instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_9183>?
The molecular formula for <BB_9183> (Cl.FC12CCC(CN1)C2) is C6H11ClFN.
Describe the ring structures in building block <BB_9183>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9183>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9183>.
**Token:** <BB_9183> **SMILES:** Cl.FC12CCC(CN1)C2 **Molecular Formula:** C6H11ClFN **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9184>.
N#CC1CC12CCC(=O)CC2
What is the building block token for the following molecule?
N#CC1CC12CCC(=O)CC2
<BB_9184>
What is the molecular formula for <BB_9184>?
The molecular formula for <BB_9184> (N#CC1CC12CCC(=O)CC2) is C9H11NO.
Describe the ring structures in building block <BB_9184>.
The molecule contains 2 ring(s): an aliphatic ring of size 3, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9184>.
The molecule contains the following groups: Ketone, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_9184>.
**Token:** <BB_9184> **SMILES:** N#CC1CC12CCC(=O)CC2 **Molecular Formula:** C9H11NO **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 3, an aliphatic ring of size 6. **Functional Groups:** Ketone, Nitrile
Provide the SMILES representation for the building block token <BB_9185>.
O=Cc1nccc2ccc(Br)cc12
What is the building block token for the following molecule?
O=Cc1nccc2ccc(Br)cc12
<BB_9185>
What is the molecular formula for <BB_9185>?
The molecular formula for <BB_9185> (O=Cc1nccc2ccc(Br)cc12) is C10H6BrNO.
Describe the ring structures in building block <BB_9185>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9185>.
The molecule contains the following groups: Aldehyde, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9185>.
**Token:** <BB_9185> **SMILES:** O=Cc1nccc2ccc(Br)cc12 **Molecular Formula:** C10H6BrNO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Aldehyde, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9186>.
COc1ccc(C(C)C)cc1O
What is the building block token for the following molecule?
COc1ccc(C(C)C)cc1O
<BB_9186>
What is the molecular formula for <BB_9186>?
The molecular formula for <BB_9186> (COc1ccc(C(C)C)cc1O) is C10H14O2.
Describe the ring structures in building block <BB_9186>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9186>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_9186>.
**Token:** <BB_9186> **SMILES:** COc1ccc(C(C)C)cc1O **Molecular Formula:** C10H14O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_9187>.
CC(O)c1ncc(C=O)s1
What is the building block token for the following molecule?
CC(O)c1ncc(C=O)s1
<BB_9187>
What is the molecular formula for <BB_9187>?
The molecular formula for <BB_9187> (CC(O)c1ncc(C=O)s1) is C6H7NO2S.
Describe the ring structures in building block <BB_9187>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9187>.
The molecule contains the following groups: Aldehyde, Alcohol.
Provide a comprehensive chemical profile for the building block <BB_9187>.
**Token:** <BB_9187> **SMILES:** CC(O)c1ncc(C=O)s1 **Molecular Formula:** C6H7NO2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Aldehyde, Alcohol
Provide the SMILES representation for the building block token <BB_9188>.
BrC12CC3(Br)CC(Br)(C1)CC(Br)(C2)C3
What is the building block token for the following molecule?
BrC12CC3(Br)CC(Br)(C1)CC(Br)(C2)C3
<BB_9188>
What is the molecular formula for <BB_9188>?
The molecular formula for <BB_9188> (BrC12CC3(Br)CC(Br)(C1)CC(Br)(C2)C3) is C10H12Br4.
Describe the ring structures in building block <BB_9188>.
The molecule contains 4 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9188>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9188>.
**Token:** <BB_9188> **SMILES:** BrC12CC3(Br)CC(Br)(C1)CC(Br)(C2)C3 **Molecular Formula:** C10H12Br4 **Ring System:** The molecule contains 4 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9189>.
c1nc(-c2nnn[nH]2)cs1
What is the building block token for the following molecule?
c1nc(-c2nnn[nH]2)cs1
<BB_9189>
What is the molecular formula for <BB_9189>?
The molecular formula for <BB_9189> (c1nc(-c2nnn[nH]2)cs1) is C4H3N5S.
Describe the ring structures in building block <BB_9189>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5.
List the primary functional groups present in <BB_9189>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_9189>.
**Token:** <BB_9189> **SMILES:** c1nc(-c2nnn[nH]2)cs1 **Molecular Formula:** C4H3N5S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_9190>.
O=C(O)[C@H]1C[C@H]1C(=O)c1ccccc1
What is the building block token for the following molecule?
O=C(O)[C@H]1C[C@H]1C(=O)c1ccccc1
<BB_9190>
What is the molecular formula for <BB_9190>?
The molecular formula for <BB_9190> (O=C(O)[C@H]1C[C@H]1C(=O)c1ccccc1) is C11H10O3.
Describe the ring structures in building block <BB_9190>.
The molecule contains 2 ring(s): an aliphatic ring of size 3, an aromatic ring of size 6.
List the primary functional groups present in <BB_9190>.
The molecule contains the following groups: Carboxylic Acid, Ketone.
Provide a comprehensive chemical profile for the building block <BB_9190>.
**Token:** <BB_9190> **SMILES:** O=C(O)[C@H]1C[C@H]1C(=O)c1ccccc1 **Molecular Formula:** C11H10O3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 3, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ketone
Provide the SMILES representation for the building block token <BB_9191>.
C=CCC(C)(C(=O)[O-])N(C)C.[K+]
What is the building block token for the following molecule?
C=CCC(C)(C(=O)[O-])N(C)C.[K+]
<BB_9191>
What is the molecular formula for <BB_9191>?
The molecular formula for <BB_9191> (C=CCC(C)(C(=O)[O-])N(C)C.[K+]) is C8H14KNO2.
Describe the ring structures in building block <BB_9191>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9191>.
The molecule contains the following groups: Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_9191>.
**Token:** <BB_9191> **SMILES:** C=CCC(C)(C(=O)[O-])N(C)C.[K+] **Molecular Formula:** C8H14KNO2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Tertiary Amine
Provide the SMILES representation for the building block token <BB_9192>.
Oc1ccc(F)nc1C(F)(F)F
What is the building block token for the following molecule?
Oc1ccc(F)nc1C(F)(F)F
<BB_9192>
What is the molecular formula for <BB_9192>?
The molecular formula for <BB_9192> (Oc1ccc(F)nc1C(F)(F)F) is C6H3F4NO.
Describe the ring structures in building block <BB_9192>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9192>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9192>.
**Token:** <BB_9192> **SMILES:** Oc1ccc(F)nc1C(F)(F)F **Molecular Formula:** C6H3F4NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9193>.
COc1cc2[nH]nnc2cc1C(=O)O
What is the building block token for the following molecule?
COc1cc2[nH]nnc2cc1C(=O)O
<BB_9193>
What is the molecular formula for <BB_9193>?
The molecular formula for <BB_9193> (COc1cc2[nH]nnc2cc1C(=O)O) is C8H7N3O3.
Describe the ring structures in building block <BB_9193>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9193>.
The molecule contains the following groups: Carboxylic Acid, Ether.
Provide a comprehensive chemical profile for the building block <BB_9193>.
**Token:** <BB_9193> **SMILES:** COc1cc2[nH]nnc2cc1C(=O)O **Molecular Formula:** C8H7N3O3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Ether
Provide the SMILES representation for the building block token <BB_9194>.
O=C(O)c1ccc(OC2CC2)c(F)n1
What is the building block token for the following molecule?
O=C(O)c1ccc(OC2CC2)c(F)n1
<BB_9194>
What is the molecular formula for <BB_9194>?
The molecular formula for <BB_9194> (O=C(O)c1ccc(OC2CC2)c(F)n1) is C9H8FNO3.
Describe the ring structures in building block <BB_9194>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_9194>.
The molecule contains the following groups: Carboxylic Acid, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9194>.
**Token:** <BB_9194> **SMILES:** O=C(O)c1ccc(OC2CC2)c(F)n1 **Molecular Formula:** C9H8FNO3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Carboxylic Acid, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9195>.
C=CC(=O)N[C@@H](C)C(=O)O
What is the building block token for the following molecule?
C=CC(=O)N[C@@H](C)C(=O)O
<BB_9195>
What is the molecular formula for <BB_9195>?
The molecular formula for <BB_9195> (C=CC(=O)N[C@@H](C)C(=O)O) is C6H9NO3.
Describe the ring structures in building block <BB_9195>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9195>.
The molecule contains the following groups: Carboxylic Acid, Amide.
Provide a comprehensive chemical profile for the building block <BB_9195>.
**Token:** <BB_9195> **SMILES:** C=CC(=O)N[C@@H](C)C(=O)O **Molecular Formula:** C6H9NO3 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid, Amide
Provide the SMILES representation for the building block token <BB_9196>.
CC1CCC(=O)Cc2ccccc21
What is the building block token for the following molecule?
CC1CCC(=O)Cc2ccccc21
<BB_9196>
What is the molecular formula for <BB_9196>?
The molecular formula for <BB_9196> (CC1CCC(=O)Cc2ccccc21) is C12H14O.
Describe the ring structures in building block <BB_9196>.
The molecule contains 2 ring(s): an aliphatic ring of size 7, an aromatic ring of size 6.
List the primary functional groups present in <BB_9196>.
The molecule contains the following groups: Ketone.
Provide a comprehensive chemical profile for the building block <BB_9196>.
**Token:** <BB_9196> **SMILES:** CC1CCC(=O)Cc2ccccc21 **Molecular Formula:** C12H14O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 7, an aromatic ring of size 6. **Functional Groups:** Ketone
Provide the SMILES representation for the building block token <BB_9197>.
COC(=O)CC[C@@H](N)C(C)C.Cl
What is the building block token for the following molecule?
COC(=O)CC[C@@H](N)C(C)C.Cl
<BB_9197>
What is the molecular formula for <BB_9197>?
The molecular formula for <BB_9197> (COC(=O)CC[C@@H](N)C(C)C.Cl) is C8H18ClNO2.
Describe the ring structures in building block <BB_9197>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9197>.
The molecule contains the following groups: Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9197>.
**Token:** <BB_9197> **SMILES:** COC(=O)CC[C@@H](N)C(C)C.Cl **Molecular Formula:** C8H18ClNO2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9198>.
OB(O)c1cccc2c1CCCC2
What is the building block token for the following molecule?
OB(O)c1cccc2c1CCCC2
<BB_9198>
What is the molecular formula for <BB_9198>?
The molecular formula for <BB_9198> (OB(O)c1cccc2c1CCCC2) is C10H13BO2.
Describe the ring structures in building block <BB_9198>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9198>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_9198>.
**Token:** <BB_9198> **SMILES:** OB(O)c1cccc2c1CCCC2 **Molecular Formula:** C10H13BO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_9199>.
COc1ccc(S(=O)(=O)Cl)cc1C(=O)O
What is the building block token for the following molecule?
COc1ccc(S(=O)(=O)Cl)cc1C(=O)O
<BB_9199>
What is the molecular formula for <BB_9199>?
The molecular formula for <BB_9199> (COc1ccc(S(=O)(=O)Cl)cc1C(=O)O) is C8H7ClO5S.
Describe the ring structures in building block <BB_9199>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9199>.
The molecule contains the following groups: Carboxylic Acid, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9199>.
**Token:** <BB_9199> **SMILES:** COc1ccc(S(=O)(=O)Cl)cc1C(=O)O **Molecular Formula:** C8H7ClO5S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ether, Halogen (F,Cl,Br,I)