instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_850>.
CCP(=O)(CC)c1cccc(F)c1
What is the building block token for the following molecule?
CCP(=O)(CC)c1cccc(F)c1
<BB_850>
What is the molecular formula for <BB_850>?
The molecular formula for <BB_850> (CCP(=O)(CC)c1cccc(F)c1) is C10H14FOP.
Describe the ring structures in building block <BB_850>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_850>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_850>.
**Token:** <BB_850> **SMILES:** CCP(=O)(CC)c1cccc(F)c1 **Molecular Formula:** C10H14FOP **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_851>.
CNCc1ccc(F)c(Cl)c1.Cl
What is the building block token for the following molecule?
CNCc1ccc(F)c(Cl)c1.Cl
<BB_851>
What is the molecular formula for <BB_851>?
The molecular formula for <BB_851> (CNCc1ccc(F)c(Cl)c1.Cl) is C8H10Cl2FN.
Describe the ring structures in building block <BB_851>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_851>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_851>.
**Token:** <BB_851> **SMILES:** CNCc1ccc(F)c(Cl)c1.Cl **Molecular Formula:** C8H10Cl2FN **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_852>.
Cl.O=C(O)CC1CCN(c2ccncc2)CC1
What is the building block token for the following molecule?
Cl.O=C(O)CC1CCN(c2ccncc2)CC1
<BB_852>
What is the molecular formula for <BB_852>?
The molecular formula for <BB_852> (Cl.O=C(O)CC1CCN(c2ccncc2)CC1) is C12H17ClN2O2.
Describe the ring structures in building block <BB_852>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_852>.
The molecule contains the following groups: Carboxylic Acid, Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_852>.
**Token:** <BB_852> **SMILES:** Cl.O=C(O)CC1CCN(c2ccncc2)CC1 **Molecular Formula:** C12H17ClN2O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_853>.
Cl.Cl.NC1CCCOC1c1ccncc1
What is the building block token for the following molecule?
Cl.Cl.NC1CCCOC1c1ccncc1
<BB_853>
What is the molecular formula for <BB_853>?
The molecular formula for <BB_853> (Cl.Cl.NC1CCCOC1c1ccncc1) is C10H16Cl2N2O.
Describe the ring structures in building block <BB_853>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_853>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_853>.
**Token:** <BB_853> **SMILES:** Cl.Cl.NC1CCCOC1c1ccncc1 **Molecular Formula:** C10H16Cl2N2O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_854>.
Nc1c(Br)cc(F)cc1C(F)(F)F
What is the building block token for the following molecule?
Nc1c(Br)cc(F)cc1C(F)(F)F
<BB_854>
What is the molecular formula for <BB_854>?
The molecular formula for <BB_854> (Nc1c(Br)cc(F)cc1C(F)(F)F) is C7H4BrF4N.
Describe the ring structures in building block <BB_854>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_854>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_854>.
**Token:** <BB_854> **SMILES:** Nc1c(Br)cc(F)cc1C(F)(F)F **Molecular Formula:** C7H4BrF4N **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_855>.
CNCc1ccc(F)cc1C(F)(F)F
What is the building block token for the following molecule?
CNCc1ccc(F)cc1C(F)(F)F
<BB_855>
What is the molecular formula for <BB_855>?
The molecular formula for <BB_855> (CNCc1ccc(F)cc1C(F)(F)F) is C9H9F4N.
Describe the ring structures in building block <BB_855>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_855>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_855>.
**Token:** <BB_855> **SMILES:** CNCc1ccc(F)cc1C(F)(F)F **Molecular Formula:** C9H9F4N **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_856>.
COC1CCC2(CC1)CC(=O)C2
What is the building block token for the following molecule?
COC1CCC2(CC1)CC(=O)C2
<BB_856>
What is the molecular formula for <BB_856>?
The molecular formula for <BB_856> (COC1CCC2(CC1)CC(=O)C2) is C10H16O2.
Describe the ring structures in building block <BB_856>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 4.
List the primary functional groups present in <BB_856>.
The molecule contains the following groups: Ketone, Ether.
Provide a comprehensive chemical profile for the building block <BB_856>.
**Token:** <BB_856> **SMILES:** COC1CCC2(CC1)CC(=O)C2 **Molecular Formula:** C10H16O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 4. **Functional Groups:** Ketone, Ether
Provide the SMILES representation for the building block token <BB_857>.
CC1CCN(Cc2ccccc2CN)CC1
What is the building block token for the following molecule?
CC1CCN(Cc2ccccc2CN)CC1
<BB_857>
What is the molecular formula for <BB_857>?
The molecular formula for <BB_857> (CC1CCN(Cc2ccccc2CN)CC1) is C14H22N2.
Describe the ring structures in building block <BB_857>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_857>.
The molecule contains the following groups: Amine, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_857>.
**Token:** <BB_857> **SMILES:** CC1CCN(Cc2ccccc2CN)CC1 **Molecular Formula:** C14H22N2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine
Provide the SMILES representation for the building block token <BB_858>.
CC(=O)N1CC(C)CNc2ccccc21.Cl
What is the building block token for the following molecule?
CC(=O)N1CC(C)CNc2ccccc21.Cl
<BB_858>
What is the molecular formula for <BB_858>?
The molecular formula for <BB_858> (CC(=O)N1CC(C)CNc2ccccc21.Cl) is C12H17ClN2O.
Describe the ring structures in building block <BB_858>.
The molecule contains 2 ring(s): an aliphatic ring of size 7, an aromatic ring of size 6.
List the primary functional groups present in <BB_858>.
The molecule contains the following groups: Secondary Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_858>.
**Token:** <BB_858> **SMILES:** CC(=O)N1CC(C)CNc2ccccc21.Cl **Molecular Formula:** C12H17ClN2O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 7, an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_859>.
O=C(O)c1ccc(F)cc1C1CC1
What is the building block token for the following molecule?
O=C(O)c1ccc(F)cc1C1CC1
<BB_859>
What is the molecular formula for <BB_859>?
The molecular formula for <BB_859> (O=C(O)c1ccc(F)cc1C1CC1) is C10H9FO2.
Describe the ring structures in building block <BB_859>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_859>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_859>.
**Token:** <BB_859> **SMILES:** O=C(O)c1ccc(F)cc1C1CC1 **Molecular Formula:** C10H9FO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_860>.
CCOC(=O)c1conc1CCl
What is the building block token for the following molecule?
CCOC(=O)c1conc1CCl
<BB_860>
What is the molecular formula for <BB_860>?
The molecular formula for <BB_860> (CCOC(=O)c1conc1CCl) is C7H8ClNO3.
Describe the ring structures in building block <BB_860>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_860>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_860>.
**Token:** <BB_860> **SMILES:** CCOC(=O)c1conc1CCl **Molecular Formula:** C7H8ClNO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_861>.
Sc1nc2ccc(Cl)cc2[nH]1
What is the building block token for the following molecule?
Sc1nc2ccc(Cl)cc2[nH]1
<BB_861>
What is the molecular formula for <BB_861>?
The molecular formula for <BB_861> (Sc1nc2ccc(Cl)cc2[nH]1) is C7H5ClN2S.
Describe the ring structures in building block <BB_861>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_861>.
The molecule contains the following groups: Thiol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_861>.
**Token:** <BB_861> **SMILES:** Sc1nc2ccc(Cl)cc2[nH]1 **Molecular Formula:** C7H5ClN2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Thiol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_862>.
N#CCc1cc(F)c(Br)cc1[N+](=O)[O-]
What is the building block token for the following molecule?
N#CCc1cc(F)c(Br)cc1[N+](=O)[O-]
<BB_862>
What is the molecular formula for <BB_862>?
The molecular formula for <BB_862> (N#CCc1cc(F)c(Br)cc1[N+](=O)[O-]) is C8H4BrFN2O2.
Describe the ring structures in building block <BB_862>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_862>.
The molecule contains the following groups: Tertiary Amine, Halogen (F,Cl,Br,I), Nitrile, Nitro.
Provide a comprehensive chemical profile for the building block <BB_862>.
**Token:** <BB_862> **SMILES:** N#CCc1cc(F)c(Br)cc1[N+](=O)[O-] **Molecular Formula:** C8H4BrFN2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Halogen (F,Cl,Br,I), Nitrile, Nitro
Provide the SMILES representation for the building block token <BB_863>.
O=C(O)C1CSCN1C(=O)C1CC1
What is the building block token for the following molecule?
O=C(O)C1CSCN1C(=O)C1CC1
<BB_863>
What is the molecular formula for <BB_863>?
The molecular formula for <BB_863> (O=C(O)C1CSCN1C(=O)C1CC1) is C8H11NO3S.
Describe the ring structures in building block <BB_863>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 3.
List the primary functional groups present in <BB_863>.
The molecule contains the following groups: Carboxylic Acid, Amide, Sulfide.
Provide a comprehensive chemical profile for the building block <BB_863>.
**Token:** <BB_863> **SMILES:** O=C(O)C1CSCN1C(=O)C1CC1 **Molecular Formula:** C8H11NO3S **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 3. **Functional Groups:** Carboxylic Acid, Amide, Sulfide
Provide the SMILES representation for the building block token <BB_864>.
N#Cc1ccc(F)c2cnccc12
What is the building block token for the following molecule?
N#Cc1ccc(F)c2cnccc12
<BB_864>
What is the molecular formula for <BB_864>?
The molecular formula for <BB_864> (N#Cc1ccc(F)c2cnccc12) is C10H5FN2.
Describe the ring structures in building block <BB_864>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_864>.
The molecule contains the following groups: Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_864>.
**Token:** <BB_864> **SMILES:** N#Cc1ccc(F)c2cnccc12 **Molecular Formula:** C10H5FN2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_865>.
CC(C)(C)OC(=O)N1CC=CC1C(=O)O
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CC=CC1C(=O)O
<BB_865>
What is the molecular formula for <BB_865>?
The molecular formula for <BB_865> (CC(C)(C)OC(=O)N1CC=CC1C(=O)O) is C10H15NO4.
Describe the ring structures in building block <BB_865>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_865>.
The molecule contains the following groups: Carboxylic Acid, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_865>.
**Token:** <BB_865> **SMILES:** CC(C)(C)OC(=O)N1CC=CC1C(=O)O **Molecular Formula:** C10H15NO4 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid, Amide, Ether
Provide the SMILES representation for the building block token <BB_866>.
CNC(=O)C(c1ccccc1)N1CCNCC1
What is the building block token for the following molecule?
CNC(=O)C(c1ccccc1)N1CCNCC1
<BB_866>
What is the molecular formula for <BB_866>?
The molecular formula for <BB_866> (CNC(=O)C(c1ccccc1)N1CCNCC1) is C13H19N3O.
Describe the ring structures in building block <BB_866>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.