instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_866>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Amide.
Provide a comprehensive chemical profile for the building block <BB_866>.
**Token:** <BB_866> **SMILES:** CNC(=O)C(c1ccccc1)N1CCNCC1 **Molecular Formula:** C13H19N3O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Tertiary Amine, Amide
Provide the SMILES representation for the building block token <BB_867>.
CC(Br)c1ccccc1F
What is the building block token for the following molecule?
CC(Br)c1ccccc1F
<BB_867>
What is the molecular formula for <BB_867>?
The molecular formula for <BB_867> (CC(Br)c1ccccc1F) is C8H8BrF.
Describe the ring structures in building block <BB_867>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_867>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_867>.
**Token:** <BB_867> **SMILES:** CC(Br)c1ccccc1F **Molecular Formula:** C8H8BrF **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_868>.
OCC1CC(CC(F)(F)F)C1
What is the building block token for the following molecule?
OCC1CC(CC(F)(F)F)C1
<BB_868>
What is the molecular formula for <BB_868>?
The molecular formula for <BB_868> (OCC1CC(CC(F)(F)F)C1) is C7H11F3O.
Describe the ring structures in building block <BB_868>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_868>.
The molecule contains the following groups: Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_868>.
**Token:** <BB_868> **SMILES:** OCC1CC(CC(F)(F)F)C1 **Molecular Formula:** C7H11F3O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_869>.
FC(F)(F)c1nnnn1C1CCNCC1
What is the building block token for the following molecule?
FC(F)(F)c1nnnn1C1CCNCC1
<BB_869>
What is the molecular formula for <BB_869>?
The molecular formula for <BB_869> (FC(F)(F)c1nnnn1C1CCNCC1) is C7H10F3N5.
Describe the ring structures in building block <BB_869>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_869>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_869>.
**Token:** <BB_869> **SMILES:** FC(F)(F)c1nnnn1C1CCNCC1 **Molecular Formula:** C7H10F3N5 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_870>.
Cn1cc(C(N)CNC(=O)OC(C)(C)C)cn1
What is the building block token for the following molecule?
Cn1cc(C(N)CNC(=O)OC(C)(C)C)cn1
<BB_870>
What is the molecular formula for <BB_870>?
The molecular formula for <BB_870> (Cn1cc(C(N)CNC(=O)OC(C)(C)C)cn1) is C11H20N4O2.
Describe the ring structures in building block <BB_870>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_870>.
The molecule contains the following groups: Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_870>.
**Token:** <BB_870> **SMILES:** Cn1cc(C(N)CNC(=O)OC(C)(C)C)cn1 **Molecular Formula:** C11H20N4O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_871>.
NCC1=NOC2(CCC2)C1
What is the building block token for the following molecule?
NCC1=NOC2(CCC2)C1
<BB_871>
What is the molecular formula for <BB_871>?
The molecular formula for <BB_871> (NCC1=NOC2(CCC2)C1) is C7H12N2O.
Describe the ring structures in building block <BB_871>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 4.
List the primary functional groups present in <BB_871>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_871>.
**Token:** <BB_871> **SMILES:** NCC1=NOC2(CCC2)C1 **Molecular Formula:** C7H12N2O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 4. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_872>.
Cn1ccnc1C(O)(CCN)C(F)(F)F
What is the building block token for the following molecule?
Cn1ccnc1C(O)(CCN)C(F)(F)F
<BB_872>
What is the molecular formula for <BB_872>?
The molecular formula for <BB_872> (Cn1ccnc1C(O)(CCN)C(F)(F)F) is C8H12F3N3O.
Describe the ring structures in building block <BB_872>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_872>.
The molecule contains the following groups: Amine, Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_872>.
**Token:** <BB_872> **SMILES:** Cn1ccnc1C(O)(CCN)C(F)(F)F **Molecular Formula:** C8H12F3N3O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_873>.
CCn1ncc2c(NN)ncnc21
What is the building block token for the following molecule?
CCn1ncc2c(NN)ncnc21
<BB_873>
What is the molecular formula for <BB_873>?
The molecular formula for <BB_873> (CCn1ncc2c(NN)ncnc21) is C7H10N6.
Describe the ring structures in building block <BB_873>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_873>.
The molecule contains the following groups: Amine, Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_873>.
**Token:** <BB_873> **SMILES:** CCn1ncc2c(NN)ncnc21 **Molecular Formula:** C7H10N6 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Secondary Amine
Provide the SMILES representation for the building block token <BB_874>.
CCC1(NC(=O)OC(C)(C)C)CCNCC1
What is the building block token for the following molecule?
CCC1(NC(=O)OC(C)(C)C)CCNCC1
<BB_874>
What is the molecular formula for <BB_874>?
The molecular formula for <BB_874> (CCC1(NC(=O)OC(C)(C)C)CCNCC1) is C12H24N2O2.
Describe the ring structures in building block <BB_874>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_874>.
The molecule contains the following groups: Secondary Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_874>.
**Token:** <BB_874> **SMILES:** CCC1(NC(=O)OC(C)(C)C)CCNCC1 **Molecular Formula:** C12H24N2O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_875>.
COc1cc(F)c(C#N)cc1[N+](=O)[O-]
What is the building block token for the following molecule?
COc1cc(F)c(C#N)cc1[N+](=O)[O-]
<BB_875>
What is the molecular formula for <BB_875>?
The molecular formula for <BB_875> (COc1cc(F)c(C#N)cc1[N+](=O)[O-]) is C8H5FN2O3.
Describe the ring structures in building block <BB_875>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_875>.
The molecule contains the following groups: Tertiary Amine, Ether, Halogen (F,Cl,Br,I), Nitrile, Nitro.
Provide a comprehensive chemical profile for the building block <BB_875>.
**Token:** <BB_875> **SMILES:** COc1cc(F)c(C#N)cc1[N+](=O)[O-] **Molecular Formula:** C8H5FN2O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Ether, Halogen (F,Cl,Br,I), Nitrile, Nitro
Provide the SMILES representation for the building block token <BB_876>.
COC(=O)c1cc([N+](=O)[O-])c(C)c(C(F)(F)F)c1
What is the building block token for the following molecule?
COC(=O)c1cc([N+](=O)[O-])c(C)c(C(F)(F)F)c1
<BB_876>
What is the molecular formula for <BB_876>?
The molecular formula for <BB_876> (COC(=O)c1cc([N+](=O)[O-])c(C)c(C(F)(F)F)c1) is C10H8F3NO4.
Describe the ring structures in building block <BB_876>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_876>.
The molecule contains the following groups: Tertiary Amine, Ester, Ether, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_876>.
**Token:** <BB_876> **SMILES:** COC(=O)c1cc([N+](=O)[O-])c(C)c(C(F)(F)F)c1 **Molecular Formula:** C10H8F3NO4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Ester, Ether, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_877>.
CCN(CC)C(=O)c1c(Cl)c(OC)cc(OC)c1Cl
What is the building block token for the following molecule?
CCN(CC)C(=O)c1c(Cl)c(OC)cc(OC)c1Cl
<BB_877>
What is the molecular formula for <BB_877>?
The molecular formula for <BB_877> (CCN(CC)C(=O)c1c(Cl)c(OC)cc(OC)c1Cl) is C13H17Cl2NO3.
Describe the ring structures in building block <BB_877>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_877>.
The molecule contains the following groups: Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_877>.
**Token:** <BB_877> **SMILES:** CCN(CC)C(=O)c1c(Cl)c(OC)cc(OC)c1Cl **Molecular Formula:** C13H17Cl2NO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_878>.
Nc1ccc(Oc2cccc(F)c2)c(Br)c1
What is the building block token for the following molecule?
Nc1ccc(Oc2cccc(F)c2)c(Br)c1
<BB_878>
What is the molecular formula for <BB_878>?
The molecular formula for <BB_878> (Nc1ccc(Oc2cccc(F)c2)c(Br)c1) is C12H9BrFNO.
Describe the ring structures in building block <BB_878>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_878>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_878>.
**Token:** <BB_878> **SMILES:** Nc1ccc(Oc2cccc(F)c2)c(Br)c1 **Molecular Formula:** C12H9BrFNO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_879>.
Cn1nc(C(=O)O)nc1O
What is the building block token for the following molecule?
Cn1nc(C(=O)O)nc1O
<BB_879>
What is the molecular formula for <BB_879>?
The molecular formula for <BB_879> (Cn1nc(C(=O)O)nc1O) is C4H5N3O3.
Describe the ring structures in building block <BB_879>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_879>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_879>.
**Token:** <BB_879> **SMILES:** Cn1nc(C(=O)O)nc1O **Molecular Formula:** C4H5N3O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_880>.
C[C@@H](N)C(C)(C)O.Cl
What is the building block token for the following molecule?
C[C@@H](N)C(C)(C)O.Cl
<BB_880>
What is the molecular formula for <BB_880>?
The molecular formula for <BB_880> (C[C@@H](N)C(C)(C)O.Cl) is C5H14ClNO.
Describe the ring structures in building block <BB_880>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_880>.
The molecule contains the following groups: Amine, Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_880>.
**Token:** <BB_880> **SMILES:** C[C@@H](N)C(C)(C)O.Cl **Molecular Formula:** C5H14ClNO **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_881>.
CCOC(=O)c1cccc(C(=O)O)c1
What is the building block token for the following molecule?
CCOC(=O)c1cccc(C(=O)O)c1
<BB_881>
What is the molecular formula for <BB_881>?
The molecular formula for <BB_881> (CCOC(=O)c1cccc(C(=O)O)c1) is C10H10O4.
Describe the ring structures in building block <BB_881>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_881>.
The molecule contains the following groups: Carboxylic Acid, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_881>.
**Token:** <BB_881> **SMILES:** CCOC(=O)c1cccc(C(=O)O)c1 **Molecular Formula:** C10H10O4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ester, Ether
Provide the SMILES representation for the building block token <BB_882>.
CC(C)C(NS(=O)(=O)c1ccc(Br)s1)C(=O)O
What is the building block token for the following molecule?
CC(C)C(NS(=O)(=O)c1ccc(Br)s1)C(=O)O
<BB_882>
What is the molecular formula for <BB_882>?
The molecular formula for <BB_882> (CC(C)C(NS(=O)(=O)c1ccc(Br)s1)C(=O)O) is C9H12BrNO4S2.
Describe the ring structures in building block <BB_882>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_882>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I), Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_882>.
**Token:** <BB_882> **SMILES:** CC(C)C(NS(=O)(=O)c1ccc(Br)s1)C(=O)O **Molecular Formula:** C9H12BrNO4S2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I), Sulfonamide
Provide the SMILES representation for the building block token <BB_883>.
CC1(C)OB(c2cccc3oc(=O)[nH]c23)OC1(C)C
What is the building block token for the following molecule?
CC1(C)OB(c2cccc3oc(=O)[nH]c23)OC1(C)C
<BB_883>