instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_916>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_916>.
**Token:** <BB_916> **SMILES:** CC(C)(C)Oc1ccc(S(=O)[O-])cn1.[Li+] **Molecular Formula:** C9H12LiNO3S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_917>.
COC[C@H](N)C(=O)OC.Cl
What is the building block token for the following molecule?
COC[C@H](N)C(=O)OC.Cl
<BB_917>
What is the molecular formula for <BB_917>?
The molecular formula for <BB_917> (COC[C@H](N)C(=O)OC.Cl) is C5H12ClNO3.
Describe the ring structures in building block <BB_917>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_917>.
The molecule contains the following groups: Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_917>.
**Token:** <BB_917> **SMILES:** COC[C@H](N)C(=O)OC.Cl **Molecular Formula:** C5H12ClNO3 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_918>.
CNC(C)C(=O)NC(C)(C)C
What is the building block token for the following molecule?
CNC(C)C(=O)NC(C)(C)C
<BB_918>
What is the molecular formula for <BB_918>?
The molecular formula for <BB_918> (CNC(C)C(=O)NC(C)(C)C) is C8H18N2O.
Describe the ring structures in building block <BB_918>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_918>.
The molecule contains the following groups: Secondary Amine, Amide.
Provide a comprehensive chemical profile for the building block <BB_918>.
**Token:** <BB_918> **SMILES:** CNC(C)C(=O)NC(C)(C)C **Molecular Formula:** C8H18N2O **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Secondary Amine, Amide
Provide the SMILES representation for the building block token <BB_919>.
CC(C)(C)OC(=O)NCCNCC1CC1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)NCCNCC1CC1
<BB_919>
What is the molecular formula for <BB_919>?
The molecular formula for <BB_919> (CC(C)(C)OC(=O)NCCNCC1CC1) is C11H22N2O2.
Describe the ring structures in building block <BB_919>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_919>.
The molecule contains the following groups: Secondary Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_919>.
**Token:** <BB_919> **SMILES:** CC(C)(C)OC(=O)NCCNCC1CC1 **Molecular Formula:** C11H22N2O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Secondary Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_920>.
OCc1ncnn1CC(F)F
What is the building block token for the following molecule?
OCc1ncnn1CC(F)F
<BB_920>
What is the molecular formula for <BB_920>?
The molecular formula for <BB_920> (OCc1ncnn1CC(F)F) is C5H7F2N3O.
Describe the ring structures in building block <BB_920>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_920>.
The molecule contains the following groups: Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_920>.
**Token:** <BB_920> **SMILES:** OCc1ncnn1CC(F)F **Molecular Formula:** C5H7F2N3O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_921>.
CC(C)(C)OC(=O)N1CCCC1C(=O)n1ccnc1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CCCC1C(=O)n1ccnc1
<BB_921>
What is the molecular formula for <BB_921>?
The molecular formula for <BB_921> (CC(C)(C)OC(=O)N1CCCC1C(=O)n1ccnc1) is C13H19N3O3.
Describe the ring structures in building block <BB_921>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 5.
List the primary functional groups present in <BB_921>.
The molecule contains the following groups: Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_921>.
**Token:** <BB_921> **SMILES:** CC(C)(C)OC(=O)N1CCCC1C(=O)n1ccnc1 **Molecular Formula:** C13H19N3O3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 5. **Functional Groups:** Amide, Ether
Provide the SMILES representation for the building block token <BB_922>.
Cc1snc(N)c1C(=O)O.Cl
What is the building block token for the following molecule?
Cc1snc(N)c1C(=O)O.Cl
<BB_922>
What is the molecular formula for <BB_922>?
The molecular formula for <BB_922> (Cc1snc(N)c1C(=O)O.Cl) is C5H7ClN2O2S.
Describe the ring structures in building block <BB_922>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_922>.
The molecule contains the following groups: Carboxylic Acid, Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_922>.
**Token:** <BB_922> **SMILES:** Cc1snc(N)c1C(=O)O.Cl **Molecular Formula:** C5H7ClN2O2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_923>.
O=Cc1ccc(Br)c(Br)n1
What is the building block token for the following molecule?
O=Cc1ccc(Br)c(Br)n1
<BB_923>
What is the molecular formula for <BB_923>?
The molecular formula for <BB_923> (O=Cc1ccc(Br)c(Br)n1) is C6H3Br2NO.
Describe the ring structures in building block <BB_923>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_923>.
The molecule contains the following groups: Aldehyde, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_923>.
**Token:** <BB_923> **SMILES:** O=Cc1ccc(Br)c(Br)n1 **Molecular Formula:** C6H3Br2NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Aldehyde, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_924>.
N[C@@H](CC(=O)OCc1ccccc1)C(=O)O
What is the building block token for the following molecule?
N[C@@H](CC(=O)OCc1ccccc1)C(=O)O
<BB_924>
What is the molecular formula for <BB_924>?
The molecular formula for <BB_924> (N[C@@H](CC(=O)OCc1ccccc1)C(=O)O) is C11H13NO4.
Describe the ring structures in building block <BB_924>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_924>.
The molecule contains the following groups: Carboxylic Acid, Amine, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_924>.
**Token:** <BB_924> **SMILES:** N[C@@H](CC(=O)OCc1ccccc1)C(=O)O **Molecular Formula:** C11H13NO4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amine, Ester, Ether
Provide the SMILES representation for the building block token <BB_925>.
Cc1cc(C(F)(F)F)ccc1CN
What is the building block token for the following molecule?
Cc1cc(C(F)(F)F)ccc1CN
<BB_925>
What is the molecular formula for <BB_925>?
The molecular formula for <BB_925> (Cc1cc(C(F)(F)F)ccc1CN) is C9H10F3N.
Describe the ring structures in building block <BB_925>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_925>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_925>.
**Token:** <BB_925> **SMILES:** Cc1cc(C(F)(F)F)ccc1CN **Molecular Formula:** C9H10F3N **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_926>.
O=C1CC2CC(C1)C2
What is the building block token for the following molecule?
O=C1CC2CC(C1)C2
<BB_926>
What is the molecular formula for <BB_926>?
The molecular formula for <BB_926> (O=C1CC2CC(C1)C2) is C7H10O.
Describe the ring structures in building block <BB_926>.
The molecule contains 3 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_926>.
The molecule contains the following groups: Ketone.
Provide a comprehensive chemical profile for the building block <BB_926>.
**Token:** <BB_926> **SMILES:** O=C1CC2CC(C1)C2 **Molecular Formula:** C7H10O **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Ketone
Provide the SMILES representation for the building block token <BB_927>.
Cn1cnnc1-c1ccc(Br)cc1
What is the building block token for the following molecule?
Cn1cnnc1-c1ccc(Br)cc1
<BB_927>
What is the molecular formula for <BB_927>?
The molecular formula for <BB_927> (Cn1cnnc1-c1ccc(Br)cc1) is C9H8BrN3.
Describe the ring structures in building block <BB_927>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_927>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_927>.
**Token:** <BB_927> **SMILES:** Cn1cnnc1-c1ccc(Br)cc1 **Molecular Formula:** C9H8BrN3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_928>.
Cl.NCCc1c[nH]c2cc([N+](=O)[O-])ccc12
What is the building block token for the following molecule?
Cl.NCCc1c[nH]c2cc([N+](=O)[O-])ccc12
<BB_928>
What is the molecular formula for <BB_928>?
The molecular formula for <BB_928> (Cl.NCCc1c[nH]c2cc([N+](=O)[O-])ccc12) is C10H12ClN3O2.
Describe the ring structures in building block <BB_928>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_928>.
The molecule contains the following groups: Amine, Tertiary Amine, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_928>.
**Token:** <BB_928> **SMILES:** Cl.NCCc1c[nH]c2cc([N+](=O)[O-])ccc12 **Molecular Formula:** C10H12ClN3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_929>.
Cc1nc(C)c2c(C)c(C(=O)O)sc2n1
What is the building block token for the following molecule?
Cc1nc(C)c2c(C)c(C(=O)O)sc2n1
<BB_929>
What is the molecular formula for <BB_929>?
The molecular formula for <BB_929> (Cc1nc(C)c2c(C)c(C(=O)O)sc2n1) is C10H10N2O2S.
Describe the ring structures in building block <BB_929>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_929>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_929>.
**Token:** <BB_929> **SMILES:** Cc1nc(C)c2c(C)c(C(=O)O)sc2n1 **Molecular Formula:** C10H10N2O2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_930>.
Nc1cc(=O)[nH]c(=O)n1-c1ccc(Br)cc1
What is the building block token for the following molecule?
Nc1cc(=O)[nH]c(=O)n1-c1ccc(Br)cc1
<BB_930>
What is the molecular formula for <BB_930>?
The molecular formula for <BB_930> (Nc1cc(=O)[nH]c(=O)n1-c1ccc(Br)cc1) is C10H8BrN3O2.
Describe the ring structures in building block <BB_930>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_930>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_930>.
**Token:** <BB_930> **SMILES:** Nc1cc(=O)[nH]c(=O)n1-c1ccc(Br)cc1 **Molecular Formula:** C10H8BrN3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_931>.
Cc1ncc2c(n1)CNCC2
What is the building block token for the following molecule?
Cc1ncc2c(n1)CNCC2
<BB_931>
What is the molecular formula for <BB_931>?
The molecular formula for <BB_931> (Cc1ncc2c(n1)CNCC2) is C8H11N3.
Describe the ring structures in building block <BB_931>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_931>.
The molecule contains the following groups: Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_931>.
**Token:** <BB_931> **SMILES:** Cc1ncc2c(n1)CNCC2 **Molecular Formula:** C8H11N3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine
Provide the SMILES representation for the building block token <BB_932>.
Cc1cccc(NC(=O)C(C)Cl)c1
What is the building block token for the following molecule?
Cc1cccc(NC(=O)C(C)Cl)c1
<BB_932>
What is the molecular formula for <BB_932>?
The molecular formula for <BB_932> (Cc1cccc(NC(=O)C(C)Cl)c1) is C10H12ClNO.
Describe the ring structures in building block <BB_932>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_932>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_932>.
**Token:** <BB_932> **SMILES:** Cc1cccc(NC(=O)C(C)Cl)c1 **Molecular Formula:** C10H12ClNO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_933>.
Cc1cnc(NC(=O)c2ccc(Br)o2)s1
What is the building block token for the following molecule?
Cc1cnc(NC(=O)c2ccc(Br)o2)s1
<BB_933>