instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_9150>.
COC(=O)C1CCC(=O)C(F)C1
What is the building block token for the following molecule?
COC(=O)C1CCC(=O)C(F)C1
<BB_9150>
What is the molecular formula for <BB_9150>?
The molecular formula for <BB_9150> (COC(=O)C1CCC(=O)C(F)C1) is C8H11FO3.
Describe the ring structures in building block <BB_9150>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_9150>.
The molecule contains the following groups: Ester, Ketone, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9150>.
**Token:** <BB_9150> **SMILES:** COC(=O)C1CCC(=O)C(F)C1 **Molecular Formula:** C8H11FO3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Ester, Ketone, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9151>.
Cn1cc(C=O)c(-c2ccccc2Br)n1
What is the building block token for the following molecule?
Cn1cc(C=O)c(-c2ccccc2Br)n1
<BB_9151>
What is the molecular formula for <BB_9151>?
The molecular formula for <BB_9151> (Cn1cc(C=O)c(-c2ccccc2Br)n1) is C11H9BrN2O.
Describe the ring structures in building block <BB_9151>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9151>.
The molecule contains the following groups: Aldehyde, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9151>.
**Token:** <BB_9151> **SMILES:** Cn1cc(C=O)c(-c2ccccc2Br)n1 **Molecular Formula:** C11H9BrN2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Aldehyde, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9152>.
COc1cc(CCN)cc(C)n1
What is the building block token for the following molecule?
COc1cc(CCN)cc(C)n1
<BB_9152>
What is the molecular formula for <BB_9152>?
The molecular formula for <BB_9152> (COc1cc(CCN)cc(C)n1) is C9H14N2O.
Describe the ring structures in building block <BB_9152>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9152>.
The molecule contains the following groups: Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_9152>.
**Token:** <BB_9152> **SMILES:** COc1cc(CCN)cc(C)n1 **Molecular Formula:** C9H14N2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ether
Provide the SMILES representation for the building block token <BB_9153>.
O=C(O)c1cc2cc(Cl)ccc2s1
What is the building block token for the following molecule?
O=C(O)c1cc2cc(Cl)ccc2s1
<BB_9153>
What is the molecular formula for <BB_9153>?
The molecular formula for <BB_9153> (O=C(O)c1cc2cc(Cl)ccc2s1) is C9H5ClO2S.
Describe the ring structures in building block <BB_9153>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9153>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9153>.
**Token:** <BB_9153> **SMILES:** O=C(O)c1cc2cc(Cl)ccc2s1 **Molecular Formula:** C9H5ClO2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9154>.
CCC(=O)c1ccccn1
What is the building block token for the following molecule?
CCC(=O)c1ccccn1
<BB_9154>
What is the molecular formula for <BB_9154>?
The molecular formula for <BB_9154> (CCC(=O)c1ccccn1) is C8H9NO.
Describe the ring structures in building block <BB_9154>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9154>.
The molecule contains the following groups: Ketone.
Provide a comprehensive chemical profile for the building block <BB_9154>.
**Token:** <BB_9154> **SMILES:** CCC(=O)c1ccccn1 **Molecular Formula:** C8H9NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ketone
Provide the SMILES representation for the building block token <BB_9155>.
Cl.Cl.NNc1ccc(NN)cc1
What is the building block token for the following molecule?
Cl.Cl.NNc1ccc(NN)cc1
<BB_9155>
What is the molecular formula for <BB_9155>?
The molecular formula for <BB_9155> (Cl.Cl.NNc1ccc(NN)cc1) is C6H12Cl2N4.
Describe the ring structures in building block <BB_9155>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9155>.
The molecule contains the following groups: Amine, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9155>.
**Token:** <BB_9155> **SMILES:** Cl.Cl.NNc1ccc(NN)cc1 **Molecular Formula:** C6H12Cl2N4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9156>.
Brc1ccn2c(Br)ncc2c1
What is the building block token for the following molecule?
Brc1ccn2c(Br)ncc2c1
<BB_9156>
What is the molecular formula for <BB_9156>?
The molecular formula for <BB_9156> (Brc1ccn2c(Br)ncc2c1) is C7H4Br2N2.
Describe the ring structures in building block <BB_9156>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9156>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9156>.
**Token:** <BB_9156> **SMILES:** Brc1ccn2c(Br)ncc2c1 **Molecular Formula:** C7H4Br2N2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9157>.
CC(C)Cc1nc(CCl)cs1.Cl
What is the building block token for the following molecule?
CC(C)Cc1nc(CCl)cs1.Cl
<BB_9157>
What is the molecular formula for <BB_9157>?
The molecular formula for <BB_9157> (CC(C)Cc1nc(CCl)cs1.Cl) is C8H13Cl2NS.
Describe the ring structures in building block <BB_9157>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9157>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9157>.
**Token:** <BB_9157> **SMILES:** CC(C)Cc1nc(CCl)cs1.Cl **Molecular Formula:** C8H13Cl2NS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9158>.
NCC(F)(F)C1(O)CCOCC1
What is the building block token for the following molecule?
NCC(F)(F)C1(O)CCOCC1
<BB_9158>
What is the molecular formula for <BB_9158>?
The molecular formula for <BB_9158> (NCC(F)(F)C1(O)CCOCC1) is C7H13F2NO2.
Describe the ring structures in building block <BB_9158>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_9158>.
The molecule contains the following groups: Amine, Alcohol, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9158>.
**Token:** <BB_9158> **SMILES:** NCC(F)(F)C1(O)CCOCC1 **Molecular Formula:** C7H13F2NO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amine, Alcohol, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9159>.
O=C(c1ccc(Cl)cc1)c1cncnc1
What is the building block token for the following molecule?
O=C(c1ccc(Cl)cc1)c1cncnc1
<BB_9159>
What is the molecular formula for <BB_9159>?
The molecular formula for <BB_9159> (O=C(c1ccc(Cl)cc1)c1cncnc1) is C11H7ClN2O.
Describe the ring structures in building block <BB_9159>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9159>.
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9159>.
**Token:** <BB_9159> **SMILES:** O=C(c1ccc(Cl)cc1)c1cncnc1 **Molecular Formula:** C11H7ClN2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9160>.
CNc1c(N)cnc2ccc(Br)cc12
What is the building block token for the following molecule?
CNc1c(N)cnc2ccc(Br)cc12
<BB_9160>
What is the molecular formula for <BB_9160>?
The molecular formula for <BB_9160> (CNc1c(N)cnc2ccc(Br)cc12) is C10H10BrN3.
Describe the ring structures in building block <BB_9160>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9160>.
The molecule contains the following groups: Amine, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9160>.
**Token:** <BB_9160> **SMILES:** CNc1c(N)cnc2ccc(Br)cc12 **Molecular Formula:** C10H10BrN3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9161>.
Cl.OCC12CCC(CC1)N2
What is the building block token for the following molecule?
Cl.OCC12CCC(CC1)N2
<BB_9161>
What is the molecular formula for <BB_9161>?
The molecular formula for <BB_9161> (Cl.OCC12CCC(CC1)N2) is C7H14ClNO.
Describe the ring structures in building block <BB_9161>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9161>.
The molecule contains the following groups: Secondary Amine, Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9161>.
**Token:** <BB_9161> **SMILES:** Cl.OCC12CCC(CC1)N2 **Molecular Formula:** C7H14ClNO **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9162>.
N#Cc1cc([N+](=O)[O-])cnc1O
What is the building block token for the following molecule?
N#Cc1cc([N+](=O)[O-])cnc1O
<BB_9162>
What is the molecular formula for <BB_9162>?
The molecular formula for <BB_9162> (N#Cc1cc([N+](=O)[O-])cnc1O) is C6H3N3O3.
Describe the ring structures in building block <BB_9162>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9162>.
The molecule contains the following groups: Tertiary Amine, Nitrile, Nitro.
Provide a comprehensive chemical profile for the building block <BB_9162>.
**Token:** <BB_9162> **SMILES:** N#Cc1cc([N+](=O)[O-])cnc1O **Molecular Formula:** C6H3N3O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Nitrile, Nitro
Provide the SMILES representation for the building block token <BB_9163>.
C#CCCCn1cc(N)cn1.Cl.Cl
What is the building block token for the following molecule?
C#CCCCn1cc(N)cn1.Cl.Cl
<BB_9163>
What is the molecular formula for <BB_9163>?
The molecular formula for <BB_9163> (C#CCCCn1cc(N)cn1.Cl.Cl) is C8H13Cl2N3.
Describe the ring structures in building block <BB_9163>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9163>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9163>.
**Token:** <BB_9163> **SMILES:** C#CCCCn1cc(N)cn1.Cl.Cl **Molecular Formula:** C8H13Cl2N3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9164>.
O=[N+]([O-])c1ccc(F)c2nsnc12
What is the building block token for the following molecule?
O=[N+]([O-])c1ccc(F)c2nsnc12
<BB_9164>
What is the molecular formula for <BB_9164>?
The molecular formula for <BB_9164> (O=[N+]([O-])c1ccc(F)c2nsnc12) is C6H2FN3O2S.
Describe the ring structures in building block <BB_9164>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9164>.
The molecule contains the following groups: Tertiary Amine, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_9164>.
**Token:** <BB_9164> **SMILES:** O=[N+]([O-])c1ccc(F)c2nsnc12 **Molecular Formula:** C6H2FN3O2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Tertiary Amine, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_9165>.
CN1CCc2c(sc(N)c2C#N)C1
What is the building block token for the following molecule?
CN1CCc2c(sc(N)c2C#N)C1
<BB_9165>
What is the molecular formula for <BB_9165>?
The molecular formula for <BB_9165> (CN1CCc2c(sc(N)c2C#N)C1) is C9H11N3S.
Describe the ring structures in building block <BB_9165>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9165>.
The molecule contains the following groups: Amine, Tertiary Amine, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_9165>.
**Token:** <BB_9165> **SMILES:** CN1CCc2c(sc(N)c2C#N)C1 **Molecular Formula:** C9H11N3S **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amine, Tertiary Amine, Nitrile
Provide the SMILES representation for the building block token <BB_9166>.
Cc1c(Br)cnn1C(F)F
What is the building block token for the following molecule?
Cc1c(Br)cnn1C(F)F
<BB_9166>
What is the molecular formula for <BB_9166>?
The molecular formula for <BB_9166> (Cc1c(Br)cnn1C(F)F) is C5H5BrF2N2.
Describe the ring structures in building block <BB_9166>.
The molecule contains 1 ring(s): an aromatic ring of size 5.