instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_833>?
The molecular formula for <BB_833> (Nc1ccc2c(c1)C(=O)OC2) is C8H7NO2.
Describe the ring structures in building block <BB_833>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_833>.
The molecule contains the following groups: Amine, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_833>.
**Token:** <BB_833> **SMILES:** Nc1ccc2c(c1)C(=O)OC2 **Molecular Formula:** C8H7NO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Amine, Ester, Ether
Provide the SMILES representation for the building block token <BB_834>.
Clc1ccc(OCCCBr)cc1
What is the building block token for the following molecule?
Clc1ccc(OCCCBr)cc1
<BB_834>
What is the molecular formula for <BB_834>?
The molecular formula for <BB_834> (Clc1ccc(OCCCBr)cc1) is C9H10BrClO.
Describe the ring structures in building block <BB_834>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_834>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_834>.
**Token:** <BB_834> **SMILES:** Clc1ccc(OCCCBr)cc1 **Molecular Formula:** C9H10BrClO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_835>.
NC(=O)C(Br)Cc1ccc(C(F)(F)F)cc1
What is the building block token for the following molecule?
NC(=O)C(Br)Cc1ccc(C(F)(F)F)cc1
<BB_835>
What is the molecular formula for <BB_835>?
The molecular formula for <BB_835> (NC(=O)C(Br)Cc1ccc(C(F)(F)F)cc1) is C10H9BrF3NO.
Describe the ring structures in building block <BB_835>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_835>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_835>.
**Token:** <BB_835> **SMILES:** NC(=O)C(Br)Cc1ccc(C(F)(F)F)cc1 **Molecular Formula:** C10H9BrF3NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_836>.
O[C@H]1CCCOc2ccccc21
What is the building block token for the following molecule?
O[C@H]1CCCOc2ccccc21
<BB_836>
What is the molecular formula for <BB_836>?
The molecular formula for <BB_836> (O[C@H]1CCCOc2ccccc21) is C10H12O2.
Describe the ring structures in building block <BB_836>.
The molecule contains 2 ring(s): an aliphatic ring of size 7, an aromatic ring of size 6.
List the primary functional groups present in <BB_836>.
The molecule contains the following groups: Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_836>.
**Token:** <BB_836> **SMILES:** O[C@H]1CCCOc2ccccc21 **Molecular Formula:** C10H12O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 7, an aromatic ring of size 6. **Functional Groups:** Alcohol, Ether
Provide the SMILES representation for the building block token <BB_837>.
FC(F)(F)c1ccc(C2CO2)cc1
What is the building block token for the following molecule?
FC(F)(F)c1ccc(C2CO2)cc1
<BB_837>
What is the molecular formula for <BB_837>?
The molecular formula for <BB_837> (FC(F)(F)c1ccc(C2CO2)cc1) is C9H7F3O.
Describe the ring structures in building block <BB_837>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_837>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_837>.
**Token:** <BB_837> **SMILES:** FC(F)(F)c1ccc(C2CO2)cc1 **Molecular Formula:** C9H7F3O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_838>.
O=C(O)CC1(O)CCCOC1
What is the building block token for the following molecule?
O=C(O)CC1(O)CCCOC1
<BB_838>
What is the molecular formula for <BB_838>?
The molecular formula for <BB_838> (O=C(O)CC1(O)CCCOC1) is C7H12O4.
Describe the ring structures in building block <BB_838>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_838>.
The molecule contains the following groups: Carboxylic Acid, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_838>.
**Token:** <BB_838> **SMILES:** O=C(O)CC1(O)CCCOC1 **Molecular Formula:** C7H12O4 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_839>.
CCSCCl
What is the building block token for the following molecule?
CCSCCl
<BB_839>
What is the molecular formula for <BB_839>?
The molecular formula for <BB_839> (CCSCCl) is C3H7ClS.
Describe the ring structures in building block <BB_839>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_839>.
The molecule contains the following groups: Sulfide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_839>.
**Token:** <BB_839> **SMILES:** CCSCCl **Molecular Formula:** C3H7ClS **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Sulfide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_840>.
O=c1c2ccccc2ncn1CCBr
What is the building block token for the following molecule?
O=c1c2ccccc2ncn1CCBr
<BB_840>
What is the molecular formula for <BB_840>?
The molecular formula for <BB_840> (O=c1c2ccccc2ncn1CCBr) is C10H9BrN2O.
Describe the ring structures in building block <BB_840>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_840>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_840>.
**Token:** <BB_840> **SMILES:** O=c1c2ccccc2ncn1CCBr **Molecular Formula:** C10H9BrN2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_841>.
Cl.O=C(O)C1CCNc2ccc(Br)cc21
What is the building block token for the following molecule?
Cl.O=C(O)C1CCNc2ccc(Br)cc21
<BB_841>
What is the molecular formula for <BB_841>?
The molecular formula for <BB_841> (Cl.O=C(O)C1CCNc2ccc(Br)cc21) is C10H11BrClNO2.
Describe the ring structures in building block <BB_841>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_841>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_841>.
**Token:** <BB_841> **SMILES:** Cl.O=C(O)C1CCNc2ccc(Br)cc21 **Molecular Formula:** C10H11BrClNO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_842>.
Cl.NCCc1c(Br)cccc1Br
What is the building block token for the following molecule?
Cl.NCCc1c(Br)cccc1Br
<BB_842>
What is the molecular formula for <BB_842>?
The molecular formula for <BB_842> (Cl.NCCc1c(Br)cccc1Br) is C8H10Br2ClN.
Describe the ring structures in building block <BB_842>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_842>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_842>.
**Token:** <BB_842> **SMILES:** Cl.NCCc1c(Br)cccc1Br **Molecular Formula:** C8H10Br2ClN **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_843>.
O=C(O)c1cccc(Cl)c1
What is the building block token for the following molecule?
O=C(O)c1cccc(Cl)c1
<BB_843>
What is the molecular formula for <BB_843>?
The molecular formula for <BB_843> (O=C(O)c1cccc(Cl)c1) is C7H5ClO2.
Describe the ring structures in building block <BB_843>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_843>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_843>.
**Token:** <BB_843> **SMILES:** O=C(O)c1cccc(Cl)c1 **Molecular Formula:** C7H5ClO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_844>.
FC(F)c1nnc2c(Cl)nccn12
What is the building block token for the following molecule?
FC(F)c1nnc2c(Cl)nccn12
<BB_844>
What is the molecular formula for <BB_844>?
The molecular formula for <BB_844> (FC(F)c1nnc2c(Cl)nccn12) is C6H3ClF2N4.
Describe the ring structures in building block <BB_844>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_844>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_844>.
**Token:** <BB_844> **SMILES:** FC(F)c1nnc2c(Cl)nccn12 **Molecular Formula:** C6H3ClF2N4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_845>.
CN(C)CCn1cc(Br)cn1.Cl.Cl
What is the building block token for the following molecule?
CN(C)CCn1cc(Br)cn1.Cl.Cl
<BB_845>
What is the molecular formula for <BB_845>?
The molecular formula for <BB_845> (CN(C)CCn1cc(Br)cn1.Cl.Cl) is C7H14BrCl2N3.
Describe the ring structures in building block <BB_845>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_845>.
The molecule contains the following groups: Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_845>.
**Token:** <BB_845> **SMILES:** CN(C)CCn1cc(Br)cn1.Cl.Cl **Molecular Formula:** C7H14BrCl2N3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_846>.
CCc1ccccc1N=C=S
What is the building block token for the following molecule?
CCc1ccccc1N=C=S
<BB_846>
What is the molecular formula for <BB_846>?
The molecular formula for <BB_846> (CCc1ccccc1N=C=S) is C9H9NS.
Describe the ring structures in building block <BB_846>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_846>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_846>.
**Token:** <BB_846> **SMILES:** CCc1ccccc1N=C=S **Molecular Formula:** C9H9NS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_847>.
CC1CNCC(c2ccccc2)O1
What is the building block token for the following molecule?
CC1CNCC(c2ccccc2)O1
<BB_847>
What is the molecular formula for <BB_847>?
The molecular formula for <BB_847> (CC1CNCC(c2ccccc2)O1) is C11H15NO.
Describe the ring structures in building block <BB_847>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_847>.
The molecule contains the following groups: Secondary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_847>.
**Token:** <BB_847> **SMILES:** CC1CNCC(c2ccccc2)O1 **Molecular Formula:** C11H15NO **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Ether
Provide the SMILES representation for the building block token <BB_848>.
COc1c(C)cc(Cl)cc1C(=O)O
What is the building block token for the following molecule?
COc1c(C)cc(Cl)cc1C(=O)O
<BB_848>
What is the molecular formula for <BB_848>?
The molecular formula for <BB_848> (COc1c(C)cc(Cl)cc1C(=O)O) is C9H9ClO3.
Describe the ring structures in building block <BB_848>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_848>.
The molecule contains the following groups: Carboxylic Acid, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_848>.
**Token:** <BB_848> **SMILES:** COc1c(C)cc(Cl)cc1C(=O)O **Molecular Formula:** C9H9ClO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_849>.
Cc1ccc(S(=O)(=O)O)cc1.FC1(F)[C@@H]2NCC[C@@H]21
What is the building block token for the following molecule?
Cc1ccc(S(=O)(=O)O)cc1.FC1(F)[C@@H]2NCC[C@@H]21
<BB_849>
What is the molecular formula for <BB_849>?
The molecular formula for <BB_849> (Cc1ccc(S(=O)(=O)O)cc1.FC1(F)[C@@H]2NCC[C@@H]21) is C12H15F2NO3S.
Describe the ring structures in building block <BB_849>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3, an aliphatic ring of size 5.
List the primary functional groups present in <BB_849>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_849>.
**Token:** <BB_849> **SMILES:** Cc1ccc(S(=O)(=O)O)cc1.FC1(F)[C@@H]2NCC[C@@H]21 **Molecular Formula:** C12H15F2NO3S **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)