instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_9116>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_9116>.
**Token:** <BB_9116> **SMILES:** OCC#Cc1ncccn1 **Molecular Formula:** C7H6N2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_9117>.
CNCc1cc(C(=O)O)n(C)n1.Cl
What is the building block token for the following molecule?
CNCc1cc(C(=O)O)n(C)n1.Cl
<BB_9117>
What is the molecular formula for <BB_9117>?
The molecular formula for <BB_9117> (CNCc1cc(C(=O)O)n(C)n1.Cl) is C7H12ClN3O2.
Describe the ring structures in building block <BB_9117>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9117>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9117>.
**Token:** <BB_9117> **SMILES:** CNCc1cc(C(=O)O)n(C)n1.Cl **Molecular Formula:** C7H12ClN3O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9118>.
Cl.N#Cc1n[nH]c2cc(Br)cnc12
What is the building block token for the following molecule?
Cl.N#Cc1n[nH]c2cc(Br)cnc12
<BB_9118>
What is the molecular formula for <BB_9118>?
The molecular formula for <BB_9118> (Cl.N#Cc1n[nH]c2cc(Br)cnc12) is C7H4BrClN4.
Describe the ring structures in building block <BB_9118>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9118>.
The molecule contains the following groups: Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_9118>.
**Token:** <BB_9118> **SMILES:** Cl.N#Cc1n[nH]c2cc(Br)cnc12 **Molecular Formula:** C7H4BrClN4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_9119>.
CC(C)(C=O)COC1CCCC1
What is the building block token for the following molecule?
CC(C)(C=O)COC1CCCC1
<BB_9119>
What is the molecular formula for <BB_9119>?
The molecular formula for <BB_9119> (CC(C)(C=O)COC1CCCC1) is C10H18O2.
Describe the ring structures in building block <BB_9119>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_9119>.
The molecule contains the following groups: Aldehyde, Ether.
Provide a comprehensive chemical profile for the building block <BB_9119>.
**Token:** <BB_9119> **SMILES:** CC(C)(C=O)COC1CCCC1 **Molecular Formula:** C10H18O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Aldehyde, Ether
Provide the SMILES representation for the building block token <BB_9120>.
Cc1c(C(=O)O)sc2nc3n(c(=O)c12)CCC3
What is the building block token for the following molecule?
Cc1c(C(=O)O)sc2nc3n(c(=O)c12)CCC3
<BB_9120>
What is the molecular formula for <BB_9120>?
The molecular formula for <BB_9120> (Cc1c(C(=O)O)sc2nc3n(c(=O)c12)CCC3) is C11H10N2O3S.
Describe the ring structures in building block <BB_9120>.
The molecule contains 3 ring(s): an aromatic ring of size 5, an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9120>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_9120>.
**Token:** <BB_9120> **SMILES:** Cc1c(C(=O)O)sc2nc3n(c(=O)c12)CCC3 **Molecular Formula:** C11H10N2O3S **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 5, an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_9121>.
O=C(O)CCCCC(F)F
What is the building block token for the following molecule?
O=C(O)CCCCC(F)F
<BB_9121>
What is the molecular formula for <BB_9121>?
The molecular formula for <BB_9121> (O=C(O)CCCCC(F)F) is C6H10F2O2.
Describe the ring structures in building block <BB_9121>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9121>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9121>.
**Token:** <BB_9121> **SMILES:** O=C(O)CCCCC(F)F **Molecular Formula:** C6H10F2O2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9122>.
O=C(CO)Nc1cccc([N+](=O)[O-])c1
What is the building block token for the following molecule?
O=C(CO)Nc1cccc([N+](=O)[O-])c1
<BB_9122>
What is the molecular formula for <BB_9122>?
The molecular formula for <BB_9122> (O=C(CO)Nc1cccc([N+](=O)[O-])c1) is C8H8N2O4.
Describe the ring structures in building block <BB_9122>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9122>.
The molecule contains the following groups: Tertiary Amine, Amide, Alcohol, Nitro.
Provide a comprehensive chemical profile for the building block <BB_9122>.
**Token:** <BB_9122> **SMILES:** O=C(CO)Nc1cccc([N+](=O)[O-])c1 **Molecular Formula:** C8H8N2O4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Amide, Alcohol, Nitro
Provide the SMILES representation for the building block token <BB_9123>.
Cc1nnccc1N.Cl
What is the building block token for the following molecule?
Cc1nnccc1N.Cl
<BB_9123>
What is the molecular formula for <BB_9123>?
The molecular formula for <BB_9123> (Cc1nnccc1N.Cl) is C5H8ClN3.
Describe the ring structures in building block <BB_9123>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9123>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9123>.
**Token:** <BB_9123> **SMILES:** Cc1nnccc1N.Cl **Molecular Formula:** C5H8ClN3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9124>.
NNC(=O)c1ccccc1N
What is the building block token for the following molecule?
NNC(=O)c1ccccc1N
<BB_9124>
What is the molecular formula for <BB_9124>?
The molecular formula for <BB_9124> (NNC(=O)c1ccccc1N) is C7H9N3O.
Describe the ring structures in building block <BB_9124>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9124>.
The molecule contains the following groups: Amine, Amide.
Provide a comprehensive chemical profile for the building block <BB_9124>.
**Token:** <BB_9124> **SMILES:** NNC(=O)c1ccccc1N **Molecular Formula:** C7H9N3O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Amide
Provide the SMILES representation for the building block token <BB_9125>.
CC(C)c1cc[nH]n1
What is the building block token for the following molecule?
CC(C)c1cc[nH]n1
<BB_9125>
What is the molecular formula for <BB_9125>?
The molecular formula for <BB_9125> (CC(C)c1cc[nH]n1) is C6H10N2.
Describe the ring structures in building block <BB_9125>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9125>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_9125>.
**Token:** <BB_9125> **SMILES:** CC(C)c1cc[nH]n1 **Molecular Formula:** C6H10N2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_9126>.
CC(C)CC(C)N(C)C(=O)CCl
What is the building block token for the following molecule?
CC(C)CC(C)N(C)C(=O)CCl
<BB_9126>
What is the molecular formula for <BB_9126>?
The molecular formula for <BB_9126> (CC(C)CC(C)N(C)C(=O)CCl) is C9H18ClNO.
Describe the ring structures in building block <BB_9126>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9126>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9126>.
**Token:** <BB_9126> **SMILES:** CC(C)CC(C)N(C)C(=O)CCl **Molecular Formula:** C9H18ClNO **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9127>.
Cl.O=C(O)C1CC2(CCCN2)C1
What is the building block token for the following molecule?
Cl.O=C(O)C1CC2(CCCN2)C1
<BB_9127>
What is the molecular formula for <BB_9127>?
The molecular formula for <BB_9127> (Cl.O=C(O)C1CC2(CCCN2)C1) is C8H14ClNO2.
Describe the ring structures in building block <BB_9127>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9127>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9127>.
**Token:** <BB_9127> **SMILES:** Cl.O=C(O)C1CC2(CCCN2)C1 **Molecular Formula:** C8H14ClNO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9128>.
FC1(F)CCC(CS)C1
What is the building block token for the following molecule?
FC1(F)CCC(CS)C1
<BB_9128>
What is the molecular formula for <BB_9128>?
The molecular formula for <BB_9128> (FC1(F)CCC(CS)C1) is C6H10F2S.
Describe the ring structures in building block <BB_9128>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_9128>.
The molecule contains the following groups: Thiol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9128>.
**Token:** <BB_9128> **SMILES:** FC1(F)CCC(CS)C1 **Molecular Formula:** C6H10F2S **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Thiol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9129>.
[C-]#[N+]CS(=O)(=O)c1ccc(C)cc1
What is the building block token for the following molecule?
[C-]#[N+]CS(=O)(=O)c1ccc(C)cc1
<BB_9129>
What is the molecular formula for <BB_9129>?
The molecular formula for <BB_9129> ([C-]#[N+]CS(=O)(=O)c1ccc(C)cc1) is C9H9NO2S.
Describe the ring structures in building block <BB_9129>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9129>.
The molecule contains the following groups: Nitrile.
Provide a comprehensive chemical profile for the building block <BB_9129>.
**Token:** <BB_9129> **SMILES:** [C-]#[N+]CS(=O)(=O)c1ccc(C)cc1 **Molecular Formula:** C9H9NO2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Nitrile
Provide the SMILES representation for the building block token <BB_9130>.
COC(=O)c1ccc(O)c(O)c1
What is the building block token for the following molecule?
COC(=O)c1ccc(O)c(O)c1
<BB_9130>
What is the molecular formula for <BB_9130>?
The molecular formula for <BB_9130> (COC(=O)c1ccc(O)c(O)c1) is C8H8O4.
Describe the ring structures in building block <BB_9130>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9130>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_9130>.
**Token:** <BB_9130> **SMILES:** COC(=O)c1ccc(O)c(O)c1 **Molecular Formula:** C8H8O4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_9131>.
O=C1CNc2cccc(Br)c2N1
What is the building block token for the following molecule?
O=C1CNc2cccc(Br)c2N1
<BB_9131>
What is the molecular formula for <BB_9131>?
The molecular formula for <BB_9131> (O=C1CNc2cccc(Br)c2N1) is C8H7BrN2O.
Describe the ring structures in building block <BB_9131>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9131>.
The molecule contains the following groups: Secondary Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9131>.
**Token:** <BB_9131> **SMILES:** O=C1CNc2cccc(Br)c2N1 **Molecular Formula:** C8H7BrN2O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9132>.
CN1CCC(CCCO)CC1
What is the building block token for the following molecule?
CN1CCC(CCCO)CC1
<BB_9132>
What is the molecular formula for <BB_9132>?
The molecular formula for <BB_9132> (CN1CCC(CCCO)CC1) is C9H19NO.
Describe the ring structures in building block <BB_9132>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_9132>.
The molecule contains the following groups: Tertiary Amine, Alcohol.
Provide a comprehensive chemical profile for the building block <BB_9132>.
**Token:** <BB_9132> **SMILES:** CN1CCC(CCCO)CC1 **Molecular Formula:** C9H19NO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Tertiary Amine, Alcohol
Provide the SMILES representation for the building block token <BB_9133>.
Cn1ncc(C#N)c1S(N)(=O)=O
What is the building block token for the following molecule?
Cn1ncc(C#N)c1S(N)(=O)=O
<BB_9133>