instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_816>.
The molecule contains the following groups: Ester, Ketone, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_816>.
**Token:** <BB_816> **SMILES:** COC(=O)c1ccc(C(=O)CCl)o1 **Molecular Formula:** C8H7ClO4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Ester, Ketone, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_817>.
O=C(O)c1ccc(-n2cnc([N+](=O)[O-])n2)c(Cl)c1
What is the building block token for the following molecule?
O=C(O)c1ccc(-n2cnc([N+](=O)[O-])n2)c(Cl)c1
<BB_817>
What is the molecular formula for <BB_817>?
The molecular formula for <BB_817> (O=C(O)c1ccc(-n2cnc([N+](=O)[O-])n2)c(Cl)c1) is C9H5ClN4O4.
Describe the ring structures in building block <BB_817>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_817>.
The molecule contains the following groups: Carboxylic Acid, Tertiary Amine, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_817>.
**Token:** <BB_817> **SMILES:** O=C(O)c1ccc(-n2cnc([N+](=O)[O-])n2)c(Cl)c1 **Molecular Formula:** C9H5ClN4O4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Tertiary Amine, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_818>.
Cl.NCC1(C(=O)O)CCCC1
What is the building block token for the following molecule?
Cl.NCC1(C(=O)O)CCCC1
<BB_818>
What is the molecular formula for <BB_818>?
The molecular formula for <BB_818> (Cl.NCC1(C(=O)O)CCCC1) is C7H14ClNO2.
Describe the ring structures in building block <BB_818>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_818>.
The molecule contains the following groups: Carboxylic Acid, Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_818>.
**Token:** <BB_818> **SMILES:** Cl.NCC1(C(=O)O)CCCC1 **Molecular Formula:** C7H14ClNO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid, Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_819>.
Cn1cnc(S(=O)(=O)Cl)c1Cl
What is the building block token for the following molecule?
Cn1cnc(S(=O)(=O)Cl)c1Cl
<BB_819>
What is the molecular formula for <BB_819>?
The molecular formula for <BB_819> (Cn1cnc(S(=O)(=O)Cl)c1Cl) is C4H4Cl2N2O2S.
Describe the ring structures in building block <BB_819>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_819>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_819>.
**Token:** <BB_819> **SMILES:** Cn1cnc(S(=O)(=O)Cl)c1Cl **Molecular Formula:** C4H4Cl2N2O2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_820>.
OCCC1CCNCC1
What is the building block token for the following molecule?
OCCC1CCNCC1
<BB_820>
What is the molecular formula for <BB_820>?
The molecular formula for <BB_820> (OCCC1CCNCC1) is C7H15NO.
Describe the ring structures in building block <BB_820>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_820>.
The molecule contains the following groups: Secondary Amine, Alcohol.
Provide a comprehensive chemical profile for the building block <BB_820>.
**Token:** <BB_820> **SMILES:** OCCC1CCNCC1 **Molecular Formula:** C7H15NO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Alcohol
Provide the SMILES representation for the building block token <BB_821>.
CC1=CSC(=C(C#N)N=O)N1
What is the building block token for the following molecule?
CC1=CSC(=C(C#N)N=O)N1
<BB_821>
What is the molecular formula for <BB_821>?
The molecular formula for <BB_821> (CC1=CSC(=C(C#N)N=O)N1) is C6H5N3OS.
Describe the ring structures in building block <BB_821>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_821>.
The molecule contains the following groups: Secondary Amine, Sulfide, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_821>.
**Token:** <BB_821> **SMILES:** CC1=CSC(=C(C#N)N=O)N1 **Molecular Formula:** C6H5N3OS **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Sulfide, Nitrile
Provide the SMILES representation for the building block token <BB_822>.
O=C(O)c1cc(F)c(O)c(Cl)c1
What is the building block token for the following molecule?
O=C(O)c1cc(F)c(O)c(Cl)c1
<BB_822>
What is the molecular formula for <BB_822>?
The molecular formula for <BB_822> (O=C(O)c1cc(F)c(O)c(Cl)c1) is C7H4ClFO3.
Describe the ring structures in building block <BB_822>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_822>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_822>.
**Token:** <BB_822> **SMILES:** O=C(O)c1cc(F)c(O)c(Cl)c1 **Molecular Formula:** C7H4ClFO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_823>.
CC(=O)NN=C(N)c1cnccn1
What is the building block token for the following molecule?
CC(=O)NN=C(N)c1cnccn1
<BB_823>
What is the molecular formula for <BB_823>?
The molecular formula for <BB_823> (CC(=O)NN=C(N)c1cnccn1) is C7H9N5O.
Describe the ring structures in building block <BB_823>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_823>.
The molecule contains the following groups: Amine, Amide.
Provide a comprehensive chemical profile for the building block <BB_823>.
**Token:** <BB_823> **SMILES:** CC(=O)NN=C(N)c1cnccn1 **Molecular Formula:** C7H9N5O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Amide
Provide the SMILES representation for the building block token <BB_824>.
CO[Si](C)(CCCN)OC
What is the building block token for the following molecule?
CO[Si](C)(CCCN)OC
<BB_824>
What is the molecular formula for <BB_824>?
The molecular formula for <BB_824> (CO[Si](C)(CCCN)OC) is C6H17NO2Si.
Describe the ring structures in building block <BB_824>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_824>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_824>.
**Token:** <BB_824> **SMILES:** CO[Si](C)(CCCN)OC **Molecular Formula:** C6H17NO2Si **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_825>.
ClCc1nc2cc(Cl)ccc2[nH]1
What is the building block token for the following molecule?
ClCc1nc2cc(Cl)ccc2[nH]1
<BB_825>
What is the molecular formula for <BB_825>?
The molecular formula for <BB_825> (ClCc1nc2cc(Cl)ccc2[nH]1) is C8H6Cl2N2.
Describe the ring structures in building block <BB_825>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_825>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_825>.
**Token:** <BB_825> **SMILES:** ClCc1nc2cc(Cl)ccc2[nH]1 **Molecular Formula:** C8H6Cl2N2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_826>.
COc1cc(OC)cc(-c2cccc(N)n2)c1.Cl
What is the building block token for the following molecule?
COc1cc(OC)cc(-c2cccc(N)n2)c1.Cl
<BB_826>
What is the molecular formula for <BB_826>?
The molecular formula for <BB_826> (COc1cc(OC)cc(-c2cccc(N)n2)c1.Cl) is C13H15ClN2O2.
Describe the ring structures in building block <BB_826>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_826>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_826>.
**Token:** <BB_826> **SMILES:** COc1cc(OC)cc(-c2cccc(N)n2)c1.Cl **Molecular Formula:** C13H15ClN2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_827>.
CNCc1cc2c(cc1Br)OCO2.Cl
What is the building block token for the following molecule?
CNCc1cc2c(cc1Br)OCO2.Cl
<BB_827>
What is the molecular formula for <BB_827>?
The molecular formula for <BB_827> (CNCc1cc2c(cc1Br)OCO2.Cl) is C9H11BrClNO2.
Describe the ring structures in building block <BB_827>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_827>.
The molecule contains the following groups: Secondary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_827>.
**Token:** <BB_827> **SMILES:** CNCc1cc2c(cc1Br)OCO2.Cl **Molecular Formula:** C9H11BrClNO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_828>.
CC(C)(C)OC(=O)NCCCC1N=N1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)NCCCC1N=N1
<BB_828>
What is the molecular formula for <BB_828>?
The molecular formula for <BB_828> (CC(C)(C)OC(=O)NCCCC1N=N1) is C9H17N3O2.
Describe the ring structures in building block <BB_828>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_828>.
The molecule contains the following groups: Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_828>.
**Token:** <BB_828> **SMILES:** CC(C)(C)OC(=O)NCCCC1N=N1 **Molecular Formula:** C9H17N3O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Amide, Ether
Provide the SMILES representation for the building block token <BB_829>.
NC(=O)OCC(F)(F)F
What is the building block token for the following molecule?
NC(=O)OCC(F)(F)F
<BB_829>
What is the molecular formula for <BB_829>?
The molecular formula for <BB_829> (NC(=O)OCC(F)(F)F) is C3H4F3NO2.
Describe the ring structures in building block <BB_829>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_829>.
The molecule contains the following groups: Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_829>.
**Token:** <BB_829> **SMILES:** NC(=O)OCC(F)(F)F **Molecular Formula:** C3H4F3NO2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_830>.
Nc1ccccc1NC1CCCC1
What is the building block token for the following molecule?
Nc1ccccc1NC1CCCC1
<BB_830>
What is the molecular formula for <BB_830>?
The molecular formula for <BB_830> (Nc1ccccc1NC1CCCC1) is C11H16N2.
Describe the ring structures in building block <BB_830>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_830>.
The molecule contains the following groups: Amine, Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_830>.
**Token:** <BB_830> **SMILES:** Nc1ccccc1NC1CCCC1 **Molecular Formula:** C11H16N2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Amine, Secondary Amine
Provide the SMILES representation for the building block token <BB_831>.
CN1CCNCC1C(F)F
What is the building block token for the following molecule?
CN1CCNCC1C(F)F
<BB_831>
What is the molecular formula for <BB_831>?
The molecular formula for <BB_831> (CN1CCNCC1C(F)F) is C6H12F2N2.
Describe the ring structures in building block <BB_831>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_831>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_831>.
**Token:** <BB_831> **SMILES:** CN1CCNCC1C(F)F **Molecular Formula:** C6H12F2N2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_832>.
Cl.O=C(NC1CC1)C1CCCNC1
What is the building block token for the following molecule?
Cl.O=C(NC1CC1)C1CCCNC1
<BB_832>
What is the molecular formula for <BB_832>?
The molecular formula for <BB_832> (Cl.O=C(NC1CC1)C1CCCNC1) is C9H17ClN2O.
Describe the ring structures in building block <BB_832>.
The molecule contains 2 ring(s): an aliphatic ring of size 3, an aliphatic ring of size 6.
List the primary functional groups present in <BB_832>.
The molecule contains the following groups: Secondary Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_832>.
**Token:** <BB_832> **SMILES:** Cl.O=C(NC1CC1)C1CCCNC1 **Molecular Formula:** C9H17ClN2O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 3, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_833>.
Nc1ccc2c(c1)C(=O)OC2
What is the building block token for the following molecule?
Nc1ccc2c(c1)C(=O)OC2
<BB_833>