instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_650>.
OCC1CN(CCC(F)(F)F)C1
What is the building block token for the following molecule?
OCC1CN(CCC(F)(F)F)C1
<BB_650>
What is the molecular formula for <BB_650>?
The molecular formula for <BB_650> (OCC1CN(CCC(F)(F)F)C1) is C7H12F3NO.
Describe the ring structures in building block <BB_650>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_650>.
The molecule contains the following groups: Tertiary Amine, Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_650>.
**Token:** <BB_650> **SMILES:** OCC1CN(CCC(F)(F)F)C1 **Molecular Formula:** C7H12F3NO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Tertiary Amine, Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_651>.
Cc1nc(C(=O)O)nn1-c1cccc(C(F)(F)F)c1
What is the building block token for the following molecule?
Cc1nc(C(=O)O)nn1-c1cccc(C(F)(F)F)c1
<BB_651>
What is the molecular formula for <BB_651>?
The molecular formula for <BB_651> (Cc1nc(C(=O)O)nn1-c1cccc(C(F)(F)F)c1) is C11H8F3N3O2.
Describe the ring structures in building block <BB_651>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_651>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_651>.
**Token:** <BB_651> **SMILES:** Cc1nc(C(=O)O)nn1-c1cccc(C(F)(F)F)c1 **Molecular Formula:** C11H8F3N3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_652>.
ClCC1CC(CCc2ccccc2)=NO1
What is the building block token for the following molecule?
ClCC1CC(CCc2ccccc2)=NO1
<BB_652>
What is the molecular formula for <BB_652>?
The molecular formula for <BB_652> (ClCC1CC(CCc2ccccc2)=NO1) is C12H14ClNO.
Describe the ring structures in building block <BB_652>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_652>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_652>.
**Token:** <BB_652> **SMILES:** ClCC1CC(CCc2ccccc2)=NO1 **Molecular Formula:** C12H14ClNO **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_653>.
NCC1CC2(CCOC2)CO1
What is the building block token for the following molecule?
NCC1CC2(CCOC2)CO1
<BB_653>
What is the molecular formula for <BB_653>?
The molecular formula for <BB_653> (NCC1CC2(CCOC2)CO1) is C8H15NO2.
Describe the ring structures in building block <BB_653>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_653>.
The molecule contains the following groups: Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_653>.
**Token:** <BB_653> **SMILES:** NCC1CC2(CCOC2)CO1 **Molecular Formula:** C8H15NO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Amine, Ether
Provide the SMILES representation for the building block token <BB_654>.
O=c1[nH]ncc2c1cnn2-c1ccccc1
What is the building block token for the following molecule?
O=c1[nH]ncc2c1cnn2-c1ccccc1
<BB_654>
What is the molecular formula for <BB_654>?
The molecular formula for <BB_654> (O=c1[nH]ncc2c1cnn2-c1ccccc1) is C11H8N4O.
Describe the ring structures in building block <BB_654>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_654>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_654>.
**Token:** <BB_654> **SMILES:** O=c1[nH]ncc2c1cnn2-c1ccccc1 **Molecular Formula:** C11H8N4O **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_655>.
Cc1cc2c(F)cc(Br)cc2[nH]1
What is the building block token for the following molecule?
Cc1cc2c(F)cc(Br)cc2[nH]1
<BB_655>
What is the molecular formula for <BB_655>?
The molecular formula for <BB_655> (Cc1cc2c(F)cc(Br)cc2[nH]1) is C9H7BrFN.
Describe the ring structures in building block <BB_655>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_655>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_655>.
**Token:** <BB_655> **SMILES:** Cc1cc2c(F)cc(Br)cc2[nH]1 **Molecular Formula:** C9H7BrFN **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_656>.
COC(=O)[C@H](CC(=O)CBr)NC(=O)OC(C)(C)C
What is the building block token for the following molecule?
COC(=O)[C@H](CC(=O)CBr)NC(=O)OC(C)(C)C
<BB_656>
What is the molecular formula for <BB_656>?
The molecular formula for <BB_656> (COC(=O)[C@H](CC(=O)CBr)NC(=O)OC(C)(C)C) is C11H18BrNO5.
Describe the ring structures in building block <BB_656>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_656>.
The molecule contains the following groups: Amide, Ester, Ketone, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_656>.
**Token:** <BB_656> **SMILES:** COC(=O)[C@H](CC(=O)CBr)NC(=O)OC(C)(C)C **Molecular Formula:** C11H18BrNO5 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amide, Ester, Ketone, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_657>.
CC(N)c1ccoc1.Cl
What is the building block token for the following molecule?
CC(N)c1ccoc1.Cl
<BB_657>
What is the molecular formula for <BB_657>?
The molecular formula for <BB_657> (CC(N)c1ccoc1.Cl) is C6H10ClNO.
Describe the ring structures in building block <BB_657>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_657>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_657>.
**Token:** <BB_657> **SMILES:** CC(N)c1ccoc1.Cl **Molecular Formula:** C6H10ClNO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_658>.
COc1cc2ncccc2c2cccnc12
What is the building block token for the following molecule?
COc1cc2ncccc2c2cccnc12
<BB_658>
What is the molecular formula for <BB_658>?
The molecular formula for <BB_658> (COc1cc2ncccc2c2cccnc12) is C13H10N2O.
Describe the ring structures in building block <BB_658>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_658>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_658>.
**Token:** <BB_658> **SMILES:** COc1cc2ncccc2c2cccnc12 **Molecular Formula:** C13H10N2O **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_659>.
CN1CCN(C(=O)c2ccccc2C(=O)O)CC1
What is the building block token for the following molecule?
CN1CCN(C(=O)c2ccccc2C(=O)O)CC1
<BB_659>
What is the molecular formula for <BB_659>?
The molecular formula for <BB_659> (CN1CCN(C(=O)c2ccccc2C(=O)O)CC1) is C13H16N2O3.
Describe the ring structures in building block <BB_659>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_659>.
The molecule contains the following groups: Carboxylic Acid, Tertiary Amine, Amide.
Provide a comprehensive chemical profile for the building block <BB_659>.
**Token:** <BB_659> **SMILES:** CN1CCN(C(=O)c2ccccc2C(=O)O)CC1 **Molecular Formula:** C13H16N2O3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Tertiary Amine, Amide
Provide the SMILES representation for the building block token <BB_660>.
CC(C)c1nc(CC(=O)O)cs1
What is the building block token for the following molecule?
CC(C)c1nc(CC(=O)O)cs1
<BB_660>
What is the molecular formula for <BB_660>?
The molecular formula for <BB_660> (CC(C)c1nc(CC(=O)O)cs1) is C8H11NO2S.
Describe the ring structures in building block <BB_660>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_660>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_660>.
**Token:** <BB_660> **SMILES:** CC(C)c1nc(CC(=O)O)cs1 **Molecular Formula:** C8H11NO2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_661>.
Cc1ncc(Br)c(N)n1
What is the building block token for the following molecule?
Cc1ncc(Br)c(N)n1
<BB_661>
What is the molecular formula for <BB_661>?
The molecular formula for <BB_661> (Cc1ncc(Br)c(N)n1) is C5H6BrN3.
Describe the ring structures in building block <BB_661>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_661>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_661>.
**Token:** <BB_661> **SMILES:** Cc1ncc(Br)c(N)n1 **Molecular Formula:** C5H6BrN3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_662>.
C=CC(C)(C)B1OC(C)(C)C(C)(C)O1
What is the building block token for the following molecule?
C=CC(C)(C)B1OC(C)(C)C(C)(C)O1
<BB_662>
What is the molecular formula for <BB_662>?
The molecular formula for <BB_662> (C=CC(C)(C)B1OC(C)(C)C(C)(C)O1) is C11H21BO2.
Describe the ring structures in building block <BB_662>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_662>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_662>.
**Token:** <BB_662> **SMILES:** C=CC(C)(C)B1OC(C)(C)C(C)(C)O1 **Molecular Formula:** C11H21BO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_663>.
c1ncn2c1CCCC2
What is the building block token for the following molecule?
c1ncn2c1CCCC2
<BB_663>
What is the molecular formula for <BB_663>?
The molecular formula for <BB_663> (c1ncn2c1CCCC2) is C7H10N2.
Describe the ring structures in building block <BB_663>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_663>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_663>.
**Token:** <BB_663> **SMILES:** c1ncn2c1CCCC2 **Molecular Formula:** C7H10N2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_664>.
CC1CN(C(=O)OC(C)(C)C)CC12CCCCC2=O
What is the building block token for the following molecule?
CC1CN(C(=O)OC(C)(C)C)CC12CCCCC2=O
<BB_664>
What is the molecular formula for <BB_664>?
The molecular formula for <BB_664> (CC1CN(C(=O)OC(C)(C)C)CC12CCCCC2=O) is C15H25NO3.
Describe the ring structures in building block <BB_664>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_664>.
The molecule contains the following groups: Amide, Ketone, Ether.
Provide a comprehensive chemical profile for the building block <BB_664>.
**Token:** <BB_664> **SMILES:** CC1CN(C(=O)OC(C)(C)C)CC12CCCCC2=O **Molecular Formula:** C15H25NO3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Amide, Ketone, Ether
Provide the SMILES representation for the building block token <BB_665>.
CC(C)C(CN)CO
What is the building block token for the following molecule?
CC(C)C(CN)CO
<BB_665>
What is the molecular formula for <BB_665>?
The molecular formula for <BB_665> (CC(C)C(CN)CO) is C6H15NO.
Describe the ring structures in building block <BB_665>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_665>.
The molecule contains the following groups: Amine, Alcohol.
Provide a comprehensive chemical profile for the building block <BB_665>.
**Token:** <BB_665> **SMILES:** CC(C)C(CN)CO **Molecular Formula:** C6H15NO **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Alcohol
Provide the SMILES representation for the building block token <BB_666>.
Cc1cccc(N2CCC(N)CC2)n1
What is the building block token for the following molecule?
Cc1cccc(N2CCC(N)CC2)n1
<BB_666>
What is the molecular formula for <BB_666>?
The molecular formula for <BB_666> (Cc1cccc(N2CCC(N)CC2)n1) is C11H17N3.
Describe the ring structures in building block <BB_666>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.