instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_633>?
The molecular formula for <BB_633> (O=S(=O)(Cl)c1cc2c(Br)cncc2s1) is C7H3BrClNO2S2.
Describe the ring structures in building block <BB_633>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_633>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_633>.
**Token:** <BB_633> **SMILES:** O=S(=O)(Cl)c1cc2c(Br)cncc2s1 **Molecular Formula:** C7H3BrClNO2S2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_634>.
CCc1nc(C)c(C(=O)O)o1
What is the building block token for the following molecule?
CCc1nc(C)c(C(=O)O)o1
<BB_634>
What is the molecular formula for <BB_634>?
The molecular formula for <BB_634> (CCc1nc(C)c(C(=O)O)o1) is C7H9NO3.
Describe the ring structures in building block <BB_634>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_634>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_634>.
**Token:** <BB_634> **SMILES:** CCc1nc(C)c(C(=O)O)o1 **Molecular Formula:** C7H9NO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_635>.
O=C(O)c1cccc2nc(O)ccc12
What is the building block token for the following molecule?
O=C(O)c1cccc2nc(O)ccc12
<BB_635>
What is the molecular formula for <BB_635>?
The molecular formula for <BB_635> (O=C(O)c1cccc2nc(O)ccc12) is C10H7NO3.
Describe the ring structures in building block <BB_635>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_635>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_635>.
**Token:** <BB_635> **SMILES:** O=C(O)c1cccc2nc(O)ccc12 **Molecular Formula:** C10H7NO3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_636>.
NC1CCC(c2nc(-c3ccccc3)n[nH]2)CC1
What is the building block token for the following molecule?
NC1CCC(c2nc(-c3ccccc3)n[nH]2)CC1
<BB_636>
What is the molecular formula for <BB_636>?
The molecular formula for <BB_636> (NC1CCC(c2nc(-c3ccccc3)n[nH]2)CC1) is C14H18N4.
Describe the ring structures in building block <BB_636>.
The molecule contains 3 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_636>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_636>.
**Token:** <BB_636> **SMILES:** NC1CCC(c2nc(-c3ccccc3)n[nH]2)CC1 **Molecular Formula:** C14H18N4 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_637>.
CNC=Nc1ccc(C)cc1C.Cl
What is the building block token for the following molecule?
CNC=Nc1ccc(C)cc1C.Cl
<BB_637>
What is the molecular formula for <BB_637>?
The molecular formula for <BB_637> (CNC=Nc1ccc(C)cc1C.Cl) is C10H15ClN2.
Describe the ring structures in building block <BB_637>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_637>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_637>.
**Token:** <BB_637> **SMILES:** CNC=Nc1ccc(C)cc1C.Cl **Molecular Formula:** C10H15ClN2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_638>.
FC(F)CNC1CCOCC1
What is the building block token for the following molecule?
FC(F)CNC1CCOCC1
<BB_638>
What is the molecular formula for <BB_638>?
The molecular formula for <BB_638> (FC(F)CNC1CCOCC1) is C7H13F2NO.
Describe the ring structures in building block <BB_638>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_638>.
The molecule contains the following groups: Secondary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_638>.
**Token:** <BB_638> **SMILES:** FC(F)CNC1CCOCC1 **Molecular Formula:** C7H13F2NO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_639>.
O=C(O)c1cc2cccc(C(F)(F)F)c2[nH]1
What is the building block token for the following molecule?
O=C(O)c1cc2cccc(C(F)(F)F)c2[nH]1
<BB_639>
What is the molecular formula for <BB_639>?
The molecular formula for <BB_639> (O=C(O)c1cc2cccc(C(F)(F)F)c2[nH]1) is C10H6F3NO2.
Describe the ring structures in building block <BB_639>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_639>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_639>.
**Token:** <BB_639> **SMILES:** O=C(O)c1cc2cccc(C(F)(F)F)c2[nH]1 **Molecular Formula:** C10H6F3NO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_640>.
COc1ccccc1C(CN)N(C)C
What is the building block token for the following molecule?
COc1ccccc1C(CN)N(C)C
<BB_640>
What is the molecular formula for <BB_640>?
The molecular formula for <BB_640> (COc1ccccc1C(CN)N(C)C) is C11H18N2O.
Describe the ring structures in building block <BB_640>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_640>.
The molecule contains the following groups: Amine, Tertiary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_640>.
**Token:** <BB_640> **SMILES:** COc1ccccc1C(CN)N(C)C **Molecular Formula:** C11H18N2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Ether
Provide the SMILES representation for the building block token <BB_641>.
CN(C)C(=O)c1cnc(Cl)cn1
What is the building block token for the following molecule?
CN(C)C(=O)c1cnc(Cl)cn1
<BB_641>
What is the molecular formula for <BB_641>?
The molecular formula for <BB_641> (CN(C)C(=O)c1cnc(Cl)cn1) is C7H8ClN3O.
Describe the ring structures in building block <BB_641>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_641>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_641>.
**Token:** <BB_641> **SMILES:** CN(C)C(=O)c1cnc(Cl)cn1 **Molecular Formula:** C7H8ClN3O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_642>.
CC(C)(C)OC(=O)NCCS(=O)(=O)CC(=O)O
What is the building block token for the following molecule?
CC(C)(C)OC(=O)NCCS(=O)(=O)CC(=O)O
<BB_642>
What is the molecular formula for <BB_642>?
The molecular formula for <BB_642> (CC(C)(C)OC(=O)NCCS(=O)(=O)CC(=O)O) is C9H17NO6S.
Describe the ring structures in building block <BB_642>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_642>.
The molecule contains the following groups: Carboxylic Acid, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_642>.
**Token:** <BB_642> **SMILES:** CC(C)(C)OC(=O)NCCS(=O)(=O)CC(=O)O **Molecular Formula:** C9H17NO6S **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid, Amide, Ether
Provide the SMILES representation for the building block token <BB_643>.
COc1cc(C(=O)O)cc([N+](=O)[O-])c1I
What is the building block token for the following molecule?
COc1cc(C(=O)O)cc([N+](=O)[O-])c1I
<BB_643>
What is the molecular formula for <BB_643>?
The molecular formula for <BB_643> (COc1cc(C(=O)O)cc([N+](=O)[O-])c1I) is C8H6INO5.
Describe the ring structures in building block <BB_643>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_643>.
The molecule contains the following groups: Carboxylic Acid, Tertiary Amine, Ether, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_643>.
**Token:** <BB_643> **SMILES:** COc1cc(C(=O)O)cc([N+](=O)[O-])c1I **Molecular Formula:** C8H6INO5 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Tertiary Amine, Ether, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_644>.
Cl.O=C(O)C(=O)Nc1ncc[nH]1
What is the building block token for the following molecule?
Cl.O=C(O)C(=O)Nc1ncc[nH]1
<BB_644>
What is the molecular formula for <BB_644>?
The molecular formula for <BB_644> (Cl.O=C(O)C(=O)Nc1ncc[nH]1) is C5H6ClN3O3.
Describe the ring structures in building block <BB_644>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_644>.
The molecule contains the following groups: Carboxylic Acid, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_644>.
**Token:** <BB_644> **SMILES:** Cl.O=C(O)C(=O)Nc1ncc[nH]1 **Molecular Formula:** C5H6ClN3O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_645>.
Cn1cnc2c(Cl)nc(N)nc21
What is the building block token for the following molecule?
Cn1cnc2c(Cl)nc(N)nc21
<BB_645>
What is the molecular formula for <BB_645>?
The molecular formula for <BB_645> (Cn1cnc2c(Cl)nc(N)nc21) is C6H6ClN5.
Describe the ring structures in building block <BB_645>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_645>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_645>.
**Token:** <BB_645> **SMILES:** Cn1cnc2c(Cl)nc(N)nc21 **Molecular Formula:** C6H6ClN5 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_646>.
Cc1ccc2c(c1)CCC2(C)N.Cl
What is the building block token for the following molecule?
Cc1ccc2c(c1)CCC2(C)N.Cl
<BB_646>
What is the molecular formula for <BB_646>?
The molecular formula for <BB_646> (Cc1ccc2c(c1)CCC2(C)N.Cl) is C11H16ClN.
Describe the ring structures in building block <BB_646>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_646>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_646>.
**Token:** <BB_646> **SMILES:** Cc1ccc2c(c1)CCC2(C)N.Cl **Molecular Formula:** C11H16ClN **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_647>.
Clc1ccc(C2CNC2)cc1.O=C(O)C(F)(F)F
What is the building block token for the following molecule?
Clc1ccc(C2CNC2)cc1.O=C(O)C(F)(F)F
<BB_647>
What is the molecular formula for <BB_647>?
The molecular formula for <BB_647> (Clc1ccc(C2CNC2)cc1.O=C(O)C(F)(F)F) is C11H11ClF3NO2.
Describe the ring structures in building block <BB_647>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 4.
List the primary functional groups present in <BB_647>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_647>.
**Token:** <BB_647> **SMILES:** Clc1ccc(C2CNC2)cc1.O=C(O)C(F)(F)F **Molecular Formula:** C11H11ClF3NO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 4. **Functional Groups:** Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_648>.
COC(=O)c1cccc(N=[N+]=[N-])c1C
What is the building block token for the following molecule?
COC(=O)c1cccc(N=[N+]=[N-])c1C
<BB_648>
What is the molecular formula for <BB_648>?
The molecular formula for <BB_648> (COC(=O)c1cccc(N=[N+]=[N-])c1C) is C9H9N3O2.
Describe the ring structures in building block <BB_648>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_648>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_648>.
**Token:** <BB_648> **SMILES:** COC(=O)c1cccc(N=[N+]=[N-])c1C **Molecular Formula:** C9H9N3O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_649>.
Nc1ncc([N+](=O)[O-])cc1C(=O)O
What is the building block token for the following molecule?
Nc1ncc([N+](=O)[O-])cc1C(=O)O
<BB_649>
What is the molecular formula for <BB_649>?
The molecular formula for <BB_649> (Nc1ncc([N+](=O)[O-])cc1C(=O)O) is C6H5N3O4.
Describe the ring structures in building block <BB_649>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_649>.
The molecule contains the following groups: Carboxylic Acid, Amine, Tertiary Amine, Nitro.
Provide a comprehensive chemical profile for the building block <BB_649>.
**Token:** <BB_649> **SMILES:** Nc1ncc([N+](=O)[O-])cc1C(=O)O **Molecular Formula:** C6H5N3O4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amine, Tertiary Amine, Nitro