instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_9100>.
CC(C)(C(=O)NN)n1cc([N+](=O)[O-])cn1
What is the building block token for the following molecule?
CC(C)(C(=O)NN)n1cc([N+](=O)[O-])cn1
<BB_9100>
What is the molecular formula for <BB_9100>?
The molecular formula for <BB_9100> (CC(C)(C(=O)NN)n1cc([N+](=O)[O-])cn1) is C7H11N5O3.
Describe the ring structures in building block <BB_9100>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9100>.
The molecule contains the following groups: Amine, Tertiary Amine, Amide, Nitro.
Provide a comprehensive chemical profile for the building block <BB_9100>.
**Token:** <BB_9100> **SMILES:** CC(C)(C(=O)NN)n1cc([N+](=O)[O-])cn1 **Molecular Formula:** C7H11N5O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Tertiary Amine, Amide, Nitro
Provide the SMILES representation for the building block token <BB_9101>.
CC(CB1OC(C)(C)C(C)(C)O1)C(=O)OC(C)(C)C
What is the building block token for the following molecule?
CC(CB1OC(C)(C)C(C)(C)O1)C(=O)OC(C)(C)C
<BB_9101>
What is the molecular formula for <BB_9101>?
The molecular formula for <BB_9101> (CC(CB1OC(C)(C)C(C)(C)O1)C(=O)OC(C)(C)C) is C14H27BO4.
Describe the ring structures in building block <BB_9101>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_9101>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_9101>.
**Token:** <BB_9101> **SMILES:** CC(CB1OC(C)(C)C(C)(C)O1)C(=O)OC(C)(C)C **Molecular Formula:** C14H27BO4 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_9102>.
CCCCC(F)(F)CN.Cl
What is the building block token for the following molecule?
CCCCC(F)(F)CN.Cl
<BB_9102>
What is the molecular formula for <BB_9102>?
The molecular formula for <BB_9102> (CCCCC(F)(F)CN.Cl) is C6H14ClF2N.
Describe the ring structures in building block <BB_9102>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9102>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9102>.
**Token:** <BB_9102> **SMILES:** CCCCC(F)(F)CN.Cl **Molecular Formula:** C6H14ClF2N **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9103>.
O=Cc1cc(F)c(C(=O)O)cc1F
What is the building block token for the following molecule?
O=Cc1cc(F)c(C(=O)O)cc1F
<BB_9103>
What is the molecular formula for <BB_9103>?
The molecular formula for <BB_9103> (O=Cc1cc(F)c(C(=O)O)cc1F) is C8H4F2O3.
Describe the ring structures in building block <BB_9103>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9103>.
The molecule contains the following groups: Carboxylic Acid, Aldehyde, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9103>.
**Token:** <BB_9103> **SMILES:** O=Cc1cc(F)c(C(=O)O)cc1F **Molecular Formula:** C8H4F2O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Aldehyde, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9104>.
COc1ccc(F)c(CCl)c1
What is the building block token for the following molecule?
COc1ccc(F)c(CCl)c1
<BB_9104>
What is the molecular formula for <BB_9104>?
The molecular formula for <BB_9104> (COc1ccc(F)c(CCl)c1) is C8H8ClFO.
Describe the ring structures in building block <BB_9104>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9104>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9104>.
**Token:** <BB_9104> **SMILES:** COc1ccc(F)c(CCl)c1 **Molecular Formula:** C8H8ClFO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9105>.
CC(=O)NC1(c2nc(C)cs2)CCNC1.Cl.Cl
What is the building block token for the following molecule?
CC(=O)NC1(c2nc(C)cs2)CCNC1.Cl.Cl
<BB_9105>
What is the molecular formula for <BB_9105>?
The molecular formula for <BB_9105> (CC(=O)NC1(c2nc(C)cs2)CCNC1.Cl.Cl) is C10H17Cl2N3OS.
Describe the ring structures in building block <BB_9105>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9105>.
The molecule contains the following groups: Secondary Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9105>.
**Token:** <BB_9105> **SMILES:** CC(=O)NC1(c2nc(C)cs2)CCNC1.Cl.Cl **Molecular Formula:** C10H17Cl2N3OS **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9106>.
COC1(OC)CCS(=N)(=O)CC1
What is the building block token for the following molecule?
COC1(OC)CCS(=N)(=O)CC1
<BB_9106>
What is the molecular formula for <BB_9106>?
The molecular formula for <BB_9106> (COC1(OC)CCS(=N)(=O)CC1) is C7H15NO3S.
Describe the ring structures in building block <BB_9106>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_9106>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_9106>.
**Token:** <BB_9106> **SMILES:** COC1(OC)CCS(=N)(=O)CC1 **Molecular Formula:** C7H15NO3S **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_9107>.
COC(=O)[C@@H]1CN(C(=O)OC(C)(C)C)C[C@H]1C(=O)O
What is the building block token for the following molecule?
COC(=O)[C@@H]1CN(C(=O)OC(C)(C)C)C[C@H]1C(=O)O
<BB_9107>
What is the molecular formula for <BB_9107>?
The molecular formula for <BB_9107> (COC(=O)[C@@H]1CN(C(=O)OC(C)(C)C)C[C@H]1C(=O)O) is C12H19NO6.
Describe the ring structures in building block <BB_9107>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_9107>.
The molecule contains the following groups: Carboxylic Acid, Amide, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_9107>.
**Token:** <BB_9107> **SMILES:** COC(=O)[C@@H]1CN(C(=O)OC(C)(C)C)C[C@H]1C(=O)O **Molecular Formula:** C12H19NO6 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid, Amide, Ester, Ether
Provide the SMILES representation for the building block token <BB_9108>.
Cl.NS(=O)(=O)CC1CNC1
What is the building block token for the following molecule?
Cl.NS(=O)(=O)CC1CNC1
<BB_9108>
What is the molecular formula for <BB_9108>?
The molecular formula for <BB_9108> (Cl.NS(=O)(=O)CC1CNC1) is C4H11ClN2O2S.
Describe the ring structures in building block <BB_9108>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_9108>.
The molecule contains the following groups: Amine, Secondary Amine, Halogen (F,Cl,Br,I), Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_9108>.
**Token:** <BB_9108> **SMILES:** Cl.NS(=O)(=O)CC1CNC1 **Molecular Formula:** C4H11ClN2O2S **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Amine, Secondary Amine, Halogen (F,Cl,Br,I), Sulfonamide
Provide the SMILES representation for the building block token <BB_9109>.
Clc1ncnc2c1c(Br)cn2C1CC1
What is the building block token for the following molecule?
Clc1ncnc2c1c(Br)cn2C1CC1
<BB_9109>
What is the molecular formula for <BB_9109>?
The molecular formula for <BB_9109> (Clc1ncnc2c1c(Br)cn2C1CC1) is C9H7BrClN3.
Describe the ring structures in building block <BB_9109>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aliphatic ring of size 3.
List the primary functional groups present in <BB_9109>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9109>.
**Token:** <BB_9109> **SMILES:** Clc1ncnc2c1c(Br)cn2C1CC1 **Molecular Formula:** C9H7BrClN3 **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aliphatic ring of size 3. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9110>.
C#CCCOC(=O)Cl
What is the building block token for the following molecule?
C#CCCOC(=O)Cl
<BB_9110>
What is the molecular formula for <BB_9110>?
The molecular formula for <BB_9110> (C#CCCOC(=O)Cl) is C5H5ClO2.
Describe the ring structures in building block <BB_9110>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9110>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9110>.
**Token:** <BB_9110> **SMILES:** C#CCCOC(=O)Cl **Molecular Formula:** C5H5ClO2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9111>.
O=C(O)c1cn(-c2ccccc2)nc1-c1cccs1
What is the building block token for the following molecule?
O=C(O)c1cn(-c2ccccc2)nc1-c1cccs1
<BB_9111>
What is the molecular formula for <BB_9111>?
The molecular formula for <BB_9111> (O=C(O)c1cn(-c2ccccc2)nc1-c1cccs1) is C14H10N2O2S.
Describe the ring structures in building block <BB_9111>.
The molecule contains 3 ring(s): an aromatic ring of size 5, an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9111>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_9111>.
**Token:** <BB_9111> **SMILES:** O=C(O)c1cn(-c2ccccc2)nc1-c1cccs1 **Molecular Formula:** C14H10N2O2S **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 5, an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_9112>.
O=C1Nc2cccc(Br)c2OC12CC2
What is the building block token for the following molecule?
O=C1Nc2cccc(Br)c2OC12CC2
<BB_9112>
What is the molecular formula for <BB_9112>?
The molecular formula for <BB_9112> (O=C1Nc2cccc(Br)c2OC12CC2) is C10H8BrNO2.
Describe the ring structures in building block <BB_9112>.
The molecule contains 3 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_9112>.
The molecule contains the following groups: Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9112>.
**Token:** <BB_9112> **SMILES:** O=C1Nc2cccc(Br)c2OC12CC2 **Molecular Formula:** C10H8BrNO2 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9113>.
Cl.O=S(=O)(c1ccccc1)C1CCNC1
What is the building block token for the following molecule?
Cl.O=S(=O)(c1ccccc1)C1CCNC1
<BB_9113>
What is the molecular formula for <BB_9113>?
The molecular formula for <BB_9113> (Cl.O=S(=O)(c1ccccc1)C1CCNC1) is C10H14ClNO2S.
Describe the ring structures in building block <BB_9113>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9113>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9113>.
**Token:** <BB_9113> **SMILES:** Cl.O=S(=O)(c1ccccc1)C1CCNC1 **Molecular Formula:** C10H14ClNO2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9114>.
COC(=O)[C@@H]1CNC[C@H]1C.Cl
What is the building block token for the following molecule?
COC(=O)[C@@H]1CNC[C@H]1C.Cl
<BB_9114>
What is the molecular formula for <BB_9114>?
The molecular formula for <BB_9114> (COC(=O)[C@@H]1CNC[C@H]1C.Cl) is C7H14ClNO2.
Describe the ring structures in building block <BB_9114>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_9114>.
The molecule contains the following groups: Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9114>.
**Token:** <BB_9114> **SMILES:** COC(=O)[C@@H]1CNC[C@H]1C.Cl **Molecular Formula:** C7H14ClNO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9115>.
C#CCN1CCS(=O)(=O)CC1
What is the building block token for the following molecule?
C#CCN1CCS(=O)(=O)CC1
<BB_9115>
What is the molecular formula for <BB_9115>?
The molecular formula for <BB_9115> (C#CCN1CCS(=O)(=O)CC1) is C7H11NO2S.
Describe the ring structures in building block <BB_9115>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_9115>.
The molecule contains the following groups: Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_9115>.
**Token:** <BB_9115> **SMILES:** C#CCN1CCS(=O)(=O)CC1 **Molecular Formula:** C7H11NO2S **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Tertiary Amine
Provide the SMILES representation for the building block token <BB_9116>.
OCC#Cc1ncccn1
What is the building block token for the following molecule?
OCC#Cc1ncccn1
<BB_9116>
What is the molecular formula for <BB_9116>?
The molecular formula for <BB_9116> (OCC#Cc1ncccn1) is C7H6N2O.
Describe the ring structures in building block <BB_9116>.
The molecule contains 1 ring(s): an aromatic ring of size 6.