instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_900>.
CC(C)(C)Oc1cccc(CCN=C=O)n1
What is the building block token for the following molecule?
CC(C)(C)Oc1cccc(CCN=C=O)n1
<BB_900>
What is the molecular formula for <BB_900>?
The molecular formula for <BB_900> (CC(C)(C)Oc1cccc(CCN=C=O)n1) is C12H16N2O2.
Describe the ring structures in building block <BB_900>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_900>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_900>.
**Token:** <BB_900> **SMILES:** CC(C)(C)Oc1cccc(CCN=C=O)n1 **Molecular Formula:** C12H16N2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_901>.
FC(F)(F)c1cnc(I)nc1
What is the building block token for the following molecule?
FC(F)(F)c1cnc(I)nc1
<BB_901>
What is the molecular formula for <BB_901>?
The molecular formula for <BB_901> (FC(F)(F)c1cnc(I)nc1) is C5H2F3IN2.
Describe the ring structures in building block <BB_901>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_901>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_901>.
**Token:** <BB_901> **SMILES:** FC(F)(F)c1cnc(I)nc1 **Molecular Formula:** C5H2F3IN2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_902>.
Cn1cc(C(=O)O)c2ncccc21
What is the building block token for the following molecule?
Cn1cc(C(=O)O)c2ncccc21
<BB_902>
What is the molecular formula for <BB_902>?
The molecular formula for <BB_902> (Cn1cc(C(=O)O)c2ncccc21) is C9H8N2O2.
Describe the ring structures in building block <BB_902>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_902>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_902>.
**Token:** <BB_902> **SMILES:** Cn1cc(C(=O)O)c2ncccc21 **Molecular Formula:** C9H8N2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_903>.
N#Cc1cnccc1S
What is the building block token for the following molecule?
N#Cc1cnccc1S
<BB_903>
What is the molecular formula for <BB_903>?
The molecular formula for <BB_903> (N#Cc1cnccc1S) is C6H4N2S.
Describe the ring structures in building block <BB_903>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_903>.
The molecule contains the following groups: Thiol, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_903>.
**Token:** <BB_903> **SMILES:** N#Cc1cnccc1S **Molecular Formula:** C6H4N2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Thiol, Nitrile
Provide the SMILES representation for the building block token <BB_904>.
Cc1ccc(Nc2nnc(S)s2)c(C)c1
What is the building block token for the following molecule?
Cc1ccc(Nc2nnc(S)s2)c(C)c1
<BB_904>
What is the molecular formula for <BB_904>?
The molecular formula for <BB_904> (Cc1ccc(Nc2nnc(S)s2)c(C)c1) is C10H11N3S2.
Describe the ring structures in building block <BB_904>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_904>.
The molecule contains the following groups: Secondary Amine, Thiol.
Provide a comprehensive chemical profile for the building block <BB_904>.
**Token:** <BB_904> **SMILES:** Cc1ccc(Nc2nnc(S)s2)c(C)c1 **Molecular Formula:** C10H11N3S2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Secondary Amine, Thiol
Provide the SMILES representation for the building block token <BB_905>.
CCc1c(N)noc1-c1ccc(Cl)s1
What is the building block token for the following molecule?
CCc1c(N)noc1-c1ccc(Cl)s1
<BB_905>
What is the molecular formula for <BB_905>?
The molecular formula for <BB_905> (CCc1c(N)noc1-c1ccc(Cl)s1) is C9H9ClN2OS.
Describe the ring structures in building block <BB_905>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5.
List the primary functional groups present in <BB_905>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_905>.
**Token:** <BB_905> **SMILES:** CCc1c(N)noc1-c1ccc(Cl)s1 **Molecular Formula:** C9H9ClN2OS **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_906>.
CC1(C)OB(c2cc(C#N)ccc2O)OC1(C)C
What is the building block token for the following molecule?
CC1(C)OB(c2cc(C#N)ccc2O)OC1(C)C
<BB_906>
What is the molecular formula for <BB_906>?
The molecular formula for <BB_906> (CC1(C)OB(c2cc(C#N)ccc2O)OC1(C)C) is C13H16BNO3.
Describe the ring structures in building block <BB_906>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_906>.
The molecule contains the following groups: Nitrile.
Provide a comprehensive chemical profile for the building block <BB_906>.
**Token:** <BB_906> **SMILES:** CC1(C)OB(c2cc(C#N)ccc2O)OC1(C)C **Molecular Formula:** C13H16BNO3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Nitrile
Provide the SMILES representation for the building block token <BB_907>.
CCc1cccnc1C(C)=O
What is the building block token for the following molecule?
CCc1cccnc1C(C)=O
<BB_907>
What is the molecular formula for <BB_907>?
The molecular formula for <BB_907> (CCc1cccnc1C(C)=O) is C9H11NO.
Describe the ring structures in building block <BB_907>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_907>.
The molecule contains the following groups: Ketone.
Provide a comprehensive chemical profile for the building block <BB_907>.
**Token:** <BB_907> **SMILES:** CCc1cccnc1C(C)=O **Molecular Formula:** C9H11NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ketone
Provide the SMILES representation for the building block token <BB_908>.
Clc1ncnc2cc(Br)sc12
What is the building block token for the following molecule?
Clc1ncnc2cc(Br)sc12
<BB_908>
What is the molecular formula for <BB_908>?
The molecular formula for <BB_908> (Clc1ncnc2cc(Br)sc12) is C6H2BrClN2S.
Describe the ring structures in building block <BB_908>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_908>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_908>.
**Token:** <BB_908> **SMILES:** Clc1ncnc2cc(Br)sc12 **Molecular Formula:** C6H2BrClN2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_909>.
O=[N+]([O-])[O-].O=[N+]([O-])[O-].O=[N+]([O-])[O-].O=[N+]([O-])[O-].[Zr+4]
What is the building block token for the following molecule?
O=[N+]([O-])[O-].O=[N+]([O-])[O-].O=[N+]([O-])[O-].O=[N+]([O-])[O-].[Zr+4]
<BB_909>
What is the molecular formula for <BB_909>?
The molecular formula for <BB_909> (O=[N+]([O-])[O-].O=[N+]([O-])[O-].O=[N+]([O-])[O-].O=[N+]([O-])[O-].[Zr+4]) is N4O12Zr.
Describe the ring structures in building block <BB_909>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_909>.
The molecule contains the following groups: Tertiary Amine, Nitro.
Provide a comprehensive chemical profile for the building block <BB_909>.
**Token:** <BB_909> **SMILES:** O=[N+]([O-])[O-].O=[N+]([O-])[O-].O=[N+]([O-])[O-].O=[N+]([O-])[O-].[Zr+4] **Molecular Formula:** N4O12Zr **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Tertiary Amine, Nitro
Provide the SMILES representation for the building block token <BB_910>.
Cl.FC1(Br)CC12CCNCC2
What is the building block token for the following molecule?
Cl.FC1(Br)CC12CCNCC2
<BB_910>
What is the molecular formula for <BB_910>?
The molecular formula for <BB_910> (Cl.FC1(Br)CC12CCNCC2) is C7H12BrClFN.
Describe the ring structures in building block <BB_910>.
The molecule contains 2 ring(s): an aliphatic ring of size 3, an aliphatic ring of size 6.
List the primary functional groups present in <BB_910>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_910>.
**Token:** <BB_910> **SMILES:** Cl.FC1(Br)CC12CCNCC2 **Molecular Formula:** C7H12BrClFN **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 3, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_911>.
Cc1c(C(=O)O)c[nH]c1C=O
What is the building block token for the following molecule?
Cc1c(C(=O)O)c[nH]c1C=O
<BB_911>
What is the molecular formula for <BB_911>?
The molecular formula for <BB_911> (Cc1c(C(=O)O)c[nH]c1C=O) is C7H7NO3.
Describe the ring structures in building block <BB_911>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_911>.
The molecule contains the following groups: Carboxylic Acid, Aldehyde.
Provide a comprehensive chemical profile for the building block <BB_911>.
**Token:** <BB_911> **SMILES:** Cc1c(C(=O)O)c[nH]c1C=O **Molecular Formula:** C7H7NO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Aldehyde
Provide the SMILES representation for the building block token <BB_912>.
CS(=O)(=O)OCC1CCCC(C(F)(F)F)C1
What is the building block token for the following molecule?
CS(=O)(=O)OCC1CCCC(C(F)(F)F)C1
<BB_912>
What is the molecular formula for <BB_912>?
The molecular formula for <BB_912> (CS(=O)(=O)OCC1CCCC(C(F)(F)F)C1) is C9H15F3O3S.
Describe the ring structures in building block <BB_912>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_912>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_912>.
**Token:** <BB_912> **SMILES:** CS(=O)(=O)OCC1CCCC(C(F)(F)F)C1 **Molecular Formula:** C9H15F3O3S **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_913>.
C[C@H](N)CCCNC(=O)OC(C)(C)C
What is the building block token for the following molecule?
C[C@H](N)CCCNC(=O)OC(C)(C)C
<BB_913>
What is the molecular formula for <BB_913>?
The molecular formula for <BB_913> (C[C@H](N)CCCNC(=O)OC(C)(C)C) is C10H22N2O2.
Describe the ring structures in building block <BB_913>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_913>.
The molecule contains the following groups: Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_913>.
**Token:** <BB_913> **SMILES:** C[C@H](N)CCCNC(=O)OC(C)(C)C **Molecular Formula:** C10H22N2O2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_914>.
C=CC(=O)OCC(F)(F)F
What is the building block token for the following molecule?
C=CC(=O)OCC(F)(F)F
<BB_914>
What is the molecular formula for <BB_914>?
The molecular formula for <BB_914> (C=CC(=O)OCC(F)(F)F) is C5H5F3O2.
Describe the ring structures in building block <BB_914>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_914>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_914>.
**Token:** <BB_914> **SMILES:** C=CC(=O)OCC(F)(F)F **Molecular Formula:** C5H5F3O2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_915>.
C[C@@H](CN)SC(F)F.Cl
What is the building block token for the following molecule?
C[C@@H](CN)SC(F)F.Cl
<BB_915>
What is the molecular formula for <BB_915>?
The molecular formula for <BB_915> (C[C@@H](CN)SC(F)F.Cl) is C4H10ClF2NS.
Describe the ring structures in building block <BB_915>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_915>.
The molecule contains the following groups: Amine, Sulfide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_915>.
**Token:** <BB_915> **SMILES:** C[C@@H](CN)SC(F)F.Cl **Molecular Formula:** C4H10ClF2NS **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Sulfide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_916>.
CC(C)(C)Oc1ccc(S(=O)[O-])cn1.[Li+]
What is the building block token for the following molecule?
CC(C)(C)Oc1ccc(S(=O)[O-])cn1.[Li+]
<BB_916>
What is the molecular formula for <BB_916>?
The molecular formula for <BB_916> (CC(C)(C)Oc1ccc(S(=O)[O-])cn1.[Li+]) is C9H12LiNO3S.
Describe the ring structures in building block <BB_916>.
The molecule contains 1 ring(s): an aromatic ring of size 6.