instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_783>?
The molecular formula for <BB_783> (CNc1ccc2cc(C(=O)OC)ccc2c1) is C13H13NO2.
Describe the ring structures in building block <BB_783>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_783>.
The molecule contains the following groups: Secondary Amine, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_783>.
**Token:** <BB_783> **SMILES:** CNc1ccc2cc(C(=O)OC)ccc2c1 **Molecular Formula:** C13H13NO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Ester, Ether
Provide the SMILES representation for the building block token <BB_784>.
CC(=O)c1cc(=O)[nH]cc1[N+](=O)[O-]
What is the building block token for the following molecule?
CC(=O)c1cc(=O)[nH]cc1[N+](=O)[O-]
<BB_784>
What is the molecular formula for <BB_784>?
The molecular formula for <BB_784> (CC(=O)c1cc(=O)[nH]cc1[N+](=O)[O-]) is C7H6N2O4.
Describe the ring structures in building block <BB_784>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_784>.
The molecule contains the following groups: Tertiary Amine, Ketone, Nitro.
Provide a comprehensive chemical profile for the building block <BB_784>.
**Token:** <BB_784> **SMILES:** CC(=O)c1cc(=O)[nH]cc1[N+](=O)[O-] **Molecular Formula:** C7H6N2O4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Ketone, Nitro
Provide the SMILES representation for the building block token <BB_785>.
O=C(CCl)Cc1ccc(F)cc1
What is the building block token for the following molecule?
O=C(CCl)Cc1ccc(F)cc1
<BB_785>
What is the molecular formula for <BB_785>?
The molecular formula for <BB_785> (O=C(CCl)Cc1ccc(F)cc1) is C9H8ClFO.
Describe the ring structures in building block <BB_785>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_785>.
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_785>.
**Token:** <BB_785> **SMILES:** O=C(CCl)Cc1ccc(F)cc1 **Molecular Formula:** C9H8ClFO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_786>.
Cl.O=C(NC1CCOC1)OCC1CCCCN1
What is the building block token for the following molecule?
Cl.O=C(NC1CCOC1)OCC1CCCCN1
<BB_786>
What is the molecular formula for <BB_786>?
The molecular formula for <BB_786> (Cl.O=C(NC1CCOC1)OCC1CCCCN1) is C11H21ClN2O3.
Describe the ring structures in building block <BB_786>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_786>.
The molecule contains the following groups: Secondary Amine, Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_786>.
**Token:** <BB_786> **SMILES:** Cl.O=C(NC1CCOC1)OCC1CCCCN1 **Molecular Formula:** C11H21ClN2O3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_787>.
Nc1cc(Cl)ccc1S(N)(=O)=O
What is the building block token for the following molecule?
Nc1cc(Cl)ccc1S(N)(=O)=O
<BB_787>
What is the molecular formula for <BB_787>?
The molecular formula for <BB_787> (Nc1cc(Cl)ccc1S(N)(=O)=O) is C6H7ClN2O2S.
Describe the ring structures in building block <BB_787>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_787>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I), Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_787>.
**Token:** <BB_787> **SMILES:** Nc1cc(Cl)ccc1S(N)(=O)=O **Molecular Formula:** C6H7ClN2O2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I), Sulfonamide
Provide the SMILES representation for the building block token <BB_788>.
Cl.Cl.Clc1cccc(CN2CCNCC2)c1Cl
What is the building block token for the following molecule?
Cl.Cl.Clc1cccc(CN2CCNCC2)c1Cl
<BB_788>
What is the molecular formula for <BB_788>?
The molecular formula for <BB_788> (Cl.Cl.Clc1cccc(CN2CCNCC2)c1Cl) is C11H16Cl4N2.
Describe the ring structures in building block <BB_788>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_788>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_788>.
**Token:** <BB_788> **SMILES:** Cl.Cl.Clc1cccc(CN2CCNCC2)c1Cl **Molecular Formula:** C11H16Cl4N2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_789>.
[N-]=[N+]=NCc1ccco1
What is the building block token for the following molecule?
[N-]=[N+]=NCc1ccco1
<BB_789>
What is the molecular formula for <BB_789>?
The molecular formula for <BB_789> ([N-]=[N+]=NCc1ccco1) is C5H5N3O.
Describe the ring structures in building block <BB_789>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_789>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_789>.
**Token:** <BB_789> **SMILES:** [N-]=[N+]=NCc1ccco1 **Molecular Formula:** C5H5N3O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_790>.
O=[N+]([O-])c1cc(CBr)ccc1F
What is the building block token for the following molecule?
O=[N+]([O-])c1cc(CBr)ccc1F
<BB_790>
What is the molecular formula for <BB_790>?
The molecular formula for <BB_790> (O=[N+]([O-])c1cc(CBr)ccc1F) is C7H5BrFNO2.
Describe the ring structures in building block <BB_790>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_790>.
The molecule contains the following groups: Tertiary Amine, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_790>.
**Token:** <BB_790> **SMILES:** O=[N+]([O-])c1cc(CBr)ccc1F **Molecular Formula:** C7H5BrFNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_791>.
CC(C)(C)OC(=O)NC1CC2(CC(N)CCO2)C1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)NC1CC2(CC(N)CCO2)C1
<BB_791>
What is the molecular formula for <BB_791>?
The molecular formula for <BB_791> (CC(C)(C)OC(=O)NC1CC2(CC(N)CCO2)C1) is C13H24N2O3.
Describe the ring structures in building block <BB_791>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 6.
List the primary functional groups present in <BB_791>.
The molecule contains the following groups: Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_791>.
**Token:** <BB_791> **SMILES:** CC(C)(C)OC(=O)NC1CC2(CC(N)CCO2)C1 **Molecular Formula:** C13H24N2O3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 6. **Functional Groups:** Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_792>.
N#CC(c1ccncc1)(C1CCCC1)C1CCCC1
What is the building block token for the following molecule?
N#CC(c1ccncc1)(C1CCCC1)C1CCCC1
<BB_792>
What is the molecular formula for <BB_792>?
The molecular formula for <BB_792> (N#CC(c1ccncc1)(C1CCCC1)C1CCCC1) is C17H22N2.
Describe the ring structures in building block <BB_792>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_792>.
The molecule contains the following groups: Nitrile.
Provide a comprehensive chemical profile for the building block <BB_792>.
**Token:** <BB_792> **SMILES:** N#CC(c1ccncc1)(C1CCCC1)C1CCCC1 **Molecular Formula:** C17H22N2 **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Nitrile
Provide the SMILES representation for the building block token <BB_793>.
CN1CCN(C)CC(CO)C1
What is the building block token for the following molecule?
CN1CCN(C)CC(CO)C1
<BB_793>
What is the molecular formula for <BB_793>?
The molecular formula for <BB_793> (CN1CCN(C)CC(CO)C1) is C8H18N2O.
Describe the ring structures in building block <BB_793>.
The molecule contains 1 ring(s): an aliphatic ring of size 7.
List the primary functional groups present in <BB_793>.
The molecule contains the following groups: Tertiary Amine, Alcohol.
Provide a comprehensive chemical profile for the building block <BB_793>.
**Token:** <BB_793> **SMILES:** CN1CCN(C)CC(CO)C1 **Molecular Formula:** C8H18N2O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 7. **Functional Groups:** Tertiary Amine, Alcohol
Provide the SMILES representation for the building block token <BB_794>.
COc1cc(N)cnc1OC
What is the building block token for the following molecule?
COc1cc(N)cnc1OC
<BB_794>
What is the molecular formula for <BB_794>?
The molecular formula for <BB_794> (COc1cc(N)cnc1OC) is C7H10N2O2.
Describe the ring structures in building block <BB_794>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_794>.
The molecule contains the following groups: Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_794>.
**Token:** <BB_794> **SMILES:** COc1cc(N)cnc1OC **Molecular Formula:** C7H10N2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ether
Provide the SMILES representation for the building block token <BB_795>.
Cl.Cl.NCc1ccnc(C(F)(F)F)c1
What is the building block token for the following molecule?
Cl.Cl.NCc1ccnc(C(F)(F)F)c1
<BB_795>
What is the molecular formula for <BB_795>?
The molecular formula for <BB_795> (Cl.Cl.NCc1ccnc(C(F)(F)F)c1) is C7H9Cl2F3N2.
Describe the ring structures in building block <BB_795>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_795>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_795>.
**Token:** <BB_795> **SMILES:** Cl.Cl.NCc1ccnc(C(F)(F)F)c1 **Molecular Formula:** C7H9Cl2F3N2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_796>.
CC(C)(C)OC(=O)C1CCNc2ccccc21
What is the building block token for the following molecule?
CC(C)(C)OC(=O)C1CCNc2ccccc21
<BB_796>
What is the molecular formula for <BB_796>?
The molecular formula for <BB_796> (CC(C)(C)OC(=O)C1CCNc2ccccc21) is C14H19NO2.
Describe the ring structures in building block <BB_796>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_796>.
The molecule contains the following groups: Secondary Amine, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_796>.
**Token:** <BB_796> **SMILES:** CC(C)(C)OC(=O)C1CCNc2ccccc21 **Molecular Formula:** C14H19NO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Ester, Ether
Provide the SMILES representation for the building block token <BB_797>.
C#Cc1cn(C)nc1C=O
What is the building block token for the following molecule?
C#Cc1cn(C)nc1C=O
<BB_797>
What is the molecular formula for <BB_797>?
The molecular formula for <BB_797> (C#Cc1cn(C)nc1C=O) is C7H6N2O.
Describe the ring structures in building block <BB_797>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_797>.
The molecule contains the following groups: Aldehyde.
Provide a comprehensive chemical profile for the building block <BB_797>.
**Token:** <BB_797> **SMILES:** C#Cc1cn(C)nc1C=O **Molecular Formula:** C7H6N2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Aldehyde
Provide the SMILES representation for the building block token <BB_798>.
Br.CC1CCN(CCBr)C1
What is the building block token for the following molecule?
Br.CC1CCN(CCBr)C1
<BB_798>
What is the molecular formula for <BB_798>?
The molecular formula for <BB_798> (Br.CC1CCN(CCBr)C1) is C7H15Br2N.
Describe the ring structures in building block <BB_798>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_798>.
The molecule contains the following groups: Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_798>.
**Token:** <BB_798> **SMILES:** Br.CC1CCN(CCBr)C1 **Molecular Formula:** C7H15Br2N **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_799>.
Nc1ccc2c(c1)C(O)CCC2
What is the building block token for the following molecule?
Nc1ccc2c(c1)C(O)CCC2
<BB_799>
What is the molecular formula for <BB_799>?
The molecular formula for <BB_799> (Nc1ccc2c(c1)C(O)CCC2) is C10H13NO.
Describe the ring structures in building block <BB_799>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_799>.
The molecule contains the following groups: Amine, Alcohol.
Provide a comprehensive chemical profile for the building block <BB_799>.
**Token:** <BB_799> **SMILES:** Nc1ccc2c(c1)C(O)CCC2 **Molecular Formula:** C10H13NO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Amine, Alcohol