instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_733>?
The molecular formula for <BB_733> (Clc1ccccc1-c1nnc(CNC2CC2)o1) is C12H12ClN3O.
Describe the ring structures in building block <BB_733>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aliphatic ring of size 3.
List the primary functional groups present in <BB_733>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_733>.
**Token:** <BB_733> **SMILES:** Clc1ccccc1-c1nnc(CNC2CC2)o1 **Molecular Formula:** C12H12ClN3O **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aliphatic ring of size 3. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_734>.
COC(=O)c1cccc(Cl)c1S(=O)(=O)Cl
What is the building block token for the following molecule?
COC(=O)c1cccc(Cl)c1S(=O)(=O)Cl
<BB_734>
What is the molecular formula for <BB_734>?
The molecular formula for <BB_734> (COC(=O)c1cccc(Cl)c1S(=O)(=O)Cl) is C8H6Cl2O4S.
Describe the ring structures in building block <BB_734>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_734>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_734>.
**Token:** <BB_734> **SMILES:** COC(=O)c1cccc(Cl)c1S(=O)(=O)Cl **Molecular Formula:** C8H6Cl2O4S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_735>.
Clc1cc(I)c(Cl)cn1
What is the building block token for the following molecule?
Clc1cc(I)c(Cl)cn1
<BB_735>
What is the molecular formula for <BB_735>?
The molecular formula for <BB_735> (Clc1cc(I)c(Cl)cn1) is C5H2Cl2IN.
Describe the ring structures in building block <BB_735>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_735>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_735>.
**Token:** <BB_735> **SMILES:** Clc1cc(I)c(Cl)cn1 **Molecular Formula:** C5H2Cl2IN **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_736>.
C[C@@H](N)CS(N)(=O)=O.Cl
What is the building block token for the following molecule?
C[C@@H](N)CS(N)(=O)=O.Cl
<BB_736>
What is the molecular formula for <BB_736>?
The molecular formula for <BB_736> (C[C@@H](N)CS(N)(=O)=O.Cl) is C3H11ClN2O2S.
Describe the ring structures in building block <BB_736>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_736>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I), Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_736>.
**Token:** <BB_736> **SMILES:** C[C@@H](N)CS(N)(=O)=O.Cl **Molecular Formula:** C3H11ClN2O2S **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Halogen (F,Cl,Br,I), Sulfonamide
Provide the SMILES representation for the building block token <BB_737>.
COC(=O)[C@@H]1CCc2ccccc2N1.Cl
What is the building block token for the following molecule?
COC(=O)[C@@H]1CCc2ccccc2N1.Cl
<BB_737>
What is the molecular formula for <BB_737>?
The molecular formula for <BB_737> (COC(=O)[C@@H]1CCc2ccccc2N1.Cl) is C11H14ClNO2.
Describe the ring structures in building block <BB_737>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_737>.
The molecule contains the following groups: Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_737>.
**Token:** <BB_737> **SMILES:** COC(=O)[C@@H]1CCc2ccccc2N1.Cl **Molecular Formula:** C11H14ClNO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_738>.
Cl.Cl.NC[C@H]1C[C@@H](n2cncn2)C1
What is the building block token for the following molecule?
Cl.Cl.NC[C@H]1C[C@@H](n2cncn2)C1
<BB_738>
What is the molecular formula for <BB_738>?
The molecular formula for <BB_738> (Cl.Cl.NC[C@H]1C[C@@H](n2cncn2)C1) is C7H14Cl2N4.
Describe the ring structures in building block <BB_738>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aromatic ring of size 5.
List the primary functional groups present in <BB_738>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_738>.
**Token:** <BB_738> **SMILES:** Cl.Cl.NC[C@H]1C[C@@H](n2cncn2)C1 **Molecular Formula:** C7H14Cl2N4 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aromatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_739>.
Cc1ccc(NCc2ccco2)cc1
What is the building block token for the following molecule?
Cc1ccc(NCc2ccco2)cc1
<BB_739>
What is the molecular formula for <BB_739>?
The molecular formula for <BB_739> (Cc1ccc(NCc2ccco2)cc1) is C12H13NO.
Describe the ring structures in building block <BB_739>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_739>.
The molecule contains the following groups: Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_739>.
**Token:** <BB_739> **SMILES:** Cc1ccc(NCc2ccco2)cc1 **Molecular Formula:** C12H13NO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Secondary Amine
Provide the SMILES representation for the building block token <BB_740>.
COc1cc(Br)c(S(N)(=O)=O)cc1OC
What is the building block token for the following molecule?
COc1cc(Br)c(S(N)(=O)=O)cc1OC
<BB_740>
What is the molecular formula for <BB_740>?
The molecular formula for <BB_740> (COc1cc(Br)c(S(N)(=O)=O)cc1OC) is C8H10BrNO4S.
Describe the ring structures in building block <BB_740>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_740>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I), Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_740>.
**Token:** <BB_740> **SMILES:** COc1cc(Br)c(S(N)(=O)=O)cc1OC **Molecular Formula:** C8H10BrNO4S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I), Sulfonamide
Provide the SMILES representation for the building block token <BB_741>.
CNCc1nc2ccccc2n1C(F)F.Cl.Cl
What is the building block token for the following molecule?
CNCc1nc2ccccc2n1C(F)F.Cl.Cl
<BB_741>
What is the molecular formula for <BB_741>?
The molecular formula for <BB_741> (CNCc1nc2ccccc2n1C(F)F.Cl.Cl) is C10H13Cl2F2N3.
Describe the ring structures in building block <BB_741>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_741>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_741>.
**Token:** <BB_741> **SMILES:** CNCc1nc2ccccc2n1C(F)F.Cl.Cl **Molecular Formula:** C10H13Cl2F2N3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_742>.
Cl.Nc1nccc(Cl)c1Br
What is the building block token for the following molecule?
Cl.Nc1nccc(Cl)c1Br
<BB_742>
What is the molecular formula for <BB_742>?
The molecular formula for <BB_742> (Cl.Nc1nccc(Cl)c1Br) is C5H5BrCl2N2.
Describe the ring structures in building block <BB_742>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_742>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_742>.
**Token:** <BB_742> **SMILES:** Cl.Nc1nccc(Cl)c1Br **Molecular Formula:** C5H5BrCl2N2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_743>.
C#Cc1ccc(OC2CC2)cc1
What is the building block token for the following molecule?
C#Cc1ccc(OC2CC2)cc1
<BB_743>
What is the molecular formula for <BB_743>?
The molecular formula for <BB_743> (C#Cc1ccc(OC2CC2)cc1) is C11H10O.
Describe the ring structures in building block <BB_743>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_743>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_743>.
**Token:** <BB_743> **SMILES:** C#Cc1ccc(OC2CC2)cc1 **Molecular Formula:** C11H10O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_744>.
COc1ccc2c(c1)C(C)=CC2
What is the building block token for the following molecule?
COc1ccc2c(c1)C(C)=CC2
<BB_744>
What is the molecular formula for <BB_744>?
The molecular formula for <BB_744> (COc1ccc2c(c1)C(C)=CC2) is C11H12O.
Describe the ring structures in building block <BB_744>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_744>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_744>.
**Token:** <BB_744> **SMILES:** COc1ccc2c(c1)C(C)=CC2 **Molecular Formula:** C11H12O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_745>.
CCc1cc2cc(OC)ccc2[nH]c1=O
What is the building block token for the following molecule?
CCc1cc2cc(OC)ccc2[nH]c1=O
<BB_745>
What is the molecular formula for <BB_745>?
The molecular formula for <BB_745> (CCc1cc2cc(OC)ccc2[nH]c1=O) is C12H13NO2.
Describe the ring structures in building block <BB_745>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_745>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_745>.
**Token:** <BB_745> **SMILES:** CCc1cc2cc(OC)ccc2[nH]c1=O **Molecular Formula:** C12H13NO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_746>.
Cc1coc(CN)n1.Cl.Cl
What is the building block token for the following molecule?
Cc1coc(CN)n1.Cl.Cl
<BB_746>
What is the molecular formula for <BB_746>?
The molecular formula for <BB_746> (Cc1coc(CN)n1.Cl.Cl) is C5H10Cl2N2O.
Describe the ring structures in building block <BB_746>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_746>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_746>.
**Token:** <BB_746> **SMILES:** Cc1coc(CN)n1.Cl.Cl **Molecular Formula:** C5H10Cl2N2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_747>.
CC(C)(C)OC(=O)NC12CC(C3CC3)(C1)C2
What is the building block token for the following molecule?
CC(C)(C)OC(=O)NC12CC(C3CC3)(C1)C2
<BB_747>
What is the molecular formula for <BB_747>?
The molecular formula for <BB_747> (CC(C)(C)OC(=O)NC12CC(C3CC3)(C1)C2) is C13H21NO2.
Describe the ring structures in building block <BB_747>.
The molecule contains 4 ring(s): an aliphatic ring of size 3, an aliphatic ring of size 4, an aliphatic ring of size 4, an aliphatic ring of size 4.
List the primary functional groups present in <BB_747>.
The molecule contains the following groups: Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_747>.
**Token:** <BB_747> **SMILES:** CC(C)(C)OC(=O)NC12CC(C3CC3)(C1)C2 **Molecular Formula:** C13H21NO2 **Ring System:** The molecule contains 4 ring(s): an aliphatic ring of size 3, an aliphatic ring of size 4, an aliphatic ring of size 4, an aliphatic ring of size 4. **Functional Groups:** Amide, Ether
Provide the SMILES representation for the building block token <BB_748>.
O=C(O)c1cccc2c(Br)cccc12
What is the building block token for the following molecule?
O=C(O)c1cccc2c(Br)cccc12
<BB_748>
What is the molecular formula for <BB_748>?
The molecular formula for <BB_748> (O=C(O)c1cccc2c(Br)cccc12) is C11H7BrO2.
Describe the ring structures in building block <BB_748>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_748>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_748>.
**Token:** <BB_748> **SMILES:** O=C(O)c1cccc2c(Br)cccc12 **Molecular Formula:** C11H7BrO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_749>.
COc1cc2ccc(Br)cc2cn1
What is the building block token for the following molecule?
COc1cc2ccc(Br)cc2cn1
<BB_749>
What is the molecular formula for <BB_749>?
The molecular formula for <BB_749> (COc1cc2ccc(Br)cc2cn1) is C10H8BrNO.
Describe the ring structures in building block <BB_749>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_749>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_749>.
**Token:** <BB_749> **SMILES:** COc1cc2ccc(Br)cc2cn1 **Molecular Formula:** C10H8BrNO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)