instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_700>.
C[Si]1(C)CCC(C(=O)O)(c2ccccc2)CC1
What is the building block token for the following molecule?
C[Si]1(C)CCC(C(=O)O)(c2ccccc2)CC1
<BB_700>
What is the molecular formula for <BB_700>?
The molecular formula for <BB_700> (C[Si]1(C)CCC(C(=O)O)(c2ccccc2)CC1) is C14H20O2Si.
Describe the ring structures in building block <BB_700>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_700>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_700>.
**Token:** <BB_700> **SMILES:** C[Si]1(C)CCC(C(=O)O)(c2ccccc2)CC1 **Molecular Formula:** C14H20O2Si **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_701>.
Cc1cc(F)ccc1OC1CNC1.Cl
What is the building block token for the following molecule?
Cc1cc(F)ccc1OC1CNC1.Cl
<BB_701>
What is the molecular formula for <BB_701>?
The molecular formula for <BB_701> (Cc1cc(F)ccc1OC1CNC1.Cl) is C10H13ClFNO.
Describe the ring structures in building block <BB_701>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 4.
List the primary functional groups present in <BB_701>.
The molecule contains the following groups: Secondary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_701>.
**Token:** <BB_701> **SMILES:** Cc1cc(F)ccc1OC1CNC1.Cl **Molecular Formula:** C10H13ClFNO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 4. **Functional Groups:** Secondary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_702>.
CC(O)C1CCCCCC1
What is the building block token for the following molecule?
CC(O)C1CCCCCC1
<BB_702>
What is the molecular formula for <BB_702>?
The molecular formula for <BB_702> (CC(O)C1CCCCCC1) is C9H18O.
Describe the ring structures in building block <BB_702>.
The molecule contains 1 ring(s): an aliphatic ring of size 7.
List the primary functional groups present in <BB_702>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_702>.
**Token:** <BB_702> **SMILES:** CC(O)C1CCCCCC1 **Molecular Formula:** C9H18O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 7. **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_703>.
Cl.OC1CNCCC12CC2
What is the building block token for the following molecule?
Cl.OC1CNCCC12CC2
<BB_703>
What is the molecular formula for <BB_703>?
The molecular formula for <BB_703> (Cl.OC1CNCCC12CC2) is C7H14ClNO.
Describe the ring structures in building block <BB_703>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_703>.
The molecule contains the following groups: Secondary Amine, Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_703>.
**Token:** <BB_703> **SMILES:** Cl.OC1CNCCC12CC2 **Molecular Formula:** C7H14ClNO **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Secondary Amine, Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_704>.
Cl.NCC(F)(F)c1ccccc1C(F)(F)F
What is the building block token for the following molecule?
Cl.NCC(F)(F)c1ccccc1C(F)(F)F
<BB_704>
What is the molecular formula for <BB_704>?
The molecular formula for <BB_704> (Cl.NCC(F)(F)c1ccccc1C(F)(F)F) is C9H9ClF5N.
Describe the ring structures in building block <BB_704>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_704>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_704>.
**Token:** <BB_704> **SMILES:** Cl.NCC(F)(F)c1ccccc1C(F)(F)F **Molecular Formula:** C9H9ClF5N **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_705>.
O=C(O)C(F)(F)c1csc(-c2ncc(Cl)cc2F)n1
What is the building block token for the following molecule?
O=C(O)C(F)(F)c1csc(-c2ncc(Cl)cc2F)n1
<BB_705>
What is the molecular formula for <BB_705>?
The molecular formula for <BB_705> (O=C(O)C(F)(F)c1csc(-c2ncc(Cl)cc2F)n1) is C10H4ClF3N2O2S.
Describe the ring structures in building block <BB_705>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_705>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_705>.
**Token:** <BB_705> **SMILES:** O=C(O)C(F)(F)c1csc(-c2ncc(Cl)cc2F)n1 **Molecular Formula:** C10H4ClF3N2O2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_706>.
CC(Cl)C(=O)N1CCSc2ccccc21
What is the building block token for the following molecule?
CC(Cl)C(=O)N1CCSc2ccccc21
<BB_706>
What is the molecular formula for <BB_706>?
The molecular formula for <BB_706> (CC(Cl)C(=O)N1CCSc2ccccc21) is C11H12ClNOS.
Describe the ring structures in building block <BB_706>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_706>.
The molecule contains the following groups: Amide, Sulfide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_706>.
**Token:** <BB_706> **SMILES:** CC(Cl)C(=O)N1CCSc2ccccc21 **Molecular Formula:** C11H12ClNOS **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amide, Sulfide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_707>.
CC1(C)C(N)C1(C)C.Cl
What is the building block token for the following molecule?
CC1(C)C(N)C1(C)C.Cl
<BB_707>
What is the molecular formula for <BB_707>?
The molecular formula for <BB_707> (CC1(C)C(N)C1(C)C.Cl) is C7H16ClN.
Describe the ring structures in building block <BB_707>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_707>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_707>.
**Token:** <BB_707> **SMILES:** CC1(C)C(N)C1(C)C.Cl **Molecular Formula:** C7H16ClN **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_708>.
O=Cc1ccc2c(C(=O)O)n[nH]c2c1
What is the building block token for the following molecule?
O=Cc1ccc2c(C(=O)O)n[nH]c2c1
<BB_708>
What is the molecular formula for <BB_708>?
The molecular formula for <BB_708> (O=Cc1ccc2c(C(=O)O)n[nH]c2c1) is C9H6N2O3.
Describe the ring structures in building block <BB_708>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_708>.
The molecule contains the following groups: Carboxylic Acid, Aldehyde.
Provide a comprehensive chemical profile for the building block <BB_708>.
**Token:** <BB_708> **SMILES:** O=Cc1ccc2c(C(=O)O)n[nH]c2c1 **Molecular Formula:** C9H6N2O3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Aldehyde
Provide the SMILES representation for the building block token <BB_709>.
COC(=O)c1c(N)ccc(F)c1F.Cl
What is the building block token for the following molecule?
COC(=O)c1c(N)ccc(F)c1F.Cl
<BB_709>
What is the molecular formula for <BB_709>?
The molecular formula for <BB_709> (COC(=O)c1c(N)ccc(F)c1F.Cl) is C8H8ClF2NO2.
Describe the ring structures in building block <BB_709>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_709>.
The molecule contains the following groups: Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_709>.
**Token:** <BB_709> **SMILES:** COC(=O)c1c(N)ccc(F)c1F.Cl **Molecular Formula:** C8H8ClF2NO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_710>.
COC(=O)c1cnc(CN)s1.Cl
What is the building block token for the following molecule?
COC(=O)c1cnc(CN)s1.Cl
<BB_710>
What is the molecular formula for <BB_710>?
The molecular formula for <BB_710> (COC(=O)c1cnc(CN)s1.Cl) is C6H9ClN2O2S.
Describe the ring structures in building block <BB_710>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_710>.
The molecule contains the following groups: Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_710>.
**Token:** <BB_710> **SMILES:** COC(=O)c1cnc(CN)s1.Cl **Molecular Formula:** C6H9ClN2O2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_711>.
Cl.NCCN1C(=O)C=CC1=O
What is the building block token for the following molecule?
Cl.NCCN1C(=O)C=CC1=O
<BB_711>
What is the molecular formula for <BB_711>?
The molecular formula for <BB_711> (Cl.NCCN1C(=O)C=CC1=O) is C6H9ClN2O2.
Describe the ring structures in building block <BB_711>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_711>.
The molecule contains the following groups: Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_711>.
**Token:** <BB_711> **SMILES:** Cl.NCCN1C(=O)C=CC1=O **Molecular Formula:** C6H9ClN2O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_712>.
CCCCCCCCC(=O)O
What is the building block token for the following molecule?
CCCCCCCCC(=O)O
<BB_712>
What is the molecular formula for <BB_712>?
The molecular formula for <BB_712> (CCCCCCCCC(=O)O) is C9H18O2.
Describe the ring structures in building block <BB_712>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_712>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_712>.
**Token:** <BB_712> **SMILES:** CCCCCCCCC(=O)O **Molecular Formula:** C9H18O2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_713>.
Nc1nnc(-c2ccccc2Cl)s1
What is the building block token for the following molecule?
Nc1nnc(-c2ccccc2Cl)s1
<BB_713>
What is the molecular formula for <BB_713>?
The molecular formula for <BB_713> (Nc1nnc(-c2ccccc2Cl)s1) is C8H6ClN3S.
Describe the ring structures in building block <BB_713>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_713>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_713>.
**Token:** <BB_713> **SMILES:** Nc1nnc(-c2ccccc2Cl)s1 **Molecular Formula:** C8H6ClN3S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_714>.
N#CCC(=O)c1ccc(I)cc1
What is the building block token for the following molecule?
N#CCC(=O)c1ccc(I)cc1
<BB_714>
What is the molecular formula for <BB_714>?
The molecular formula for <BB_714> (N#CCC(=O)c1ccc(I)cc1) is C9H6INO.
Describe the ring structures in building block <BB_714>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_714>.
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_714>.
**Token:** <BB_714> **SMILES:** N#CCC(=O)c1ccc(I)cc1 **Molecular Formula:** C9H6INO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ketone, Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_715>.
CN(C)c1ccc(C=C2NC(=S)NC2=O)cc1
What is the building block token for the following molecule?
CN(C)c1ccc(C=C2NC(=S)NC2=O)cc1
<BB_715>
What is the molecular formula for <BB_715>?
The molecular formula for <BB_715> (CN(C)c1ccc(C=C2NC(=S)NC2=O)cc1) is C12H13N3OS.
Describe the ring structures in building block <BB_715>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_715>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Amide.
Provide a comprehensive chemical profile for the building block <BB_715>.
**Token:** <BB_715> **SMILES:** CN(C)c1ccc(C=C2NC(=S)NC2=O)cc1 **Molecular Formula:** C12H13N3OS **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Tertiary Amine, Amide
Provide the SMILES representation for the building block token <BB_716>.
O=C(O)c1ccccc1CS(=O)(=O)c1ccccc1
What is the building block token for the following molecule?
O=C(O)c1ccccc1CS(=O)(=O)c1ccccc1
<BB_716>
What is the molecular formula for <BB_716>?
The molecular formula for <BB_716> (O=C(O)c1ccccc1CS(=O)(=O)c1ccccc1) is C14H12O4S.
Describe the ring structures in building block <BB_716>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.