instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_766>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_766>.
**Token:** <BB_766> **SMILES:** Cc1ccc(CN=[N+]=[N-])cc1 **Molecular Formula:** C8H9N3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_767>.
CCCCn1nccc1C(=O)OC
What is the building block token for the following molecule?
CCCCn1nccc1C(=O)OC
<BB_767>
What is the molecular formula for <BB_767>?
The molecular formula for <BB_767> (CCCCn1nccc1C(=O)OC) is C9H14N2O2.
Describe the ring structures in building block <BB_767>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_767>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_767>.
**Token:** <BB_767> **SMILES:** CCCCn1nccc1C(=O)OC **Molecular Formula:** C9H14N2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_768>.
Nc1ccc(Br)nc1N
What is the building block token for the following molecule?
Nc1ccc(Br)nc1N
<BB_768>
What is the molecular formula for <BB_768>?
The molecular formula for <BB_768> (Nc1ccc(Br)nc1N) is C5H6BrN3.
Describe the ring structures in building block <BB_768>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_768>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_768>.
**Token:** <BB_768> **SMILES:** Nc1ccc(Br)nc1N **Molecular Formula:** C5H6BrN3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_769>.
CC(C)(C)[C@@H]1NC(=O)CC[C@H]1[N+](=O)[O-]
What is the building block token for the following molecule?
CC(C)(C)[C@@H]1NC(=O)CC[C@H]1[N+](=O)[O-]
<BB_769>
What is the molecular formula for <BB_769>?
The molecular formula for <BB_769> (CC(C)(C)[C@@H]1NC(=O)CC[C@H]1[N+](=O)[O-]) is C9H16N2O3.
Describe the ring structures in building block <BB_769>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_769>.
The molecule contains the following groups: Tertiary Amine, Amide, Nitro.
Provide a comprehensive chemical profile for the building block <BB_769>.
**Token:** <BB_769> **SMILES:** CC(C)(C)[C@@H]1NC(=O)CC[C@H]1[N+](=O)[O-] **Molecular Formula:** C9H16N2O3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Tertiary Amine, Amide, Nitro
Provide the SMILES representation for the building block token <BB_770>.
Cl.NC1CCC(=O)N(C2CC2)C1=O
What is the building block token for the following molecule?
Cl.NC1CCC(=O)N(C2CC2)C1=O
<BB_770>
What is the molecular formula for <BB_770>?
The molecular formula for <BB_770> (Cl.NC1CCC(=O)N(C2CC2)C1=O) is C8H13ClN2O2.
Describe the ring structures in building block <BB_770>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_770>.
The molecule contains the following groups: Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_770>.
**Token:** <BB_770> **SMILES:** Cl.NC1CCC(=O)N(C2CC2)C1=O **Molecular Formula:** C8H13ClN2O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_771>.
CC(C)CC(CO)NC(=O)OC(C)(C)C
What is the building block token for the following molecule?
CC(C)CC(CO)NC(=O)OC(C)(C)C
<BB_771>
What is the molecular formula for <BB_771>?
The molecular formula for <BB_771> (CC(C)CC(CO)NC(=O)OC(C)(C)C) is C11H23NO3.
Describe the ring structures in building block <BB_771>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_771>.
The molecule contains the following groups: Amide, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_771>.
**Token:** <BB_771> **SMILES:** CC(C)CC(CO)NC(=O)OC(C)(C)C **Molecular Formula:** C11H23NO3 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amide, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_772>.
O=[N+]([O-])c1ccccc1-n1cccc1
What is the building block token for the following molecule?
O=[N+]([O-])c1ccccc1-n1cccc1
<BB_772>
What is the molecular formula for <BB_772>?
The molecular formula for <BB_772> (O=[N+]([O-])c1ccccc1-n1cccc1) is C10H8N2O2.
Describe the ring structures in building block <BB_772>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_772>.
The molecule contains the following groups: Tertiary Amine, Nitro.
Provide a comprehensive chemical profile for the building block <BB_772>.
**Token:** <BB_772> **SMILES:** O=[N+]([O-])c1ccccc1-n1cccc1 **Molecular Formula:** C10H8N2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Tertiary Amine, Nitro
Provide the SMILES representation for the building block token <BB_773>.
NC(=NO)C1CCCc2ccccc21
What is the building block token for the following molecule?
NC(=NO)C1CCCc2ccccc21
<BB_773>
What is the molecular formula for <BB_773>?
The molecular formula for <BB_773> (NC(=NO)C1CCCc2ccccc21) is C11H14N2O.
Describe the ring structures in building block <BB_773>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_773>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_773>.
**Token:** <BB_773> **SMILES:** NC(=NO)C1CCCc2ccccc21 **Molecular Formula:** C11H14N2O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_774>.
Cc1nc(NC(=N)N)nc2ccccc12.Cl
What is the building block token for the following molecule?
Cc1nc(NC(=N)N)nc2ccccc12.Cl
<BB_774>
What is the molecular formula for <BB_774>?
The molecular formula for <BB_774> (Cc1nc(NC(=N)N)nc2ccccc12.Cl) is C10H12ClN5.
Describe the ring structures in building block <BB_774>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_774>.
The molecule contains the following groups: Amine, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_774>.
**Token:** <BB_774> **SMILES:** Cc1nc(NC(=N)N)nc2ccccc12.Cl **Molecular Formula:** C10H12ClN5 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_775>.
Cc1cc(F)ccc1C(C)Br
What is the building block token for the following molecule?
Cc1cc(F)ccc1C(C)Br
<BB_775>
What is the molecular formula for <BB_775>?
The molecular formula for <BB_775> (Cc1cc(F)ccc1C(C)Br) is C9H10BrF.
Describe the ring structures in building block <BB_775>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_775>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_775>.
**Token:** <BB_775> **SMILES:** Cc1cc(F)ccc1C(C)Br **Molecular Formula:** C9H10BrF **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_776>.
C=CC(=O)ON=C(N)c1ccc(Cl)cc1
What is the building block token for the following molecule?
C=CC(=O)ON=C(N)c1ccc(Cl)cc1
<BB_776>
What is the molecular formula for <BB_776>?
The molecular formula for <BB_776> (C=CC(=O)ON=C(N)c1ccc(Cl)cc1) is C10H9ClN2O2.
Describe the ring structures in building block <BB_776>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_776>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_776>.
**Token:** <BB_776> **SMILES:** C=CC(=O)ON=C(N)c1ccc(Cl)cc1 **Molecular Formula:** C10H9ClN2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_777>.
Clc1cnc(-n2cccc2)nc1
What is the building block token for the following molecule?
Clc1cnc(-n2cccc2)nc1
<BB_777>
What is the molecular formula for <BB_777>?
The molecular formula for <BB_777> (Clc1cnc(-n2cccc2)nc1) is C8H6ClN3.
Describe the ring structures in building block <BB_777>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_777>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_777>.
**Token:** <BB_777> **SMILES:** Clc1cnc(-n2cccc2)nc1 **Molecular Formula:** C8H6ClN3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_778>.
COc1cc(N)ccc1OC(F)F
What is the building block token for the following molecule?
COc1cc(N)ccc1OC(F)F
<BB_778>
What is the molecular formula for <BB_778>?
The molecular formula for <BB_778> (COc1cc(N)ccc1OC(F)F) is C8H9F2NO2.
Describe the ring structures in building block <BB_778>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_778>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_778>.
**Token:** <BB_778> **SMILES:** COc1cc(N)ccc1OC(F)F **Molecular Formula:** C8H9F2NO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_779>.
Cl.NCC1(CO)CCCOC1
What is the building block token for the following molecule?
Cl.NCC1(CO)CCCOC1
<BB_779>
What is the molecular formula for <BB_779>?
The molecular formula for <BB_779> (Cl.NCC1(CO)CCCOC1) is C7H16ClNO2.
Describe the ring structures in building block <BB_779>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_779>.
The molecule contains the following groups: Amine, Alcohol, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_779>.
**Token:** <BB_779> **SMILES:** Cl.NCC1(CO)CCCOC1 **Molecular Formula:** C7H16ClNO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amine, Alcohol, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_780>.
CSC(C)(C)CO
What is the building block token for the following molecule?
CSC(C)(C)CO
<BB_780>
What is the molecular formula for <BB_780>?
The molecular formula for <BB_780> (CSC(C)(C)CO) is C5H12OS.
Describe the ring structures in building block <BB_780>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_780>.
The molecule contains the following groups: Alcohol, Sulfide.
Provide a comprehensive chemical profile for the building block <BB_780>.
**Token:** <BB_780> **SMILES:** CSC(C)(C)CO **Molecular Formula:** C5H12OS **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Alcohol, Sulfide
Provide the SMILES representation for the building block token <BB_781>.
Cl.Cl.Clc1cc2c(cn1)CC1(CNC1)O2
What is the building block token for the following molecule?
Cl.Cl.Clc1cc2c(cn1)CC1(CNC1)O2
<BB_781>
What is the molecular formula for <BB_781>?
The molecular formula for <BB_781> (Cl.Cl.Clc1cc2c(cn1)CC1(CNC1)O2) is C9H11Cl3N2O.
Describe the ring structures in building block <BB_781>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5, an aliphatic ring of size 4.
List the primary functional groups present in <BB_781>.
The molecule contains the following groups: Secondary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_781>.
**Token:** <BB_781> **SMILES:** Cl.Cl.Clc1cc2c(cn1)CC1(CNC1)O2 **Molecular Formula:** C9H11Cl3N2O **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5, an aliphatic ring of size 4. **Functional Groups:** Secondary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_782>.
CC(N)c1ccc(C(F)F)cc1.Cl
What is the building block token for the following molecule?
CC(N)c1ccc(C(F)F)cc1.Cl
<BB_782>
What is the molecular formula for <BB_782>?
The molecular formula for <BB_782> (CC(N)c1ccc(C(F)F)cc1.Cl) is C9H12ClF2N.
Describe the ring structures in building block <BB_782>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_782>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_782>.
**Token:** <BB_782> **SMILES:** CC(N)c1ccc(C(F)F)cc1.Cl **Molecular Formula:** C9H12ClF2N **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_783>.
CNc1ccc2cc(C(=O)OC)ccc2c1
What is the building block token for the following molecule?
CNc1ccc2cc(C(=O)OC)ccc2c1
<BB_783>