instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_800>.
Cc1nc(C)n(C2CC2)c1N.Cl
What is the building block token for the following molecule?
Cc1nc(C)n(C2CC2)c1N.Cl
<BB_800>
What is the molecular formula for <BB_800>?
The molecular formula for <BB_800> (Cc1nc(C)n(C2CC2)c1N.Cl) is C8H14ClN3.
Describe the ring structures in building block <BB_800>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3.
List the primary functional groups present in <BB_800>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_800>.
**Token:** <BB_800> **SMILES:** Cc1nc(C)n(C2CC2)c1N.Cl **Molecular Formula:** C8H14ClN3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_801>.
COCc1cc(Br)cc(C(=O)OC)c1
What is the building block token for the following molecule?
COCc1cc(Br)cc(C(=O)OC)c1
<BB_801>
What is the molecular formula for <BB_801>?
The molecular formula for <BB_801> (COCc1cc(Br)cc(C(=O)OC)c1) is C10H11BrO3.
Describe the ring structures in building block <BB_801>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_801>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_801>.
**Token:** <BB_801> **SMILES:** COCc1cc(Br)cc(C(=O)OC)c1 **Molecular Formula:** C10H11BrO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_802>.
Cc1cnn(C)c1N.Cl
What is the building block token for the following molecule?
Cc1cnn(C)c1N.Cl
<BB_802>
What is the molecular formula for <BB_802>?
The molecular formula for <BB_802> (Cc1cnn(C)c1N.Cl) is C5H10ClN3.
Describe the ring structures in building block <BB_802>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_802>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_802>.
**Token:** <BB_802> **SMILES:** Cc1cnn(C)c1N.Cl **Molecular Formula:** C5H10ClN3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_803>.
O=C1CCCc2oc(=O)c(C(=O)O)cc21
What is the building block token for the following molecule?
O=C1CCCc2oc(=O)c(C(=O)O)cc21
<BB_803>
What is the molecular formula for <BB_803>?
The molecular formula for <BB_803> (O=C1CCCc2oc(=O)c(C(=O)O)cc21) is C10H8O5.
Describe the ring structures in building block <BB_803>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_803>.
The molecule contains the following groups: Carboxylic Acid, Ketone.
Provide a comprehensive chemical profile for the building block <BB_803>.
**Token:** <BB_803> **SMILES:** O=C1CCCc2oc(=O)c(C(=O)O)cc21 **Molecular Formula:** C10H8O5 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ketone
Provide the SMILES representation for the building block token <BB_804>.
COC(=O)C1(N)CC12CC2.Cl
What is the building block token for the following molecule?
COC(=O)C1(N)CC12CC2.Cl
<BB_804>
What is the molecular formula for <BB_804>?
The molecular formula for <BB_804> (COC(=O)C1(N)CC12CC2.Cl) is C7H12ClNO2.
Describe the ring structures in building block <BB_804>.
The molecule contains 2 ring(s): an aliphatic ring of size 3, an aliphatic ring of size 3.
List the primary functional groups present in <BB_804>.
The molecule contains the following groups: Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_804>.
**Token:** <BB_804> **SMILES:** COC(=O)C1(N)CC12CC2.Cl **Molecular Formula:** C7H12ClNO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 3, an aliphatic ring of size 3. **Functional Groups:** Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_805>.
COc1ccnc2c1CCCC2N
What is the building block token for the following molecule?
COc1ccnc2c1CCCC2N
<BB_805>
What is the molecular formula for <BB_805>?
The molecular formula for <BB_805> (COc1ccnc2c1CCCC2N) is C10H14N2O.
Describe the ring structures in building block <BB_805>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_805>.
The molecule contains the following groups: Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_805>.
**Token:** <BB_805> **SMILES:** COc1ccnc2c1CCCC2N **Molecular Formula:** C10H14N2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Amine, Ether
Provide the SMILES representation for the building block token <BB_806>.
Nc1ccc2scnc2c1
What is the building block token for the following molecule?
Nc1ccc2scnc2c1
<BB_806>
What is the molecular formula for <BB_806>?
The molecular formula for <BB_806> (Nc1ccc2scnc2c1) is C7H6N2S.
Describe the ring structures in building block <BB_806>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_806>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_806>.
**Token:** <BB_806> **SMILES:** Nc1ccc2scnc2c1 **Molecular Formula:** C7H6N2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_807>.
CC(C)CC(O)C(=O)O
What is the building block token for the following molecule?
CC(C)CC(O)C(=O)O
<BB_807>
What is the molecular formula for <BB_807>?
The molecular formula for <BB_807> (CC(C)CC(O)C(=O)O) is C6H12O3.
Describe the ring structures in building block <BB_807>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_807>.
The molecule contains the following groups: Carboxylic Acid, Alcohol.
Provide a comprehensive chemical profile for the building block <BB_807>.
**Token:** <BB_807> **SMILES:** CC(C)CC(O)C(=O)O **Molecular Formula:** C6H12O3 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid, Alcohol
Provide the SMILES representation for the building block token <BB_808>.
CCOC(=O)C(C)(C(=O)OCC)C1CCC(=O)N1
What is the building block token for the following molecule?
CCOC(=O)C(C)(C(=O)OCC)C1CCC(=O)N1
<BB_808>
What is the molecular formula for <BB_808>?
The molecular formula for <BB_808> (CCOC(=O)C(C)(C(=O)OCC)C1CCC(=O)N1) is C12H19NO5.
Describe the ring structures in building block <BB_808>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_808>.
The molecule contains the following groups: Amide, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_808>.
**Token:** <BB_808> **SMILES:** CCOC(=O)C(C)(C(=O)OCC)C1CCC(=O)N1 **Molecular Formula:** C12H19NO5 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amide, Ester, Ether
Provide the SMILES representation for the building block token <BB_809>.
O=Cc1cccnc1F
What is the building block token for the following molecule?
O=Cc1cccnc1F
<BB_809>
What is the molecular formula for <BB_809>?
The molecular formula for <BB_809> (O=Cc1cccnc1F) is C6H4FNO.
Describe the ring structures in building block <BB_809>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_809>.
The molecule contains the following groups: Aldehyde, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_809>.
**Token:** <BB_809> **SMILES:** O=Cc1cccnc1F **Molecular Formula:** C6H4FNO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Aldehyde, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_810>.
Nc1nccc(N2CCOCC2)c1N
What is the building block token for the following molecule?
Nc1nccc(N2CCOCC2)c1N
<BB_810>
What is the molecular formula for <BB_810>?
The molecular formula for <BB_810> (Nc1nccc(N2CCOCC2)c1N) is C9H14N4O.
Describe the ring structures in building block <BB_810>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_810>.
The molecule contains the following groups: Amine, Tertiary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_810>.
**Token:** <BB_810> **SMILES:** Nc1nccc(N2CCOCC2)c1N **Molecular Formula:** C9H14N4O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Ether
Provide the SMILES representation for the building block token <BB_811>.
CC(C)(C)OC(=O)N1CCN[C@H]2CCC[C@]2(C)C1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CCN[C@H]2CCC[C@]2(C)C1
<BB_811>
What is the molecular formula for <BB_811>?
The molecular formula for <BB_811> (CC(C)(C)OC(=O)N1CCN[C@H]2CCC[C@]2(C)C1) is C14H26N2O2.
Describe the ring structures in building block <BB_811>.
The molecule contains 2 ring(s): an aliphatic ring of size 7, an aliphatic ring of size 5.
List the primary functional groups present in <BB_811>.
The molecule contains the following groups: Secondary Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_811>.
**Token:** <BB_811> **SMILES:** CC(C)(C)OC(=O)N1CCN[C@H]2CCC[C@]2(C)C1 **Molecular Formula:** C14H26N2O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 7, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_812>.
Brc1cccc(C2CCCOC2)c1
What is the building block token for the following molecule?
Brc1cccc(C2CCCOC2)c1
<BB_812>
What is the molecular formula for <BB_812>?
The molecular formula for <BB_812> (Brc1cccc(C2CCCOC2)c1) is C11H13BrO.
Describe the ring structures in building block <BB_812>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_812>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_812>.
**Token:** <BB_812> **SMILES:** Brc1cccc(C2CCCOC2)c1 **Molecular Formula:** C11H13BrO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_813>.
COCC1CN(C(=O)OC(C)(C)C)CCC1O
What is the building block token for the following molecule?
COCC1CN(C(=O)OC(C)(C)C)CCC1O
<BB_813>
What is the molecular formula for <BB_813>?
The molecular formula for <BB_813> (COCC1CN(C(=O)OC(C)(C)C)CCC1O) is C12H23NO4.
Describe the ring structures in building block <BB_813>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_813>.
The molecule contains the following groups: Amide, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_813>.
**Token:** <BB_813> **SMILES:** COCC1CN(C(=O)OC(C)(C)C)CCC1O **Molecular Formula:** C12H23NO4 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amide, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_814>.
COc1ccc(C(F)(F)C(=O)O)cn1
What is the building block token for the following molecule?
COc1ccc(C(F)(F)C(=O)O)cn1
<BB_814>
What is the molecular formula for <BB_814>?
The molecular formula for <BB_814> (COc1ccc(C(F)(F)C(=O)O)cn1) is C8H7F2NO3.
Describe the ring structures in building block <BB_814>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_814>.
The molecule contains the following groups: Carboxylic Acid, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_814>.
**Token:** <BB_814> **SMILES:** COc1ccc(C(F)(F)C(=O)O)cn1 **Molecular Formula:** C8H7F2NO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_815>.
Cl.Cl.NCc1nnc2c(Br)cccn12
What is the building block token for the following molecule?
Cl.Cl.NCc1nnc2c(Br)cccn12
<BB_815>
What is the molecular formula for <BB_815>?
The molecular formula for <BB_815> (Cl.Cl.NCc1nnc2c(Br)cccn12) is C7H9BrCl2N4.
Describe the ring structures in building block <BB_815>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_815>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_815>.
**Token:** <BB_815> **SMILES:** Cl.Cl.NCc1nnc2c(Br)cccn12 **Molecular Formula:** C7H9BrCl2N4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_816>.
COC(=O)c1ccc(C(=O)CCl)o1
What is the building block token for the following molecule?
COC(=O)c1ccc(C(=O)CCl)o1
<BB_816>
What is the molecular formula for <BB_816>?
The molecular formula for <BB_816> (COC(=O)c1ccc(C(=O)CCl)o1) is C8H7ClO4.
Describe the ring structures in building block <BB_816>.
The molecule contains 1 ring(s): an aromatic ring of size 5.