instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_9083>?
The molecular formula for <BB_9083> (COC(OC)C(O)Cc1ccc(Cl)cc1) is C11H15ClO3.
Describe the ring structures in building block <BB_9083>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9083>.
The molecule contains the following groups: Alcohol, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9083>.
**Token:** <BB_9083> **SMILES:** COC(OC)C(O)Cc1ccc(Cl)cc1 **Molecular Formula:** C11H15ClO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Alcohol, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9084>.
COC(=O)Cc1nc2ccccc2[nH]1.Cl
What is the building block token for the following molecule?
COC(=O)Cc1nc2ccccc2[nH]1.Cl
<BB_9084>
What is the molecular formula for <BB_9084>?
The molecular formula for <BB_9084> (COC(=O)Cc1nc2ccccc2[nH]1.Cl) is C10H11ClN2O2.
Describe the ring structures in building block <BB_9084>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9084>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9084>.
**Token:** <BB_9084> **SMILES:** COC(=O)Cc1nc2ccccc2[nH]1.Cl **Molecular Formula:** C10H11ClN2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9085>.
O=C(O)C(=O)c1ccc(F)nc1
What is the building block token for the following molecule?
O=C(O)C(=O)c1ccc(F)nc1
<BB_9085>
What is the molecular formula for <BB_9085>?
The molecular formula for <BB_9085> (O=C(O)C(=O)c1ccc(F)nc1) is C7H4FNO3.
Describe the ring structures in building block <BB_9085>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9085>.
The molecule contains the following groups: Carboxylic Acid, Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9085>.
**Token:** <BB_9085> **SMILES:** O=C(O)C(=O)c1ccc(F)nc1 **Molecular Formula:** C7H4FNO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9086>.
CC(C)(C)OC(=O)NCc1ncc(CN)s1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)NCc1ncc(CN)s1
<BB_9086>
What is the molecular formula for <BB_9086>?
The molecular formula for <BB_9086> (CC(C)(C)OC(=O)NCc1ncc(CN)s1) is C10H17N3O2S.
Describe the ring structures in building block <BB_9086>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9086>.
The molecule contains the following groups: Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_9086>.
**Token:** <BB_9086> **SMILES:** CC(C)(C)OC(=O)NCc1ncc(CN)s1 **Molecular Formula:** C10H17N3O2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_9087>.
Nc1cc(=O)[nH]c(=O)n1Cc1ccccc1
What is the building block token for the following molecule?
Nc1cc(=O)[nH]c(=O)n1Cc1ccccc1
<BB_9087>
What is the molecular formula for <BB_9087>?
The molecular formula for <BB_9087> (Nc1cc(=O)[nH]c(=O)n1Cc1ccccc1) is C11H11N3O2.
Describe the ring structures in building block <BB_9087>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9087>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_9087>.
**Token:** <BB_9087> **SMILES:** Nc1cc(=O)[nH]c(=O)n1Cc1ccccc1 **Molecular Formula:** C11H11N3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_9088>.
O=C(O)c1cnn2c(-c3ccco3)ccnc12
What is the building block token for the following molecule?
O=C(O)c1cnn2c(-c3ccco3)ccnc12
<BB_9088>
What is the molecular formula for <BB_9088>?
The molecular formula for <BB_9088> (O=C(O)c1cnn2c(-c3ccco3)ccnc12) is C11H7N3O3.
Describe the ring structures in building block <BB_9088>.
The molecule contains 3 ring(s): an aromatic ring of size 5, an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9088>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_9088>.
**Token:** <BB_9088> **SMILES:** O=C(O)c1cnn2c(-c3ccco3)ccnc12 **Molecular Formula:** C11H7N3O3 **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 5, an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_9089>.
CC(C)(C)OC(=O)N1CC(OC2CCNCC2)C1.Cl
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CC(OC2CCNCC2)C1.Cl
<BB_9089>
What is the molecular formula for <BB_9089>?
The molecular formula for <BB_9089> (CC(C)(C)OC(=O)N1CC(OC2CCNCC2)C1.Cl) is C13H25ClN2O3.
Describe the ring structures in building block <BB_9089>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9089>.
The molecule contains the following groups: Secondary Amine, Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9089>.
**Token:** <BB_9089> **SMILES:** CC(C)(C)OC(=O)N1CC(OC2CCNCC2)C1.Cl **Molecular Formula:** C13H25ClN2O3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9090>.
CC(C)c1cccc(Nc2ccncc2N)c1
What is the building block token for the following molecule?
CC(C)c1cccc(Nc2ccncc2N)c1
<BB_9090>
What is the molecular formula for <BB_9090>?
The molecular formula for <BB_9090> (CC(C)c1cccc(Nc2ccncc2N)c1) is C14H17N3.
Describe the ring structures in building block <BB_9090>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9090>.
The molecule contains the following groups: Amine, Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_9090>.
**Token:** <BB_9090> **SMILES:** CC(C)c1cccc(Nc2ccncc2N)c1 **Molecular Formula:** C14H17N3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Secondary Amine
Provide the SMILES representation for the building block token <BB_9091>.
CC1CCNC(c2cccn2C)CC1
What is the building block token for the following molecule?
CC1CCNC(c2cccn2C)CC1
<BB_9091>
What is the molecular formula for <BB_9091>?
The molecular formula for <BB_9091> (CC1CCNC(c2cccn2C)CC1) is C12H20N2.
Describe the ring structures in building block <BB_9091>.
The molecule contains 2 ring(s): an aliphatic ring of size 7, an aromatic ring of size 5.
List the primary functional groups present in <BB_9091>.
The molecule contains the following groups: Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_9091>.
**Token:** <BB_9091> **SMILES:** CC1CCNC(c2cccn2C)CC1 **Molecular Formula:** C12H20N2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 7, an aromatic ring of size 5. **Functional Groups:** Secondary Amine
Provide the SMILES representation for the building block token <BB_9092>.
CC(C)(C)OC(=O)NC(C#N)CO
What is the building block token for the following molecule?
CC(C)(C)OC(=O)NC(C#N)CO
<BB_9092>
What is the molecular formula for <BB_9092>?
The molecular formula for <BB_9092> (CC(C)(C)OC(=O)NC(C#N)CO) is C8H14N2O3.
Describe the ring structures in building block <BB_9092>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9092>.
The molecule contains the following groups: Amide, Alcohol, Ether, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_9092>.
**Token:** <BB_9092> **SMILES:** CC(C)(C)OC(=O)NC(C#N)CO **Molecular Formula:** C8H14N2O3 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amide, Alcohol, Ether, Nitrile
Provide the SMILES representation for the building block token <BB_9093>.
Cc1cccc(F)c1CCl
What is the building block token for the following molecule?
Cc1cccc(F)c1CCl
<BB_9093>
What is the molecular formula for <BB_9093>?
The molecular formula for <BB_9093> (Cc1cccc(F)c1CCl) is C8H8ClF.
Describe the ring structures in building block <BB_9093>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9093>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9093>.
**Token:** <BB_9093> **SMILES:** Cc1cccc(F)c1CCl **Molecular Formula:** C8H8ClF **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9094>.
CN(C)S(=O)(=O)Cc1ccc(CN)cc1
What is the building block token for the following molecule?
CN(C)S(=O)(=O)Cc1ccc(CN)cc1
<BB_9094>
What is the molecular formula for <BB_9094>?
The molecular formula for <BB_9094> (CN(C)S(=O)(=O)Cc1ccc(CN)cc1) is C10H16N2O2S.
Describe the ring structures in building block <BB_9094>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9094>.
The molecule contains the following groups: Amine, Tertiary Amine, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_9094>.
**Token:** <BB_9094> **SMILES:** CN(C)S(=O)(=O)Cc1ccc(CN)cc1 **Molecular Formula:** C10H16N2O2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Sulfonamide
Provide the SMILES representation for the building block token <BB_9095>.
CCOC(OCC)c1cc(-c2ccncc2)[nH]n1
What is the building block token for the following molecule?
CCOC(OCC)c1cc(-c2ccncc2)[nH]n1
<BB_9095>
What is the molecular formula for <BB_9095>?
The molecular formula for <BB_9095> (CCOC(OCC)c1cc(-c2ccncc2)[nH]n1) is C13H17N3O2.
Describe the ring structures in building block <BB_9095>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9095>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_9095>.
**Token:** <BB_9095> **SMILES:** CCOC(OCC)c1cc(-c2ccncc2)[nH]n1 **Molecular Formula:** C13H17N3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_9096>.
O=c1[nH]cnc2ccc(Cl)nc12
What is the building block token for the following molecule?
O=c1[nH]cnc2ccc(Cl)nc12
<BB_9096>
What is the molecular formula for <BB_9096>?
The molecular formula for <BB_9096> (O=c1[nH]cnc2ccc(Cl)nc12) is C7H4ClN3O.
Describe the ring structures in building block <BB_9096>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9096>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9096>.
**Token:** <BB_9096> **SMILES:** O=c1[nH]cnc2ccc(Cl)nc12 **Molecular Formula:** C7H4ClN3O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9097>.
NC(c1cccc(Br)c1)C(F)(F)F
What is the building block token for the following molecule?
NC(c1cccc(Br)c1)C(F)(F)F
<BB_9097>
What is the molecular formula for <BB_9097>?
The molecular formula for <BB_9097> (NC(c1cccc(Br)c1)C(F)(F)F) is C8H7BrF3N.
Describe the ring structures in building block <BB_9097>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9097>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9097>.
**Token:** <BB_9097> **SMILES:** NC(c1cccc(Br)c1)C(F)(F)F **Molecular Formula:** C8H7BrF3N **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9098>.
CN(C)c1ncc(Br)cn1
What is the building block token for the following molecule?
CN(C)c1ncc(Br)cn1
<BB_9098>
What is the molecular formula for <BB_9098>?
The molecular formula for <BB_9098> (CN(C)c1ncc(Br)cn1) is C6H8BrN3.
Describe the ring structures in building block <BB_9098>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9098>.
The molecule contains the following groups: Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9098>.
**Token:** <BB_9098> **SMILES:** CN(C)c1ncc(Br)cn1 **Molecular Formula:** C6H8BrN3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9099>.
NC(=O)c1ccc(CC(=O)O)cn1
What is the building block token for the following molecule?
NC(=O)c1ccc(CC(=O)O)cn1
<BB_9099>
What is the molecular formula for <BB_9099>?
The molecular formula for <BB_9099> (NC(=O)c1ccc(CC(=O)O)cn1) is C8H8N2O3.
Describe the ring structures in building block <BB_9099>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9099>.
The molecule contains the following groups: Carboxylic Acid, Amide.
Provide a comprehensive chemical profile for the building block <BB_9099>.
**Token:** <BB_9099> **SMILES:** NC(=O)c1ccc(CC(=O)O)cn1 **Molecular Formula:** C8H8N2O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amide