instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_750>.
C#Cc1ccc(CC)s1
What is the building block token for the following molecule?
C#Cc1ccc(CC)s1
<BB_750>
What is the molecular formula for <BB_750>?
The molecular formula for <BB_750> (C#Cc1ccc(CC)s1) is C8H8S.
Describe the ring structures in building block <BB_750>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_750>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_750>.
**Token:** <BB_750> **SMILES:** C#Cc1ccc(CC)s1 **Molecular Formula:** C8H8S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_751>.
CC1(C)OB(C2CC(F)(F)C2)OC1(C)C
What is the building block token for the following molecule?
CC1(C)OB(C2CC(F)(F)C2)OC1(C)C
<BB_751>
What is the molecular formula for <BB_751>?
The molecular formula for <BB_751> (CC1(C)OB(C2CC(F)(F)C2)OC1(C)C) is C10H17BF2O2.
Describe the ring structures in building block <BB_751>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 4.
List the primary functional groups present in <BB_751>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_751>.
**Token:** <BB_751> **SMILES:** CC1(C)OB(C2CC(F)(F)C2)OC1(C)C **Molecular Formula:** C10H17BF2O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 4. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_752>.
CC1(C)OB(c2cc(C=O)cs2)OC1(C)C
What is the building block token for the following molecule?
CC1(C)OB(c2cc(C=O)cs2)OC1(C)C
<BB_752>
What is the molecular formula for <BB_752>?
The molecular formula for <BB_752> (CC1(C)OB(c2cc(C=O)cs2)OC1(C)C) is C11H15BO3S.
Describe the ring structures in building block <BB_752>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 5.
List the primary functional groups present in <BB_752>.
The molecule contains the following groups: Aldehyde.
Provide a comprehensive chemical profile for the building block <BB_752>.
**Token:** <BB_752> **SMILES:** CC1(C)OB(c2cc(C=O)cs2)OC1(C)C **Molecular Formula:** C11H15BO3S **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 5. **Functional Groups:** Aldehyde
Provide the SMILES representation for the building block token <BB_753>.
O=C(Cl)[C@@H]1C[C@H]1c1ccc(F)cc1
What is the building block token for the following molecule?
O=C(Cl)[C@@H]1C[C@H]1c1ccc(F)cc1
<BB_753>
What is the molecular formula for <BB_753>?
The molecular formula for <BB_753> (O=C(Cl)[C@@H]1C[C@H]1c1ccc(F)cc1) is C10H8ClFO.
Describe the ring structures in building block <BB_753>.
The molecule contains 2 ring(s): an aliphatic ring of size 3, an aromatic ring of size 6.
List the primary functional groups present in <BB_753>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_753>.
**Token:** <BB_753> **SMILES:** O=C(Cl)[C@@H]1C[C@H]1c1ccc(F)cc1 **Molecular Formula:** C10H8ClFO **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 3, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_754>.
O[C@H]1C[C@H](CCBr)C1
What is the building block token for the following molecule?
O[C@H]1C[C@H](CCBr)C1
<BB_754>
What is the molecular formula for <BB_754>?
The molecular formula for <BB_754> (O[C@H]1C[C@H](CCBr)C1) is C6H11BrO.
Describe the ring structures in building block <BB_754>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_754>.
The molecule contains the following groups: Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_754>.
**Token:** <BB_754> **SMILES:** O[C@H]1C[C@H](CCBr)C1 **Molecular Formula:** C6H11BrO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_755>.
Cl.Cl.NC[C@H](O)CN1CCCCC1
What is the building block token for the following molecule?
Cl.Cl.NC[C@H](O)CN1CCCCC1
<BB_755>
What is the molecular formula for <BB_755>?
The molecular formula for <BB_755> (Cl.Cl.NC[C@H](O)CN1CCCCC1) is C8H20Cl2N2O.
Describe the ring structures in building block <BB_755>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_755>.
The molecule contains the following groups: Amine, Tertiary Amine, Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_755>.
**Token:** <BB_755> **SMILES:** Cl.Cl.NC[C@H](O)CN1CCCCC1 **Molecular Formula:** C8H20Cl2N2O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_756>.
CC1CCC(C)C1N
What is the building block token for the following molecule?
CC1CCC(C)C1N
<BB_756>
What is the molecular formula for <BB_756>?
The molecular formula for <BB_756> (CC1CCC(C)C1N) is C7H15N.
Describe the ring structures in building block <BB_756>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_756>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_756>.
**Token:** <BB_756> **SMILES:** CC1CCC(C)C1N **Molecular Formula:** C7H15N **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_757>.
CSCC[C@H](N)c1nc2ccccc2[nH]1.Cl.Cl
What is the building block token for the following molecule?
CSCC[C@H](N)c1nc2ccccc2[nH]1.Cl.Cl
<BB_757>
What is the molecular formula for <BB_757>?
The molecular formula for <BB_757> (CSCC[C@H](N)c1nc2ccccc2[nH]1.Cl.Cl) is C11H17Cl2N3S.
Describe the ring structures in building block <BB_757>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_757>.
The molecule contains the following groups: Amine, Sulfide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_757>.
**Token:** <BB_757> **SMILES:** CSCC[C@H](N)c1nc2ccccc2[nH]1.Cl.Cl **Molecular Formula:** C11H17Cl2N3S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Sulfide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_758>.
CCc1cc(C(=O)OC)cc(CC)c1CC(=O)O
What is the building block token for the following molecule?
CCc1cc(C(=O)OC)cc(CC)c1CC(=O)O
<BB_758>
What is the molecular formula for <BB_758>?
The molecular formula for <BB_758> (CCc1cc(C(=O)OC)cc(CC)c1CC(=O)O) is C14H18O4.
Describe the ring structures in building block <BB_758>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_758>.
The molecule contains the following groups: Carboxylic Acid, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_758>.
**Token:** <BB_758> **SMILES:** CCc1cc(C(=O)OC)cc(CC)c1CC(=O)O **Molecular Formula:** C14H18O4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ester, Ether
Provide the SMILES representation for the building block token <BB_759>.
Cl.NCC(O)c1ccc(O)c([N+](=O)[O-])c1
What is the building block token for the following molecule?
Cl.NCC(O)c1ccc(O)c([N+](=O)[O-])c1
<BB_759>
What is the molecular formula for <BB_759>?
The molecular formula for <BB_759> (Cl.NCC(O)c1ccc(O)c([N+](=O)[O-])c1) is C8H11ClN2O4.
Describe the ring structures in building block <BB_759>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_759>.
The molecule contains the following groups: Amine, Tertiary Amine, Alcohol, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_759>.
**Token:** <BB_759> **SMILES:** Cl.NCC(O)c1ccc(O)c([N+](=O)[O-])c1 **Molecular Formula:** C8H11ClN2O4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Alcohol, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_760>.
Cl.NC1CCCCc2cc(Br)ccc21
What is the building block token for the following molecule?
Cl.NC1CCCCc2cc(Br)ccc21
<BB_760>
What is the molecular formula for <BB_760>?
The molecular formula for <BB_760> (Cl.NC1CCCCc2cc(Br)ccc21) is C11H15BrClN.
Describe the ring structures in building block <BB_760>.
The molecule contains 2 ring(s): an aliphatic ring of size 7, an aromatic ring of size 6.
List the primary functional groups present in <BB_760>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_760>.
**Token:** <BB_760> **SMILES:** Cl.NC1CCCCc2cc(Br)ccc21 **Molecular Formula:** C11H15BrClN **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 7, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_761>.
O=C(CCl)NCC1CCCCC1
What is the building block token for the following molecule?
O=C(CCl)NCC1CCCCC1
<BB_761>
What is the molecular formula for <BB_761>?
The molecular formula for <BB_761> (O=C(CCl)NCC1CCCCC1) is C9H16ClNO.
Describe the ring structures in building block <BB_761>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_761>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_761>.
**Token:** <BB_761> **SMILES:** O=C(CCl)NCC1CCCCC1 **Molecular Formula:** C9H16ClNO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_762>.
NC(=O)c1cccc(S(=O)(=O)Cl)c1
What is the building block token for the following molecule?
NC(=O)c1cccc(S(=O)(=O)Cl)c1
<BB_762>
What is the molecular formula for <BB_762>?
The molecular formula for <BB_762> (NC(=O)c1cccc(S(=O)(=O)Cl)c1) is C7H6ClNO3S.
Describe the ring structures in building block <BB_762>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_762>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_762>.
**Token:** <BB_762> **SMILES:** NC(=O)c1cccc(S(=O)(=O)Cl)c1 **Molecular Formula:** C7H6ClNO3S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_763>.
Cc1cc(CC#N)c(F)cc1Br
What is the building block token for the following molecule?
Cc1cc(CC#N)c(F)cc1Br
<BB_763>
What is the molecular formula for <BB_763>?
The molecular formula for <BB_763> (Cc1cc(CC#N)c(F)cc1Br) is C9H7BrFN.
Describe the ring structures in building block <BB_763>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_763>.
The molecule contains the following groups: Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_763>.
**Token:** <BB_763> **SMILES:** Cc1cc(CC#N)c(F)cc1Br **Molecular Formula:** C9H7BrFN **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_764>.
CNCCCCC(=O)OC.Cl
What is the building block token for the following molecule?
CNCCCCC(=O)OC.Cl
<BB_764>
What is the molecular formula for <BB_764>?
The molecular formula for <BB_764> (CNCCCCC(=O)OC.Cl) is C7H16ClNO2.
Describe the ring structures in building block <BB_764>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_764>.
The molecule contains the following groups: Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_764>.
**Token:** <BB_764> **SMILES:** CNCCCCC(=O)OC.Cl **Molecular Formula:** C7H16ClNO2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_765>.
CC1CCc2c(sc3nc(S)nc(N)c23)C1
What is the building block token for the following molecule?
CC1CCc2c(sc3nc(S)nc(N)c23)C1
<BB_765>
What is the molecular formula for <BB_765>?
The molecular formula for <BB_765> (CC1CCc2c(sc3nc(S)nc(N)c23)C1) is C11H13N3S2.
Describe the ring structures in building block <BB_765>.
The molecule contains 3 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_765>.
The molecule contains the following groups: Amine, Thiol.
Provide a comprehensive chemical profile for the building block <BB_765>.
**Token:** <BB_765> **SMILES:** CC1CCc2c(sc3nc(S)nc(N)c23)C1 **Molecular Formula:** C11H13N3S2 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Thiol
Provide the SMILES representation for the building block token <BB_766>.
Cc1ccc(CN=[N+]=[N-])cc1
What is the building block token for the following molecule?
Cc1ccc(CN=[N+]=[N-])cc1
<BB_766>
What is the molecular formula for <BB_766>?
The molecular formula for <BB_766> (Cc1ccc(CN=[N+]=[N-])cc1) is C8H9N3.
Describe the ring structures in building block <BB_766>.
The molecule contains 1 ring(s): an aromatic ring of size 6.