5. **Functional Groups:** Nitrile
Provide the SMILES representation for the building block token <BB_630>.
CC(C)n1ncc2c(=O)[nH]cnc21
What is the building block token for the following molecule?
CC(C)n1ncc2c(=O)[nH]cnc21
<BB_630>
What is the molecular formula for <BB_630>?
The molecular formula for <BB_630> (CC(C)n1ncc2c(=O)[nH]cnc21) is C8H10N4O.
Describe the ring structures in building block <BB_630>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_630>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_630>.
**Token:** <BB_630> **SMILES:** CC(C)n1ncc2c(=O)[nH]cnc21 **Molecular Formula:** C8H10N4O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_631>.
Brc1cncc(C2OCCO2)c1
What is the building block token for the following molecule?
Brc1cncc(C2OCCO2)c1
<BB_631>
What is the molecular formula for <BB_631>?
The molecular formula for <BB_631> (Brc1cncc(C2OCCO2)c1) is C8H8BrNO2.
Describe the ring structures in building block <BB_631>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_631>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_631>.
**Token:** <BB_631> **SMILES:** Brc1cncc(C2OCCO2)c1 **Molecular Formula:** C8H8BrNO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_632>.
Nc1ccc2c(C(=O)O)n[nH]c2c1
What is the building block token for the following molecule?
Nc1ccc2c(C(=O)O)n[nH]c2c1
<BB_632>
What is the molecular formula for <BB_632>?
The molecular formula for <BB_632> (Nc1ccc2c(C(=O)O)n[nH]c2c1) is C8H7N3O2.
Describe the ring structures in building block <BB_632>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_632>.
The molecule contains the following groups: Carboxylic Acid, Amine.
Provide a comprehensive chemical profile for the building block <BB_632>.
**Token:** <BB_632> **SMILES:** Nc1ccc2c(C(=O)O)n[nH]c2c1 **Molecular Formula:** C8H7N3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Amine
Provide the SMILES representation for the building block token <BB_633>.
O=S(=O)(Cl)c1cc2c(Br)cncc2s1
What is the building block token for the following molecule?
O=S(=O)(Cl)c1cc2c(Br)cncc2s1
<BB_633>