instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_716>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_716>.
**Token:** <BB_716> **SMILES:** O=C(O)c1ccccc1CS(=O)(=O)c1ccccc1 **Molecular Formula:** C14H12O4S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_717>.
[Na+].[S-]c1nnc2ncccn12
What is the building block token for the following molecule?
[Na+].[S-]c1nnc2ncccn12
<BB_717>
What is the molecular formula for <BB_717>?
The molecular formula for <BB_717> ([Na+].[S-]c1nnc2ncccn12) is C5H3N4NaS.
Describe the ring structures in building block <BB_717>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_717>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_717>.
**Token:** <BB_717> **SMILES:** [Na+].[S-]c1nnc2ncccn12 **Molecular Formula:** C5H3N4NaS **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_718>.
CC(Cl)C1CC(c2ccc3c(c2)CCO3)=NO1
What is the building block token for the following molecule?
CC(Cl)C1CC(c2ccc3c(c2)CCO3)=NO1
<BB_718>
What is the molecular formula for <BB_718>?
The molecular formula for <BB_718> (CC(Cl)C1CC(c2ccc3c(c2)CCO3)=NO1) is C13H14ClNO2.
Describe the ring structures in building block <BB_718>.
The molecule contains 3 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_718>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_718>.
**Token:** <BB_718> **SMILES:** CC(Cl)C1CC(c2ccc3c(c2)CCO3)=NO1 **Molecular Formula:** C13H14ClNO2 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_719>.
CC(C)(C)OC(=O)N1CCNc2ccccc2C1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CCNc2ccccc2C1
<BB_719>
What is the molecular formula for <BB_719>?
The molecular formula for <BB_719> (CC(C)(C)OC(=O)N1CCNc2ccccc2C1) is C14H20N2O2.
Describe the ring structures in building block <BB_719>.
The molecule contains 2 ring(s): an aliphatic ring of size 7, an aromatic ring of size 6.
List the primary functional groups present in <BB_719>.
The molecule contains the following groups: Secondary Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_719>.
**Token:** <BB_719> **SMILES:** CC(C)(C)OC(=O)N1CCNc2ccccc2C1 **Molecular Formula:** C14H20N2O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 7, an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_720>.
O=C(CC(=O)C(F)(F)F)C(F)(F)F
What is the building block token for the following molecule?
O=C(CC(=O)C(F)(F)F)C(F)(F)F
<BB_720>
What is the molecular formula for <BB_720>?
The molecular formula for <BB_720> (O=C(CC(=O)C(F)(F)F)C(F)(F)F) is C5H2F6O2.
Describe the ring structures in building block <BB_720>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_720>.
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_720>.
**Token:** <BB_720> **SMILES:** O=C(CC(=O)C(F)(F)F)C(F)(F)F **Molecular Formula:** C5H2F6O2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_721>.
O=C(O)c1ccc(-c2ccc(Cl)cc2)c(F)c1
What is the building block token for the following molecule?
O=C(O)c1ccc(-c2ccc(Cl)cc2)c(F)c1
<BB_721>
What is the molecular formula for <BB_721>?
The molecular formula for <BB_721> (O=C(O)c1ccc(-c2ccc(Cl)cc2)c(F)c1) is C13H8ClFO2.
Describe the ring structures in building block <BB_721>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_721>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_721>.
**Token:** <BB_721> **SMILES:** O=C(O)c1ccc(-c2ccc(Cl)cc2)c(F)c1 **Molecular Formula:** C13H8ClFO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_722>.
CC(C)(C)OC(=O)N1CC(F)(F)CC1CC#N
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CC(F)(F)CC1CC#N
<BB_722>
What is the molecular formula for <BB_722>?
The molecular formula for <BB_722> (CC(C)(C)OC(=O)N1CC(F)(F)CC1CC#N) is C11H16F2N2O2.
Describe the ring structures in building block <BB_722>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_722>.
The molecule contains the following groups: Amide, Ether, Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_722>.
**Token:** <BB_722> **SMILES:** CC(C)(C)OC(=O)N1CC(F)(F)CC1CC#N **Molecular Formula:** C11H16F2N2O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amide, Ether, Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_723>.
CC(C)(C)OC(=O)N1CC(n2nccc2C=O)C1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CC(n2nccc2C=O)C1
<BB_723>
What is the molecular formula for <BB_723>?
The molecular formula for <BB_723> (CC(C)(C)OC(=O)N1CC(n2nccc2C=O)C1) is C12H17N3O3.
Describe the ring structures in building block <BB_723>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aromatic ring of size 5.
List the primary functional groups present in <BB_723>.
The molecule contains the following groups: Amide, Aldehyde, Ether.
Provide a comprehensive chemical profile for the building block <BB_723>.
**Token:** <BB_723> **SMILES:** CC(C)(C)OC(=O)N1CC(n2nccc2C=O)C1 **Molecular Formula:** C12H17N3O3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aromatic ring of size 5. **Functional Groups:** Amide, Aldehyde, Ether
Provide the SMILES representation for the building block token <BB_724>.
O=c1ccc(-c2nccs2)c[nH]1
What is the building block token for the following molecule?
O=c1ccc(-c2nccs2)c[nH]1
<BB_724>
What is the molecular formula for <BB_724>?
The molecular formula for <BB_724> (O=c1ccc(-c2nccs2)c[nH]1) is C8H6N2OS.
Describe the ring structures in building block <BB_724>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_724>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_724>.
**Token:** <BB_724> **SMILES:** O=c1ccc(-c2nccs2)c[nH]1 **Molecular Formula:** C8H6N2OS **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_725>.
CN1CCNC[C@@H]1C(F)F.Cl.Cl
What is the building block token for the following molecule?
CN1CCNC[C@@H]1C(F)F.Cl.Cl
<BB_725>
What is the molecular formula for <BB_725>?
The molecular formula for <BB_725> (CN1CCNC[C@@H]1C(F)F.Cl.Cl) is C6H14Cl2F2N2.
Describe the ring structures in building block <BB_725>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_725>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_725>.
**Token:** <BB_725> **SMILES:** CN1CCNC[C@@H]1C(F)F.Cl.Cl **Molecular Formula:** C6H14Cl2F2N2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_726>.
O=C(CCl)c1cc(Br)cs1
What is the building block token for the following molecule?
O=C(CCl)c1cc(Br)cs1
<BB_726>
What is the molecular formula for <BB_726>?
The molecular formula for <BB_726> (O=C(CCl)c1cc(Br)cs1) is C6H4BrClOS.
Describe the ring structures in building block <BB_726>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_726>.
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_726>.
**Token:** <BB_726> **SMILES:** O=C(CCl)c1cc(Br)cs1 **Molecular Formula:** C6H4BrClOS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_727>.
Cl.N[C@H]1CC[C@@H](C(=O)O)C1
What is the building block token for the following molecule?
Cl.N[C@H]1CC[C@@H](C(=O)O)C1
<BB_727>
What is the molecular formula for <BB_727>?
The molecular formula for <BB_727> (Cl.N[C@H]1CC[C@@H](C(=O)O)C1) is C6H12ClNO2.
Describe the ring structures in building block <BB_727>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_727>.
The molecule contains the following groups: Carboxylic Acid, Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_727>.
**Token:** <BB_727> **SMILES:** Cl.N[C@H]1CC[C@@H](C(=O)O)C1 **Molecular Formula:** C6H12ClNO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid, Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_728>.
CNCC(=O)Nc1cc(Cl)ccc1OC
What is the building block token for the following molecule?
CNCC(=O)Nc1cc(Cl)ccc1OC
<BB_728>
What is the molecular formula for <BB_728>?
The molecular formula for <BB_728> (CNCC(=O)Nc1cc(Cl)ccc1OC) is C10H13ClN2O2.
Describe the ring structures in building block <BB_728>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_728>.
The molecule contains the following groups: Secondary Amine, Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_728>.
**Token:** <BB_728> **SMILES:** CNCC(=O)Nc1cc(Cl)ccc1OC **Molecular Formula:** C10H13ClN2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_729>.
CC1(N)CCN(C(=O)OC(C)(C)C)CC1
What is the building block token for the following molecule?
CC1(N)CCN(C(=O)OC(C)(C)C)CC1
<BB_729>
What is the molecular formula for <BB_729>?
The molecular formula for <BB_729> (CC1(N)CCN(C(=O)OC(C)(C)C)CC1) is C11H22N2O2.
Describe the ring structures in building block <BB_729>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_729>.
The molecule contains the following groups: Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_729>.
**Token:** <BB_729> **SMILES:** CC1(N)CCN(C(=O)OC(C)(C)C)CC1 **Molecular Formula:** C11H22N2O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_730>.
Cc1ncsc1CCCN
What is the building block token for the following molecule?
Cc1ncsc1CCCN
<BB_730>
What is the molecular formula for <BB_730>?
The molecular formula for <BB_730> (Cc1ncsc1CCCN) is C7H12N2S.
Describe the ring structures in building block <BB_730>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_730>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_730>.
**Token:** <BB_730> **SMILES:** Cc1ncsc1CCCN **Molecular Formula:** C7H12N2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_731>.
COCCC(=O)C(C)(C)C
What is the building block token for the following molecule?
COCCC(=O)C(C)(C)C
<BB_731>
What is the molecular formula for <BB_731>?
The molecular formula for <BB_731> (COCCC(=O)C(C)(C)C) is C8H16O2.
Describe the ring structures in building block <BB_731>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_731>.
The molecule contains the following groups: Ketone, Ether.
Provide a comprehensive chemical profile for the building block <BB_731>.
**Token:** <BB_731> **SMILES:** COCCC(=O)C(C)(C)C **Molecular Formula:** C8H16O2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ketone, Ether
Provide the SMILES representation for the building block token <BB_732>.
Clc1cccc2cccc(Br)c12
What is the building block token for the following molecule?
Clc1cccc2cccc(Br)c12
<BB_732>
What is the molecular formula for <BB_732>?
The molecular formula for <BB_732> (Clc1cccc2cccc(Br)c12) is C10H6BrCl.
Describe the ring structures in building block <BB_732>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_732>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_732>.
**Token:** <BB_732> **SMILES:** Clc1cccc2cccc(Br)c12 **Molecular Formula:** C10H6BrCl **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_733>.
Clc1ccccc1-c1nnc(CNC2CC2)o1
What is the building block token for the following molecule?
Clc1ccccc1-c1nnc(CNC2CC2)o1
<BB_733>