instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_9166>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9166>.
**Token:** <BB_9166> **SMILES:** Cc1c(Br)cnn1C(F)F **Molecular Formula:** C5H5BrF2N2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9167>.
CN(C)S(=O)(=O)N1CCNCC1
What is the building block token for the following molecule?
CN(C)S(=O)(=O)N1CCNCC1
<BB_9167>
What is the molecular formula for <BB_9167>?
The molecular formula for <BB_9167> (CN(C)S(=O)(=O)N1CCNCC1) is C6H15N3O2S.
Describe the ring structures in building block <BB_9167>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_9167>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_9167>.
**Token:** <BB_9167> **SMILES:** CN(C)S(=O)(=O)N1CCNCC1 **Molecular Formula:** C6H15N3O2S **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Tertiary Amine, Sulfonamide
Provide the SMILES representation for the building block token <BB_9168>.
COc1ccccc1CCNC(=O)CCl
What is the building block token for the following molecule?
COc1ccccc1CCNC(=O)CCl
<BB_9168>
What is the molecular formula for <BB_9168>?
The molecular formula for <BB_9168> (COc1ccccc1CCNC(=O)CCl) is C11H14ClNO2.
Describe the ring structures in building block <BB_9168>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9168>.
The molecule contains the following groups: Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9168>.
**Token:** <BB_9168> **SMILES:** COc1ccccc1CCNC(=O)CCl **Molecular Formula:** C11H14ClNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9169>.
O=C(O)c1cc2ccc(C(F)(F)F)cc2s1
What is the building block token for the following molecule?
O=C(O)c1cc2ccc(C(F)(F)F)cc2s1
<BB_9169>
What is the molecular formula for <BB_9169>?
The molecular formula for <BB_9169> (O=C(O)c1cc2ccc(C(F)(F)F)cc2s1) is C10H5F3O2S.
Describe the ring structures in building block <BB_9169>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9169>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9169>.
**Token:** <BB_9169> **SMILES:** O=C(O)c1cc2ccc(C(F)(F)F)cc2s1 **Molecular Formula:** C10H5F3O2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9170>.
Nc1cccc(C(=O)Nc2ccc(Br)cn2)c1
What is the building block token for the following molecule?
Nc1cccc(C(=O)Nc2ccc(Br)cn2)c1
<BB_9170>
What is the molecular formula for <BB_9170>?
The molecular formula for <BB_9170> (Nc1cccc(C(=O)Nc2ccc(Br)cn2)c1) is C12H10BrN3O.
Describe the ring structures in building block <BB_9170>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9170>.
The molecule contains the following groups: Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9170>.
**Token:** <BB_9170> **SMILES:** Nc1cccc(C(=O)Nc2ccc(Br)cn2)c1 **Molecular Formula:** C12H10BrN3O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9171>.
Cl.NCc1ccc(-c2ccco2)cc1
What is the building block token for the following molecule?
Cl.NCc1ccc(-c2ccco2)cc1
<BB_9171>
What is the molecular formula for <BB_9171>?
The molecular formula for <BB_9171> (Cl.NCc1ccc(-c2ccco2)cc1) is C11H12ClNO.
Describe the ring structures in building block <BB_9171>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9171>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9171>.
**Token:** <BB_9171> **SMILES:** Cl.NCc1ccc(-c2ccco2)cc1 **Molecular Formula:** C11H12ClNO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9172>.
CC(C)(C)OC(=O)N[C@H]1CCCC[C@H]1CO
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N[C@H]1CCCC[C@H]1CO
<BB_9172>
What is the molecular formula for <BB_9172>?
The molecular formula for <BB_9172> (CC(C)(C)OC(=O)N[C@H]1CCCC[C@H]1CO) is C12H23NO3.
Describe the ring structures in building block <BB_9172>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_9172>.
The molecule contains the following groups: Amide, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_9172>.
**Token:** <BB_9172> **SMILES:** CC(C)(C)OC(=O)N[C@H]1CCCC[C@H]1CO **Molecular Formula:** C12H23NO3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amide, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_9173>.
Cl.Fc1ccc(F)c(C2CCCNC2)c1
What is the building block token for the following molecule?
Cl.Fc1ccc(F)c(C2CCCNC2)c1
<BB_9173>
What is the molecular formula for <BB_9173>?
The molecular formula for <BB_9173> (Cl.Fc1ccc(F)c(C2CCCNC2)c1) is C11H14ClF2N.
Describe the ring structures in building block <BB_9173>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9173>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9173>.
**Token:** <BB_9173> **SMILES:** Cl.Fc1ccc(F)c(C2CCCNC2)c1 **Molecular Formula:** C11H14ClF2N **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9174>.
Cc1nonc1CS(=O)(=O)[O-].[Na+]
What is the building block token for the following molecule?
Cc1nonc1CS(=O)(=O)[O-].[Na+]
<BB_9174>
What is the molecular formula for <BB_9174>?
The molecular formula for <BB_9174> (Cc1nonc1CS(=O)(=O)[O-].[Na+]) is C4H5N2NaO4S.
Describe the ring structures in building block <BB_9174>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9174>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_9174>.
**Token:** <BB_9174> **SMILES:** Cc1nonc1CS(=O)(=O)[O-].[Na+] **Molecular Formula:** C4H5N2NaO4S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_9175>.
O=C(O)C(=O)Nc1cccc(C(F)(F)F)c1
What is the building block token for the following molecule?
O=C(O)C(=O)Nc1cccc(C(F)(F)F)c1
<BB_9175>
What is the molecular formula for <BB_9175>?
The molecular formula for <BB_9175> (O=C(O)C(=O)Nc1cccc(C(F)(F)F)c1) is C9H6F3NO3.
Describe the ring structures in building block <BB_9175>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9175>.
The molecule contains the following groups: Carboxylic Acid, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9175>.
**Token:** <BB_9175> **SMILES:** O=C(O)C(=O)Nc1cccc(C(F)(F)F)c1 **Molecular Formula:** C9H6F3NO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9176>.
Cl.NCc1cc(-c2cccs2)on1
What is the building block token for the following molecule?
Cl.NCc1cc(-c2cccs2)on1
<BB_9176>
What is the molecular formula for <BB_9176>?
The molecular formula for <BB_9176> (Cl.NCc1cc(-c2cccs2)on1) is C8H9ClN2OS.
Describe the ring structures in building block <BB_9176>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5.
List the primary functional groups present in <BB_9176>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9176>.
**Token:** <BB_9176> **SMILES:** Cl.NCc1cc(-c2cccs2)on1 **Molecular Formula:** C8H9ClN2OS **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9177>.
Cc1cc(N)ncc1S(N)(=O)=O
What is the building block token for the following molecule?
Cc1cc(N)ncc1S(N)(=O)=O
<BB_9177>
What is the molecular formula for <BB_9177>?
The molecular formula for <BB_9177> (Cc1cc(N)ncc1S(N)(=O)=O) is C6H9N3O2S.
Describe the ring structures in building block <BB_9177>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9177>.
The molecule contains the following groups: Amine, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_9177>.
**Token:** <BB_9177> **SMILES:** Cc1cc(N)ncc1S(N)(=O)=O **Molecular Formula:** C6H9N3O2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Sulfonamide
Provide the SMILES representation for the building block token <BB_9178>.
COC1(CNC(=O)OC(C)(C)C)CNC1
What is the building block token for the following molecule?
COC1(CNC(=O)OC(C)(C)C)CNC1
<BB_9178>
What is the molecular formula for <BB_9178>?
The molecular formula for <BB_9178> (COC1(CNC(=O)OC(C)(C)C)CNC1) is C10H20N2O3.
Describe the ring structures in building block <BB_9178>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_9178>.
The molecule contains the following groups: Secondary Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_9178>.
**Token:** <BB_9178> **SMILES:** COC1(CNC(=O)OC(C)(C)C)CNC1 **Molecular Formula:** C10H20N2O3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Secondary Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_9179>.
Cl.NC1CC2CC1CC2F
What is the building block token for the following molecule?
Cl.NC1CC2CC1CC2F
<BB_9179>
What is the molecular formula for <BB_9179>?
The molecular formula for <BB_9179> (Cl.NC1CC2CC1CC2F) is C7H13ClFN.
Describe the ring structures in building block <BB_9179>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9179>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9179>.
**Token:** <BB_9179> **SMILES:** Cl.NC1CC2CC1CC2F **Molecular Formula:** C7H13ClFN **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9180>.
O=C(O)Cn1nc(C(F)(F)F)c2c1CCOC2
What is the building block token for the following molecule?
O=C(O)Cn1nc(C(F)(F)F)c2c1CCOC2
<BB_9180>
What is the molecular formula for <BB_9180>?
The molecular formula for <BB_9180> (O=C(O)Cn1nc(C(F)(F)F)c2c1CCOC2) is C9H9F3N2O3.
Describe the ring structures in building block <BB_9180>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9180>.
The molecule contains the following groups: Carboxylic Acid, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9180>.
**Token:** <BB_9180> **SMILES:** O=C(O)Cn1nc(C(F)(F)F)c2c1CCOC2 **Molecular Formula:** C9H9F3N2O3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9181>.
FC(F)(F)C1(c2ccc(I)cc2)N=N1
What is the building block token for the following molecule?
FC(F)(F)C1(c2ccc(I)cc2)N=N1
<BB_9181>
What is the molecular formula for <BB_9181>?
The molecular formula for <BB_9181> (FC(F)(F)C1(c2ccc(I)cc2)N=N1) is C8H4F3IN2.
Describe the ring structures in building block <BB_9181>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_9181>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9181>.
**Token:** <BB_9181> **SMILES:** FC(F)(F)C1(c2ccc(I)cc2)N=N1 **Molecular Formula:** C8H4F3IN2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9182>.
CC(=O)c1ccc(N)cc1O
What is the building block token for the following molecule?
CC(=O)c1ccc(N)cc1O
<BB_9182>
What is the molecular formula for <BB_9182>?
The molecular formula for <BB_9182> (CC(=O)c1ccc(N)cc1O) is C8H9NO2.
Describe the ring structures in building block <BB_9182>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9182>.
The molecule contains the following groups: Amine, Ketone.
Provide a comprehensive chemical profile for the building block <BB_9182>.
**Token:** <BB_9182> **SMILES:** CC(=O)c1ccc(N)cc1O **Molecular Formula:** C8H9NO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ketone
Provide the SMILES representation for the building block token <BB_9183>.
Cl.FC12CCC(CN1)C2
What is the building block token for the following molecule?
Cl.FC12CCC(CN1)C2
<BB_9183>