instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_116>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_116>.
**Token:** <BB_116> **SMILES:** CCCCc1nnc(N)s1 **Molecular Formula:** C6H11N3S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_117>.
C#Cc1c(F)ccc(F)c1Cl
What is the building block token for the following molecule?
C#Cc1c(F)ccc(F)c1Cl
<BB_117>
What is the molecular formula for <BB_117>?
The molecular formula for <BB_117> (C#Cc1c(F)ccc(F)c1Cl) is C8H3ClF2.
Describe the ring structures in building block <BB_117>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_117>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_117>.
**Token:** <BB_117> **SMILES:** C#Cc1c(F)ccc(F)c1Cl **Molecular Formula:** C8H3ClF2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_118>.
CCOP(=O)(OCC)C12CC(S(=O)[O-])(C1)C2.[Li+]
What is the building block token for the following molecule?
CCOP(=O)(OCC)C12CC(S(=O)[O-])(C1)C2.[Li+]
<BB_118>
What is the molecular formula for <BB_118>?
The molecular formula for <BB_118> (CCOP(=O)(OCC)C12CC(S(=O)[O-])(C1)C2.[Li+]) is C9H16LiO5PS.
Describe the ring structures in building block <BB_118>.
The molecule contains 3 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4, an aliphatic ring of size 4.
List the primary functional groups present in <BB_118>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_118>.
**Token:** <BB_118> **SMILES:** CCOP(=O)(OCC)C12CC(S(=O)[O-])(C1)C2.[Li+] **Molecular Formula:** C9H16LiO5PS **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4, an aliphatic ring of size 4. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_119>.
CC(C)(C)OC(=O)NC(COC(F)F)C(=O)O
What is the building block token for the following molecule?
CC(C)(C)OC(=O)NC(COC(F)F)C(=O)O
<BB_119>
What is the molecular formula for <BB_119>?
The molecular formula for <BB_119> (CC(C)(C)OC(=O)NC(COC(F)F)C(=O)O) is C9H15F2NO5.
Describe the ring structures in building block <BB_119>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_119>.
The molecule contains the following groups: Carboxylic Acid, Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_119>.
**Token:** <BB_119> **SMILES:** CC(C)(C)OC(=O)NC(COC(F)F)C(=O)O **Molecular Formula:** C9H15F2NO5 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid, Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_120>.
CCOC(=O)CC1C(=O)CCN1C(=O)OCC
What is the building block token for the following molecule?
CCOC(=O)CC1C(=O)CCN1C(=O)OCC
<BB_120>
What is the molecular formula for <BB_120>?
The molecular formula for <BB_120> (CCOC(=O)CC1C(=O)CCN1C(=O)OCC) is C11H17NO5.
Describe the ring structures in building block <BB_120>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_120>.
The molecule contains the following groups: Amide, Ester, Ketone, Ether.
Provide a comprehensive chemical profile for the building block <BB_120>.
**Token:** <BB_120> **SMILES:** CCOC(=O)CC1C(=O)CCN1C(=O)OCC **Molecular Formula:** C11H17NO5 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amide, Ester, Ketone, Ether
Provide the SMILES representation for the building block token <BB_121>.
CC(C)(C)OC(=O)N[C@H]1C[C@]2(CCCCCN2)C1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N[C@H]1C[C@]2(CCCCCN2)C1
<BB_121>
What is the molecular formula for <BB_121>?
The molecular formula for <BB_121> (CC(C)(C)OC(=O)N[C@H]1C[C@]2(CCCCCN2)C1) is C14H26N2O2.
Describe the ring structures in building block <BB_121>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 7.
List the primary functional groups present in <BB_121>.
The molecule contains the following groups: Secondary Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_121>.
**Token:** <BB_121> **SMILES:** CC(C)(C)OC(=O)N[C@H]1C[C@]2(CCCCCN2)C1 **Molecular Formula:** C14H26N2O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 7. **Functional Groups:** Secondary Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_122>.
Nc1cnc(Cl)nc1Br
What is the building block token for the following molecule?
Nc1cnc(Cl)nc1Br
<BB_122>
What is the molecular formula for <BB_122>?
The molecular formula for <BB_122> (Nc1cnc(Cl)nc1Br) is C4H3BrClN3.
Describe the ring structures in building block <BB_122>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_122>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_122>.
**Token:** <BB_122> **SMILES:** Nc1cnc(Cl)nc1Br **Molecular Formula:** C4H3BrClN3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_123>.
COc1cccnc1C(=O)O.Cl
What is the building block token for the following molecule?
COc1cccnc1C(=O)O.Cl
<BB_123>
What is the molecular formula for <BB_123>?
The molecular formula for <BB_123> (COc1cccnc1C(=O)O.Cl) is C7H8ClNO3.
Describe the ring structures in building block <BB_123>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_123>.
The molecule contains the following groups: Carboxylic Acid, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_123>.
**Token:** <BB_123> **SMILES:** COc1cccnc1C(=O)O.Cl **Molecular Formula:** C7H8ClNO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_124>.
Cl.NC12CC(C3CCCC3)(C1)C2
What is the building block token for the following molecule?
Cl.NC12CC(C3CCCC3)(C1)C2
<BB_124>
What is the molecular formula for <BB_124>?
The molecular formula for <BB_124> (Cl.NC12CC(C3CCCC3)(C1)C2) is C10H18ClN.
Describe the ring structures in building block <BB_124>.
The molecule contains 4 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4, an aliphatic ring of size 5, an aliphatic ring of size 4.
List the primary functional groups present in <BB_124>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_124>.
**Token:** <BB_124> **SMILES:** Cl.NC12CC(C3CCCC3)(C1)C2 **Molecular Formula:** C10H18ClN **Ring System:** The molecule contains 4 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4, an aliphatic ring of size 5, an aliphatic ring of size 4. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_125>.
Cc1cc(Cl)cc(C#N)c1
What is the building block token for the following molecule?
Cc1cc(Cl)cc(C#N)c1
<BB_125>
What is the molecular formula for <BB_125>?
The molecular formula for <BB_125> (Cc1cc(Cl)cc(C#N)c1) is C8H6ClN.
Describe the ring structures in building block <BB_125>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_125>.
The molecule contains the following groups: Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_125>.
**Token:** <BB_125> **SMILES:** Cc1cc(Cl)cc(C#N)c1 **Molecular Formula:** C8H6ClN **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_126>.
O=C(CCOc1ccccc1)N1CCCC1
What is the building block token for the following molecule?
O=C(CCOc1ccccc1)N1CCCC1
<BB_126>
What is the molecular formula for <BB_126>?
The molecular formula for <BB_126> (O=C(CCOc1ccccc1)N1CCCC1) is C13H17NO2.
Describe the ring structures in building block <BB_126>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_126>.
The molecule contains the following groups: Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_126>.
**Token:** <BB_126> **SMILES:** O=C(CCOc1ccccc1)N1CCCC1 **Molecular Formula:** C13H17NO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Amide, Ether
Provide the SMILES representation for the building block token <BB_127>.
N#CC(O)c1ccc(Br)cc1F
What is the building block token for the following molecule?
N#CC(O)c1ccc(Br)cc1F
<BB_127>
What is the molecular formula for <BB_127>?
The molecular formula for <BB_127> (N#CC(O)c1ccc(Br)cc1F) is C8H5BrFNO.
Describe the ring structures in building block <BB_127>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_127>.
The molecule contains the following groups: Alcohol, Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_127>.
**Token:** <BB_127> **SMILES:** N#CC(O)c1ccc(Br)cc1F **Molecular Formula:** C8H5BrFNO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Alcohol, Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_128>.
N#CCC(=O)c1cc(Cl)ccc1Cl
What is the building block token for the following molecule?
N#CCC(=O)c1cc(Cl)ccc1Cl
<BB_128>
What is the molecular formula for <BB_128>?
The molecular formula for <BB_128> (N#CCC(=O)c1cc(Cl)ccc1Cl) is C9H5Cl2NO.
Describe the ring structures in building block <BB_128>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_128>.
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_128>.
**Token:** <BB_128> **SMILES:** N#CCC(=O)c1cc(Cl)ccc1Cl **Molecular Formula:** C9H5Cl2NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ketone, Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_129>.
O=C(O)c1cc2c3c(c1)C(=O)C(=O)N3CCC2
What is the building block token for the following molecule?
O=C(O)c1cc2c3c(c1)C(=O)C(=O)N3CCC2
<BB_129>
What is the molecular formula for <BB_129>?
The molecular formula for <BB_129> (O=C(O)c1cc2c3c(c1)C(=O)C(=O)N3CCC2) is C12H9NO4.
Describe the ring structures in building block <BB_129>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_129>.
The molecule contains the following groups: Carboxylic Acid, Amide, Ketone.
Provide a comprehensive chemical profile for the building block <BB_129>.
**Token:** <BB_129> **SMILES:** O=C(O)c1cc2c3c(c1)C(=O)C(=O)N3CCC2 **Molecular Formula:** C12H9NO4 **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amide, Ketone
Provide the SMILES representation for the building block token <BB_130>.
COCCSCCCBr
What is the building block token for the following molecule?
COCCSCCCBr
<BB_130>
What is the molecular formula for <BB_130>?
The molecular formula for <BB_130> (COCCSCCCBr) is C6H13BrOS.
Describe the ring structures in building block <BB_130>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_130>.
The molecule contains the following groups: Ether, Sulfide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_130>.
**Token:** <BB_130> **SMILES:** COCCSCCCBr **Molecular Formula:** C6H13BrOS **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ether, Sulfide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_131>.
C[C@H](O)[C@@H](N)C(=O)O
What is the building block token for the following molecule?
C[C@H](O)[C@@H](N)C(=O)O
<BB_131>
What is the molecular formula for <BB_131>?
The molecular formula for <BB_131> (C[C@H](O)[C@@H](N)C(=O)O) is C4H9NO3.
Describe the ring structures in building block <BB_131>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_131>.
The molecule contains the following groups: Carboxylic Acid, Amine, Alcohol.
Provide a comprehensive chemical profile for the building block <BB_131>.
**Token:** <BB_131> **SMILES:** C[C@H](O)[C@@H](N)C(=O)O **Molecular Formula:** C4H9NO3 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid, Amine, Alcohol
Provide the SMILES representation for the building block token <BB_132>.
CC(C)C1(O)CCCNC1.Cl
What is the building block token for the following molecule?
CC(C)C1(O)CCCNC1.Cl
<BB_132>
What is the molecular formula for <BB_132>?
The molecular formula for <BB_132> (CC(C)C1(O)CCCNC1.Cl) is C8H18ClNO.
Describe the ring structures in building block <BB_132>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_132>.
The molecule contains the following groups: Secondary Amine, Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_132>.
**Token:** <BB_132> **SMILES:** CC(C)C1(O)CCCNC1.Cl **Molecular Formula:** C8H18ClNO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_133>.
O=C(O)COc1ccc(CO)cc1
What is the building block token for the following molecule?
O=C(O)COc1ccc(CO)cc1
<BB_133>