instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_683>?
The molecular formula for <BB_683> (Cc1ccc2ccc(N)c(O)c2n1) is C10H10N2O.
Describe the ring structures in building block <BB_683>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_683>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_683>.
**Token:** <BB_683> **SMILES:** Cc1ccc2ccc(N)c(O)c2n1 **Molecular Formula:** C10H10N2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_684>.
CC(Br)C(=O)c1cccc(Cl)c1
What is the building block token for the following molecule?
CC(Br)C(=O)c1cccc(Cl)c1
<BB_684>
What is the molecular formula for <BB_684>?
The molecular formula for <BB_684> (CC(Br)C(=O)c1cccc(Cl)c1) is C9H8BrClO.
Describe the ring structures in building block <BB_684>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_684>.
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_684>.
**Token:** <BB_684> **SMILES:** CC(Br)C(=O)c1cccc(Cl)c1 **Molecular Formula:** C9H8BrClO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_685>.
COc1ncnc(N(C)C)c1N
What is the building block token for the following molecule?
COc1ncnc(N(C)C)c1N
<BB_685>
What is the molecular formula for <BB_685>?
The molecular formula for <BB_685> (COc1ncnc(N(C)C)c1N) is C7H12N4O.
Describe the ring structures in building block <BB_685>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_685>.
The molecule contains the following groups: Amine, Tertiary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_685>.
**Token:** <BB_685> **SMILES:** COc1ncnc(N(C)C)c1N **Molecular Formula:** C7H12N4O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Ether
Provide the SMILES representation for the building block token <BB_686>.
O=S(=O)(Cl)c1cnn(-c2ccccc2)c1
What is the building block token for the following molecule?
O=S(=O)(Cl)c1cnn(-c2ccccc2)c1
<BB_686>
What is the molecular formula for <BB_686>?
The molecular formula for <BB_686> (O=S(=O)(Cl)c1cnn(-c2ccccc2)c1) is C9H7ClN2O2S.
Describe the ring structures in building block <BB_686>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_686>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_686>.
**Token:** <BB_686> **SMILES:** O=S(=O)(Cl)c1cnn(-c2ccccc2)c1 **Molecular Formula:** C9H7ClN2O2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_687>.
CCOC(=O)[C@@H]1[C@H]2CC[C@H](N)[C@H]21.Cl
What is the building block token for the following molecule?
CCOC(=O)[C@@H]1[C@H]2CC[C@H](N)[C@H]21.Cl
<BB_687>
What is the molecular formula for <BB_687>?
The molecular formula for <BB_687> (CCOC(=O)[C@@H]1[C@H]2CC[C@H](N)[C@H]21.Cl) is C9H16ClNO2.
Describe the ring structures in building block <BB_687>.
The molecule contains 2 ring(s): an aliphatic ring of size 3, an aliphatic ring of size 5.
List the primary functional groups present in <BB_687>.
The molecule contains the following groups: Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_687>.
**Token:** <BB_687> **SMILES:** CCOC(=O)[C@@H]1[C@H]2CC[C@H](N)[C@H]21.Cl **Molecular Formula:** C9H16ClNO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 3, an aliphatic ring of size 5. **Functional Groups:** Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_688>.
CCC(O)CCc1cccnc1
What is the building block token for the following molecule?
CCC(O)CCc1cccnc1
<BB_688>
What is the molecular formula for <BB_688>?
The molecular formula for <BB_688> (CCC(O)CCc1cccnc1) is C10H15NO.
Describe the ring structures in building block <BB_688>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_688>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_688>.
**Token:** <BB_688> **SMILES:** CCC(O)CCc1cccnc1 **Molecular Formula:** C10H15NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_689>.
CC(C)(C)OC(=O)NCC1CNCCCO1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)NCC1CNCCCO1
<BB_689>
What is the molecular formula for <BB_689>?
The molecular formula for <BB_689> (CC(C)(C)OC(=O)NCC1CNCCCO1) is C11H22N2O3.
Describe the ring structures in building block <BB_689>.
The molecule contains 1 ring(s): an aliphatic ring of size 7.
List the primary functional groups present in <BB_689>.
The molecule contains the following groups: Secondary Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_689>.
**Token:** <BB_689> **SMILES:** CC(C)(C)OC(=O)NCC1CNCCCO1 **Molecular Formula:** C11H22N2O3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 7. **Functional Groups:** Secondary Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_690>.
O=C(O)Cc1sncc1Br
What is the building block token for the following molecule?
O=C(O)Cc1sncc1Br
<BB_690>
What is the molecular formula for <BB_690>?
The molecular formula for <BB_690> (O=C(O)Cc1sncc1Br) is C5H4BrNO2S.
Describe the ring structures in building block <BB_690>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_690>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_690>.
**Token:** <BB_690> **SMILES:** O=C(O)Cc1sncc1Br **Molecular Formula:** C5H4BrNO2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_691>.
O=C(O)c1ccc(Cl)c(N2CCOCC2)c1
What is the building block token for the following molecule?
O=C(O)c1ccc(Cl)c(N2CCOCC2)c1
<BB_691>
What is the molecular formula for <BB_691>?
The molecular formula for <BB_691> (O=C(O)c1ccc(Cl)c(N2CCOCC2)c1) is C11H12ClNO3.
Describe the ring structures in building block <BB_691>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_691>.
The molecule contains the following groups: Carboxylic Acid, Tertiary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_691>.
**Token:** <BB_691> **SMILES:** O=C(O)c1ccc(Cl)c(N2CCOCC2)c1 **Molecular Formula:** C11H12ClNO3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Tertiary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_692>.
CC(C)(C)OC(=O)NCCC1CNCCCO1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)NCCC1CNCCCO1
<BB_692>
What is the molecular formula for <BB_692>?
The molecular formula for <BB_692> (CC(C)(C)OC(=O)NCCC1CNCCCO1) is C12H24N2O3.
Describe the ring structures in building block <BB_692>.
The molecule contains 1 ring(s): an aliphatic ring of size 7.
List the primary functional groups present in <BB_692>.
The molecule contains the following groups: Secondary Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_692>.
**Token:** <BB_692> **SMILES:** CC(C)(C)OC(=O)NCCC1CNCCCO1 **Molecular Formula:** C12H24N2O3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 7. **Functional Groups:** Secondary Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_693>.
CC(C)(C)OC(=O)C1(C(F)F)CC(=O)C1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)C1(C(F)F)CC(=O)C1
<BB_693>
What is the molecular formula for <BB_693>?
The molecular formula for <BB_693> (CC(C)(C)OC(=O)C1(C(F)F)CC(=O)C1) is C10H14F2O3.
Describe the ring structures in building block <BB_693>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_693>.
The molecule contains the following groups: Ester, Ketone, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_693>.
**Token:** <BB_693> **SMILES:** CC(C)(C)OC(=O)C1(C(F)F)CC(=O)C1 **Molecular Formula:** C10H14F2O3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Ester, Ketone, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_694>.
CCOC(=O)C1CNCC12CCC2
What is the building block token for the following molecule?
CCOC(=O)C1CNCC12CCC2
<BB_694>
What is the molecular formula for <BB_694>?
The molecular formula for <BB_694> (CCOC(=O)C1CNCC12CCC2) is C10H17NO2.
Describe the ring structures in building block <BB_694>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 4.
List the primary functional groups present in <BB_694>.
The molecule contains the following groups: Secondary Amine, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_694>.
**Token:** <BB_694> **SMILES:** CCOC(=O)C1CNCC12CCC2 **Molecular Formula:** C10H17NO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 4. **Functional Groups:** Secondary Amine, Ester, Ether
Provide the SMILES representation for the building block token <BB_695>.
Cl.NC1COC2(CCOC2)C1
What is the building block token for the following molecule?
Cl.NC1COC2(CCOC2)C1
<BB_695>
What is the molecular formula for <BB_695>?
The molecular formula for <BB_695> (Cl.NC1COC2(CCOC2)C1) is C7H14ClNO2.
Describe the ring structures in building block <BB_695>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_695>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_695>.
**Token:** <BB_695> **SMILES:** Cl.NC1COC2(CCOC2)C1 **Molecular Formula:** C7H14ClNO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_696>.
Nc1ncc(Br)nc1OC1CCC1
What is the building block token for the following molecule?
Nc1ncc(Br)nc1OC1CCC1
<BB_696>
What is the molecular formula for <BB_696>?
The molecular formula for <BB_696> (Nc1ncc(Br)nc1OC1CCC1) is C8H10BrN3O.
Describe the ring structures in building block <BB_696>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 4.
List the primary functional groups present in <BB_696>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_696>.
**Token:** <BB_696> **SMILES:** Nc1ncc(Br)nc1OC1CCC1 **Molecular Formula:** C8H10BrN3O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 4. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_697>.
O=C(CC(=O)C(F)(F)F)c1ccc2c(c1)OCCO2
What is the building block token for the following molecule?
O=C(CC(=O)C(F)(F)F)c1ccc2c(c1)OCCO2
<BB_697>
What is the molecular formula for <BB_697>?
The molecular formula for <BB_697> (O=C(CC(=O)C(F)(F)F)c1ccc2c(c1)OCCO2) is C12H9F3O4.
Describe the ring structures in building block <BB_697>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_697>.
The molecule contains the following groups: Ketone, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_697>.
**Token:** <BB_697> **SMILES:** O=C(CC(=O)C(F)(F)F)c1ccc2c(c1)OCCO2 **Molecular Formula:** C12H9F3O4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Ketone, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_698>.
O=S(=O)(Cl)CC1(CC(F)F)CCC1
What is the building block token for the following molecule?
O=S(=O)(Cl)CC1(CC(F)F)CCC1
<BB_698>
What is the molecular formula for <BB_698>?
The molecular formula for <BB_698> (O=S(=O)(Cl)CC1(CC(F)F)CCC1) is C7H11ClF2O2S.
Describe the ring structures in building block <BB_698>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_698>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_698>.
**Token:** <BB_698> **SMILES:** O=S(=O)(Cl)CC1(CC(F)F)CCC1 **Molecular Formula:** C7H11ClF2O2S **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_699>.
COc1cnc(C(=O)O)nc1Cl
What is the building block token for the following molecule?
COc1cnc(C(=O)O)nc1Cl
<BB_699>
What is the molecular formula for <BB_699>?
The molecular formula for <BB_699> (COc1cnc(C(=O)O)nc1Cl) is C6H5ClN2O3.
Describe the ring structures in building block <BB_699>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_699>.
The molecule contains the following groups: Carboxylic Acid, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_699>.
**Token:** <BB_699> **SMILES:** COc1cnc(C(=O)O)nc1Cl **Molecular Formula:** C6H5ClN2O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ether, Halogen (F,Cl,Br,I)