instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_933>?
The molecular formula for <BB_933> (Cc1cnc(NC(=O)c2ccc(Br)o2)s1) is C9H7BrN2O2S.
Describe the ring structures in building block <BB_933>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5.
List the primary functional groups present in <BB_933>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_933>.
**Token:** <BB_933> **SMILES:** Cc1cnc(NC(=O)c2ccc(Br)o2)s1 **Molecular Formula:** C9H7BrN2O2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_934>.
O=C(O)c1ccc(-c2ccc(OC(F)(F)F)cc2)s1
What is the building block token for the following molecule?
O=C(O)c1ccc(-c2ccc(OC(F)(F)F)cc2)s1
<BB_934>
What is the molecular formula for <BB_934>?
The molecular formula for <BB_934> (O=C(O)c1ccc(-c2ccc(OC(F)(F)F)cc2)s1) is C12H7F3O3S.
Describe the ring structures in building block <BB_934>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_934>.
The molecule contains the following groups: Carboxylic Acid, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_934>.
**Token:** <BB_934> **SMILES:** O=C(O)c1ccc(-c2ccc(OC(F)(F)F)cc2)s1 **Molecular Formula:** C12H7F3O3S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_935>.
Nc1cc2nc(Cl)ccc2cc1Br
What is the building block token for the following molecule?
Nc1cc2nc(Cl)ccc2cc1Br
<BB_935>
What is the molecular formula for <BB_935>?
The molecular formula for <BB_935> (Nc1cc2nc(Cl)ccc2cc1Br) is C9H6BrClN2.
Describe the ring structures in building block <BB_935>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_935>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_935>.
**Token:** <BB_935> **SMILES:** Nc1cc2nc(Cl)ccc2cc1Br **Molecular Formula:** C9H6BrClN2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_936>.
C[Si](C)(C)C(F)(F)F
What is the building block token for the following molecule?
C[Si](C)(C)C(F)(F)F
<BB_936>
What is the molecular formula for <BB_936>?
The molecular formula for <BB_936> (C[Si](C)(C)C(F)(F)F) is C4H9F3Si.
Describe the ring structures in building block <BB_936>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_936>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_936>.
**Token:** <BB_936> **SMILES:** C[Si](C)(C)C(F)(F)F **Molecular Formula:** C4H9F3Si **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_937>.
CC(C)(C)OC(=O)N1C[C@]2(CCCOC2)C[C@H]1CO
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1C[C@]2(CCCOC2)C[C@H]1CO
<BB_937>
What is the molecular formula for <BB_937>?
The molecular formula for <BB_937> (CC(C)(C)OC(=O)N1C[C@]2(CCCOC2)C[C@H]1CO) is C14H25NO4.
Describe the ring structures in building block <BB_937>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_937>.
The molecule contains the following groups: Amide, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_937>.
**Token:** <BB_937> **SMILES:** CC(C)(C)OC(=O)N1C[C@]2(CCCOC2)C[C@H]1CO **Molecular Formula:** C14H25NO4 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Amide, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_938>.
Nc1ccc(S(=O)(=O)F)cc1
What is the building block token for the following molecule?
Nc1ccc(S(=O)(=O)F)cc1
<BB_938>
What is the molecular formula for <BB_938>?
The molecular formula for <BB_938> (Nc1ccc(S(=O)(=O)F)cc1) is C6H6FNO2S.
Describe the ring structures in building block <BB_938>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_938>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_938>.
**Token:** <BB_938> **SMILES:** Nc1ccc(S(=O)(=O)F)cc1 **Molecular Formula:** C6H6FNO2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_939>.
Cc1c(C(=O)O)sc2nc[nH]c(=O)c12
What is the building block token for the following molecule?
Cc1c(C(=O)O)sc2nc[nH]c(=O)c12
<BB_939>
What is the molecular formula for <BB_939>?
The molecular formula for <BB_939> (Cc1c(C(=O)O)sc2nc[nH]c(=O)c12) is C8H6N2O3S.
Describe the ring structures in building block <BB_939>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_939>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_939>.
**Token:** <BB_939> **SMILES:** Cc1c(C(=O)O)sc2nc[nH]c(=O)c12 **Molecular Formula:** C8H6N2O3S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_940>.
CNCCI.I
What is the building block token for the following molecule?
CNCCI.I
<BB_940>
What is the molecular formula for <BB_940>?
The molecular formula for <BB_940> (CNCCI.I) is C3H9I2N.
Describe the ring structures in building block <BB_940>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_940>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_940>.
**Token:** <BB_940> **SMILES:** CNCCI.I **Molecular Formula:** C3H9I2N **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_941>.
CCC(=O)NC=C(Cl)Cl
What is the building block token for the following molecule?
CCC(=O)NC=C(Cl)Cl
<BB_941>
What is the molecular formula for <BB_941>?
The molecular formula for <BB_941> (CCC(=O)NC=C(Cl)Cl) is C5H7Cl2NO.
Describe the ring structures in building block <BB_941>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_941>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_941>.
**Token:** <BB_941> **SMILES:** CCC(=O)NC=C(Cl)Cl **Molecular Formula:** C5H7Cl2NO **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_942>.
Oc1cc(Cl)ccc1F
What is the building block token for the following molecule?
Oc1cc(Cl)ccc1F
<BB_942>
What is the molecular formula for <BB_942>?
The molecular formula for <BB_942> (Oc1cc(Cl)ccc1F) is C6H4ClFO.
Describe the ring structures in building block <BB_942>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_942>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_942>.
**Token:** <BB_942> **SMILES:** Oc1cc(Cl)ccc1F **Molecular Formula:** C6H4ClFO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_943>.
CC(CO)C1CCCOC1
What is the building block token for the following molecule?
CC(CO)C1CCCOC1
<BB_943>
What is the molecular formula for <BB_943>?
The molecular formula for <BB_943> (CC(CO)C1CCCOC1) is C8H16O2.
Describe the ring structures in building block <BB_943>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_943>.
The molecule contains the following groups: Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_943>.
**Token:** <BB_943> **SMILES:** CC(CO)C1CCCOC1 **Molecular Formula:** C8H16O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Alcohol, Ether
Provide the SMILES representation for the building block token <BB_944>.
Cc1ccc(C[C@@H](N)CO)cc1.Cl
What is the building block token for the following molecule?
Cc1ccc(C[C@@H](N)CO)cc1.Cl
<BB_944>
What is the molecular formula for <BB_944>?
The molecular formula for <BB_944> (Cc1ccc(C[C@@H](N)CO)cc1.Cl) is C10H16ClNO.
Describe the ring structures in building block <BB_944>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_944>.
The molecule contains the following groups: Amine, Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_944>.
**Token:** <BB_944> **SMILES:** Cc1ccc(C[C@@H](N)CO)cc1.Cl **Molecular Formula:** C10H16ClNO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_945>.
Cl.Cl.NC[C@@H]1CCCCN1
What is the building block token for the following molecule?
Cl.Cl.NC[C@@H]1CCCCN1
<BB_945>
What is the molecular formula for <BB_945>?
The molecular formula for <BB_945> (Cl.Cl.NC[C@@H]1CCCCN1) is C6H16Cl2N2.
Describe the ring structures in building block <BB_945>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_945>.
The molecule contains the following groups: Amine, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_945>.
**Token:** <BB_945> **SMILES:** Cl.Cl.NC[C@@H]1CCCCN1 **Molecular Formula:** C6H16Cl2N2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amine, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_946>.
Nc1nc(F)ccc1-c1ccc(F)nc1N
What is the building block token for the following molecule?
Nc1nc(F)ccc1-c1ccc(F)nc1N
<BB_946>
What is the molecular formula for <BB_946>?
The molecular formula for <BB_946> (Nc1nc(F)ccc1-c1ccc(F)nc1N) is C10H8F2N4.
Describe the ring structures in building block <BB_946>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_946>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_946>.
**Token:** <BB_946> **SMILES:** Nc1nc(F)ccc1-c1ccc(F)nc1N **Molecular Formula:** C10H8F2N4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_947>.
CN(Cc1ccccc1)C(=O)C(F)(F)F
What is the building block token for the following molecule?
CN(Cc1ccccc1)C(=O)C(F)(F)F
<BB_947>
What is the molecular formula for <BB_947>?
The molecular formula for <BB_947> (CN(Cc1ccccc1)C(=O)C(F)(F)F) is C10H10F3NO.
Describe the ring structures in building block <BB_947>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_947>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_947>.
**Token:** <BB_947> **SMILES:** CN(Cc1ccccc1)C(=O)C(F)(F)F **Molecular Formula:** C10H10F3NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_948>.
C#Cc1ccc(C(=O)OC(C)(C)C)c(F)c1F
What is the building block token for the following molecule?
C#Cc1ccc(C(=O)OC(C)(C)C)c(F)c1F
<BB_948>
What is the molecular formula for <BB_948>?
The molecular formula for <BB_948> (C#Cc1ccc(C(=O)OC(C)(C)C)c(F)c1F) is C13H12F2O2.
Describe the ring structures in building block <BB_948>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_948>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_948>.
**Token:** <BB_948> **SMILES:** C#Cc1ccc(C(=O)OC(C)(C)C)c(F)c1F **Molecular Formula:** C13H12F2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_949>.
C1CNCC2(C1)CCO2.Cl
What is the building block token for the following molecule?
C1CNCC2(C1)CCO2.Cl
<BB_949>
What is the molecular formula for <BB_949>?
The molecular formula for <BB_949> (C1CNCC2(C1)CCO2.Cl) is C7H14ClNO.
Describe the ring structures in building block <BB_949>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 4.
List the primary functional groups present in <BB_949>.
The molecule contains the following groups: Secondary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_949>.
**Token:** <BB_949> **SMILES:** C1CNCC2(C1)CCO2.Cl **Molecular Formula:** C7H14ClNO **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 4. **Functional Groups:** Secondary Amine, Ether, Halogen (F,Cl,Br,I)