instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_883>?
The molecular formula for <BB_883> (CC1(C)OB(c2cccc3oc(=O)[nH]c23)OC1(C)C) is C13H16BNO4.
Describe the ring structures in building block <BB_883>.
The molecule contains 3 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_883>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_883>.
**Token:** <BB_883> **SMILES:** CC1(C)OB(c2cccc3oc(=O)[nH]c23)OC1(C)C **Molecular Formula:** C13H16BNO4 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_884>.
Cc1cc(C=O)c(C)n1-c1ccc(Br)cc1
What is the building block token for the following molecule?
Cc1cc(C=O)c(C)n1-c1ccc(Br)cc1
<BB_884>
What is the molecular formula for <BB_884>?
The molecular formula for <BB_884> (Cc1cc(C=O)c(C)n1-c1ccc(Br)cc1) is C13H12BrNO.
Describe the ring structures in building block <BB_884>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_884>.
The molecule contains the following groups: Aldehyde, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_884>.
**Token:** <BB_884> **SMILES:** Cc1cc(C=O)c(C)n1-c1ccc(Br)cc1 **Molecular Formula:** C13H12BrNO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Aldehyde, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_885>.
Cl.N=C(N)NC(=N)N1CCOCC1
What is the building block token for the following molecule?
Cl.N=C(N)NC(=N)N1CCOCC1
<BB_885>
What is the molecular formula for <BB_885>?
The molecular formula for <BB_885> (Cl.N=C(N)NC(=N)N1CCOCC1) is C6H14ClN5O.
Describe the ring structures in building block <BB_885>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_885>.
The molecule contains the following groups: Amine, Secondary Amine, Tertiary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_885>.
**Token:** <BB_885> **SMILES:** Cl.N=C(N)NC(=N)N1CCOCC1 **Molecular Formula:** C6H14ClN5O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amine, Secondary Amine, Tertiary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_886>.
CC(C)C(NS(=O)(=O)c1ccccc1)C(=O)O
What is the building block token for the following molecule?
CC(C)C(NS(=O)(=O)c1ccccc1)C(=O)O
<BB_886>
What is the molecular formula for <BB_886>?
The molecular formula for <BB_886> (CC(C)C(NS(=O)(=O)c1ccccc1)C(=O)O) is C11H15NO4S.
Describe the ring structures in building block <BB_886>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_886>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_886>.
**Token:** <BB_886> **SMILES:** CC(C)C(NS(=O)(=O)c1ccccc1)C(=O)O **Molecular Formula:** C11H15NO4S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Secondary Amine, Sulfonamide
Provide the SMILES representation for the building block token <BB_887>.
Cc1cccc(CCN)c1Cl.Cl
What is the building block token for the following molecule?
Cc1cccc(CCN)c1Cl.Cl
<BB_887>
What is the molecular formula for <BB_887>?
The molecular formula for <BB_887> (Cc1cccc(CCN)c1Cl.Cl) is C9H13Cl2N.
Describe the ring structures in building block <BB_887>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_887>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_887>.
**Token:** <BB_887> **SMILES:** Cc1cccc(CCN)c1Cl.Cl **Molecular Formula:** C9H13Cl2N **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_888>.
C#Cc1ccc(F)c(C(=O)O)c1
What is the building block token for the following molecule?
C#Cc1ccc(F)c(C(=O)O)c1
<BB_888>
What is the molecular formula for <BB_888>?
The molecular formula for <BB_888> (C#Cc1ccc(F)c(C(=O)O)c1) is C9H5FO2.
Describe the ring structures in building block <BB_888>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_888>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_888>.
**Token:** <BB_888> **SMILES:** C#Cc1ccc(F)c(C(=O)O)c1 **Molecular Formula:** C9H5FO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_889>.
[N-]=[N+]=NCC1CCCOC1
What is the building block token for the following molecule?
[N-]=[N+]=NCC1CCCOC1
<BB_889>
What is the molecular formula for <BB_889>?
The molecular formula for <BB_889> ([N-]=[N+]=NCC1CCCOC1) is C6H11N3O.
Describe the ring structures in building block <BB_889>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_889>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_889>.
**Token:** <BB_889> **SMILES:** [N-]=[N+]=NCC1CCCOC1 **Molecular Formula:** C6H11N3O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_890>.
C[C@H]1CC[C@H](OCCCN)CC1.Cl
What is the building block token for the following molecule?
C[C@H]1CC[C@H](OCCCN)CC1.Cl
<BB_890>
What is the molecular formula for <BB_890>?
The molecular formula for <BB_890> (C[C@H]1CC[C@H](OCCCN)CC1.Cl) is C10H22ClNO.
Describe the ring structures in building block <BB_890>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_890>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_890>.
**Token:** <BB_890> **SMILES:** C[C@H]1CC[C@H](OCCCN)CC1.Cl **Molecular Formula:** C10H22ClNO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_891>.
NCCNC(=S)NC1CCc2ccccc21
What is the building block token for the following molecule?
NCCNC(=S)NC1CCc2ccccc21
<BB_891>
What is the molecular formula for <BB_891>?
The molecular formula for <BB_891> (NCCNC(=S)NC1CCc2ccccc21) is C12H17N3S.
Describe the ring structures in building block <BB_891>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_891>.
The molecule contains the following groups: Amine, Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_891>.
**Token:** <BB_891> **SMILES:** NCCNC(=S)NC1CCc2ccccc21 **Molecular Formula:** C12H17N3S **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Secondary Amine
Provide the SMILES representation for the building block token <BB_892>.
CCCc1cc(N)n[nH]1.Cl
What is the building block token for the following molecule?
CCCc1cc(N)n[nH]1.Cl
<BB_892>
What is the molecular formula for <BB_892>?
The molecular formula for <BB_892> (CCCc1cc(N)n[nH]1.Cl) is C6H12ClN3.
Describe the ring structures in building block <BB_892>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_892>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_892>.
**Token:** <BB_892> **SMILES:** CCCc1cc(N)n[nH]1.Cl **Molecular Formula:** C6H12ClN3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_893>.
CC1(C)CNC(c2ccccc2)C1.Cl
What is the building block token for the following molecule?
CC1(C)CNC(c2ccccc2)C1.Cl
<BB_893>
What is the molecular formula for <BB_893>?
The molecular formula for <BB_893> (CC1(C)CNC(c2ccccc2)C1.Cl) is C12H18ClN.
Describe the ring structures in building block <BB_893>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_893>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_893>.
**Token:** <BB_893> **SMILES:** CC1(C)CNC(c2ccccc2)C1.Cl **Molecular Formula:** C12H18ClN **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_894>.
C[C@@H](CCO)N(C)C.Cl
What is the building block token for the following molecule?
C[C@@H](CCO)N(C)C.Cl
<BB_894>
What is the molecular formula for <BB_894>?
The molecular formula for <BB_894> (C[C@@H](CCO)N(C)C.Cl) is C6H16ClNO.
Describe the ring structures in building block <BB_894>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_894>.
The molecule contains the following groups: Tertiary Amine, Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_894>.
**Token:** <BB_894> **SMILES:** C[C@@H](CCO)N(C)C.Cl **Molecular Formula:** C6H16ClNO **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Tertiary Amine, Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_895>.
O=C(O)c1ccc(=O)n(-c2cccc(Cl)c2)c1
What is the building block token for the following molecule?
O=C(O)c1ccc(=O)n(-c2cccc(Cl)c2)c1
<BB_895>
What is the molecular formula for <BB_895>?
The molecular formula for <BB_895> (O=C(O)c1ccc(=O)n(-c2cccc(Cl)c2)c1) is C12H8ClNO3.
Describe the ring structures in building block <BB_895>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_895>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_895>.
**Token:** <BB_895> **SMILES:** O=C(O)c1ccc(=O)n(-c2cccc(Cl)c2)c1 **Molecular Formula:** C12H8ClNO3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_896>.
OC1CCN(C2COC2)CC1
What is the building block token for the following molecule?
OC1CCN(C2COC2)CC1
<BB_896>
What is the molecular formula for <BB_896>?
The molecular formula for <BB_896> (OC1CCN(C2COC2)CC1) is C8H15NO2.
Describe the ring structures in building block <BB_896>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 4.
List the primary functional groups present in <BB_896>.
The molecule contains the following groups: Tertiary Amine, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_896>.
**Token:** <BB_896> **SMILES:** OC1CCN(C2COC2)CC1 **Molecular Formula:** C8H15NO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 4. **Functional Groups:** Tertiary Amine, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_897>.
CC1(C)CCC(N)(C(=O)O)c2ccccc21.Cl
What is the building block token for the following molecule?
CC1(C)CCC(N)(C(=O)O)c2ccccc21.Cl
<BB_897>
What is the molecular formula for <BB_897>?
The molecular formula for <BB_897> (CC1(C)CCC(N)(C(=O)O)c2ccccc21.Cl) is C13H18ClNO2.
Describe the ring structures in building block <BB_897>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_897>.
The molecule contains the following groups: Carboxylic Acid, Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_897>.
**Token:** <BB_897> **SMILES:** CC1(C)CCC(N)(C(=O)O)c2ccccc21.Cl **Molecular Formula:** C13H18ClNO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_898>.
C#CC#CC(C)(C)NC(=O)OC(C)(C)C
What is the building block token for the following molecule?
C#CC#CC(C)(C)NC(=O)OC(C)(C)C
<BB_898>
What is the molecular formula for <BB_898>?
The molecular formula for <BB_898> (C#CC#CC(C)(C)NC(=O)OC(C)(C)C) is C12H17NO2.
Describe the ring structures in building block <BB_898>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_898>.
The molecule contains the following groups: Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_898>.
**Token:** <BB_898> **SMILES:** C#CC#CC(C)(C)NC(=O)OC(C)(C)C **Molecular Formula:** C12H17NO2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amide, Ether
Provide the SMILES representation for the building block token <BB_899>.
CC1CC(N)CN1C1CC1
What is the building block token for the following molecule?
CC1CC(N)CN1C1CC1
<BB_899>
What is the molecular formula for <BB_899>?
The molecular formula for <BB_899> (CC1CC(N)CN1C1CC1) is C8H16N2.
Describe the ring structures in building block <BB_899>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 3.
List the primary functional groups present in <BB_899>.
The molecule contains the following groups: Amine, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_899>.
**Token:** <BB_899> **SMILES:** CC1CC(N)CN1C1CC1 **Molecular Formula:** C8H16N2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 3. **Functional Groups:** Amine, Tertiary Amine