instruction
stringlengths 41
142
| input
stringlengths 0
478
| output
stringlengths 4
382
|
|---|---|---|
Provide the SMILES representation for the building block token <BB_700>.
|
C[Si]1(C)CCC(C(=O)O)(c2ccccc2)CC1
|
|
What is the building block token for the following molecule?
|
C[Si]1(C)CCC(C(=O)O)(c2ccccc2)CC1
|
<BB_700>
|
What is the molecular formula for <BB_700>?
|
The molecular formula for <BB_700> (C[Si]1(C)CCC(C(=O)O)(c2ccccc2)CC1) is C14H20O2Si.
|
|
Describe the ring structures in building block <BB_700>.
|
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
|
|
List the primary functional groups present in <BB_700>.
|
The molecule contains the following groups: Carboxylic Acid.
|
|
Provide a comprehensive chemical profile for the building block <BB_700>.
|
**Token:** <BB_700>
**SMILES:** C[Si]1(C)CCC(C(=O)O)(c2ccccc2)CC1
**Molecular Formula:** C14H20O2Si
**Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
**Functional Groups:** Carboxylic Acid
|
|
Provide the SMILES representation for the building block token <BB_701>.
|
Cc1cc(F)ccc1OC1CNC1.Cl
|
|
What is the building block token for the following molecule?
|
Cc1cc(F)ccc1OC1CNC1.Cl
|
<BB_701>
|
What is the molecular formula for <BB_701>?
|
The molecular formula for <BB_701> (Cc1cc(F)ccc1OC1CNC1.Cl) is C10H13ClFNO.
|
|
Describe the ring structures in building block <BB_701>.
|
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 4.
|
|
List the primary functional groups present in <BB_701>.
|
The molecule contains the following groups: Secondary Amine, Ether, Halogen (F,Cl,Br,I).
|
|
Provide a comprehensive chemical profile for the building block <BB_701>.
|
**Token:** <BB_701>
**SMILES:** Cc1cc(F)ccc1OC1CNC1.Cl
**Molecular Formula:** C10H13ClFNO
**Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 4.
**Functional Groups:** Secondary Amine, Ether, Halogen (F,Cl,Br,I)
|
|
Provide the SMILES representation for the building block token <BB_702>.
|
CC(O)C1CCCCCC1
|
|
What is the building block token for the following molecule?
|
CC(O)C1CCCCCC1
|
<BB_702>
|
What is the molecular formula for <BB_702>?
|
The molecular formula for <BB_702> (CC(O)C1CCCCCC1) is C9H18O.
|
|
Describe the ring structures in building block <BB_702>.
|
The molecule contains 1 ring(s): an aliphatic ring of size 7.
|
|
List the primary functional groups present in <BB_702>.
|
The molecule contains the following groups: Alcohol.
|
|
Provide a comprehensive chemical profile for the building block <BB_702>.
|
**Token:** <BB_702>
**SMILES:** CC(O)C1CCCCCC1
**Molecular Formula:** C9H18O
**Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 7.
**Functional Groups:** Alcohol
|
|
Provide the SMILES representation for the building block token <BB_703>.
|
Cl.OC1CNCCC12CC2
|
|
What is the building block token for the following molecule?
|
Cl.OC1CNCCC12CC2
|
<BB_703>
|
What is the molecular formula for <BB_703>?
|
The molecular formula for <BB_703> (Cl.OC1CNCCC12CC2) is C7H14ClNO.
|
|
Describe the ring structures in building block <BB_703>.
|
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 3.
|
|
List the primary functional groups present in <BB_703>.
|
The molecule contains the following groups: Secondary Amine, Alcohol, Halogen (F,Cl,Br,I).
|
|
Provide a comprehensive chemical profile for the building block <BB_703>.
|
**Token:** <BB_703>
**SMILES:** Cl.OC1CNCCC12CC2
**Molecular Formula:** C7H14ClNO
**Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 3.
**Functional Groups:** Secondary Amine, Alcohol, Halogen (F,Cl,Br,I)
|
|
Provide the SMILES representation for the building block token <BB_704>.
|
Cl.NCC(F)(F)c1ccccc1C(F)(F)F
|
|
What is the building block token for the following molecule?
|
Cl.NCC(F)(F)c1ccccc1C(F)(F)F
|
<BB_704>
|
What is the molecular formula for <BB_704>?
|
The molecular formula for <BB_704> (Cl.NCC(F)(F)c1ccccc1C(F)(F)F) is C9H9ClF5N.
|
|
Describe the ring structures in building block <BB_704>.
|
The molecule contains 1 ring(s): an aromatic ring of size 6.
|
|
List the primary functional groups present in <BB_704>.
|
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
|
|
Provide a comprehensive chemical profile for the building block <BB_704>.
|
**Token:** <BB_704>
**SMILES:** Cl.NCC(F)(F)c1ccccc1C(F)(F)F
**Molecular Formula:** C9H9ClF5N
**Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6.
**Functional Groups:** Amine, Halogen (F,Cl,Br,I)
|
|
Provide the SMILES representation for the building block token <BB_705>.
|
O=C(O)C(F)(F)c1csc(-c2ncc(Cl)cc2F)n1
|
|
What is the building block token for the following molecule?
|
O=C(O)C(F)(F)c1csc(-c2ncc(Cl)cc2F)n1
|
<BB_705>
|
What is the molecular formula for <BB_705>?
|
The molecular formula for <BB_705> (O=C(O)C(F)(F)c1csc(-c2ncc(Cl)cc2F)n1) is C10H4ClF3N2O2S.
|
|
Describe the ring structures in building block <BB_705>.
|
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
|
|
List the primary functional groups present in <BB_705>.
|
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
|
|
Provide a comprehensive chemical profile for the building block <BB_705>.
|
**Token:** <BB_705>
**SMILES:** O=C(O)C(F)(F)c1csc(-c2ncc(Cl)cc2F)n1
**Molecular Formula:** C10H4ClF3N2O2S
**Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
**Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
|
|
Provide the SMILES representation for the building block token <BB_706>.
|
CC(Cl)C(=O)N1CCSc2ccccc21
|
|
What is the building block token for the following molecule?
|
CC(Cl)C(=O)N1CCSc2ccccc21
|
<BB_706>
|
What is the molecular formula for <BB_706>?
|
The molecular formula for <BB_706> (CC(Cl)C(=O)N1CCSc2ccccc21) is C11H12ClNOS.
|
|
Describe the ring structures in building block <BB_706>.
|
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
|
|
List the primary functional groups present in <BB_706>.
|
The molecule contains the following groups: Amide, Sulfide, Halogen (F,Cl,Br,I).
|
|
Provide a comprehensive chemical profile for the building block <BB_706>.
|
**Token:** <BB_706>
**SMILES:** CC(Cl)C(=O)N1CCSc2ccccc21
**Molecular Formula:** C11H12ClNOS
**Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
**Functional Groups:** Amide, Sulfide, Halogen (F,Cl,Br,I)
|
|
Provide the SMILES representation for the building block token <BB_707>.
|
CC1(C)C(N)C1(C)C.Cl
|
|
What is the building block token for the following molecule?
|
CC1(C)C(N)C1(C)C.Cl
|
<BB_707>
|
What is the molecular formula for <BB_707>?
|
The molecular formula for <BB_707> (CC1(C)C(N)C1(C)C.Cl) is C7H16ClN.
|
|
Describe the ring structures in building block <BB_707>.
|
The molecule contains 1 ring(s): an aliphatic ring of size 3.
|
|
List the primary functional groups present in <BB_707>.
|
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
|
|
Provide a comprehensive chemical profile for the building block <BB_707>.
|
**Token:** <BB_707>
**SMILES:** CC1(C)C(N)C1(C)C.Cl
**Molecular Formula:** C7H16ClN
**Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3.
**Functional Groups:** Amine, Halogen (F,Cl,Br,I)
|
|
Provide the SMILES representation for the building block token <BB_708>.
|
O=Cc1ccc2c(C(=O)O)n[nH]c2c1
|
|
What is the building block token for the following molecule?
|
O=Cc1ccc2c(C(=O)O)n[nH]c2c1
|
<BB_708>
|
What is the molecular formula for <BB_708>?
|
The molecular formula for <BB_708> (O=Cc1ccc2c(C(=O)O)n[nH]c2c1) is C9H6N2O3.
|
|
Describe the ring structures in building block <BB_708>.
|
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
|
|
List the primary functional groups present in <BB_708>.
|
The molecule contains the following groups: Carboxylic Acid, Aldehyde.
|
|
Provide a comprehensive chemical profile for the building block <BB_708>.
|
**Token:** <BB_708>
**SMILES:** O=Cc1ccc2c(C(=O)O)n[nH]c2c1
**Molecular Formula:** C9H6N2O3
**Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
**Functional Groups:** Carboxylic Acid, Aldehyde
|
|
Provide the SMILES representation for the building block token <BB_709>.
|
COC(=O)c1c(N)ccc(F)c1F.Cl
|
|
What is the building block token for the following molecule?
|
COC(=O)c1c(N)ccc(F)c1F.Cl
|
<BB_709>
|
What is the molecular formula for <BB_709>?
|
The molecular formula for <BB_709> (COC(=O)c1c(N)ccc(F)c1F.Cl) is C8H8ClF2NO2.
|
|
Describe the ring structures in building block <BB_709>.
|
The molecule contains 1 ring(s): an aromatic ring of size 6.
|
|
List the primary functional groups present in <BB_709>.
|
The molecule contains the following groups: Amine, Ester, Ether, Halogen (F,Cl,Br,I).
|
|
Provide a comprehensive chemical profile for the building block <BB_709>.
|
**Token:** <BB_709>
**SMILES:** COC(=O)c1c(N)ccc(F)c1F.Cl
**Molecular Formula:** C8H8ClF2NO2
**Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6.
**Functional Groups:** Amine, Ester, Ether, Halogen (F,Cl,Br,I)
|
|
Provide the SMILES representation for the building block token <BB_710>.
|
COC(=O)c1cnc(CN)s1.Cl
|
|
What is the building block token for the following molecule?
|
COC(=O)c1cnc(CN)s1.Cl
|
<BB_710>
|
What is the molecular formula for <BB_710>?
|
The molecular formula for <BB_710> (COC(=O)c1cnc(CN)s1.Cl) is C6H9ClN2O2S.
|
|
Describe the ring structures in building block <BB_710>.
|
The molecule contains 1 ring(s): an aromatic ring of size 5.
|
|
List the primary functional groups present in <BB_710>.
|
The molecule contains the following groups: Amine, Ester, Ether, Halogen (F,Cl,Br,I).
|
|
Provide a comprehensive chemical profile for the building block <BB_710>.
|
**Token:** <BB_710>
**SMILES:** COC(=O)c1cnc(CN)s1.Cl
**Molecular Formula:** C6H9ClN2O2S
**Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5.
**Functional Groups:** Amine, Ester, Ether, Halogen (F,Cl,Br,I)
|
|
Provide the SMILES representation for the building block token <BB_711>.
|
Cl.NCCN1C(=O)C=CC1=O
|
|
What is the building block token for the following molecule?
|
Cl.NCCN1C(=O)C=CC1=O
|
<BB_711>
|
What is the molecular formula for <BB_711>?
|
The molecular formula for <BB_711> (Cl.NCCN1C(=O)C=CC1=O) is C6H9ClN2O2.
|
|
Describe the ring structures in building block <BB_711>.
|
The molecule contains 1 ring(s): an aliphatic ring of size 5.
|
|
List the primary functional groups present in <BB_711>.
|
The molecule contains the following groups: Amine, Amide, Halogen (F,Cl,Br,I).
|
|
Provide a comprehensive chemical profile for the building block <BB_711>.
|
**Token:** <BB_711>
**SMILES:** Cl.NCCN1C(=O)C=CC1=O
**Molecular Formula:** C6H9ClN2O2
**Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5.
**Functional Groups:** Amine, Amide, Halogen (F,Cl,Br,I)
|
|
Provide the SMILES representation for the building block token <BB_712>.
|
CCCCCCCCC(=O)O
|
|
What is the building block token for the following molecule?
|
CCCCCCCCC(=O)O
|
<BB_712>
|
What is the molecular formula for <BB_712>?
|
The molecular formula for <BB_712> (CCCCCCCCC(=O)O) is C9H18O2.
|
|
Describe the ring structures in building block <BB_712>.
|
The molecule is acyclic (contains no rings).
|
|
List the primary functional groups present in <BB_712>.
|
The molecule contains the following groups: Carboxylic Acid.
|
|
Provide a comprehensive chemical profile for the building block <BB_712>.
|
**Token:** <BB_712>
**SMILES:** CCCCCCCCC(=O)O
**Molecular Formula:** C9H18O2
**Ring System:** The molecule is acyclic (contains no rings).
**Functional Groups:** Carboxylic Acid
|
|
Provide the SMILES representation for the building block token <BB_713>.
|
Nc1nnc(-c2ccccc2Cl)s1
|
|
What is the building block token for the following molecule?
|
Nc1nnc(-c2ccccc2Cl)s1
|
<BB_713>
|
What is the molecular formula for <BB_713>?
|
The molecular formula for <BB_713> (Nc1nnc(-c2ccccc2Cl)s1) is C8H6ClN3S.
|
|
Describe the ring structures in building block <BB_713>.
|
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
|
|
List the primary functional groups present in <BB_713>.
|
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
|
|
Provide a comprehensive chemical profile for the building block <BB_713>.
|
**Token:** <BB_713>
**SMILES:** Nc1nnc(-c2ccccc2Cl)s1
**Molecular Formula:** C8H6ClN3S
**Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
**Functional Groups:** Amine, Halogen (F,Cl,Br,I)
|
|
Provide the SMILES representation for the building block token <BB_714>.
|
N#CCC(=O)c1ccc(I)cc1
|
|
What is the building block token for the following molecule?
|
N#CCC(=O)c1ccc(I)cc1
|
<BB_714>
|
What is the molecular formula for <BB_714>?
|
The molecular formula for <BB_714> (N#CCC(=O)c1ccc(I)cc1) is C9H6INO.
|
|
Describe the ring structures in building block <BB_714>.
|
The molecule contains 1 ring(s): an aromatic ring of size 6.
|
|
List the primary functional groups present in <BB_714>.
|
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I), Nitrile.
|
|
Provide a comprehensive chemical profile for the building block <BB_714>.
|
**Token:** <BB_714>
**SMILES:** N#CCC(=O)c1ccc(I)cc1
**Molecular Formula:** C9H6INO
**Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6.
**Functional Groups:** Ketone, Halogen (F,Cl,Br,I), Nitrile
|
|
Provide the SMILES representation for the building block token <BB_715>.
|
CN(C)c1ccc(C=C2NC(=S)NC2=O)cc1
|
|
What is the building block token for the following molecule?
|
CN(C)c1ccc(C=C2NC(=S)NC2=O)cc1
|
<BB_715>
|
What is the molecular formula for <BB_715>?
|
The molecular formula for <BB_715> (CN(C)c1ccc(C=C2NC(=S)NC2=O)cc1) is C12H13N3OS.
|
|
Describe the ring structures in building block <BB_715>.
|
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
|
|
List the primary functional groups present in <BB_715>.
|
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Amide.
|
|
Provide a comprehensive chemical profile for the building block <BB_715>.
|
**Token:** <BB_715>
**SMILES:** CN(C)c1ccc(C=C2NC(=S)NC2=O)cc1
**Molecular Formula:** C12H13N3OS
**Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
**Functional Groups:** Secondary Amine, Tertiary Amine, Amide
|
|
Provide the SMILES representation for the building block token <BB_716>.
|
O=C(O)c1ccccc1CS(=O)(=O)c1ccccc1
|
|
What is the building block token for the following molecule?
|
O=C(O)c1ccccc1CS(=O)(=O)c1ccccc1
|
<BB_716>
|
What is the molecular formula for <BB_716>?
|
The molecular formula for <BB_716> (O=C(O)c1ccccc1CS(=O)(=O)c1ccccc1) is C14H12O4S.
|
|
Describe the ring structures in building block <BB_716>.
|
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
|
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.