instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_9133>?
The molecular formula for <BB_9133> (Cn1ncc(C#N)c1S(N)(=O)=O) is C5H6N4O2S.
Describe the ring structures in building block <BB_9133>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9133>.
The molecule contains the following groups: Amine, Nitrile, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_9133>.
**Token:** <BB_9133> **SMILES:** Cn1ncc(C#N)c1S(N)(=O)=O **Molecular Formula:** C5H6N4O2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Nitrile, Sulfonamide
Provide the SMILES representation for the building block token <BB_9134>.
Nc1cccc(C(=O)Nc2ccc(Cl)cn2)c1
What is the building block token for the following molecule?
Nc1cccc(C(=O)Nc2ccc(Cl)cn2)c1
<BB_9134>
What is the molecular formula for <BB_9134>?
The molecular formula for <BB_9134> (Nc1cccc(C(=O)Nc2ccc(Cl)cn2)c1) is C12H10ClN3O.
Describe the ring structures in building block <BB_9134>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9134>.
The molecule contains the following groups: Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9134>.
**Token:** <BB_9134> **SMILES:** Nc1cccc(C(=O)Nc2ccc(Cl)cn2)c1 **Molecular Formula:** C12H10ClN3O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9135>.
COC(=O)C12CC(C(=O)O)(C1)C2F
What is the building block token for the following molecule?
COC(=O)C12CC(C(=O)O)(C1)C2F
<BB_9135>
What is the molecular formula for <BB_9135>?
The molecular formula for <BB_9135> (COC(=O)C12CC(C(=O)O)(C1)C2F) is C8H9FO4.
Describe the ring structures in building block <BB_9135>.
The molecule contains 3 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4, an aliphatic ring of size 4.
List the primary functional groups present in <BB_9135>.
The molecule contains the following groups: Carboxylic Acid, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9135>.
**Token:** <BB_9135> **SMILES:** COC(=O)C12CC(C(=O)O)(C1)C2F **Molecular Formula:** C8H9FO4 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4, an aliphatic ring of size 4. **Functional Groups:** Carboxylic Acid, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9136>.
Cc1ccccc1C(N)c1cccc(Cl)c1
What is the building block token for the following molecule?
Cc1ccccc1C(N)c1cccc(Cl)c1
<BB_9136>
What is the molecular formula for <BB_9136>?
The molecular formula for <BB_9136> (Cc1ccccc1C(N)c1cccc(Cl)c1) is C14H14ClN.
Describe the ring structures in building block <BB_9136>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9136>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9136>.
**Token:** <BB_9136> **SMILES:** Cc1ccccc1C(N)c1cccc(Cl)c1 **Molecular Formula:** C14H14ClN **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9137>.
Cl.Cl.N#Cc1ccnc(N2CCCNCC2)c1
What is the building block token for the following molecule?
Cl.Cl.N#Cc1ccnc(N2CCCNCC2)c1
<BB_9137>
What is the molecular formula for <BB_9137>?
The molecular formula for <BB_9137> (Cl.Cl.N#Cc1ccnc(N2CCCNCC2)c1) is C11H16Cl2N4.
Describe the ring structures in building block <BB_9137>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 7.
List the primary functional groups present in <BB_9137>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_9137>.
**Token:** <BB_9137> **SMILES:** Cl.Cl.N#Cc1ccnc(N2CCCNCC2)c1 **Molecular Formula:** C11H16Cl2N4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 7. **Functional Groups:** Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_9138>.
CC1(C)OB(c2cncs2)OC1(C)C
What is the building block token for the following molecule?
CC1(C)OB(c2cncs2)OC1(C)C
<BB_9138>
What is the molecular formula for <BB_9138>?
The molecular formula for <BB_9138> (CC1(C)OB(c2cncs2)OC1(C)C) is C9H14BNO2S.
Describe the ring structures in building block <BB_9138>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 5.
List the primary functional groups present in <BB_9138>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_9138>.
**Token:** <BB_9138> **SMILES:** CC1(C)OB(c2cncs2)OC1(C)C **Molecular Formula:** C9H14BNO2S **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 5. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_9139>.
COCCS(=O)CCN.Cl
What is the building block token for the following molecule?
COCCS(=O)CCN.Cl
<BB_9139>
What is the molecular formula for <BB_9139>?
The molecular formula for <BB_9139> (COCCS(=O)CCN.Cl) is C5H14ClNO2S.
Describe the ring structures in building block <BB_9139>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9139>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9139>.
**Token:** <BB_9139> **SMILES:** COCCS(=O)CCN.Cl **Molecular Formula:** C5H14ClNO2S **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9140>.
O=C1COc2ccccc2OC1
What is the building block token for the following molecule?
O=C1COc2ccccc2OC1
<BB_9140>
What is the molecular formula for <BB_9140>?
The molecular formula for <BB_9140> (O=C1COc2ccccc2OC1) is C9H8O3.
Describe the ring structures in building block <BB_9140>.
The molecule contains 2 ring(s): an aliphatic ring of size 7, an aromatic ring of size 6.
List the primary functional groups present in <BB_9140>.
The molecule contains the following groups: Ketone, Ether.
Provide a comprehensive chemical profile for the building block <BB_9140>.
**Token:** <BB_9140> **SMILES:** O=C1COc2ccccc2OC1 **Molecular Formula:** C9H8O3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 7, an aromatic ring of size 6. **Functional Groups:** Ketone, Ether
Provide the SMILES representation for the building block token <BB_9141>.
CC(C)(C)OC(=O)N1CCN(c2nnc(N)o2)CC1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CCN(c2nnc(N)o2)CC1
<BB_9141>
What is the molecular formula for <BB_9141>?
The molecular formula for <BB_9141> (CC(C)(C)OC(=O)N1CCN(c2nnc(N)o2)CC1) is C11H19N5O3.
Describe the ring structures in building block <BB_9141>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9141>.
The molecule contains the following groups: Amine, Tertiary Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_9141>.
**Token:** <BB_9141> **SMILES:** CC(C)(C)OC(=O)N1CCN(c2nnc(N)o2)CC1 **Molecular Formula:** C11H19N5O3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amine, Tertiary Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_9142>.
CC[C@@H](N)CF.Cl
What is the building block token for the following molecule?
CC[C@@H](N)CF.Cl
<BB_9142>
What is the molecular formula for <BB_9142>?
The molecular formula for <BB_9142> (CC[C@@H](N)CF.Cl) is C4H11ClFN.
Describe the ring structures in building block <BB_9142>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9142>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9142>.
**Token:** <BB_9142> **SMILES:** CC[C@@H](N)CF.Cl **Molecular Formula:** C4H11ClFN **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9143>.
O=C(NCc1ccc(F)cc1)Nc1ccccc1
What is the building block token for the following molecule?
O=C(NCc1ccc(F)cc1)Nc1ccccc1
<BB_9143>
What is the molecular formula for <BB_9143>?
The molecular formula for <BB_9143> (O=C(NCc1ccc(F)cc1)Nc1ccccc1) is C14H13FN2O.
Describe the ring structures in building block <BB_9143>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9143>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9143>.
**Token:** <BB_9143> **SMILES:** O=C(NCc1ccc(F)cc1)Nc1ccccc1 **Molecular Formula:** C14H13FN2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9144>.
C#CCCN(C)c1ccccc1
What is the building block token for the following molecule?
C#CCCN(C)c1ccccc1
<BB_9144>
What is the molecular formula for <BB_9144>?
The molecular formula for <BB_9144> (C#CCCN(C)c1ccccc1) is C11H13N.
Describe the ring structures in building block <BB_9144>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9144>.
The molecule contains the following groups: Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_9144>.
**Token:** <BB_9144> **SMILES:** C#CCCN(C)c1ccccc1 **Molecular Formula:** C11H13N **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Tertiary Amine
Provide the SMILES representation for the building block token <BB_9145>.
CCOc1n[nH]cc1[N+](=O)[O-]
What is the building block token for the following molecule?
CCOc1n[nH]cc1[N+](=O)[O-]
<BB_9145>
What is the molecular formula for <BB_9145>?
The molecular formula for <BB_9145> (CCOc1n[nH]cc1[N+](=O)[O-]) is C5H7N3O3.
Describe the ring structures in building block <BB_9145>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9145>.
The molecule contains the following groups: Tertiary Amine, Ether, Nitro.
Provide a comprehensive chemical profile for the building block <BB_9145>.
**Token:** <BB_9145> **SMILES:** CCOc1n[nH]cc1[N+](=O)[O-] **Molecular Formula:** C5H7N3O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Tertiary Amine, Ether, Nitro
Provide the SMILES representation for the building block token <BB_9146>.
O=C(O)c1ccn(-c2ccc(F)c(Cl)c2)n1
What is the building block token for the following molecule?
O=C(O)c1ccn(-c2ccc(F)c(Cl)c2)n1
<BB_9146>
What is the molecular formula for <BB_9146>?
The molecular formula for <BB_9146> (O=C(O)c1ccn(-c2ccc(F)c(Cl)c2)n1) is C10H6ClFN2O2.
Describe the ring structures in building block <BB_9146>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9146>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9146>.
**Token:** <BB_9146> **SMILES:** O=C(O)c1ccn(-c2ccc(F)c(Cl)c2)n1 **Molecular Formula:** C10H6ClFN2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9147>.
CC(C)C(NCC(F)(F)F)C(N)=O.Cl
What is the building block token for the following molecule?
CC(C)C(NCC(F)(F)F)C(N)=O.Cl
<BB_9147>
What is the molecular formula for <BB_9147>?
The molecular formula for <BB_9147> (CC(C)C(NCC(F)(F)F)C(N)=O.Cl) is C7H14ClF3N2O.
Describe the ring structures in building block <BB_9147>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9147>.
The molecule contains the following groups: Secondary Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9147>.
**Token:** <BB_9147> **SMILES:** CC(C)C(NCC(F)(F)F)C(N)=O.Cl **Molecular Formula:** C7H14ClF3N2O **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Secondary Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9148>.
CC(C)(C)OC(=O)c1ccccn1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)c1ccccn1
<BB_9148>
What is the molecular formula for <BB_9148>?
The molecular formula for <BB_9148> (CC(C)(C)OC(=O)c1ccccn1) is C10H13NO2.
Describe the ring structures in building block <BB_9148>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9148>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_9148>.
**Token:** <BB_9148> **SMILES:** CC(C)(C)OC(=O)c1ccccn1 **Molecular Formula:** C10H13NO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_9149>.
COC(=O)C(O)c1cccc2c1OC(F)(F)O2
What is the building block token for the following molecule?
COC(=O)C(O)c1cccc2c1OC(F)(F)O2
<BB_9149>
What is the molecular formula for <BB_9149>?
The molecular formula for <BB_9149> (COC(=O)C(O)c1cccc2c1OC(F)(F)O2) is C10H8F2O5.
Describe the ring structures in building block <BB_9149>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9149>.
The molecule contains the following groups: Ester, Alcohol, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9149>.
**Token:** <BB_9149> **SMILES:** COC(=O)C(O)c1cccc2c1OC(F)(F)O2 **Molecular Formula:** C10H8F2O5 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Ester, Alcohol, Ether, Halogen (F,Cl,Br,I)